diff --git a/lerna.json b/lerna.json index aa444d861c..a5851dcc31 100644 --- a/lerna.json +++ b/lerna.json @@ -1,5 +1,5 @@ { - "version": "0.0.16", + "version": "0.0.24", "npmClient": "yarn", "packages": [ "packages/*" diff --git a/packages/bootstrap-components/package.json b/packages/bootstrap-components/package.json index e13101c1b2..b93b2e88a5 100644 --- a/packages/bootstrap-components/package.json +++ b/packages/bootstrap-components/package.json @@ -12,7 +12,7 @@ "publishdev": "yarn build && node ./scripts/publishDev.js" }, "devDependencies": { - "@budibase/client": "^0.0.16", + "@budibase/client": "^0.0.24", "fs-extra": "^8.1.0", "lodash": "^4.17.15", "npm-run-all": "^4.1.5", @@ -30,7 +30,7 @@ "keywords": [ "svelte" ], - "version": "0.0.16", + "version": "0.0.24", "license": "MIT", "gitHead": "115189f72a850bfb52b65ec61d932531bf327072" } diff --git a/packages/builder/package.json b/packages/builder/package.json index 904a609ca6..a09ac67db8 100644 --- a/packages/builder/package.json +++ b/packages/builder/package.json @@ -1,7 +1,8 @@ { "name": "@budibase/builder", - "version": "0.0.16", + "version": "0.0.24", "license": "AGPL-3.0", + "private": true, "scripts": { "build": "rollup -c", "start": "rollup -c -w", @@ -34,7 +35,7 @@ ] }, "dependencies": { - "@budibase/client": "^0.0.16", + "@budibase/client": "^0.0.24", "@nx-js/compiler-util": "^2.0.0", "codemirror": "^5.51.0", "date-fns": "^1.29.0", diff --git a/packages/builder/rollup.config.js b/packages/builder/rollup.config.js index 10e6e866ea..183dba265c 100644 --- a/packages/builder/rollup.config.js +++ b/packages/builder/rollup.config.js @@ -16,17 +16,20 @@ const _builderProxy = proxy("/_builder", { pathRewrite: { "^/_builder": "" }, }) -const apiProxy = proxy(["/_builder/api/**", "/_builder/**/componentlibrary"], { - target, - logLevel: "debug", - changeOrigin: true, - cookieDomainRewrite: true, - onProxyReq(proxyReq) { - if (proxyReq.getHeader("origin")) { - proxyReq.setHeader("origin", target) - } - }, -}) +const apiProxy = proxy( + ["/_builder/assets/**", "/_builder/api/**", "/_builder/**/componentlibrary"], + { + target, + logLevel: "debug", + changeOrigin: true, + cookieDomainRewrite: true, + onProxyReq(proxyReq) { + if (proxyReq.getHeader("origin")) { + proxyReq.setHeader("origin", target) + } + }, + } +) const production = !process.env.ROLLUP_WATCH diff --git a/packages/builder/src/PackageRoot.svelte b/packages/builder/src/PackageRoot.svelte index 6652c74a1f..ce87fe65e9 100644 --- a/packages/builder/src/PackageRoot.svelte +++ b/packages/builder/src/PackageRoot.svelte @@ -10,7 +10,7 @@
{#if componentLibrary} {#each generate_components_list(componentLibrary.components) as component} @@ -221,9 +224,10 @@ } .library-container { - padding: 0 0 10px 10px; + padding: 0 0 10px 0; flex: 1 1 auto; min-height: 0px; + margin-top: 20px; } .component-container { @@ -237,7 +241,7 @@ cursor: pointer; border: 1px solid #ebebeb; border-radius: 2px; - margin: 10px 0; + margin: 5px 0; height: 40px; box-sizing: border-box; color: #163057; @@ -300,7 +304,7 @@ border-radius: 5px; } - li button { + /* li button { width: 100%; height: 100%; background: none; @@ -309,12 +313,12 @@ padding: 12px; outline: none; cursor: pointer; - } + } */ - .selected { + /* .selected { color: var(--button-text); background: var(--background-button) !important; - } + } */ .open { color: rgba(0, 85, 255, 1); diff --git a/packages/builder/src/userInterface/ComponentsPaneSwitcher.svelte b/packages/builder/src/userInterface/ComponentsPaneSwitcher.svelte index 5d094ad94e..d7abe25b6d 100644 --- a/packages/builder/src/userInterface/ComponentsPaneSwitcher.svelte +++ b/packages/builder/src/userInterface/ComponentsPaneSwitcher.svelte @@ -21,18 +21,18 @@ {#if $store.currentFrontEndType === 'page' || $store.screens.length}
- - + +
@@ -45,8 +45,6 @@ {/if}
- {:else} -

Please create a new screen

{/if}
@@ -56,13 +54,14 @@ height: 100%; display: flex; flex-direction: column; - padding: 2rem 1.5rem 2rem 1.5rem; + padding: 2rem 0; } .switcher { display: flex; justify-content: space-between; margin-bottom: 25px; + padding: 0 1.5rem; } .switcher > button { @@ -86,5 +85,6 @@ flex: 1 1 auto; height: 0px; overflow-y: auto; + padding: 0 1.5rem 1.5rem 1.5rem; } diff --git a/packages/builder/src/userInterface/NewScreen.svelte b/packages/builder/src/userInterface/NewScreen.svelte index 3fb7fb0fbb..ce460c6c61 100644 --- a/packages/builder/src/userInterface/NewScreen.svelte +++ b/packages/builder/src/userInterface/NewScreen.svelte @@ -3,6 +3,7 @@ import PropsView from "./PropsView.svelte" import Textbox from "../common/Textbox.svelte" import Button from "../common/Button.svelte" + import ActionButton from "../common/ActionButton.svelte" import ButtonGroup from "../common/ButtonGroup.svelte" import { pipe } from "../common/core" import UIkit from "uikit" @@ -122,8 +123,8 @@ - - + Create Screen + Cancel diff --git a/packages/builder/src/userInterface/UserInterfaceRoot.svelte b/packages/builder/src/userInterface/UserInterfaceRoot.svelte index 1f85dac89e..bfe8ee4a99 100644 --- a/packages/builder/src/userInterface/UserInterfaceRoot.svelte +++ b/packages/builder/src/userInterface/UserInterfaceRoot.svelte @@ -119,9 +119,11 @@ .ui-nav { grid-column: 1; background-color: var(--secondary5); - height: 100%; - padding: 0 1.5rem 0rem 0; - overflow-y: auto; + height: calc(100vh - 49px); + padding: 0; + overflow: hidden; + display: flex; + flex-direction: column; } .preview-pane { @@ -209,4 +211,9 @@ margin-top: 1.5rem; width: calc(100% + 1.5rem); } + + .components-list-container { + overflow: auto; + padding: 0 30px 0 0; + } diff --git a/packages/cli/.npmignore b/packages/cli/.npmignore new file mode 100644 index 0000000000..6e870a6399 --- /dev/null +++ b/packages/cli/.npmignore @@ -0,0 +1,3 @@ +* +!bin/* +!src/**/* diff --git a/packages/cli/package.json b/packages/cli/package.json index 5cc2fdfca0..0b8ee3b4dc 100644 --- a/packages/cli/package.json +++ b/packages/cli/package.json @@ -1,6 +1,6 @@ { "name": "budibase", - "version": "0.0.16", + "version": "0.0.24", "description": "Budibase CLI", "repository": "https://github.com/Budibase/Budibase", "homepage": "https://budibase.com", @@ -20,8 +20,8 @@ "author": "Budibase", "license": "AGPL-3.0-or-later", "dependencies": { - "@budibase/datastores": "^0.0.16", - "@budibase/server": "^0.0.16", + "@budibase/datastores": "^0.0.24", + "@budibase/server": "^0.0.24", "@inquirer/password": "^0.0.6-alpha.0", "chalk": "^2.4.2", "fs-extra": "^8.1.0", diff --git a/packages/cli/src/commands/init/index.js b/packages/cli/src/commands/init/index.js index 0de3e58928..e3b35d6530 100644 --- a/packages/cli/src/commands/init/index.js +++ b/packages/cli/src/commands/init/index.js @@ -15,7 +15,7 @@ module.exports = { type: "string", describe: "config template file to use - optional, defaults to config.js", alias: "c", - default: "config.dev.js", + default: "dev", choices: ["dev", "contributors"], }) yargs.positional("username", { @@ -26,7 +26,7 @@ module.exports = { }) yargs.positional("password", { type: "string", - describe: "passord for admin interface", + describe: "password for admin interface", alias: "p", default: "", }) diff --git a/packages/cli/src/commands/new/appPackageTemplate/package.json b/packages/cli/src/commands/new/appPackageTemplate/package.json index 53db27f272..9828683df7 100644 --- a/packages/cli/src/commands/new/appPackageTemplate/package.json +++ b/packages/cli/src/commands/new/appPackageTemplate/package.json @@ -8,7 +8,7 @@ "author": "", "license": "ISC", "dependencies": { - "@budibase/standard-components": "^0.0.3", - "@budibase/materialdesign-components": "^0.0.16" + "@budibase/standard-components": "0.x", + "@budibase/materialdesign-components": "0.x" } } diff --git a/packages/client/.npmignore b/packages/client/.npmignore new file mode 100644 index 0000000000..9fdaeccbc3 --- /dev/null +++ b/packages/client/.npmignore @@ -0,0 +1,2 @@ +* +!dist/* diff --git a/packages/client/package.json b/packages/client/package.json index 04c180beb5..b950267325 100644 --- a/packages/client/package.json +++ b/packages/client/package.json @@ -1,6 +1,6 @@ { "name": "@budibase/client", - "version": "0.0.16", + "version": "0.0.24", "license": "MPL-2.0", "main": "dist/budibase-client.js", "module": "dist/budibase-client.esm.mjs", diff --git a/packages/client/src/render/attachChildren.js b/packages/client/src/render/attachChildren.js index 803bc30895..3e244b495e 100644 --- a/packages/client/src/render/attachChildren.js +++ b/packages/client/src/render/attachChildren.js @@ -24,6 +24,8 @@ export const attachChildren = initialiseOpts => (htmlElement, options) => { childNode.destroy() } + if (!htmlElement) return + if (hydrate) { while (htmlElement.firstChild) { htmlElement.removeChild(htmlElement.firstChild) diff --git a/packages/client/src/state/bbComponentApi.js b/packages/client/src/state/bbComponentApi.js index d130a4b7ae..75b00bd5dc 100644 --- a/packages/client/src/state/bbComponentApi.js +++ b/packages/client/src/state/bbComponentApi.js @@ -13,10 +13,14 @@ export const bbFactory = ({ uiFunctions, onScreenSlotRendered, }) => { - const relativeUrl = url => - frontendDefinition.appRootPath - ? frontendDefinition.appRootPath + "/" + trimSlash(url) - : url + const relativeUrl = url => { + if (!frontendDefinition.appRootPath) return url + if (url.startsWith("http:") + || url.startsWith("https:") + || url.startsWith("./")) return url + + return frontendDefinition.appRootPath + "/" + trimSlash(url) + } const apiCall = method => (url, body) => fetch(relativeUrl(url), { diff --git a/packages/core/.npmignore b/packages/core/.npmignore new file mode 100644 index 0000000000..9fdaeccbc3 --- /dev/null +++ b/packages/core/.npmignore @@ -0,0 +1,2 @@ +* +!dist/* diff --git a/packages/core/package.json b/packages/core/package.json index 90209df3b2..e83f57c7ff 100644 --- a/packages/core/package.json +++ b/packages/core/package.json @@ -1,6 +1,6 @@ { "name": "@budibase/core", - "version": "0.0.16", + "version": "0.0.24", "description": "core javascript library for budibase", "main": "dist/budibase-core.umd.js", "module": "dist/budibase-core.esm.js", diff --git a/packages/core/q b/packages/core/q deleted file mode 100644 index cdf63d511e..0000000000 --- a/packages/core/q +++ /dev/null @@ -1,1131 +0,0 @@ -commit d5a047a435cd1c1a987f02a0a6e02e4682d6fb93 (HEAD -> master) -Author: danbudi -Date: Mon May 6 23:26:38 2019 +0100 - - retry logic tests - -commit 1211d73c8e9245c644c5ecbb860d9aeccd58dfd4 -Merge: af625aa 6fa8502 -Author: danbudi -Date: Sun May 5 23:22:11 2019 +0100 - - merge upstream - -commit af625aa0d0955c7ff39975f76ae93b022ba919ed -Author: danbudi -Date: Sat May 4 12:02:21 2019 +0100 - - retry logic in common/index.js - -commit 6fa85022a7aeff9b501b6f7ce4d0d95bd16dbedf -Author: danbudi <50263791+danbudi@users.noreply.github.com> -Date: Sat May 4 12:00:37 2019 +0100 - - Update AUTHORS.md - -commit 4b3dbf25affa8fd08b8ad3f363b3eceb22c14390 (origin/master, origin/HEAD) -Author: Mike Shanks <49766997+mikebudi@users.noreply.github.com> -Date: Wed Apr 24 20:04:24 2019 +0100 - - typo in readme - -commit ece328a481ef4cd0c1d6950b87d7b5d54bc276fa -Author: michael shanks -Date: Wed Apr 24 16:39:03 2019 +0100 - - added contributing guidelines - -commit 09e35e2971fb7d3601813eeb5a001d4ad528a4da -Author: michael shanks -Date: Mon Apr 22 22:53:06 2019 +0100 - - updated readme - -commit ade153d2e9058e146fe670c0f004b909105c9d30 -Merge: e2e6646 4ce30fa -Author: Michael Shanks -Date: Sun Apr 14 08:01:13 2019 +0100 - - Merge branch 'master' of gitlab.com:budibase-source/budibase-core into removing_collections - -commit e2e6646670c213fff7b74f66ac09a0937245719f -Author: Michael Shanks -Date: Sun Apr 14 08:00:57 2019 +0100 - - no collections - all passing - -commit da9d907e535111a50056664f143d0ba136ec2264 -Author: Michael Shanks -Date: Fri Apr 12 18:28:40 2019 +0100 - - removing collections .. close - -commit 4ce30fabc30e376084e9020cd1e86a6216b53867 -Author: Michael Shanks -Date: Fri Apr 12 12:52:51 2019 +0000 - - Update readme.md - -commit 74c4580ea1f42730ff34cf1b2b4cd9d0f6ac012d -Author: = -Date: Fri Apr 12 09:15:28 2019 +0100 - - exporting all hierarchy methods - -commit 5b13e86e30d482b250c15e7d0444be5686a6f351 -Author: = -Date: Fri Apr 12 09:08:45 2019 +0100 - - exporting hierarchy ethods - -commit 7bbf6ef76d41cbca43e0987c011c860cf869e027 -Merge: d9d8d1f 215947c -Author: = -Date: Wed Apr 10 22:37:41 2019 +0100 - - Merge branch 'master' of gitlab.com:budibase-source/budibase-core - -commit d9d8d1f58f7d64dce572d609dd69e75de0834253 -Author: = -Date: Wed Apr 10 22:36:18 2019 +0100 - - exposed constructHierarchy - -commit 215947cb454fc01042c83ffe05d266d18fde99ab -Author: Michael Shanks -Date: Mon Apr 8 21:24:06 2019 +0000 - - Update package.json - MPL license - -commit f2fca48b270537f44db3654a6167f9475fef09b6 -Author: Michael Shanks -Date: Mon Apr 8 21:04:13 2019 +0000 - - Update readme.md - some basic getting started - -commit 0668df1f949f1773c57d23e4e0d9afc2a0cbcbdb -Author: Michael Shanks -Date: Fri Apr 5 16:31:02 2019 +0100 - - backup... - -commit 47e2346a1e6ece50bb91295d1c0358733648be81 -Author: Michael Shanks -Date: Wed Mar 27 22:21:11 2019 +0000 - - typo.. - -commit 5de74d1c242fb0e84a37805ff0fead28eb61a9f9 -Author: Michael Shanks -Date: Wed Mar 27 22:20:07 2019 +0000 - - getAppApis - accepts app definition as arg - -commit 1a390d51c35ef3c413969690a7813673214d8123 -Author: Michael Shanks -Date: Mon Mar 25 21:26:55 2019 +0000 - - BIG refactor - all indexes on records, and root, not collection - -commit b7deaef9482340daf6b0ccc71d387a72cc09c4b8 -Author: Michael Shanks -Date: Sat Mar 23 23:56:32 2019 +0000 - - upload/download files complete - -commit 548f2a2713eff415d6102b6de1bacef7f1510680 -Author: Michael Shanks -Date: Sat Mar 23 19:08:54 2019 +0000 - - fixed failing tests after added file field - -commit 90214c8931ba1648cd8c7493d816f9b4f080af0d -Author: Michael Shanks -Date: Fri Mar 22 22:05:54 2019 +0000 - - fixed some failing tests - -commit d60ddc65f47593c382e1d0b14d530fdf4bf353f1 -Author: Michael Shanks -Date: Fri Mar 22 21:49:04 2019 +0000 - - untested upload/download file - -commit 5160bca054ea9af4222e1d4fd91f9ff2152f7995 -Author: Michael Shanks -Date: Thu Mar 21 13:31:43 2019 +0000 - - database manager & more exports - -commit 9f85a24352dc1f506b4c500c8fba2dbc256823e3 -Author: Michael Shanks -Date: Thu Mar 21 10:03:31 2019 +0000 - - databaseFactory > databaseManager - -commit 3e2a62f6c0a46b4859f61f94279bebec6906c458 -Author: Michael Shanks -Date: Thu Mar 21 09:25:15 2019 +0000 - - renaming typo... - -commit 6cf600cdd1ce61a9cd07a4e1511d2152ff9f93df -Author: Michael Shanks -Date: Thu Mar 21 09:22:31 2019 +0000 - - bla - -commit ed18edfa21b06097a8328a2d57e4191067b384fd -Author: Michael Shanks -Date: Tue Mar 19 21:24:44 2019 +0000 - - removing createemptydb for normal circumstances - -commit c180da2b1c707179d5ddc9cad34c4c7599636fb3 -Author: Michael Shanks -Date: Tue Mar 19 21:21:00 2019 +0000 - - validation on create database - -commit cc1f0db735a0c789f0774946ebf809ed4e1302da -Author: Michael Shanks -Date: Tue Mar 19 21:06:58 2019 +0000 - - database creator - -commit e43750345a65c41b0bea9171f8fbd79e2b0e184e -Author: Michael Shanks -Date: Tue Mar 19 20:48:17 2019 +0000 - - removing storeHandle from apis - -commit 7a58d2d1e86b935a30ae62aed42b7a0cd3de9873 -Author: Michael Shanks -Date: Sun Mar 17 22:35:02 2019 +0000 - - setUserAccessLevels - -commit a99e3fab43f5c887c1f0e34e2962ca352740d1d1 -Author: Michael Shanks -Date: Sun Mar 17 20:26:43 2019 +0000 - - added initialiseData to index.js - -commit 2eb827025db50c2cf2a174a2774b92a7ac3ec1d8 -Author: Michael Shanks -Date: Sun Mar 17 19:40:59 2019 +0000 - - initialise data tests passing - -commit ac0c29fc28c79445a9ab9c9e66cc81d5826ed85d -Author: Michael Shanks -Date: Wed Mar 13 22:40:48 2019 +0000 - - initialise app method - -commit 5b8ccc80e6d96b6f8bdc3533b3742ffb070de1af -Author: Michael Shanks -Date: Mon Mar 11 22:46:51 2019 +0000 - - actionsApi Auth - tested - -commit 2208f62b51eec9594dfe454c4248830824e20222 -Author: Michael Shanks -Date: Sun Mar 10 22:42:19 2019 +0000 - - renamed actions test file - -commit 870834516e6279524146227f5347f0d3892359fe -Author: Michael Shanks -Date: Sun Mar 10 22:41:17 2019 +0000 - - refactor to allow actions to be called as api - -commit ba00ef003273e1e569a8de30199a4f6986bbb0a6 -Author: Michael Shanks -Date: Sat Mar 9 22:18:52 2019 +0000 - - authApi isAuthorized testing - -commit f00a2a6ff15ca4f1520ad7b6741794581f22c7cd -Author: Michael Shanks -Date: Fri Mar 8 22:48:17 2019 +0000 - - auth tests on app hierarchy - -commit 63affd0056eddf775a157eefa414d6c378fc371e -Author: Michael Shanks -Date: Thu Mar 7 22:26:51 2019 +0000 - - more auth testing - -commit 83e382d36239fd7235e5021d679c871f9881fe70 -Author: Michael Shanks -Date: Thu Mar 7 21:38:17 2019 +0000 - - more auth testing - -commit a64c3fd97127da3438d70d0dc9ce518b553840f9 -Author: Michael Shanks -Date: Wed Mar 6 22:30:22 2019 +0000 - - fixed broken tests - -commit 36091652b05b8eb95f88c71defa4f80e517037ce -Author: Michael Shanks -Date: Wed Mar 6 21:50:01 2019 +0000 - - testing recordApi auth - -commit bec0f94a62ed62320a019c3a581bac934d4fe0c1 -Author: Michael Shanks -Date: Tue Mar 5 22:21:20 2019 +0000 - - isAuthorized integrated into api functions - -commit 7f5c830f4a90ecbe95bacf16fb74c0397a0cb02b -Author: Michael Shanks -Date: Mon Mar 4 19:42:25 2019 +0000 - - split apiWrapper for async and sync - -commit faf42685b79ac0ba07fff3375e61bfa7ab918f6d -Author: Michael Shanks -Date: Fri Mar 1 22:44:42 2019 +0000 - - plugin points for authApi ... failing.. - -commit 9735eea4a1acfc272fd3103fe70d54fcf5a2199b -Author: Michael Shanks -Date: Thu Feb 28 22:49:44 2019 +0000 - - enable disable user - -commit 4da747abece4f5d64b55a7ff72da8820b20be2b6 -Author: Michael Shanks -Date: Wed Feb 27 22:10:47 2019 +0000 - - setting & resetting passwords - -commit 2b75d12fb9ea3c8d0d31149c9b5799ae56b0fc6d -Author: Michael Shanks -Date: Mon Feb 25 23:34:14 2019 +0000 - - typo.. - -commit b5f8e6c2f72a5ca0b5c9c2b1ff8721cd4df6c2dc -Author: Michael Shanks -Date: Mon Feb 25 23:30:31 2019 +0000 - - authentication - temporar access - -commit 52eebdf96ddb033ca87b7b925341395a4e16c1d0 -Author: Michael Shanks -Date: Mon Feb 25 22:43:10 2019 +0000 - - authentication testing.. - -commit f7521cd0782e3990c5bbefeca0a27a16eeb173ba -Author: Michael Shanks -Date: Sun Feb 24 22:37:59 2019 +0000 - - started authenticate - -commit 636cfd45144e410c84242670797ce93c014fb38b -Author: Michael Shanks -Date: Sat Feb 23 22:28:45 2019 +0000 - - create user testing - -commit a61ae11994349ff2837f62578234ca5483732919 -Author: Michael Shanks -Date: Sat Feb 23 20:41:29 2019 +0000 - - validateUses tests - -commit 31361c918298b1642165ee0cba211c055ea73073 -Author: Michael Shanks -Date: Sat Feb 23 10:24:59 2019 +0000 - - createUser testing - -commit 1ec8e0df2a8da2e8e4d8ec5fe121552e8d1f329a -Author: Michael Shanks -Date: Fri Feb 22 21:23:05 2019 +0000 - - save access levels... test complete - -commit aadf821a77a34428ade4c46b36fcf82084b6cbac -Author: Michael Shanks -Date: Fri Feb 22 12:30:09 2019 +0000 - - few pssing on validation of access levels - -commit b5246be7fce6858bf24a475783ddb01ba7c4dc89 -Author: Michael Shanks -Date: Fri Feb 22 11:21:37 2019 +0000 - - access level validateion - -commit 22bc3fc4a208aa8a452af5b92542fb4d11e46632 -Author: Michael Shanks -Date: Thu Feb 21 23:43:22 2019 +0000 - - access levels - moved validationCommon - -commit ab5a24ba0c09a1784c18144f85532452124ea818 -Author: Michael Shanks -Date: Wed Feb 20 22:54:11 2019 +0000 - - access levels... - -commit 4795f33926da83e7de209d44f42688bb84b7f4c2 -Author: Michael Shanks -Date: Tue Feb 19 22:49:18 2019 +0000 - - starting access levels - -commit 1f818669eab153e856477ff838269e80db4d662e -Author: Michael Shanks -Date: Tue Feb 19 22:05:00 2019 +0000 - - authApi - wrapper - -commit 3861a4785f9acd5565904d1553d71c2f0163d49a -Author: Michael Shanks -Date: Tue Feb 19 21:17:02 2019 +0000 - - fixing broken test - -commit ce96870c2ca71af99920075b75aaf95316c81e10 -Author: Michael Shanks -Date: Mon Feb 18 22:48:31 2019 +0000 - - username case insensitive - -commit 78c921be09cd816e0e8be4df8e3ea057f65c71f9 -Author: Michael Shanks -Date: Mon Feb 18 22:43:03 2019 +0000 - - make sure returned users contain no hashes - -commit 8245baff9dd8ae994298a68b5322c515593b2898 -Author: Michael Shanks -Date: Mon Feb 18 22:36:40 2019 +0000 - - more auth - -commit bfd0085396158a083d095ac76f4722033d94abb7 -Author: Michael Shanks -Date: Mon Feb 18 22:08:29 2019 +0000 - - work on auth - -commit 9fdecbdea7145a5f2e9a0406b19be099e2176044 -Author: Michael Shanks -Date: Sun Feb 17 22:49:33 2019 +0000 - - user access file structure - -commit d73f01a48eb912241693a8cd2be48bb5918920e0 -Author: Michael Shanks -Date: Thu Feb 14 20:16:05 2019 +0000 - - removed collectionApi.listRecords - -commit 8603817456d52e75011d8c0abd0ad7830b744565 -Author: Michael Shanks -Date: Thu Feb 14 20:10:29 2019 +0000 - - concurrency tests - -commit 002b9a89a03bc8c065bd0bafefe0d9d9c73fb34d -Author: Michael Shanks -Date: Wed Feb 13 22:35:30 2019 +0000 - - added a load of concurrency tests - -commit 69a086a8aa0bcf61af020705406e78e77e9f66d1 -Author: Michael Shanks -Date: Tue Feb 12 22:01:13 2019 +0000 - - all tests passing ! - -commit 95c36598463014f14bc503eaf482eff648ad3d9b -Author: Michael Shanks -Date: Mon Feb 11 23:31:23 2019 +0000 - - tidy up - -commit c9d1c7454fc343414bd8e8b9bc28e2afa39891e4 -Author: Michael Shanks -Date: Mon Feb 11 23:30:13 2019 +0000 - - reverse to go only - -commit c1707f232f414254fb19ffe6e4c5d509e2977a52 -Author: Michael Shanks -Date: Mon Feb 11 22:40:21 2019 +0000 - - getting better.. - -commit 6815f18351ce4d97d6e6b7e70997194567f26029 -Author: Michael Shanks -Date: Mon Feb 11 21:38:53 2019 +0000 - - commiting before i break it all - -commit 52425588910bdd802ffb98ddbd2b7f570b81a6c0 -Author: Michael Shanks -Date: Sun Feb 10 22:45:52 2019 +0000 - - buildindex tests... - -commit c1df98f5d164c2b719a1e62788321dcbedaa28fc -Author: Michael Shanks -Date: Sun Feb 10 00:01:23 2019 +0000 - - buildindex some tests starting to pass - -commit 8506d019e5e27160924e6e4505ae0c78e658b05f -Author: Michael Shanks -Date: Fri Feb 8 22:13:36 2019 +0000 - - build index - tests failing - -commit ff33499debdd8ccc271e35251b88e7bd4b59ec5d -Author: Michael Shanks -Date: Wed Feb 6 20:57:50 2019 +0000 - - just buildIndex to go... - -commit bb1c54a168c52d4ff49515d85fecf80d4885cf67 -Author: Michael Shanks -Date: Tue Feb 5 22:46:35 2019 +0000 - - working down the errors - -commit 613c93d4a60e101c1801ed1ddc54094c0a4650cd -Author: Michael Shanks -Date: Mon Feb 4 23:05:42 2019 +0000 - - working thru errors... - -commit eb6971c4f9d04c9e0c6d696520960fdcc97418b8 -Author: Michael Shanks -Date: Sun Feb 3 22:25:57 2019 +0000 - - working through errors - -commit b6bb57f501a10f7d60bb35fcfa4653278ddab808 -Author: Michael Shanks -Date: Sun Feb 3 00:13:45 2019 +0000 - - everything broken , fear not - -commit c50fd93a1fb9b7d14bb53634208fbd31b4be5815 -Author: Michael Shanks -Date: Sat Feb 2 23:17:28 2019 +0000 - - massive changes, everything rekt - -commit e036e0a2867eb50868ecf687c09fcc8cb373372e -Author: Michael Shanks -Date: Sat Feb 2 22:12:14 2019 +0000 - - bacuk before it all goes wrong - -commit 226025550b7ffbaf15bda07f35be355b5bd19239 -Author: Michael Shanks -Date: Thu Jan 31 21:50:34 2019 +0000 - - dodgy backup - -commit 90b4aec2e24c9953d3beb19d4420c00f685ea952 -Author: Michael Shanks -Date: Wed Jan 30 22:41:14 2019 +0000 - - starting transactions - -commit 40819bee5c720e70a7a010b27d41ac6b5fbc555c -Author: Michael Shanks -Date: Tue Jan 29 19:53:02 2019 +0000 - - load, loads references - -commit b626cf058fdec3f5d8a90cb404b29654f3617711 -Author: Michael Shanks -Date: Mon Jan 21 22:27:49 2019 +0000 - - some packaging stuff - -commit 24e02b18207aff073345f86db4cc7c522606a938 -Author: Michael Shanks -Date: Mon Jan 21 22:21:37 2019 +0000 - - package updates - -commit d83b66eb8aba3225707e658c94b1e2256cef2fc5 -Author: Michael Shanks -Date: Mon Jan 21 22:19:02 2019 +0000 - - referential integrity - -commit 24f884b378f3950bd01b1abe6eb9b788159258f8 -Author: Michael Shanks -Date: Mon Jan 21 19:42:12 2019 +0000 - - finish refactoring reverseIndexNodeKey on field, to be array - -commit 2f16c86ba7db5675001875cd3fdadcfd776dfa97 -Author: Michael Shanks -Date: Sun Jan 20 22:23:38 2019 +0000 - - started making reverseIndexNode key to array - -commit 20b076dc636a5cc8c8e555f4945165a29b39b04c -Author: Michael Shanks -Date: Sun Jan 20 22:04:41 2019 +0000 - - added some safety around deleting indexes - -commit ffccb15b849a8186f7d5bd2f0faa40e0b81efe9d -Author: Michael Shanks -Date: Sun Jan 20 01:37:06 2019 +0000 - - typeContraint - fixing tests - -commit 83206f6404b794e16b41c3c631f5b3fd3dcb508d -Author: Michael Shanks -Date: Sun Jan 20 01:14:36 2019 +0000 - - tests for typeOptions validations - -commit 77ce948d54290aa5e95ed88546f69e742eabcdb7 -Author: Michael Shanks -Date: Sun Jan 20 00:22:58 2019 +0000 - - big refactor of type contraints - -commit c1445cef4c6456ebaf1f514791e08856ceef5789 -Author: Michael Shanks -Date: Sat Jan 19 20:29:36 2019 +0000 - - investigation: + skipped test : failing test on nested references - -commit 1bba64b7b9f083700f8be75d3e9c012caed69be0 -Author: Michael Shanks -Date: Fri Jan 18 21:57:23 2019 +0000 - - refactoring to allow references do validate that value belongs to index - -commit d7c4614ed84cc39a4a88b361669eba232b25dc54 -Author: Michael Shanks -Date: Wed Jan 16 21:35:49 2019 +0000 - - failing test for updated reference - -commit 85a4b41847b7cb1a5f526d5ee8bb7397a4f9c07b -Author: Michael Shanks -Date: Wed Jan 16 20:52:13 2019 +0000 - - tests for search - -commit 513551b8b0142a14142bab0cb23770488ab876fd -Author: Michael Shanks -Date: Tue Jan 15 22:46:13 2019 +0000 - - implemented search - no tests - -commit 241105f71e1e17761de8ccd6e58fefd351bdf267 -Author: Michael Shanks -Date: Tue Jan 15 22:28:56 2019 +0000 - - refactoring to allow search phrase in list items - -commit 2208be1a64c7299cedfb59e125bda0a64c4a5b1d -Author: Michael Shanks -Date: Mon Jan 14 22:12:46 2019 +0000 - - aggregates - -done - -commit f5d4d4cfe1a66c9b9d490e22958faa07c59f0143 -Author: Michael Shanks -Date: Sun Jan 13 22:00:15 2019 +0000 - - aggregates... - -commit 1236f264bd7442f26268a0ee7af5968e4a0040e9 -Author: Michael Shanks -Date: Fri Jan 11 21:49:58 2019 +0000 - - all tests passing tf - -commit 929fff39c79efbebd9bbc5a65b4872e5f662d04c -Author: Michael Shanks -Date: Wed Jan 9 22:22:32 2019 +0000 - - more tests passing yay - -commit 0e1f32d8b0b062ae454f8ce93246a09ced164ca3 -Author: Michael Shanks -Date: Sun Jan 6 00:06:18 2019 +0000 - - working through errors.... - -commit a1b2b3430a2e130832d9a4ee1a44a1a0d1c768e9 -Author: Michael Shanks -Date: Sat Jan 5 22:34:54 2019 +0000 - - schema generator works - -commit f17dd45a7377780b03abf2ff289813e2610023ef -Author: Michael Shanks -Date: Fri Jan 4 23:00:41 2019 +0000 - - starting testing of index schema generator - -commit 44aecb8c5caf966a2c38149f6fdec90f5aaa491f -Author: Michael Shanks -Date: Fri Jan 4 21:44:51 2019 +0000 - - half way through index streaming - -commit 4503b890cea6d88a5790b5bd23577c58e945cf21 -Author: Michael Shanks -Date: Mon Dec 31 08:52:27 2018 +0000 - - index only relevant if allowedRecordNodeId contains records nodeid - -commit 3d53721cc7dbd6d07f126cbbb920b4cc466d4e95 -Author: Michael Shanks -Date: Sat Dec 29 00:22:36 2018 +0000 - - added recordNodeId as global id, instead of collectionChildId - -commit 3a85968dce9b71ca68adfeaf93b925bc7715b033 -Author: Michael Shanks -Date: Fri Dec 28 22:17:14 2018 +0000 - - all tests passing - -commit 284ebf1ed7f396691ba9268a74a5f62868a790e2 -Author: Michael Shanks -Date: Fri Dec 28 22:11:13 2018 +0000 - - aggregates - abandoning for now... - -commit 14ea83f029a4c1a9b9fd983331277271986a19e8 -Author: Michael Shanks -Date: Tue Dec 18 22:05:41 2018 +0000 - - bugfix.. reloading of hierarchy not rehydrating aggregates - -commit f7053af9e503e86a12fc873b04fdc58c6573343e -Author: Michael Shanks -Date: Tue Dec 18 21:39:23 2018 +0000 - - aggregates - templateApi validation - -commit c3af14e18fb02fc92d6dcbde95a67b8a2a6793c2 -Author: Michael Shanks -Date: Mon Dec 17 22:15:14 2018 +0000 - - getting ready to start dev on aggregates - -commit 8ee9205cd9a825642c397cc1cd22cd42f473e539 -Author: Michael Shanks -Date: Tue Dec 11 21:04:32 2018 +0000 - - index sharding complete - -commit e1cda0d24ac1da947646535cd1c4d2841837f23f -Author: Michael Shanks -Date: Mon Dec 10 22:26:44 2018 +0000 - - more tests for sharded indexes - -commit 5cbe367461f1ca060ea9b6b0183ed52a3568977c -Author: Michael Shanks -Date: Mon Dec 10 21:18:06 2018 +0000 - - refactoring build index for sharding... old tests passing - -commit b2555c52c0e3c9ebb0087e190ff35987709de6e6 -Author: Michael Shanks -Date: Sat Dec 8 21:39:00 2018 +0000 - - list items - testing sharded indexs - -commit 7a549c87ef7133407bfe92afe4721f12349034ea -Author: Michael Shanks -Date: Sat Dec 8 14:05:30 2018 +0000 - - index shrading tests passing again - -commit c6d067f248d3faefa0791e95725cebb4ec0060e6 -Author: Michael Shanks -Date: Fri Dec 7 23:27:03 2018 +0000 - - index shrading WIP - -commit 670e9941cc8901d9764436fd70094eb6e904f0fa -Author: Michael Shanks -Date: Thu Dec 6 23:02:18 2018 +0000 - - index sharding refactoring - -commit 969c4801c107eb3958d1ef9d9c559ac03d7da7b2 -Author: Michael Shanks -Date: Wed Dec 5 22:28:02 2018 +0000 - - refactoring for shard index... - -commit 5df82b19fa6954be20b9d3a1cf0a5f93b06cc9e6 -Author: Michael Shanks -Date: Mon Dec 3 21:40:16 2018 +0000 - - remove from allids - now used and tested - -commit a04500193b227ede3bd48eee3193dd6760a82476 -Author: Michael Shanks -Date: Thu Nov 29 09:20:10 2018 +0000 - - fields validated on hierarchy validation - -commit 603382aa3067d1b429ea5761bd005dd3a69cdb59 -Author: Michael Shanks -Date: Tue Nov 27 22:14:16 2018 +0000 - - lots more testing of buildIndex for reverse indexing - -commit afc29d2ecc7b8ab661afd116ced9e8ff69031142 -Author: Michael Shanks -Date: Sun Nov 25 22:49:39 2018 +0000 - - reverse index - rebuild, just starting... - -commit ddd70e9aa8a91f3d8713d3d3a69f27720869a4d8 -Author: Michael Shanks -Date: Sun Nov 25 21:22:42 2018 +0000 - - reverse indexes tested yay - -commit 044e955658695ba875d151252bbab471b8b1233a -Author: Michael Shanks -Date: Sun Nov 25 20:34:27 2018 +0000 - - more testing revers indexes - -commit 1dbdb9fa26f38ca938bc269988f55f28cfd94d1b -Author: Michael Shanks -Date: Fri Nov 23 22:49:51 2018 +0000 - - reverse index failing test - reindex for update - -commit 5ff917a748a8db764fa4a4e451f942d183f5d5bc -Author: Michael Shanks -Date: Fri Nov 23 21:26:21 2018 +0000 - - reverse indexes all passing... amybe need more tests - -commit a507978efaadb527b24b6e7747a972e11c8f7765 -Author: Michael Shanks -Date: Thu Nov 22 22:40:38 2018 +0000 - - reverse indexes getIndexedDataKey using mappedRecord for path - -commit d0017223799947ce027b5917b042fe3b1b155e1a -Author: Michael Shanks -Date: Wed Nov 21 22:51:24 2018 +0000 - - reverse index - reindex - failing test - -commit d6fbd485e0c6a17e80dfce8c1ef15c6e6d2796e8 -Author: Michael Shanks -Date: Wed Nov 21 21:48:55 2018 +0000 - - reference indexes testing.. - -commit eca8bb8b87e762b906c1e8c7828aa523ed0eb238 -Author: Michael Shanks -Date: Tue Nov 20 22:40:14 2018 +0000 - - reverse reference indexes - shaky - -commit 0e79d4e2fba773d35eb76e0603fc770172347798 -Author: Michael Shanks -Date: Mon Nov 19 21:36:23 2018 +0000 - - removed view concept - -commit b1825f1d3c9495dc401c513f171c91660bb5d9c6 -Author: Michael Shanks -Date: Sun Nov 18 22:16:45 2018 +0000 - - index validation, no tests - -commit 7fbba8dfa4575a3ddae50963d8f17544aa40d003 -Author: Michael Shanks -Date: Sat Nov 17 22:57:47 2018 +0000 - - validation common module - -commit 4edb6911a2330e17ddbdbdeb9aefdc277489ec40 -Author: Michael Shanks -Date: Fri Nov 16 22:39:40 2018 +0000 - - heararchy validation - -commit ad464d8a5a2a3dae3820dc9df4e9bc2701d1d11d -Author: Michael Shanks -Date: Fri Nov 16 19:00:56 2018 +0000 - - calling validate on save hierarchy - -commit 4015a29e7f9f69c26fb87af328aaa2d1dfee9008 -Author: Michael Shanks -Date: Thu Nov 15 22:14:03 2018 +0000 - - triggers! - -commit aa2a1f9c2b0f868ddaf378de9a62a66707ea430a -Author: Michael Shanks -Date: Wed Nov 14 20:42:47 2018 +0000 - - action execution - -commit 422546979af609274996dcc8a9ced221cc7e4438 -Author: Michael Shanks -Date: Tue Nov 13 22:36:56 2018 +0000 - - still failing - getting into debuggine of initialse actions - -commit aca46047dc6c5febd948fdc286c40389aeb1ec17 -Author: Michael Shanks -Date: Tue Nov 13 22:26:53 2018 +0000 - - actions initialise - failing tests - -commit 3eed51db82fad61a377a173cd3f2695aa36aa9d2 -Author: Michael Shanks -Date: Mon Nov 12 21:41:28 2018 +0000 - - actions and triggers creation - -commit 66672605846692d87645f49ab646b51bc05c3e9a -Author: Michael Shanks -Date: Sun Nov 11 23:25:32 2018 +0000 - - few more tests for action and trigger validation - -commit efd9648ae6a00c7e197f0a241a704c112379d24b -Author: Michael Shanks -Date: Sun Nov 11 23:23:27 2018 +0000 - - action and trigger validation - -commit 0a7374ee6c382aaa497d9e42b209e0aa1f3e90b2 -Author: Michael Shanks -Date: Fri Nov 9 22:54:19 2018 +0000 - - action validation starter - -commit 9528e4ea670e6642105a0a38903401895d86eac5 -Author: Michael Shanks -Date: Fri Nov 9 21:30:30 2018 +0000 - - actions started - -commit 6f16dbeba7d4e2b21f9874ee5a3baaa6f542e0f6 -Merge: 3db75d0 d1d9c86 -Author: Michael Shanks -Date: Fri Nov 9 18:44:53 2018 +0000 - - Merge branch 'master' of gitlab.com:budibase-source/budibase-core - -commit 3db75d02025f95f8011972fd37c674b909b7fea0 -Author: Michael Shanks -Date: Fri Nov 9 18:44:40 2018 +0000 - - appHierarchy > appDefinition (inc. actions) - -commit d1d9c869cc99a9da46dbbdf1efa2233743297ea6 -Author: Michael Shanks -Date: Thu Nov 8 16:33:50 2018 +0000 - - Add LICENSE - -commit f960ff58ee147a4c220b4a474224746e31b8aa56 -Author: Michael Shanks -Date: Wed Nov 7 21:57:05 2018 +0000 - - delete record working - -commit ff1f956d84375a1489e2fe593c52e9b1deec466b -Author: Michael Shanks -Date: Tue Nov 6 21:55:41 2018 +0000 - - delete working 99% - race condition somewhere - -commit 72d35f5da5254cbcea74e34da30948428059c15b -Author: Michael Shanks -Date: Sun Nov 4 22:20:32 2018 +0000 - - allids folders created - -commit 35ba20f11d1c99c8485389bcb8124de547f69681 -Author: Michael Shanks -Date: Sat Nov 3 09:29:27 2018 +0000 - - records now saved at /colection/1234/record.json - -commit 8098d2764b122c4837bc56a469ab83a358b87004 -Author: Michael Shanks -Date: Sat Nov 3 09:07:04 2018 +0000 - - creating .config folder - -commit 595ac9da001eab24ede2f019a3863d4dd91e8fde -Author: Michael Shanks -Date: Sat Nov 3 08:52:41 2018 +0000 - - adding folder for collection initialise - -commit f0974a618e1d9b67dadc9853be22fb8084b286bd -Author: Michael Shanks -Date: Tue Oct 30 21:49:28 2018 +0000 - - exporting setupDatastore - -commit 022927ad188686df79511c4d9ce9a42be1906901 -Author: Michael Shanks -Date: Tue Oct 30 21:36:46 2018 +0000 - - events export with main module - -commit 2a64c73ec80d63c0cdac72fa7ca438b6cfd570f3 -Author: Michael Shanks -Date: Tue Oct 30 20:52:42 2018 +0000 - - events list - -commit 641f3c7cddb4dcee7516efdc9efcd8c95dbe0fb3 -Author: Michael Shanks -Date: Tue Oct 30 20:49:46 2018 +0000 - - flat event list - -commit d68025cab9d1ab650b380fd06cbbec6e0610ae78 -Author: Michael Shanks -Date: Tue Oct 30 19:03:16 2018 +0000 - - test passing... - -commit 716c889aa33f8303c18eed67619b2766eb921f66 -Author: Michael Shanks -Date: Mon Oct 29 23:16:09 2018 +0000 - - added elapsed & threadIds - -commit aa8da8fe20cc4e6229a34f6a8cff7e4fdb0fda74 -Author: Michael Shanks -Date: Sun Oct 28 00:25:58 2018 +0100 - - unused inports - -commit 852843826742ac542f4cdcac2ebb252348c7793a -Author: Michael Shanks -Date: Sun Oct 28 00:23:39 2018 +0100 - - all events in one file - -commit dfe9c51906cdc66909eb589f52e103dafb655b8c -Author: Michael Shanks -Date: Sat Oct 27 22:37:40 2018 +0100 - - events added to viewApi, collectionApi - -commit 75a59c29a2697ffb558d83af13d6a3687b1dcc9a -Author: Michael Shanks -Date: Sat Oct 27 21:56:04 2018 +0100 - - added events to all recordApi - -commit 19b062a6144a817142b420beba034c62ca4064ce -Author: Michael Shanks -Date: Fri Oct 26 23:20:25 2018 +0100 - - api wrapper tested - -commit 71c497397502d4ef50e21c22d8a931a388a87e0a -Author: Michael Shanks -Date: Fri Oct 26 21:23:57 2018 +0100 - - adding events - api wrapper - -commit d4a48494fbcf44f33bcca692f0f48718aa634acc -Author: Michael Shanks -Date: Wed Oct 24 22:36:00 2018 +0100 - - adding save events.... - -commit f8cbd187fc124bb13ffd314c649b9200a1d2df50 -Author: Michael Shanks -Date: Mon Oct 22 22:36:25 2018 +0100 - - added event aggregator - -commit f5a0df320659f41c1bfa86e7c7d8b7d30f439b5b -Author: Michael Shanks -Date: Mon Oct 22 21:43:02 2018 +0100 - - appHierarchy myst exist to initialise application - -commit a1a5d12db1eeb924f33d16eaac6dc4d04d476c34 -Author: Michael Shanks -Date: Sun Oct 21 21:54:53 2018 +0100 - - throwing error when app hierarchy does not exists - and everything breaks - -commit 5c081caf28f197b1445035df9e752a644809a122 -Author: Michael Shanks -Date: Sat Oct 20 23:28:50 2018 +0100 - - removing datastores - new repo - -commit 7c82b6ee305b4f2a50ecb0b2521d69e35d6281fe -Author: Michael Shanks -Date: Fri Oct 19 21:41:57 2018 +0100 - - rollup confing & package entry points - -commit bf563ff2126b951d4c14fa2bdaea07460b97c67e -Author: Michael Shanks -Date: Fri Oct 19 08:40:00 2018 +0100 - - added rollup - package to esm and cjs - -commit a906a3fa6ee0725c363f234083bbdcee5c7ca25f -Author: Michael Shanks -Date: Thu Oct 18 22:25:56 2018 +0100 - - removed unused ensureDefaults - -commit 6e0af0b0989bb58cad23e265026442b6b89d0eb5 -Author: Michael Shanks -Date: Thu Oct 18 22:23:35 2018 +0100 - - removed group concept - -commit ad19a896c1af11db1b2b9d6891a6d69c821c3321 -Author: Michael Shanks -Date: Thu Oct 18 21:36:06 2018 +0100 - - removing UI from hierarchy - -commit a97d65d7b1d802322fc263e49fd8440e1ef4d4df -Author: Michael Shanks -Date: Thu Oct 18 13:55:43 2018 +0100 - - initial commit - split core library diff --git a/packages/datastores/.npmignore b/packages/datastores/.npmignore new file mode 100644 index 0000000000..b32ff96dfc --- /dev/null +++ b/packages/datastores/.npmignore @@ -0,0 +1,5 @@ +* +!datastores/* +!index.js +!config.js +!config.template.js \ No newline at end of file diff --git a/packages/datastores/package.json b/packages/datastores/package.json index 7a279706d4..8bb2d4b134 100644 --- a/packages/datastores/package.json +++ b/packages/datastores/package.json @@ -1,6 +1,6 @@ { "name": "@budibase/datastores", - "version": "0.0.16", + "version": "0.0.24", "description": "implementations of all the datastores... azureblob, local etc", "main": "index.js", "scripts": { @@ -27,7 +27,7 @@ "@babel/core": "^7.1.2", "@babel/node": "^7.0.0", "@babel/preset-env": "^7.1.0", - "@budibase/core": "^0.0.16", + "@budibase/core": "^0.0.24", "es6-promisify": "^6.0.1", "fs-extra": "^8.1.0", "lodash": "^4.17.13", diff --git a/packages/materialdesign-components/.npmignore b/packages/materialdesign-components/.npmignore new file mode 100644 index 0000000000..81c5644598 --- /dev/null +++ b/packages/materialdesign-components/.npmignore @@ -0,0 +1,3 @@ +* +!dist/* +!components.json \ No newline at end of file diff --git a/packages/materialdesign-components/dist/generators.js b/packages/materialdesign-components/dist/generators.js deleted file mode 100644 index ee31a7427f..0000000000 --- a/packages/materialdesign-components/dist/generators.js +++ /dev/null @@ -1 +0,0 @@ -//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJmaWxlIjoiZ2VuZXJhdG9ycy5qcyIsInNvdXJjZXMiOltdLCJzb3VyY2VzQ29udGVudCI6W10sIm5hbWVzIjpbXSwibWFwcGluZ3MiOiIifQ== diff --git a/packages/materialdesign-components/package.json b/packages/materialdesign-components/package.json index 7d09e4b492..ba2e4dc891 100644 --- a/packages/materialdesign-components/package.json +++ b/packages/materialdesign-components/package.json @@ -12,9 +12,16 @@ "publishdev": "yarn build && node ./scripts/publishDev.js" }, "devDependencies": { - "@budibase/client": "^0.0.16", - "@budibase/standard-components": "^0.0.16", + "@budibase/client": "^0.0.24", + "@budibase/standard-components": "^0.0.24", "@material/button": "^4.0.0", + "@material/checkbox": "^4.0.0", + "@material/data-table": "4.0.0", + "@material/form-field": "^4.0.0", + "@material/list": "4.0.0", + "@material/menu": "4.0.0", + "@material/radio": "^4.0.0", + "@material/textfield": "^4.0.0", "@nx-js/compiler-util": "^2.0.0", "bcryptjs": "^2.4.3", "fs-extra": "^8.1.0", @@ -37,16 +44,7 @@ "keywords": [ "svelte" ], - "version": "0.0.16", + "version": "0.0.24", "license": "MIT", - "gitHead": "115189f72a850bfb52b65ec61d932531bf327072", - "dependencies": { - "@material/checkbox": "^4.0.0", - "@material/data-table": "4.0.0", - "@material/form-field": "^4.0.0", - "@material/list": "4.0.0", - "@material/menu": "4.0.0", - "@material/radio": "^4.0.0", - "@material/textfield": "^4.0.0" - } + "gitHead": "115189f72a850bfb52b65ec61d932531bf327072" } diff --git a/packages/materialdesign-components/rollup.config.js b/packages/materialdesign-components/rollup.config.js index ce1db3f707..263ee81d66 100644 --- a/packages/materialdesign-components/rollup.config.js +++ b/packages/materialdesign-components/rollup.config.js @@ -1,6 +1,7 @@ import svelte from "rollup-plugin-svelte" import postcss from "rollup-plugin-postcss" import resolve from "rollup-plugin-node-resolve" +import commonjs from "rollup-plugin-commonjs" const postcssOptions = () => ({ extensions: [".scss", ".sass"], @@ -16,6 +17,10 @@ const postcssOptions = () => ({ ], }) +const coreExternal = [ + "shortid", +] + export default { input: "src/index.js", output: [ @@ -30,7 +35,18 @@ export default { svelte({ hydratable: true, }), - resolve(), + resolve({ + preferBuiltins: true, + browser: true, + dedupe: importee => { + return coreExternal.includes(importee) + }, + }), + commonjs({ + namedExports: { + shortid: ["generate"], + }, + }), postcss(postcssOptions()), ], } diff --git a/packages/materialdesign-components/src/Checkbox/Checkbox.svelte b/packages/materialdesign-components/src/Checkbox/Checkbox.svelte index bfe861f373..ceced6af9c 100644 --- a/packages/materialdesign-components/src/Checkbox/Checkbox.svelte +++ b/packages/materialdesign-components/src/Checkbox/Checkbox.svelte @@ -1,5 +1,5 @@ @@ -54,7 +65,8 @@ {id} {disabled} {checked} - on:click={onClick} /> + on:click={onClick} + on:change={changed} />
diff --git a/packages/materialdesign-components/src/Common/Formfield.svelte b/packages/materialdesign-components/src/Common/Formfield.svelte index 3559f721df..d019ac39a9 100644 --- a/packages/materialdesign-components/src/Common/Formfield.svelte +++ b/packages/materialdesign-components/src/Common/Formfield.svelte @@ -3,13 +3,14 @@ import ClassBuilder from "../ClassBuilder.js" import { fieldStore } from "./FormfieldStore.js" import { MDCFormField } from "@material/form-field" - import { onMount, onDestroy, setContext } from "svelte" + import { onMount, onDestroy } from "svelte" const cb = new ClassBuilder("form-field") let store const unsubscribe = fieldStore.subscribe(s => (store = s)) + export let _bb export let id = "" export let label = "" export let alignEnd = false @@ -23,7 +24,8 @@ onMount(() => { if (!!formField) fieldStore.set(new MDCFormField(formField)) - setContext("BBMD:field-element", fieldStore) + //TODO: Fix this, _bb is coming back undefined + // _bb.setContext("BBMD:field-element", fieldStore) }) onDestroy(unsubscribe) diff --git a/packages/materialdesign-components/src/Common/ItemStore.js b/packages/materialdesign-components/src/Common/ItemStore.js new file mode 100644 index 0000000000..c523405dad --- /dev/null +++ b/packages/materialdesign-components/src/Common/ItemStore.js @@ -0,0 +1,54 @@ +import { writable } from "svelte/store"; + +function createItemsStore(componentOnSelect) { + const { subscribe, set, update } = writable([]); + + function addItem(item) { + update(items => { + return [...items, item] + }) + if (componentOnSelect) { + componentOnSelect(); + } + } + + function addSingleItem(item) { + set([item]) + if (componentOnSelect) { + componentOnSelect(); + } + } + + function removeItem(itemId) { + update(items => { + let index = getItemIdx(items, itemId) + items.splice(index, 1); + return items; + }) + if (componentOnSelect) { + componentOnSelect(); + } + } + + function clearItems() { + set([]); + if (componentOnSelect) { + componentOnSelect(); + } + } + + function getItemIdx(items, itemId) { + return items.findIndex(i => i._id === itemId); + } + + return { + subscribe, + addItem, + addSingleItem, + removeItem, + clearItems, + getItemIdx + } +} + +export default createItemsStore diff --git a/packages/materialdesign-components/src/List/List.svelte b/packages/materialdesign-components/src/List/List.svelte index 3ba864e355..f1686c43ee 100644 --- a/packages/materialdesign-components/src/List/List.svelte +++ b/packages/materialdesign-components/src/List/List.svelte @@ -1,10 +1,13 @@ -
  • +
  • {#if leadingIcon} - {#if inputElement} - {#if inputElement === 'radiobutton'} - - {:else if inputElement === 'checkbox'} - + {#if listProps} + {#if listProps.inputElement === 'radiobutton'} + + {:else if listProps.inputElement === 'checkbox'} + {/if} {:else if trailingIcon} diff --git a/packages/materialdesign-components/src/Radiobutton/Radiobutton.svelte b/packages/materialdesign-components/src/Radiobutton/Radiobutton.svelte index 9b4c475241..cb83f88d40 100644 --- a/packages/materialdesign-components/src/Radiobutton/Radiobutton.svelte +++ b/packages/materialdesign-components/src/Radiobutton/Radiobutton.svelte @@ -1,10 +1,11 @@ diff --git a/packages/server/appPackages/_master/public/unauthenticated/budibase-client.js b/packages/server/appPackages/_master/public/unauthenticated/budibase-client.js index ddaad74d45..2758a2c256 100644 --- a/packages/server/appPackages/_master/public/unauthenticated/budibase-client.js +++ b/packages/server/appPackages/_master/public/unauthenticated/budibase-client.js @@ -133,6 +133,10 @@ var app = (function (exports) { return module = { exports: {} }, fn(module, module.exports), module.exports; } + function getCjsExportFromNamespace (n) { + return n && n['default'] || n; + } + var lodash_min = createCommonjsModule(function (module, exports) { (function(){function n(n,t,r){switch(r.length){case 0:return n.call(t);case 1:return n.call(t,r[0]);case 2:return n.call(t,r[0],r[1]);case 3:return n.call(t,r[0],r[1],r[2])}return n.apply(t,r)}function t(n,t,r,e){for(var u=-1,i=null==n?0:n.length;++u { + const func = props._id ? uiFunctions[props._id] : undefined; + + const parentContext = (parentNode && parentNode.context) || {}; + + let nodesToRender = []; + const createNodeAndRender = context => { + let componentContext = parentContext; + if (context) { + componentContext = { ...context }; + componentContext.$parent = parentContext; + } + + const thisNode = createTreeNode(); + thisNode.context = componentContext; + thisNode.parentNode = parentNode; + thisNode.props = props; + nodesToRender.push(thisNode); + + thisNode.render = initialProps => { + thisNode.component = new componentConstructor({ + target: htmlElement, + props: initialProps, + hydrate: false, + anchor, + }); + thisNode.rootElement = + htmlElement.children[htmlElement.children.length - 1]; + + if (props._id && thisNode.rootElement) { + thisNode.rootElement.classList.add(`pos-${props._id}`); + } + }; + }; + + if (func) { + const state = getCurrentState(); + const routeParams = state["##routeParams"]; + func(createNodeAndRender, parentContext, getCurrentState(), routeParams); + } else { + createNodeAndRender(); + } + + return nodesToRender + }; + + const createTreeNode = () => ({ + context: {}, + props: {}, + rootElement: null, + parentNode: null, + children: [], + bindings: [], + component: null, + unsubscribe: () => {}, + render: () => {}, + get destroy() { + const node = this; + return () => { + if (node.unsubscribe) node.unsubscribe(); + if (node.component && node.component.$destroy) node.component.$destroy(); + if (node.children) { + for (let child of node.children) { + child.destroy(); + } + } + for (let onDestroyItem of node.onDestroy) { + onDestroyItem(); + } + } + }, + onDestroy: [], + }); + + const screenSlotComponent = window => { + return function(opts) { + const node = window.document.createElement("DIV"); + const $set = props => { + props._bb.attachChildren(node); + }; + const $destroy = () => { + if (opts.target && node) opts.target.removeChild(node); + }; + this.$set = $set; + this.$destroy = $destroy; + opts.target.appendChild(node); + } + }; + + const builtinLibName = "##builtin"; + + const isScreenSlot = componentName => + componentName === "##builtin/screenslot"; + + const builtins = window => ({ + screenslot: screenSlotComponent(window), + }); + + var toStr = Object.prototype.toString; + + var isArguments = function isArguments(value) { + var str = toStr.call(value); + var isArgs = str === '[object Arguments]'; + if (!isArgs) { + isArgs = str !== '[object Array]' && + value !== null && + typeof value === 'object' && + typeof value.length === 'number' && + value.length >= 0 && + toStr.call(value.callee) === '[object Function]'; + } + return isArgs; + }; + + var keysShim; + if (!Object.keys) { + // modified from https://github.com/es-shims/es5-shim + var has$1 = Object.prototype.hasOwnProperty; + var toStr$1 = Object.prototype.toString; + var isArgs = isArguments; // eslint-disable-line global-require + var isEnumerable = Object.prototype.propertyIsEnumerable; + var hasDontEnumBug = !isEnumerable.call({ toString: null }, 'toString'); + var hasProtoEnumBug = isEnumerable.call(function () {}, 'prototype'); + var dontEnums = [ + 'toString', + 'toLocaleString', + 'valueOf', + 'hasOwnProperty', + 'isPrototypeOf', + 'propertyIsEnumerable', + 'constructor' + ]; + var equalsConstructorPrototype = function (o) { + var ctor = o.constructor; + return ctor && ctor.prototype === o; + }; + var excludedKeys = { + $applicationCache: true, + $console: true, + $external: true, + $frame: true, + $frameElement: true, + $frames: true, + $innerHeight: true, + $innerWidth: true, + $onmozfullscreenchange: true, + $onmozfullscreenerror: true, + $outerHeight: true, + $outerWidth: true, + $pageXOffset: true, + $pageYOffset: true, + $parent: true, + $scrollLeft: true, + $scrollTop: true, + $scrollX: true, + $scrollY: true, + $self: true, + $webkitIndexedDB: true, + $webkitStorageInfo: true, + $window: true + }; + var hasAutomationEqualityBug = (function () { + /* global window */ + if (typeof window === 'undefined') { return false; } + for (var k in window) { + try { + if (!excludedKeys['$' + k] && has$1.call(window, k) && window[k] !== null && typeof window[k] === 'object') { + try { + equalsConstructorPrototype(window[k]); + } catch (e) { + return true; + } + } + } catch (e) { + return true; + } + } + return false; + }()); + var equalsConstructorPrototypeIfNotBuggy = function (o) { + /* global window */ + if (typeof window === 'undefined' || !hasAutomationEqualityBug) { + return equalsConstructorPrototype(o); + } + try { + return equalsConstructorPrototype(o); + } catch (e) { + return false; + } + }; + + keysShim = function keys(object) { + var isObject = object !== null && typeof object === 'object'; + var isFunction = toStr$1.call(object) === '[object Function]'; + var isArguments = isArgs(object); + var isString = isObject && toStr$1.call(object) === '[object String]'; + var theKeys = []; + + if (!isObject && !isFunction && !isArguments) { + throw new TypeError('Object.keys called on a non-object'); + } + + var skipProto = hasProtoEnumBug && isFunction; + if (isString && object.length > 0 && !has$1.call(object, 0)) { + for (var i = 0; i < object.length; ++i) { + theKeys.push(String(i)); + } + } + + if (isArguments && object.length > 0) { + for (var j = 0; j < object.length; ++j) { + theKeys.push(String(j)); + } + } else { + for (var name in object) { + if (!(skipProto && name === 'prototype') && has$1.call(object, name)) { + theKeys.push(String(name)); + } + } + } + + if (hasDontEnumBug) { + var skipConstructor = equalsConstructorPrototypeIfNotBuggy(object); + + for (var k = 0; k < dontEnums.length; ++k) { + if (!(skipConstructor && dontEnums[k] === 'constructor') && has$1.call(object, dontEnums[k])) { + theKeys.push(dontEnums[k]); + } + } + } + return theKeys; + }; + } + var implementation = keysShim; + + var slice = Array.prototype.slice; + + + var origKeys = Object.keys; + var keysShim$1 = origKeys ? function keys(o) { return origKeys(o); } : implementation; + + var originalKeys = Object.keys; + + keysShim$1.shim = function shimObjectKeys() { + if (Object.keys) { + var keysWorksWithArguments = (function () { + // Safari 5.0 bug + var args = Object.keys(arguments); + return args && args.length === arguments.length; + }(1, 2)); + if (!keysWorksWithArguments) { + Object.keys = function keys(object) { // eslint-disable-line func-name-matching + if (isArguments(object)) { + return originalKeys(slice.call(object)); + } + return originalKeys(object); + }; + } + } else { + Object.keys = keysShim$1; + } + return Object.keys || keysShim$1; + }; + + var objectKeys = keysShim$1; + + var hasToStringTag = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol'; + var toStr$2 = Object.prototype.toString; + + var isStandardArguments = function isArguments(value) { + if (hasToStringTag && value && typeof value === 'object' && Symbol.toStringTag in value) { + return false; + } + return toStr$2.call(value) === '[object Arguments]'; + }; + + var isLegacyArguments = function isArguments(value) { + if (isStandardArguments(value)) { + return true; + } + return value !== null && + typeof value === 'object' && + typeof value.length === 'number' && + value.length >= 0 && + toStr$2.call(value) !== '[object Array]' && + toStr$2.call(value.callee) === '[object Function]'; + }; + + var supportsStandardArguments = (function () { + return isStandardArguments(arguments); + }()); + + isStandardArguments.isLegacyArguments = isLegacyArguments; // for tests + + var isArguments$1 = supportsStandardArguments ? isStandardArguments : isLegacyArguments; + + // http://www.ecma-international.org/ecma-262/6.0/#sec-object.is + + var numberIsNaN = function (value) { + return value !== value; + }; + + var objectIs = function is(a, b) { + if (a === 0 && b === 0) { + return 1 / a === 1 / b; + } + if (a === b) { + return true; + } + if (numberIsNaN(a) && numberIsNaN(b)) { + return true; + } + return false; + }; + + /* eslint no-invalid-this: 1 */ + + var ERROR_MESSAGE = 'Function.prototype.bind called on incompatible '; + var slice$1 = Array.prototype.slice; + var toStr$3 = Object.prototype.toString; + var funcType = '[object Function]'; + + var implementation$1 = function bind(that) { + var target = this; + if (typeof target !== 'function' || toStr$3.call(target) !== funcType) { + throw new TypeError(ERROR_MESSAGE + target); + } + var args = slice$1.call(arguments, 1); + + var bound; + var binder = function () { + if (this instanceof bound) { + var result = target.apply( + this, + args.concat(slice$1.call(arguments)) + ); + if (Object(result) === result) { + return result; + } + return this; + } else { + return target.apply( + that, + args.concat(slice$1.call(arguments)) + ); + } + }; + + var boundLength = Math.max(0, target.length - args.length); + var boundArgs = []; + for (var i = 0; i < boundLength; i++) { + boundArgs.push('$' + i); + } + + bound = Function('binder', 'return function (' + boundArgs.join(',') + '){ return binder.apply(this,arguments); }')(binder); + + if (target.prototype) { + var Empty = function Empty() {}; + Empty.prototype = target.prototype; + bound.prototype = new Empty(); + Empty.prototype = null; + } + + return bound; + }; + + var functionBind = Function.prototype.bind || implementation$1; + + var src = functionBind.call(Function.call, Object.prototype.hasOwnProperty); + + var regexExec = RegExp.prototype.exec; + var gOPD = Object.getOwnPropertyDescriptor; + + var tryRegexExecCall = function tryRegexExec(value) { + try { + var lastIndex = value.lastIndex; + value.lastIndex = 0; + + regexExec.call(value); + return true; + } catch (e) { + return false; + } finally { + value.lastIndex = lastIndex; + } + }; + var toStr$4 = Object.prototype.toString; + var regexClass = '[object RegExp]'; + var hasToStringTag$1 = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol'; + + var isRegex = function isRegex(value) { + if (!value || typeof value !== 'object') { + return false; + } + if (!hasToStringTag$1) { + return toStr$4.call(value) === regexClass; + } + + var descriptor = gOPD(value, 'lastIndex'); + var hasLastIndexDataProperty = descriptor && src(descriptor, 'value'); + if (!hasLastIndexDataProperty) { + return false; + } + + return tryRegexExecCall(value); + }; + + var hasSymbols = typeof Symbol === 'function' && typeof Symbol('foo') === 'symbol'; + + var toStr$5 = Object.prototype.toString; + var concat = Array.prototype.concat; + var origDefineProperty = Object.defineProperty; + + var isFunction = function (fn) { + return typeof fn === 'function' && toStr$5.call(fn) === '[object Function]'; + }; + + var arePropertyDescriptorsSupported = function () { + var obj = {}; + try { + origDefineProperty(obj, 'x', { enumerable: false, value: obj }); + // eslint-disable-next-line no-unused-vars, no-restricted-syntax + for (var _ in obj) { // jscs:ignore disallowUnusedVariables + return false; + } + return obj.x === obj; + } catch (e) { /* this is IE 8. */ + return false; + } + }; + var supportsDescriptors = origDefineProperty && arePropertyDescriptorsSupported(); + + var defineProperty = function (object, name, value, predicate) { + if (name in object && (!isFunction(predicate) || !predicate())) { + return; + } + if (supportsDescriptors) { + origDefineProperty(object, name, { + configurable: true, + enumerable: false, + value: value, + writable: true + }); + } else { + object[name] = value; + } + }; + + var defineProperties = function (object, map) { + var predicates = arguments.length > 2 ? arguments[2] : {}; + var props = objectKeys(map); + if (hasSymbols) { + props = concat.call(props, Object.getOwnPropertySymbols(map)); + } + for (var i = 0; i < props.length; i += 1) { + defineProperty(object, props[i], map[props[i]], predicates[props[i]]); + } + }; + + defineProperties.supportsDescriptors = !!supportsDescriptors; + + var defineProperties_1 = defineProperties; + + /* eslint complexity: [2, 18], max-statements: [2, 33] */ + var shams = function hasSymbols() { + if (typeof Symbol !== 'function' || typeof Object.getOwnPropertySymbols !== 'function') { return false; } + if (typeof Symbol.iterator === 'symbol') { return true; } + + var obj = {}; + var sym = Symbol('test'); + var symObj = Object(sym); + if (typeof sym === 'string') { return false; } + + if (Object.prototype.toString.call(sym) !== '[object Symbol]') { return false; } + if (Object.prototype.toString.call(symObj) !== '[object Symbol]') { return false; } + + // temp disabled per https://github.com/ljharb/object.assign/issues/17 + // if (sym instanceof Symbol) { return false; } + // temp disabled per https://github.com/WebReflection/get-own-property-symbols/issues/4 + // if (!(symObj instanceof Symbol)) { return false; } + + // if (typeof Symbol.prototype.toString !== 'function') { return false; } + // if (String(sym) !== Symbol.prototype.toString.call(sym)) { return false; } + + var symVal = 42; + obj[sym] = symVal; + for (sym in obj) { return false; } // eslint-disable-line no-restricted-syntax + if (typeof Object.keys === 'function' && Object.keys(obj).length !== 0) { return false; } + + if (typeof Object.getOwnPropertyNames === 'function' && Object.getOwnPropertyNames(obj).length !== 0) { return false; } + + var syms = Object.getOwnPropertySymbols(obj); + if (syms.length !== 1 || syms[0] !== sym) { return false; } + + if (!Object.prototype.propertyIsEnumerable.call(obj, sym)) { return false; } + + if (typeof Object.getOwnPropertyDescriptor === 'function') { + var descriptor = Object.getOwnPropertyDescriptor(obj, sym); + if (descriptor.value !== symVal || descriptor.enumerable !== true) { return false; } + } + + return true; + }; + + var origSymbol = commonjsGlobal.Symbol; + + + var hasSymbols$1 = function hasNativeSymbols() { + if (typeof origSymbol !== 'function') { return false; } + if (typeof Symbol !== 'function') { return false; } + if (typeof origSymbol('foo') !== 'symbol') { return false; } + if (typeof Symbol('bar') !== 'symbol') { return false; } + + return shams(); + }; + + /* globals + Atomics, + SharedArrayBuffer, + */ + + var undefined$1; + + var $TypeError = TypeError; + + var $gOPD = Object.getOwnPropertyDescriptor; + if ($gOPD) { + try { + $gOPD({}, ''); + } catch (e) { + $gOPD = null; // this is IE 8, which has a broken gOPD + } + } + + var throwTypeError = function () { throw new $TypeError(); }; + var ThrowTypeError = $gOPD + ? (function () { + try { + // eslint-disable-next-line no-unused-expressions, no-caller, no-restricted-properties + arguments.callee; // IE 8 does not throw here + return throwTypeError; + } catch (calleeThrows) { + try { + // IE 8 throws on Object.getOwnPropertyDescriptor(arguments, '') + return $gOPD(arguments, 'callee').get; + } catch (gOPDthrows) { + return throwTypeError; + } + } + }()) + : throwTypeError; + + var hasSymbols$2 = hasSymbols$1(); + + var getProto = Object.getPrototypeOf || function (x) { return x.__proto__; }; // eslint-disable-line no-proto + var generatorFunction = undefined$1; + var asyncFunction = undefined$1; + var asyncGenFunction = undefined$1; + + var TypedArray = typeof Uint8Array === 'undefined' ? undefined$1 : getProto(Uint8Array); + + var INTRINSICS = { + '%Array%': Array, + '%ArrayBuffer%': typeof ArrayBuffer === 'undefined' ? undefined$1 : ArrayBuffer, + '%ArrayBufferPrototype%': typeof ArrayBuffer === 'undefined' ? undefined$1 : ArrayBuffer.prototype, + '%ArrayIteratorPrototype%': hasSymbols$2 ? getProto([][Symbol.iterator]()) : undefined$1, + '%ArrayPrototype%': Array.prototype, + '%ArrayProto_entries%': Array.prototype.entries, + '%ArrayProto_forEach%': Array.prototype.forEach, + '%ArrayProto_keys%': Array.prototype.keys, + '%ArrayProto_values%': Array.prototype.values, + '%AsyncFromSyncIteratorPrototype%': undefined$1, + '%AsyncFunction%': asyncFunction, + '%AsyncFunctionPrototype%': undefined$1, + '%AsyncGenerator%': undefined$1, + '%AsyncGeneratorFunction%': asyncGenFunction, + '%AsyncGeneratorPrototype%': undefined$1, + '%AsyncIteratorPrototype%': undefined$1, + '%Atomics%': typeof Atomics === 'undefined' ? undefined$1 : Atomics, + '%Boolean%': Boolean, + '%BooleanPrototype%': Boolean.prototype, + '%DataView%': typeof DataView === 'undefined' ? undefined$1 : DataView, + '%DataViewPrototype%': typeof DataView === 'undefined' ? undefined$1 : DataView.prototype, + '%Date%': Date, + '%DatePrototype%': Date.prototype, + '%decodeURI%': decodeURI, + '%decodeURIComponent%': decodeURIComponent, + '%encodeURI%': encodeURI, + '%encodeURIComponent%': encodeURIComponent, + '%Error%': Error, + '%ErrorPrototype%': Error.prototype, + '%eval%': eval, // eslint-disable-line no-eval + '%EvalError%': EvalError, + '%EvalErrorPrototype%': EvalError.prototype, + '%Float32Array%': typeof Float32Array === 'undefined' ? undefined$1 : Float32Array, + '%Float32ArrayPrototype%': typeof Float32Array === 'undefined' ? undefined$1 : Float32Array.prototype, + '%Float64Array%': typeof Float64Array === 'undefined' ? undefined$1 : Float64Array, + '%Float64ArrayPrototype%': typeof Float64Array === 'undefined' ? undefined$1 : Float64Array.prototype, + '%Function%': Function, + '%FunctionPrototype%': Function.prototype, + '%Generator%': undefined$1, + '%GeneratorFunction%': generatorFunction, + '%GeneratorPrototype%': undefined$1, + '%Int8Array%': typeof Int8Array === 'undefined' ? undefined$1 : Int8Array, + '%Int8ArrayPrototype%': typeof Int8Array === 'undefined' ? undefined$1 : Int8Array.prototype, + '%Int16Array%': typeof Int16Array === 'undefined' ? undefined$1 : Int16Array, + '%Int16ArrayPrototype%': typeof Int16Array === 'undefined' ? undefined$1 : Int8Array.prototype, + '%Int32Array%': typeof Int32Array === 'undefined' ? undefined$1 : Int32Array, + '%Int32ArrayPrototype%': typeof Int32Array === 'undefined' ? undefined$1 : Int32Array.prototype, + '%isFinite%': isFinite, + '%isNaN%': isNaN, + '%IteratorPrototype%': hasSymbols$2 ? getProto(getProto([][Symbol.iterator]())) : undefined$1, + '%JSON%': typeof JSON === 'object' ? JSON : undefined$1, + '%JSONParse%': typeof JSON === 'object' ? JSON.parse : undefined$1, + '%Map%': typeof Map === 'undefined' ? undefined$1 : Map, + '%MapIteratorPrototype%': typeof Map === 'undefined' || !hasSymbols$2 ? undefined$1 : getProto(new Map()[Symbol.iterator]()), + '%MapPrototype%': typeof Map === 'undefined' ? undefined$1 : Map.prototype, + '%Math%': Math, + '%Number%': Number, + '%NumberPrototype%': Number.prototype, + '%Object%': Object, + '%ObjectPrototype%': Object.prototype, + '%ObjProto_toString%': Object.prototype.toString, + '%ObjProto_valueOf%': Object.prototype.valueOf, + '%parseFloat%': parseFloat, + '%parseInt%': parseInt, + '%Promise%': typeof Promise === 'undefined' ? undefined$1 : Promise, + '%PromisePrototype%': typeof Promise === 'undefined' ? undefined$1 : Promise.prototype, + '%PromiseProto_then%': typeof Promise === 'undefined' ? undefined$1 : Promise.prototype.then, + '%Promise_all%': typeof Promise === 'undefined' ? undefined$1 : Promise.all, + '%Promise_reject%': typeof Promise === 'undefined' ? undefined$1 : Promise.reject, + '%Promise_resolve%': typeof Promise === 'undefined' ? undefined$1 : Promise.resolve, + '%Proxy%': typeof Proxy === 'undefined' ? undefined$1 : Proxy, + '%RangeError%': RangeError, + '%RangeErrorPrototype%': RangeError.prototype, + '%ReferenceError%': ReferenceError, + '%ReferenceErrorPrototype%': ReferenceError.prototype, + '%Reflect%': typeof Reflect === 'undefined' ? undefined$1 : Reflect, + '%RegExp%': RegExp, + '%RegExpPrototype%': RegExp.prototype, + '%Set%': typeof Set === 'undefined' ? undefined$1 : Set, + '%SetIteratorPrototype%': typeof Set === 'undefined' || !hasSymbols$2 ? undefined$1 : getProto(new Set()[Symbol.iterator]()), + '%SetPrototype%': typeof Set === 'undefined' ? undefined$1 : Set.prototype, + '%SharedArrayBuffer%': typeof SharedArrayBuffer === 'undefined' ? undefined$1 : SharedArrayBuffer, + '%SharedArrayBufferPrototype%': typeof SharedArrayBuffer === 'undefined' ? undefined$1 : SharedArrayBuffer.prototype, + '%String%': String, + '%StringIteratorPrototype%': hasSymbols$2 ? getProto(''[Symbol.iterator]()) : undefined$1, + '%StringPrototype%': String.prototype, + '%Symbol%': hasSymbols$2 ? Symbol : undefined$1, + '%SymbolPrototype%': hasSymbols$2 ? Symbol.prototype : undefined$1, + '%SyntaxError%': SyntaxError, + '%SyntaxErrorPrototype%': SyntaxError.prototype, + '%ThrowTypeError%': ThrowTypeError, + '%TypedArray%': TypedArray, + '%TypedArrayPrototype%': TypedArray ? TypedArray.prototype : undefined$1, + '%TypeError%': $TypeError, + '%TypeErrorPrototype%': $TypeError.prototype, + '%Uint8Array%': typeof Uint8Array === 'undefined' ? undefined$1 : Uint8Array, + '%Uint8ArrayPrototype%': typeof Uint8Array === 'undefined' ? undefined$1 : Uint8Array.prototype, + '%Uint8ClampedArray%': typeof Uint8ClampedArray === 'undefined' ? undefined$1 : Uint8ClampedArray, + '%Uint8ClampedArrayPrototype%': typeof Uint8ClampedArray === 'undefined' ? undefined$1 : Uint8ClampedArray.prototype, + '%Uint16Array%': typeof Uint16Array === 'undefined' ? undefined$1 : Uint16Array, + '%Uint16ArrayPrototype%': typeof Uint16Array === 'undefined' ? undefined$1 : Uint16Array.prototype, + '%Uint32Array%': typeof Uint32Array === 'undefined' ? undefined$1 : Uint32Array, + '%Uint32ArrayPrototype%': typeof Uint32Array === 'undefined' ? undefined$1 : Uint32Array.prototype, + '%URIError%': URIError, + '%URIErrorPrototype%': URIError.prototype, + '%WeakMap%': typeof WeakMap === 'undefined' ? undefined$1 : WeakMap, + '%WeakMapPrototype%': typeof WeakMap === 'undefined' ? undefined$1 : WeakMap.prototype, + '%WeakSet%': typeof WeakSet === 'undefined' ? undefined$1 : WeakSet, + '%WeakSetPrototype%': typeof WeakSet === 'undefined' ? undefined$1 : WeakSet.prototype + }; + + + var $replace = functionBind.call(Function.call, String.prototype.replace); + + /* adapted from https://github.com/lodash/lodash/blob/4.17.15/dist/lodash.js#L6735-L6744 */ + var rePropName = /[^%.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|%$))/g; + var reEscapeChar = /\\(\\)?/g; /** Used to match backslashes in property paths. */ + var stringToPath = function stringToPath(string) { + var result = []; + $replace(string, rePropName, function (match, number, quote, subString) { + result[result.length] = quote ? $replace(subString, reEscapeChar, '$1') : (number || match); + }); + return result; + }; + /* end adaptation */ + + var getBaseIntrinsic = function getBaseIntrinsic(name, allowMissing) { + if (!(name in INTRINSICS)) { + throw new SyntaxError('intrinsic ' + name + ' does not exist!'); + } + + // istanbul ignore if // hopefully this is impossible to test :-) + if (typeof INTRINSICS[name] === 'undefined' && !allowMissing) { + throw new $TypeError('intrinsic ' + name + ' exists, but is not available. Please file an issue!'); + } + + return INTRINSICS[name]; + }; + + var GetIntrinsic = function GetIntrinsic(name, allowMissing) { + if (typeof name !== 'string' || name.length === 0) { + throw new TypeError('intrinsic name must be a non-empty string'); + } + if (arguments.length > 1 && typeof allowMissing !== 'boolean') { + throw new TypeError('"allowMissing" argument must be a boolean'); + } + + var parts = stringToPath(name); + + var value = getBaseIntrinsic('%' + (parts.length > 0 ? parts[0] : '') + '%', allowMissing); + for (var i = 1; i < parts.length; i += 1) { + if (value != null) { + if ($gOPD && (i + 1) >= parts.length) { + var desc = $gOPD(value, parts[i]); + if (!allowMissing && !(parts[i] in value)) { + throw new $TypeError('base intrinsic for ' + name + ' exists, but the property is not available.'); + } + value = desc ? (desc.get || desc.value) : value[parts[i]]; + } else { + value = value[parts[i]]; + } + } + } + return value; + }; + + var $Function = GetIntrinsic('%Function%'); + var $apply = $Function.apply; + var $call = $Function.call; + + var callBind = function callBind() { + return functionBind.apply($call, arguments); + }; + + var apply = function applyBind() { + return functionBind.apply($apply, arguments); + }; + callBind.apply = apply; + + var $Object = Object; + var $TypeError$1 = TypeError; + + var implementation$2 = function flags() { + if (this != null && this !== $Object(this)) { + throw new $TypeError$1('RegExp.prototype.flags getter called on non-object'); + } + var result = ''; + if (this.global) { + result += 'g'; + } + if (this.ignoreCase) { + result += 'i'; + } + if (this.multiline) { + result += 'm'; + } + if (this.dotAll) { + result += 's'; + } + if (this.unicode) { + result += 'u'; + } + if (this.sticky) { + result += 'y'; + } + return result; + }; + + var supportsDescriptors$1 = defineProperties_1.supportsDescriptors; + var $gOPD$1 = Object.getOwnPropertyDescriptor; + var $TypeError$2 = TypeError; + + var polyfill = function getPolyfill() { + if (!supportsDescriptors$1) { + throw new $TypeError$2('RegExp.prototype.flags requires a true ES5 environment that supports property descriptors'); + } + if ((/a/mig).flags === 'gim') { + var descriptor = $gOPD$1(RegExp.prototype, 'flags'); + if (descriptor && typeof descriptor.get === 'function' && typeof (/a/).dotAll === 'boolean') { + return descriptor.get; + } + } + return implementation$2; + }; + + var supportsDescriptors$2 = defineProperties_1.supportsDescriptors; + + var gOPD$1 = Object.getOwnPropertyDescriptor; + var defineProperty$1 = Object.defineProperty; + var TypeErr = TypeError; + var getProto$1 = Object.getPrototypeOf; + var regex = /a/; + + var shim = function shimFlags() { + if (!supportsDescriptors$2 || !getProto$1) { + throw new TypeErr('RegExp.prototype.flags requires a true ES5 environment that supports property descriptors'); + } + var polyfill$1 = polyfill(); + var proto = getProto$1(regex); + var descriptor = gOPD$1(proto, 'flags'); + if (!descriptor || descriptor.get !== polyfill$1) { + defineProperty$1(proto, 'flags', { + configurable: true, + enumerable: false, + get: polyfill$1 + }); + } + return polyfill$1; + }; + + var flagsBound = callBind(implementation$2); + + defineProperties_1(flagsBound, { + getPolyfill: polyfill, + implementation: implementation$2, + shim: shim + }); + + var regexp_prototype_flags = flagsBound; + + var toString = {}.toString; + + var isarray = Array.isArray || function (arr) { + return toString.call(arr) == '[object Array]'; + }; + + var getDay = Date.prototype.getDay; + var tryDateObject = function tryDateObject(value) { + try { + getDay.call(value); + return true; + } catch (e) { + return false; + } + }; + + var toStr$6 = Object.prototype.toString; + var dateClass = '[object Date]'; + var hasToStringTag$2 = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol'; + + var isDateObject = function isDateObject(value) { + if (typeof value !== 'object' || value === null) { return false; } + return hasToStringTag$2 ? tryDateObject(value) : toStr$6.call(value) === dateClass; + }; + + var strValue = String.prototype.valueOf; + var tryStringObject = function tryStringObject(value) { + try { + strValue.call(value); + return true; + } catch (e) { + return false; + } + }; + var toStr$7 = Object.prototype.toString; + var strClass = '[object String]'; + var hasToStringTag$3 = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol'; + + var isString = function isString(value) { + if (typeof value === 'string') { + return true; + } + if (typeof value !== 'object') { + return false; + } + return hasToStringTag$3 ? tryStringObject(value) : toStr$7.call(value) === strClass; + }; + + var numToStr = Number.prototype.toString; + var tryNumberObject = function tryNumberObject(value) { + try { + numToStr.call(value); + return true; + } catch (e) { + return false; + } + }; + var toStr$8 = Object.prototype.toString; + var numClass = '[object Number]'; + var hasToStringTag$4 = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol'; + + var isNumberObject = function isNumberObject(value) { + if (typeof value === 'number') { + return true; + } + if (typeof value !== 'object') { + return false; + } + return hasToStringTag$4 ? tryNumberObject(value) : toStr$8.call(value) === numClass; + }; + + var boolToStr = Boolean.prototype.toString; + + var tryBooleanObject = function booleanBrandCheck(value) { + try { + boolToStr.call(value); + return true; + } catch (e) { + return false; + } + }; + var toStr$9 = Object.prototype.toString; + var boolClass = '[object Boolean]'; + var hasToStringTag$5 = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol'; + + var isBooleanObject = function isBoolean(value) { + if (typeof value === 'boolean') { + return true; + } + if (value === null || typeof value !== 'object') { + return false; + } + return hasToStringTag$5 && Symbol.toStringTag in value ? tryBooleanObject(value) : toStr$9.call(value) === boolClass; + }; + + /* eslint complexity: [2, 17], max-statements: [2, 33] */ + var shams$1 = function hasSymbols() { + if (typeof Symbol !== 'function' || typeof Object.getOwnPropertySymbols !== 'function') { return false; } + if (typeof Symbol.iterator === 'symbol') { return true; } + + var obj = {}; + var sym = Symbol('test'); + var symObj = Object(sym); + if (typeof sym === 'string') { return false; } + + if (Object.prototype.toString.call(sym) !== '[object Symbol]') { return false; } + if (Object.prototype.toString.call(symObj) !== '[object Symbol]') { return false; } + + // temp disabled per https://github.com/ljharb/object.assign/issues/17 + // if (sym instanceof Symbol) { return false; } + // temp disabled per https://github.com/WebReflection/get-own-property-symbols/issues/4 + // if (!(symObj instanceof Symbol)) { return false; } + + // if (typeof Symbol.prototype.toString !== 'function') { return false; } + // if (String(sym) !== Symbol.prototype.toString.call(sym)) { return false; } + + var symVal = 42; + obj[sym] = symVal; + for (sym in obj) { return false; } // eslint-disable-line no-restricted-syntax + if (typeof Object.keys === 'function' && Object.keys(obj).length !== 0) { return false; } + + if (typeof Object.getOwnPropertyNames === 'function' && Object.getOwnPropertyNames(obj).length !== 0) { return false; } + + var syms = Object.getOwnPropertySymbols(obj); + if (syms.length !== 1 || syms[0] !== sym) { return false; } + + if (!Object.prototype.propertyIsEnumerable.call(obj, sym)) { return false; } + + if (typeof Object.getOwnPropertyDescriptor === 'function') { + var descriptor = Object.getOwnPropertyDescriptor(obj, sym); + if (descriptor.value !== symVal || descriptor.enumerable !== true) { return false; } + } + + return true; + }; + + var origSymbol$1 = commonjsGlobal.Symbol; + + + var hasSymbols$3 = function hasNativeSymbols() { + if (typeof origSymbol$1 !== 'function') { return false; } + if (typeof Symbol !== 'function') { return false; } + if (typeof origSymbol$1('foo') !== 'symbol') { return false; } + if (typeof Symbol('bar') !== 'symbol') { return false; } + + return shams$1(); + }; + + var isSymbol = createCommonjsModule(function (module) { + + var toStr = Object.prototype.toString; + var hasSymbols = hasSymbols$3(); + + if (hasSymbols) { + var symToStr = Symbol.prototype.toString; + var symStringRegex = /^Symbol\(.*\)$/; + var isSymbolObject = function isRealSymbolObject(value) { + if (typeof value.valueOf() !== 'symbol') { + return false; + } + return symStringRegex.test(symToStr.call(value)); + }; + + module.exports = function isSymbol(value) { + if (typeof value === 'symbol') { + return true; + } + if (toStr.call(value) !== '[object Symbol]') { + return false; + } + try { + return isSymbolObject(value); + } catch (e) { + return false; + } + }; + } else { + + module.exports = function isSymbol(value) { + // this environment does not support Symbols. + return false ; + }; + } + }); + + var isBigint = createCommonjsModule(function (module) { + + if (typeof BigInt === 'function') { + var bigIntValueOf = BigInt.prototype.valueOf; + var tryBigInt = function tryBigIntObject(value) { + try { + bigIntValueOf.call(value); + return true; + } catch (e) { + } + return false; + }; + + module.exports = function isBigInt(value) { + if ( + value === null + || typeof value === 'undefined' + || typeof value === 'boolean' + || typeof value === 'string' + || typeof value === 'number' + || typeof value === 'symbol' + || typeof value === 'function' + ) { + return false; + } + if (typeof value === 'bigint') { // eslint-disable-line valid-typeof + return true; + } + + return tryBigInt(value); + }; + } else { + module.exports = function isBigInt(value) { + return false ; + }; + } + }); + + // eslint-disable-next-line consistent-return + var whichBoxedPrimitive = function whichBoxedPrimitive(value) { + // eslint-disable-next-line eqeqeq + if (value == null || (typeof value !== 'object' && typeof value !== 'function')) { + return null; + } + if (isString(value)) { + return 'String'; + } + if (isNumberObject(value)) { + return 'Number'; + } + if (isBooleanObject(value)) { + return 'Boolean'; + } + if (isSymbol(value)) { + return 'Symbol'; + } + if (isBigint(value)) { + return 'BigInt'; + } + }; + + var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf')); + + var callBound = function callBoundIntrinsic(name, allowMissing) { + var intrinsic = GetIntrinsic(name, !!allowMissing); + if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.')) { + return callBind(intrinsic); + } + return intrinsic; + }; + + var $Map = typeof Map === 'function' && Map.prototype ? Map : null; + var $Set = typeof Set === 'function' && Set.prototype ? Set : null; + + var exported; + + if (!$Map) { + // eslint-disable-next-line no-unused-vars + exported = function isMap(x) { + // `Map` is not present in this environment. + return false; + }; + } + + var $mapHas = $Map ? Map.prototype.has : null; + var $setHas = $Set ? Set.prototype.has : null; + if (!exported && !$mapHas) { + // eslint-disable-next-line no-unused-vars + exported = function isMap(x) { + // `Map` does not have a `has` method + return false; + }; + } + + var isMap = exported || function isMap(x) { + if (!x || typeof x !== 'object') { + return false; + } + try { + $mapHas.call(x); + if ($setHas) { + try { + $setHas.call(x); + } catch (e) { + return true; + } + } + return x instanceof $Map; // core-js workaround, pre-v2.5.0 + } catch (e) {} + return false; + }; + + var $Map$1 = typeof Map === 'function' && Map.prototype ? Map : null; + var $Set$1 = typeof Set === 'function' && Set.prototype ? Set : null; + + var exported$1; + + if (!$Set$1) { + // eslint-disable-next-line no-unused-vars + exported$1 = function isSet(x) { + // `Set` is not present in this environment. + return false; + }; + } + + var $mapHas$1 = $Map$1 ? Map.prototype.has : null; + var $setHas$1 = $Set$1 ? Set.prototype.has : null; + if (!exported$1 && !$setHas$1) { + // eslint-disable-next-line no-unused-vars + exported$1 = function isSet(x) { + // `Set` does not have a `has` method + return false; + }; + } + + var isSet = exported$1 || function isSet(x) { + if (!x || typeof x !== 'object') { + return false; + } + try { + $setHas$1.call(x); + if ($mapHas$1) { + try { + $mapHas$1.call(x); + } catch (e) { + return true; + } + } + return x instanceof $Set$1; // core-js workaround, pre-v2.5.0 + } catch (e) {} + return false; + }; + + var $WeakMap = typeof WeakMap === 'function' && WeakMap.prototype ? WeakMap : null; + var $WeakSet = typeof WeakSet === 'function' && WeakSet.prototype ? WeakSet : null; + + var exported$2; + + if (!$WeakMap) { + // eslint-disable-next-line no-unused-vars + exported$2 = function isWeakMap(x) { + // `WeakMap` is not present in this environment. + return false; + }; + } + + var $mapHas$2 = $WeakMap ? $WeakMap.prototype.has : null; + var $setHas$2 = $WeakSet ? $WeakSet.prototype.has : null; + if (!exported$2 && !$mapHas$2) { + // eslint-disable-next-line no-unused-vars + exported$2 = function isWeakMap(x) { + // `WeakMap` does not have a `has` method + return false; + }; + } + + var isWeakmap = exported$2 || function isWeakMap(x) { + if (!x || typeof x !== 'object') { + return false; + } + try { + $mapHas$2.call(x, $mapHas$2); + if ($setHas$2) { + try { + $setHas$2.call(x, $setHas$2); + } catch (e) { + return true; + } + } + return x instanceof $WeakMap; // core-js workaround, pre-v3 + } catch (e) {} + return false; + }; + + var isWeakset = createCommonjsModule(function (module) { + + var $WeakMap = typeof WeakMap === 'function' && WeakMap.prototype ? WeakMap : null; + var $WeakSet = typeof WeakSet === 'function' && WeakSet.prototype ? WeakSet : null; + + var exported; + + if (!$WeakMap) { + // eslint-disable-next-line no-unused-vars + exported = function isWeakSet(x) { + // `WeakSet` is not present in this environment. + return false; + }; + } + + var $mapHas = $WeakMap ? $WeakMap.prototype.has : null; + var $setHas = $WeakSet ? $WeakSet.prototype.has : null; + if (!exported && !$setHas) { + // eslint-disable-next-line no-unused-vars + module.exports = function isWeakSet(x) { + // `WeakSet` does not have a `has` method + return false; + }; + } + + module.exports = exported || function isWeakSet(x) { + if (!x || typeof x !== 'object') { + return false; + } + try { + $setHas.call(x, $setHas); + if ($mapHas) { + try { + $mapHas.call(x, $mapHas); + } catch (e) { + return true; + } + } + return x instanceof $WeakSet; // core-js workaround, pre-v3 + } catch (e) {} + return false; + }; + }); + + var whichCollection = function whichCollection(value) { + if (value && typeof value === 'object') { + if (isMap(value)) { + return 'Map'; + } + if (isSet(value)) { + return 'Set'; + } + if (isWeakmap(value)) { + return 'WeakMap'; + } + if (isWeakset(value)) { + return 'WeakSet'; + } + } + return false; + }; + + /* eslint complexity: [2, 18], max-statements: [2, 33] */ + var shams$2 = function hasSymbols() { + if (typeof Symbol !== 'function' || typeof Object.getOwnPropertySymbols !== 'function') { return false; } + if (typeof Symbol.iterator === 'symbol') { return true; } + + var obj = {}; + var sym = Symbol('test'); + var symObj = Object(sym); + if (typeof sym === 'string') { return false; } + + if (Object.prototype.toString.call(sym) !== '[object Symbol]') { return false; } + if (Object.prototype.toString.call(symObj) !== '[object Symbol]') { return false; } + + // temp disabled per https://github.com/ljharb/object.assign/issues/17 + // if (sym instanceof Symbol) { return false; } + // temp disabled per https://github.com/WebReflection/get-own-property-symbols/issues/4 + // if (!(symObj instanceof Symbol)) { return false; } + + // if (typeof Symbol.prototype.toString !== 'function') { return false; } + // if (String(sym) !== Symbol.prototype.toString.call(sym)) { return false; } + + var symVal = 42; + obj[sym] = symVal; + for (sym in obj) { return false; } // eslint-disable-line no-restricted-syntax + if (typeof Object.keys === 'function' && Object.keys(obj).length !== 0) { return false; } + + if (typeof Object.getOwnPropertyNames === 'function' && Object.getOwnPropertyNames(obj).length !== 0) { return false; } + + var syms = Object.getOwnPropertySymbols(obj); + if (syms.length !== 1 || syms[0] !== sym) { return false; } + + if (!Object.prototype.propertyIsEnumerable.call(obj, sym)) { return false; } + + if (typeof Object.getOwnPropertyDescriptor === 'function') { + var descriptor = Object.getOwnPropertyDescriptor(obj, sym); + if (descriptor.value !== symVal || descriptor.enumerable !== true) { return false; } + } + + return true; + }; + + var origSymbol$2 = commonjsGlobal.Symbol; + + + var hasSymbols$4 = function hasNativeSymbols() { + if (typeof origSymbol$2 !== 'function') { return false; } + if (typeof Symbol !== 'function') { return false; } + if (typeof origSymbol$2('foo') !== 'symbol') { return false; } + if (typeof Symbol('bar') !== 'symbol') { return false; } + + return shams$2(); + }; + + var toString$1 = {}.toString; + + var isarray$1 = Array.isArray || function (arr) { + return toString$1.call(arr) == '[object Array]'; + }; + + var esGetIterator = createCommonjsModule(function (module) { + + /* eslint global-require: 0 */ + // the code is structured this way so that bundlers can + // alias out `has-symbols` to `() => true` or `() => false` if your target + // environments' Symbol capabilities are known, and then use + // dead code elimination on the rest of this module. + // + // Similarly, `isarray` can be aliased to `Array.isArray` if + // available in all target environments. + + + + if (hasSymbols$4() || shams$2()) { + var $iterator = Symbol.iterator; + // Symbol is available natively or shammed + // natively: + // - Chrome >= 38 + // - Edge 12-14?, Edge >= 15 for sure + // - FF >= 36 + // - Safari >= 9 + // - node >= 0.12 + module.exports = function getIterator(iterable) { + // alternatively, `iterable[$iterator]?.()` + if (iterable != null && typeof iterable[$iterator] !== 'undefined') { + return iterable[$iterator](); + } + if (isArguments$1(iterable)) { + // arguments objects lack Symbol.iterator + // - node 0.12 + return Array.prototype[$iterator].call(iterable); + } + }; + } else { + // Symbol is not available, native or shammed + var isArray = isarray$1; + var isString$1 = isString; + var GetIntrinsic$1 = GetIntrinsic; + var $Map = GetIntrinsic$1('%Map%', true); + var $Set = GetIntrinsic$1('%Set%', true); + var callBound$1 = callBound; + var $arrayPush = callBound$1('Array.prototype.push'); + var $charCodeAt = callBound$1('String.prototype.charCodeAt'); + var $stringSlice = callBound$1('String.prototype.slice'); + + var advanceStringIndex = function advanceStringIndex(S, index) { + var length = S.length; + if ((index + 1) >= length) { + return index + 1; + } + + var first = $charCodeAt(S, index); + if (first < 0xD800 || first > 0xDBFF) { + return index + 1; + } + + var second = $charCodeAt(S, index + 1); + if (second < 0xDC00 || second > 0xDFFF) { + return index + 1; + } + + return index + 2; + }; + + var getArrayIterator = function getArrayIterator(arraylike) { + var i = 0; + return { + next: function next() { + var done = i >= arraylike.length; + var value; + if (!done) { + value = arraylike[i]; + i += 1; + } + return { + done: done, + value: value + }; + } + }; + }; + + var getNonCollectionIterator = function getNonCollectionIterator(iterable) { + if (isArray(iterable) || isArguments$1(iterable)) { + return getArrayIterator(iterable); + } + if (isString$1(iterable)) { + var i = 0; + return { + next: function next() { + var nextIndex = advanceStringIndex(iterable, i); + var value = $stringSlice(iterable, i, nextIndex); + i = nextIndex; + return { + done: nextIndex > iterable.length, + value: value + }; + } + }; + } + }; + + if (!$Map && !$Set) { + // the only language iterables are Array, String, arguments + // - Safari <= 6.0 + // - Chrome < 38 + // - node < 0.12 + // - FF < 13 + // - IE < 11 + // - Edge < 11 + + module.exports = getNonCollectionIterator; + } else { + // either Map or Set are available, but Symbol is not + // - es6-shim on an ES5 browser + // - Safari 6.2 (maybe 6.1?) + // - FF v[13, 36) + // - IE 11 + // - Edge 11 + // - Safari v[6, 9) + + var isMap$1 = isMap; + var isSet$1 = isSet; + + // Firefox >= 27, IE 11, Safari 6.2 - 9, Edge 11, es6-shim in older envs, all have forEach + var $mapForEach = callBound$1('Map.prototype.forEach', true); + var $setForEach = callBound$1('Set.prototype.forEach', true); + if (typeof process === 'undefined' || !process.versions || !process.versions.node) { // "if is not node" + + // Firefox 17 - 26 has `.iterator()`, whose iterator `.next()` either + // returns a value, or throws a StopIteration object. These browsers + // do not have any other mechanism for iteration. + var $mapIterator = callBound$1('Map.prototype.iterator', true); + var $setIterator = callBound$1('Set.prototype.iterator', true); + var getStopIterationIterator = function (iterator) { + var done = false; + return { + next: function next() { + try { + return { + done: done, + value: done ? undefined : iterator.next() + }; + } catch (e) { + done = true; + return { + done: true, + value: undefined + }; + } + } + }; + }; + } + // Firefox 27-35, and some older es6-shim versions, use a string "@@iterator" property + // this returns a proper iterator object, so we should use it instead of forEach. + // newer es6-shim versions use a string "_es6-shim iterator_" property. + var $mapAtAtIterator = callBound$1('Map.prototype.@@iterator', true) || callBound$1('Map.prototype._es6-shim iterator_', true); + var $setAtAtIterator = callBound$1('Set.prototype.@@iterator', true) || callBound$1('Set.prototype._es6-shim iterator_', true); + + var getCollectionIterator = function getCollectionIterator(iterable) { + if (isMap$1(iterable)) { + if ($mapIterator) { + return getStopIterationIterator($mapIterator(iterable)); + } + if ($mapAtAtIterator) { + return $mapAtAtIterator(iterable); + } + if ($mapForEach) { + var entries = []; + $mapForEach(iterable, function (v, k) { + $arrayPush(entries, [k, v]); + }); + return getArrayIterator(entries); + } + } + if (isSet$1(iterable)) { + if ($setIterator) { + return getStopIterationIterator($setIterator(iterable)); + } + if ($setAtAtIterator) { + return $setAtAtIterator(iterable); + } + if ($setForEach) { + var values = []; + $setForEach(iterable, function (v) { + $arrayPush(values, v); + }); + return getArrayIterator(values); + } + } + }; + + module.exports = function getIterator(iterable) { + return getCollectionIterator(iterable) || getNonCollectionIterator(iterable); + }; + } + } + }); + + var _nodeResolve_empty = {}; + + var _nodeResolve_empty$1 = /*#__PURE__*/Object.freeze({ + 'default': _nodeResolve_empty + }); + + var require$$0$1 = getCjsExportFromNamespace(_nodeResolve_empty$1); + + var hasMap = typeof Map === 'function' && Map.prototype; + var mapSizeDescriptor = Object.getOwnPropertyDescriptor && hasMap ? Object.getOwnPropertyDescriptor(Map.prototype, 'size') : null; + var mapSize = hasMap && mapSizeDescriptor && typeof mapSizeDescriptor.get === 'function' ? mapSizeDescriptor.get : null; + var mapForEach = hasMap && Map.prototype.forEach; + var hasSet = typeof Set === 'function' && Set.prototype; + var setSizeDescriptor = Object.getOwnPropertyDescriptor && hasSet ? Object.getOwnPropertyDescriptor(Set.prototype, 'size') : null; + var setSize = hasSet && setSizeDescriptor && typeof setSizeDescriptor.get === 'function' ? setSizeDescriptor.get : null; + var setForEach = hasSet && Set.prototype.forEach; + var hasWeakMap = typeof WeakMap === 'function' && WeakMap.prototype; + var weakMapHas = hasWeakMap ? WeakMap.prototype.has : null; + var hasWeakSet = typeof WeakSet === 'function' && WeakSet.prototype; + var weakSetHas = hasWeakSet ? WeakSet.prototype.has : null; + var booleanValueOf = Boolean.prototype.valueOf; + var objectToString = Object.prototype.toString; + var match = String.prototype.match; + var bigIntValueOf = typeof BigInt === 'function' ? BigInt.prototype.valueOf : null; + + var inspectCustom = require$$0$1.custom; + var inspectSymbol = inspectCustom && isSymbol$1(inspectCustom) ? inspectCustom : null; + + var objectInspect = function inspect_(obj, options, depth, seen) { + var opts = options || {}; + + if (has$2(opts, 'quoteStyle') && (opts.quoteStyle !== 'single' && opts.quoteStyle !== 'double')) { + throw new TypeError('option "quoteStyle" must be "single" or "double"'); + } + + if (typeof obj === 'undefined') { + return 'undefined'; + } + if (obj === null) { + return 'null'; + } + if (typeof obj === 'boolean') { + return obj ? 'true' : 'false'; + } + + if (typeof obj === 'string') { + return inspectString(obj, opts); + } + if (typeof obj === 'number') { + if (obj === 0) { + return Infinity / obj > 0 ? '0' : '-0'; + } + return String(obj); + } + if (typeof obj === 'bigint') { // eslint-disable-line valid-typeof + return String(obj) + 'n'; + } + + var maxDepth = typeof opts.depth === 'undefined' ? 5 : opts.depth; + if (typeof depth === 'undefined') { depth = 0; } + if (depth >= maxDepth && maxDepth > 0 && typeof obj === 'object') { + return '[Object]'; + } + + if (typeof seen === 'undefined') { + seen = []; + } else if (indexOf(seen, obj) >= 0) { + return '[Circular]'; + } + + function inspect(value, from) { + if (from) { + seen = seen.slice(); + seen.push(from); + } + return inspect_(value, opts, depth + 1, seen); + } + + if (typeof obj === 'function') { + var name = nameOf(obj); + return '[Function' + (name ? ': ' + name : '') + ']'; + } + if (isSymbol$1(obj)) { + var symString = Symbol.prototype.toString.call(obj); + return typeof obj === 'object' ? markBoxed(symString) : symString; + } + if (isElement(obj)) { + var s = '<' + String(obj.nodeName).toLowerCase(); + var attrs = obj.attributes || []; + for (var i = 0; i < attrs.length; i++) { + s += ' ' + attrs[i].name + '=' + wrapQuotes(quote(attrs[i].value), 'double', opts); + } + s += '>'; + if (obj.childNodes && obj.childNodes.length) { s += '...'; } + s += ''; + return s; + } + if (isArray(obj)) { + if (obj.length === 0) { return '[]'; } + return '[ ' + arrObjKeys(obj, inspect).join(', ') + ' ]'; + } + if (isError(obj)) { + var parts = arrObjKeys(obj, inspect); + if (parts.length === 0) { return '[' + String(obj) + ']'; } + return '{ [' + String(obj) + '] ' + parts.join(', ') + ' }'; + } + if (typeof obj === 'object') { + if (inspectSymbol && typeof obj[inspectSymbol] === 'function') { + return obj[inspectSymbol](); + } else if (typeof obj.inspect === 'function') { + return obj.inspect(); + } + } + if (isMap$1(obj)) { + var mapParts = []; + mapForEach.call(obj, function (value, key) { + mapParts.push(inspect(key, obj) + ' => ' + inspect(value, obj)); + }); + return collectionOf('Map', mapSize.call(obj), mapParts); + } + if (isSet$1(obj)) { + var setParts = []; + setForEach.call(obj, function (value) { + setParts.push(inspect(value, obj)); + }); + return collectionOf('Set', setSize.call(obj), setParts); + } + if (isWeakMap(obj)) { + return weakCollectionOf('WeakMap'); + } + if (isWeakSet(obj)) { + return weakCollectionOf('WeakSet'); + } + if (isNumber(obj)) { + return markBoxed(inspect(Number(obj))); + } + if (isBigInt(obj)) { + return markBoxed(inspect(bigIntValueOf.call(obj))); + } + if (isBoolean(obj)) { + return markBoxed(booleanValueOf.call(obj)); + } + if (isString$1(obj)) { + return markBoxed(inspect(String(obj))); + } + if (!isDate(obj) && !isRegExp(obj)) { + var xs = arrObjKeys(obj, inspect); + if (xs.length === 0) { return '{}'; } + return '{ ' + xs.join(', ') + ' }'; + } + return String(obj); + }; + + function wrapQuotes(s, defaultStyle, opts) { + var quoteChar = (opts.quoteStyle || defaultStyle) === 'double' ? '"' : "'"; + return quoteChar + s + quoteChar; + } + + function quote(s) { + return String(s).replace(/"/g, '"'); + } + + function isArray(obj) { return toStr$a(obj) === '[object Array]'; } + function isDate(obj) { return toStr$a(obj) === '[object Date]'; } + function isRegExp(obj) { return toStr$a(obj) === '[object RegExp]'; } + function isError(obj) { return toStr$a(obj) === '[object Error]'; } + function isSymbol$1(obj) { return toStr$a(obj) === '[object Symbol]'; } + function isString$1(obj) { return toStr$a(obj) === '[object String]'; } + function isNumber(obj) { return toStr$a(obj) === '[object Number]'; } + function isBigInt(obj) { return toStr$a(obj) === '[object BigInt]'; } + function isBoolean(obj) { return toStr$a(obj) === '[object Boolean]'; } + + var hasOwn = Object.prototype.hasOwnProperty || function (key) { return key in this; }; + function has$2(obj, key) { + return hasOwn.call(obj, key); + } + + function toStr$a(obj) { + return objectToString.call(obj); + } + + function nameOf(f) { + if (f.name) { return f.name; } + var m = match.call(f, /^function\s*([\w$]+)/); + if (m) { return m[1]; } + return null; + } + + function indexOf(xs, x) { + if (xs.indexOf) { return xs.indexOf(x); } + for (var i = 0, l = xs.length; i < l; i++) { + if (xs[i] === x) { return i; } + } + return -1; + } + + function isMap$1(x) { + if (!mapSize || !x || typeof x !== 'object') { + return false; + } + try { + mapSize.call(x); + try { + setSize.call(x); + } catch (s) { + return true; + } + return x instanceof Map; // core-js workaround, pre-v2.5.0 + } catch (e) {} + return false; + } + + function isWeakMap(x) { + if (!weakMapHas || !x || typeof x !== 'object') { + return false; + } + try { + weakMapHas.call(x, weakMapHas); + try { + weakSetHas.call(x, weakSetHas); + } catch (s) { + return true; + } + return x instanceof WeakMap; // core-js workaround, pre-v2.5.0 + } catch (e) {} + return false; + } + + function isSet$1(x) { + if (!setSize || !x || typeof x !== 'object') { + return false; + } + try { + setSize.call(x); + try { + mapSize.call(x); + } catch (m) { + return true; + } + return x instanceof Set; // core-js workaround, pre-v2.5.0 + } catch (e) {} + return false; + } + + function isWeakSet(x) { + if (!weakSetHas || !x || typeof x !== 'object') { + return false; + } + try { + weakSetHas.call(x, weakSetHas); + try { + weakMapHas.call(x, weakMapHas); + } catch (s) { + return true; + } + return x instanceof WeakSet; // core-js workaround, pre-v2.5.0 + } catch (e) {} + return false; + } + + function isElement(x) { + if (!x || typeof x !== 'object') { return false; } + if (typeof HTMLElement !== 'undefined' && x instanceof HTMLElement) { + return true; + } + return typeof x.nodeName === 'string' && typeof x.getAttribute === 'function'; + } + + function inspectString(str, opts) { + // eslint-disable-next-line no-control-regex + var s = str.replace(/(['\\])/g, '\\$1').replace(/[\x00-\x1f]/g, lowbyte); + return wrapQuotes(s, 'single', opts); + } + + function lowbyte(c) { + var n = c.charCodeAt(0); + var x = { + 8: 'b', 9: 't', 10: 'n', 12: 'f', 13: 'r' + }[n]; + if (x) { return '\\' + x; } + return '\\x' + (n < 0x10 ? '0' : '') + n.toString(16); + } + + function markBoxed(str) { + return 'Object(' + str + ')'; + } + + function weakCollectionOf(type) { + return type + ' { ? }'; + } + + function collectionOf(type, size, entries) { + return type + ' (' + size + ') {' + entries.join(', ') + '}'; + } + + function arrObjKeys(obj, inspect) { + var isArr = isArray(obj); + var xs = []; + if (isArr) { + xs.length = obj.length; + for (var i = 0; i < obj.length; i++) { + xs[i] = has$2(obj, i) ? inspect(obj[i], obj) : ''; + } + } + for (var key in obj) { // eslint-disable-line no-restricted-syntax + if (!has$2(obj, key)) { continue; } // eslint-disable-line no-restricted-syntax, no-continue + if (isArr && String(Number(key)) === key && key < obj.length) { continue; } // eslint-disable-line no-restricted-syntax, no-continue + if ((/[^\w$]/).test(key)) { + xs.push(inspect(key, obj) + ': ' + inspect(obj[key], obj)); + } else { + xs.push(key + ': ' + inspect(obj[key], obj)); + } + } + return xs; + } + + var $TypeError$3 = GetIntrinsic('%TypeError%'); + var $WeakMap$1 = GetIntrinsic('%WeakMap%', true); + var $Map$2 = GetIntrinsic('%Map%', true); + var $push = callBound('Array.prototype.push'); + + var $weakMapGet = callBound('WeakMap.prototype.get', true); + var $weakMapSet = callBound('WeakMap.prototype.set', true); + var $weakMapHas = callBound('WeakMap.prototype.has', true); + var $mapGet = callBound('Map.prototype.get', true); + var $mapSet = callBound('Map.prototype.set', true); + var $mapHas$3 = callBound('Map.prototype.has', true); + var objectGet = function (objects, key) { // eslint-disable-line consistent-return + for (var i = 0; i < objects.length; i += 1) { + if (objects[i].key === key) { + return objects[i].value; + } + } + }; + var objectSet = function (objects, key, value) { + for (var i = 0; i < objects.length; i += 1) { + if (objects[i].key === key) { + objects[i].value = value; // eslint-disable-line no-param-reassign + return; + } + } + $push(objects, { + key: key, + value: value + }); + }; + var objectHas = function (objects, key) { + for (var i = 0; i < objects.length; i += 1) { + if (objects[i].key === key) { + return true; + } + } + return false; + }; + + var sideChannel = function getSideChannel() { + var $wm; + var $m; + var $o; + var channel = { + assert: function (key) { + if (!channel.has(key)) { + throw new $TypeError$3('Side channel does not contain ' + objectInspect(key)); + } + }, + get: function (key) { // eslint-disable-line consistent-return + if ($WeakMap$1 && key && (typeof key === 'object' || typeof key === 'function')) { + if ($wm) { + return $weakMapGet($wm, key); + } + } else if ($Map$2) { + if ($m) { + return $mapGet($m, key); + } + } else { + if ($o) { // eslint-disable-line no-lonely-if + return objectGet($o, key); + } + } + }, + has: function (key) { + if ($WeakMap$1 && key && (typeof key === 'object' || typeof key === 'function')) { + if ($wm) { + return $weakMapHas($wm, key); + } + } else if ($Map$2) { + if ($m) { + return $mapHas$3($m, key); + } + } else { + if ($o) { // eslint-disable-line no-lonely-if + return objectHas($o, key); + } + } + return false; + }, + set: function (key, value) { + if ($WeakMap$1 && key && (typeof key === 'object' || typeof key === 'function')) { + if (!$wm) { + $wm = new $WeakMap$1(); + } + $weakMapSet($wm, key, value); + } else if ($Map$2) { + if (!$m) { + $m = new $Map$2(); + } + $mapSet($m, key, value); + } else { + if (!$o) { + $o = []; + } + objectSet($o, key, value); + } + } + }; + return channel; + }; + + var $getTime = callBound('Date.prototype.getTime'); + var gPO = Object.getPrototypeOf; + var $objToString = callBound('Object.prototype.toString'); + + var $Set$2 = GetIntrinsic('%Set%', true); + var $mapHas$4 = callBound('Map.prototype.has', true); + var $mapGet$1 = callBound('Map.prototype.get', true); + var $mapSize = callBound('Map.prototype.size', true); + var $setAdd = callBound('Set.prototype.add', true); + var $setDelete = callBound('Set.prototype.delete', true); + var $setHas$3 = callBound('Set.prototype.has', true); + var $setSize = callBound('Set.prototype.size', true); + + // taken from https://github.com/browserify/commonjs-assert/blob/bba838e9ba9e28edf3127ce6974624208502f6bc/internal/util/comparisons.js#L401-L414 + function setHasEqualElement(set, val1, strict, channel) { + var i = esGetIterator(set); + var result; + while ((result = i.next()) && !result.done) { + if (internalDeepEqual(val1, result.value, strict, channel)) { // eslint-disable-line no-use-before-define + // Remove the matching element to make sure we do not check that again. + $setDelete(set, result.value); + return true; + } + } + + return false; + } + + // taken from https://github.com/browserify/commonjs-assert/blob/bba838e9ba9e28edf3127ce6974624208502f6bc/internal/util/comparisons.js#L416-L439 + function findLooseMatchingPrimitives(prim) { + if (typeof prim === 'undefined') { + return null; + } + if (typeof prim === 'object') { // Only pass in null as object! + return void 0; + } + if (typeof prim === 'symbol') { + return false; + } + if (typeof prim === 'string' || typeof prim === 'number') { + // Loose equal entries exist only if the string is possible to convert to a regular number and not NaN. + return +prim === +prim; // eslint-disable-line no-implicit-coercion + } + return true; + } + + // taken from https://github.com/browserify/commonjs-assert/blob/bba838e9ba9e28edf3127ce6974624208502f6bc/internal/util/comparisons.js#L449-L460 + function mapMightHaveLoosePrim(a, b, prim, item, channel) { + var altValue = findLooseMatchingPrimitives(prim); + if (altValue != null) { + return altValue; + } + var curB = $mapGet$1(b, altValue); + // eslint-disable-next-line no-use-before-define + if ((typeof curB === 'undefined' && !$mapHas$4(b, altValue)) || !internalDeepEqual(item, curB, false, channel)) { + return false; + } + // eslint-disable-next-line no-use-before-define + return !$mapHas$4(a, altValue) && internalDeepEqual(item, curB, false, channel); + } + + // taken from https://github.com/browserify/commonjs-assert/blob/bba838e9ba9e28edf3127ce6974624208502f6bc/internal/util/comparisons.js#L441-L447 + function setMightHaveLoosePrim(a, b, prim) { + var altValue = findLooseMatchingPrimitives(prim); + if (altValue != null) { + return altValue; + } + + return $setHas$3(b, altValue) && !$setHas$3(a, altValue); + } + + // taken from https://github.com/browserify/commonjs-assert/blob/bba838e9ba9e28edf3127ce6974624208502f6bc/internal/util/comparisons.js#L518-L533 + function mapHasEqualEntry(set, map, key1, item1, strict, channel) { + var i = esGetIterator(set); + var result; + var key2; + while ((result = i.next()) && !result.done) { + key2 = result.value; + if ( + // eslint-disable-next-line no-use-before-define + internalDeepEqual(key1, key2, strict, channel) + // eslint-disable-next-line no-use-before-define + && internalDeepEqual(item1, $mapGet$1(map, key2), strict, channel) + ) { + $setDelete(set, key2); + return true; + } + } + + return false; + } + + function internalDeepEqual(actual, expected, options, channel) { + var opts = options || {}; + + // 7.1. All identical values are equivalent, as determined by ===. + if (opts.strict ? objectIs(actual, expected) : actual === expected) { + return true; + } + + var actualBoxed = whichBoxedPrimitive(actual); + var expectedBoxed = whichBoxedPrimitive(expected); + if (actualBoxed !== expectedBoxed) { + return false; + } + + // 7.3. Other pairs that do not both pass typeof value == 'object', equivalence is determined by ==. + if (!actual || !expected || (typeof actual !== 'object' && typeof expected !== 'object')) { + if ((actual === false && expected) || (actual && expected === false)) { return false; } + return opts.strict ? objectIs(actual, expected) : actual == expected; // eslint-disable-line eqeqeq + } + + /* + * 7.4. For all other Object pairs, including Array objects, equivalence is + * determined by having the same number of owned properties (as verified + * with Object.prototype.hasOwnProperty.call), the same set of keys + * (although not necessarily the same order), equivalent values for every + * corresponding key, and an identical 'prototype' property. Note: this + * accounts for both named and indexed properties on Arrays. + */ + // see https://github.com/nodejs/node/commit/d3aafd02efd3a403d646a3044adcf14e63a88d32 for memos/channel inspiration + + var hasActual = channel.has(actual); + var hasExpected = channel.has(expected); + var sentinel; + if (hasActual && hasExpected) { + if (channel.get(actual) === channel.get(expected)) { + return true; + } + } else { + sentinel = {}; + } + if (!hasActual) { channel.set(actual, sentinel); } + if (!hasExpected) { channel.set(expected, sentinel); } + + // eslint-disable-next-line no-use-before-define + return objEquiv(actual, expected, opts, channel); + } + + function isBuffer(x) { + if (!x || typeof x !== 'object' || typeof x.length !== 'number') { + return false; + } + if (typeof x.copy !== 'function' || typeof x.slice !== 'function') { + return false; + } + if (x.length > 0 && typeof x[0] !== 'number') { + return false; + } + return true; + } + + function setEquiv(a, b, opts, channel) { + if ($setSize(a) !== $setSize(b)) { + return false; + } + var iA = esGetIterator(a); + var iB = esGetIterator(b); + var resultA; + var resultB; + var set; + while ((resultA = iA.next()) && !resultA.done) { + if (resultA.value && typeof resultA.value === 'object') { + if (!set) { set = new $Set$2(); } + $setAdd(set, resultA.value); + } else if (!$setHas$3(b, resultA.value)) { + if (opts.strict) { return false; } + if (!setMightHaveLoosePrim(a, b, resultA.value)) { + return false; + } + if (!set) { set = new $Set$2(); } + $setAdd(set, resultA.value); + } + } + if (set) { + while ((resultB = iB.next()) && !resultB.done) { + // We have to check if a primitive value is already matching and only if it's not, go hunting for it. + if (resultB.value && typeof resultB.value === 'object') { + if (!setHasEqualElement(set, resultB.value, opts.strict, channel)) { + return false; + } + } else if ( + !opts.strict + && !$setHas$3(a, resultB.value) + && !setHasEqualElement(set, resultB.value, opts.strict, channel) + ) { + return false; + } + } + return $setSize(set) === 0; + } + return true; + } + + function mapEquiv(a, b, opts, channel) { + if ($mapSize(a) !== $mapSize(b)) { + return false; + } + var iA = esGetIterator(a); + var iB = esGetIterator(b); + var resultA; + var resultB; + var set; + var key; + var item1; + var item2; + while ((resultA = iA.next()) && !resultA.done) { + key = resultA.value[0]; + item1 = resultA.value[1]; + if (key && typeof key === 'object') { + if (!set) { set = new $Set$2(); } + $setAdd(set, key); + } else { + item2 = $mapGet$1(b, key); + // if (typeof curB === 'undefined' && !$mapHas(b, altValue) || !internalDeepEqual(item, curB, false, channel)) { + if ((typeof item2 === 'undefined' && !$mapHas$4(b, key)) || !internalDeepEqual(item1, item2, opts.strict, channel)) { + if (opts.strict) { + return false; + } + if (!mapMightHaveLoosePrim(a, b, key, item1, channel)) { + return false; + } + if (!set) { set = new $Set$2(); } + $setAdd(set, key); + } + } + } + + if (set) { + while ((resultB = iB.next()) && !resultB.done) { + key = resultB.value[0]; + item1 = resultB.value[1]; + if (key && typeof key === 'object') { + if (!mapHasEqualEntry(set, a, key, item1, opts.strict, channel)) { + return false; + } + } else if ( + !opts.strict + && (!a.has(key) || !internalDeepEqual($mapGet$1(a, key), item1, false, channel)) + && !mapHasEqualEntry(set, a, key, item1, false, channel) + ) { + return false; + } + } + return $setSize(set) === 0; + } + return true; + } + + function objEquiv(a, b, opts, channel) { + /* eslint max-statements: [2, 100], max-lines-per-function: [2, 120], max-depth: [2, 5] */ + var i, key; + + if (typeof a !== typeof b) { return false; } + if (a == null || b == null) { return false; } + + // an identical 'prototype' property. + if (a.prototype !== b.prototype) { return false; } + + if ($objToString(a) !== $objToString(b)) { return false; } + + if (isArguments$1(a) !== isArguments$1(b)) { return false; } + + var aIsArray = isarray(a); + var bIsArray = isarray(b); + if (aIsArray !== bIsArray) { return false; } + + // TODO: replace when a cross-realm brand check is available + var aIsError = a instanceof Error; + var bIsError = b instanceof Error; + if (aIsError !== bIsError) { return false; } + if (aIsError || bIsError) { + if (a.name !== b.name || a.message !== b.message) { return false; } + } + + var aIsRegex = isRegex(a); + var bIsRegex = isRegex(b); + if (aIsRegex !== bIsRegex) { return false; } + if ((aIsRegex || bIsRegex) && (a.source !== b.source || regexp_prototype_flags(a) !== regexp_prototype_flags(b))) { + return false; + } + + var aIsDate = isDateObject(a); + var bIsDate = isDateObject(b); + if (aIsDate !== bIsDate) { return false; } + if (aIsDate || bIsDate) { // && would work too, because both are true or both false here + if ($getTime(a) !== $getTime(b)) { return false; } + } + if (opts.strict && gPO && gPO(a) !== gPO(b)) { return false; } + + var aIsBuffer = isBuffer(a); + var bIsBuffer = isBuffer(b); + if (aIsBuffer !== bIsBuffer) { return false; } + if (aIsBuffer || bIsBuffer) { // && would work too, because both are true or both false here + if (a.length !== b.length) { return false; } + for (i = 0; i < a.length; i++) { + if (a[i] !== b[i]) { return false; } + } + return true; + } + + if (typeof a !== typeof b) { return false; } + + try { + var ka = objectKeys(a); + var kb = objectKeys(b); + } catch (e) { // happens when one is a string literal and the other isn't + return false; + } + // having the same number of owned properties (keys incorporates hasOwnProperty) + if (ka.length !== kb.length) { return false; } + + // the same set of keys (although not necessarily the same order), + ka.sort(); + kb.sort(); + // ~~~cheap key test + for (i = ka.length - 1; i >= 0; i--) { + if (ka[i] != kb[i]) { return false; } // eslint-disable-line eqeqeq + } + + // equivalent values for every corresponding key, and ~~~possibly expensive deep test + for (i = ka.length - 1; i >= 0; i--) { + key = ka[i]; + if (!internalDeepEqual(a[key], b[key], opts, channel)) { return false; } + } + + var aCollection = whichCollection(a); + var bCollection = whichCollection(b); + if (aCollection !== bCollection) { + return false; + } + if (aCollection === 'Set' || bCollection === 'Set') { // aCollection === bCollection + return setEquiv(a, b, opts, channel); + } + if (aCollection === 'Map') { // aCollection === bCollection + return mapEquiv(a, b, opts, channel); + } + + return true; + } + + var deepEqual = function deepEqual(a, b, opts) { + return internalDeepEqual(a, b, opts, sideChannel()); + }; + + const attachChildren = initialiseOpts => (htmlElement, options) => { + const { + uiFunctions, + componentLibraries, + treeNode, + onScreenSlotRendered, + setupState, + getCurrentState, + } = initialiseOpts; + + const anchor = options && options.anchor ? options.anchor : null; + const force = options ? options.force : false; + const hydrate = options ? options.hydrate : true; + + if (!force && treeNode.children.length > 0) return treeNode.children + + for (let childNode of treeNode.children) { + childNode.destroy(); + } + + if (hydrate) { + while (htmlElement.firstChild) { + htmlElement.removeChild(htmlElement.firstChild); + } + } + + htmlElement.classList.add(`lay-${treeNode.props._id}`); + + const childNodes = []; + for (let childProps of treeNode.props._children) { + const { componentName, libName } = splitName(childProps._component); + + if (!componentName || !libName) return + + const componentConstructor = componentLibraries[libName][componentName]; + + const childNodesThisIteration = prepareRenderComponent({ + props: childProps, + parentNode: treeNode, + componentConstructor, + uiFunctions, + htmlElement, + anchor, + getCurrentState, + }); + + for (let childNode of childNodesThisIteration) { + childNodes.push(childNode); + } + } + + if (areTreeNodesEqual(treeNode.children, childNodes)) return treeNode.children + + for (let node of childNodes) { + const initialProps = setupState(node); + node.render(initialProps); + } + + const screenSlot = childNodes.find(n => isScreenSlot(n.props._component)); + + if (onScreenSlotRendered && screenSlot) { + // assuming there is only ever one screen slot + onScreenSlotRendered(screenSlot); + } + + treeNode.children = childNodes; + + return childNodes + }; + + const splitName = fullname => { + const componentName = $(fullname, [fp_3("/"), fp_5]); + + const libName = fullname.substring( + 0, + fullname.length - componentName.length - 1 + ); + + return { libName, componentName } + }; + + const areTreeNodesEqual = (children1, children2) => { + if (children1.length !== children2.length) return false + if (children1 === children2) return true + + let isEqual = false; + for (let i = 0; i < children1.length; i++) { + isEqual = deepEqual(children1[i].context, children2[i].context); + if (!isEqual) return false + if (isScreenSlot(children1[i].parentNode.props._component)) { + isEqual = deepEqual(children1[i].props, children2[i].props); + } + if (!isEqual) return false + } + return true + }; + + function regexparam (str, loose) { + if (str instanceof RegExp) return { keys:false, pattern:str }; + var c, o, tmp, ext, keys=[], pattern='', arr = str.split('/'); + arr[0] || arr.shift(); + + while (tmp = arr.shift()) { + c = tmp[0]; + if (c === '*') { + keys.push('wild'); + pattern += '/(.*)'; + } else if (c === ':') { + o = tmp.indexOf('?', 1); + ext = tmp.indexOf('.', 1); + keys.push( tmp.substring(1, !!~o ? o : !!~ext ? ext : tmp.length) ); + pattern += !!~o && !~ext ? '(?:/([^/]+?))?' : '/([^/]+?)'; + if (!!~ext) pattern += (!!~o ? '?' : '') + '\\' + tmp.substring(ext); + } else { + pattern += '/' + tmp; + } + } + + return { + keys: keys, + pattern: new RegExp('^' + pattern + (loose ? '(?=$|\/)' : '\/?$'), 'i') + }; + } + + const screenRouter = (screens, onScreenSelected, appRootPath) => { + const makeRootedPath = url => { + if (appRootPath) { + if (url) return `${appRootPath}${url.startsWith("/") ? "" : "/"}${url}` + return appRootPath + } + return url + }; + + const routes = screens.map(s => makeRootedPath(s.route)); + let fallback = routes.findIndex(([p]) => p === "*"); + if (fallback < 0) fallback = 0; + + let current; + + function route(url) { + const _url = makeRootedPath(url.state || url); + current = routes.findIndex( + p => p !== "*" && new RegExp("^" + p + "$").test(_url) + ); + + const params = {}; + + if (current === -1) { + routes.forEach((p, i) => { + const pm = regexparam(p); + const matches = pm.pattern.exec(_url); + + if (!matches) return + + let j = 0; + while (j < pm.keys.length) { + params[pm.keys[j]] = matches[++j] || null; + } + + current = i; + }); + } + + const storeInitial = {}; + storeInitial["##routeParams"] = params; + const store = writable(storeInitial); + + if (current !== -1) { + onScreenSelected(screens[current], store, _url); + } else { + onScreenSelected(screens[fallback], store, _url); + } + + try { + !url.state && history.pushState(_url, null, _url); + } catch (_) { + // ignoring an exception here as the builder runs an iframe, which does not like this + } + } + + function click(e) { + const x = e.target.closest("a"); + const y = x && x.getAttribute("href"); + + if ( + e.ctrlKey || + e.metaKey || + e.altKey || + e.shiftKey || + e.button || + e.defaultPrevented + ) + return + + if (!y || x.target || x.host !== location.host) return + + e.preventDefault(); + route(y); + } + + addEventListener("popstate", route); + addEventListener("pushstate", route); + addEventListener("click", click); + + return route + }; + const BB_STATE_BINDINGPATH = "##bbstate"; const BB_STATE_BINDINGSOURCE = "##bbsource"; const BB_STATE_FALLBACK = "##bbstatefallback"; - const isBound = prop => - prop !== undefined && prop[BB_STATE_BINDINGPATH] !== undefined; + const isBound = prop => !!parseBinding(prop); - const takeStateFromStore = prop => - prop[BB_STATE_BINDINGSOURCE] === undefined || - prop[BB_STATE_BINDINGSOURCE] === "store"; + /** + * + * @param {object|string|number} prop - component property to parse for a dynamic state binding + * @returns {object|boolean} + */ + const parseBinding = prop => { + if (!prop) return false - const takeStateFromContext = prop => - prop[BB_STATE_BINDINGSOURCE] === "context"; + if (isBindingExpression(prop)) { + return parseBindingExpression(prop) + } - const takeStateFromEventParameters = prop => - prop[BB_STATE_BINDINGSOURCE] === "event"; + if (isAlreadyBinding(prop)) { + return { + path: prop.path, + source: prop.source || "store", + fallback: prop.fallback, + } + } + + if (hasBindingObject(prop)) { + return { + path: prop[BB_STATE_BINDINGPATH], + fallback: prop[BB_STATE_FALLBACK] || "", + source: prop[BB_STATE_BINDINGSOURCE] || "store", + } + } + }; + + const isStoreBinding = binding => binding && binding.source === "store"; + + const hasBindingObject = prop => + typeof prop === "object" && prop[BB_STATE_BINDINGPATH] !== undefined; + + const isAlreadyBinding = prop => typeof prop === "object" && prop.path; + + const isBindingExpression = prop => + typeof prop === "string" && + (prop.startsWith("state.") || + prop.startsWith("context.") || + prop.startsWith("event.") || + prop.startsWith("route.")); + + const parseBindingExpression = prop => { + let [source, ...rest] = prop.split("."); + let path = rest.join("."); + + if (source === "route") { + source = "state"; + path = `##routeParams.${path}`; + } + + return { + fallback: "", // TODO: provide fallback support + source, + path, + } + }; + + const setState = (store, path, value) => { + if (!path || path.length === 0) return + + const pathParts = path.split("."); + + const safeSetPath = (state, currentPartIndex = 0) => { + const currentKey = pathParts[currentPartIndex]; + + if (pathParts.length - 1 == currentPartIndex) { + state[currentKey] = value; + return + } + + if ( + state[currentKey] === null || + state[currentKey] === undefined || + !fp_8(state[currentKey]) + ) { + state[currentKey] = {}; + } + + safeSetPath(state[currentKey], currentPartIndex + 1); + }; + + store.update(state => { + safeSetPath(state); + return state + }); + }; + + const setStateFromBinding = (store, binding, value) => { + const parsedBinding = parseBinding(binding); + if (!parsedBinding) return + return setState(store, parsedBinding.path, value) + }; const getState = (s, path, fallback) => { if (!s) return fallback @@ -21715,61 +24303,21 @@ var app = (function (exports) { const getStateOrValue = (globalState, prop, currentContext) => { if (!prop) return prop - if (isBound(prop)) { - const stateToUse = takeStateFromStore(prop) ? globalState : currentContext; + const binding = parseBinding(prop); - return getState( - stateToUse, - prop[BB_STATE_BINDINGPATH], - prop[BB_STATE_FALLBACK] - ) - } + if (binding) { + const stateToUse = isStoreBinding(binding) ? globalState : currentContext; - if (prop.path && prop.source) { - const stateToUse = prop.source === "store" ? globalState : currentContext; - - return getState(stateToUse, prop.path, prop.fallback) + return getState(stateToUse, binding.path, binding.fallback) } return prop }; - const setState = (store, path, value) => { - if (!path || path.length === 0) return - - const pathParts = path.split("."); - const safeSetPath = (obj, currentPartIndex = 0) => { - const currentKey = pathParts[currentPartIndex]; - - if (pathParts.length - 1 == currentPartIndex) { - obj[currentKey] = value; - return - } - - if ( - obj[currentKey] === null || - obj[currentKey] === undefined || - !fp_8(obj[currentKey]) - ) { - obj[currentKey] = {}; - } - - safeSetPath(obj[currentKey], currentPartIndex + 1); - }; - - store.update(s => { - safeSetPath(s); - return s - }); - }; - - const setStateFromBinding = (store, binding, value) => - setState(store, binding[BB_STATE_BINDINGPATH], value); + const ERROR = "##error_message"; const trimSlash = str => str.replace(/^\/+|\/+$/g, ""); - const ERROR = "##error_message"; - const loadRecord = api => async ({ recordKey, statePath }) => { if (!recordKey) { api.error("Load Record: record key not set"); @@ -21857,7 +24405,7 @@ var app = (function (exports) { if (api.isSuccess(savedRecord)) api.setState(statePath, savedRecord); }; - const createApi = ({ rootPath, setState, getState }) => { + const createApi = ({ rootPath = "", setState, getState }) => { const apiCall = method => ({ url, body, @@ -22000,7 +24548,7 @@ var app = (function (exports) { const EVENT_TYPE_MEMBER_NAME = "##eventHandlerType"; - const eventHandlers = (store, coreApi, rootPath) => { + const eventHandlers = (store, coreApi, rootPath, routeTo) => { const handler = (parameters, execute) => ({ execute, parameters, @@ -22014,7 +24562,7 @@ var app = (function (exports) { }); const api = createApi({ - rootPath: rootPath, + rootPath, setState: setStateWithStore, getState: (path, fallback) => getState(currentState, path, fallback), }); @@ -22037,6 +24585,8 @@ var app = (function (exports) { getNewRecordToState(coreApi, setStateWithStore) ), + "Navigate To": handler(["url"], param => routeTo(param && param.url)), + Authenticate: handler(["username", "password"], api.authenticate), } }; @@ -22046,466 +24596,26 @@ var app = (function (exports) { prop.length > 0 && !fp_2(prop[0][EVENT_TYPE_MEMBER_NAME]); - const doNothing = () => {}; - doNothing.isPlaceholder = true; + const setContext = treeNode => (key, value) => + (treeNode.context[key] = value); - const isMetaProp = propName => - propName === "_component" || - propName === "_children" || - propName === "_id" || - propName === "_style"; + const getContext = treeNode => key => { + if (treeNode.context && treeNode.context[key] !== undefined) + return treeNode.context[key] - const setupBinding = (store, rootProps, coreApi, context, rootPath) => { - const rootInitialProps = { ...rootProps }; + if (!treeNode.context.$parent) return - const getBindings = (props, initialProps) => { - const boundProps = []; - const contextBoundProps = []; - const componentEventHandlers = []; - - for (let propName in props) { - if (isMetaProp(propName)) continue - - const val = props[propName]; - - if (isBound(val) && takeStateFromStore(val)) { - const binding = BindingPath(val); - const source = BindingSource(val); - const fallback = BindingFallback(val); - - boundProps.push({ - path: binding, - fallback, - propName, - source, - }); - - initialProps[propName] = fallback; - } else if (isBound(val) && takeStateFromContext(val)) { - const binding = BindingPath(val); - const fallback = BindingFallback(val); - const source = BindingSource(val); - - contextBoundProps.push({ - path: binding, - fallback, - propName, - source, - }); - - initialProps[propName] = !context - ? val - : getState(context, binding, fallback); - } else if (isEventType(val)) { - const handlers = { propName, handlers: [] }; - componentEventHandlers.push(handlers); - - for (let e of val) { - handlers.handlers.push({ - handlerType: e[EVENT_TYPE_MEMBER_NAME], - parameters: e.parameters, - }); - } - - initialProps[propName] = doNothing; - } - } - - return { - contextBoundProps, - boundProps, - componentEventHandlers, - initialProps, - } - }; - - const bind = rootBindings => component => { - if ( - rootBindings.boundProps.length === 0 && - rootBindings.componentEventHandlers.length === 0 - ) - return - - const handlerTypes = eventHandlers(store, coreApi, rootPath); - - const unsubscribe = store.subscribe(rootState => { - const getPropsFromBindings = (s, bindings) => { - const { boundProps, componentEventHandlers } = bindings; - const newProps = { ...bindings.initialProps }; - - for (let boundProp of boundProps) { - const val = getState(s, boundProp.path, boundProp.fallback); - - if (val === undefined && newProps[boundProp.propName] !== undefined) { - delete newProps[boundProp.propName]; - } - - if (val !== undefined) { - newProps[boundProp.propName] = val; - } - } - - for (let boundHandler of componentEventHandlers) { - const closuredHandlers = []; - for (let h of boundHandler.handlers) { - const handlerType = handlerTypes[h.handlerType]; - closuredHandlers.push(eventContext => { - const parameters = {}; - for (let pname in h.parameters) { - const p = h.parameters[pname]; - parameters[pname] = !isBound(p) - ? p - : takeStateFromStore(p) - ? getState(s, p[BB_STATE_BINDINGPATH], p[BB_STATE_FALLBACK]) - : takeStateFromEventParameters(p) - ? getState( - eventContext, - p[BB_STATE_BINDINGPATH], - p[BB_STATE_FALLBACK] - ) - : takeStateFromContext(p) - ? getState( - context, - p[BB_STATE_BINDINGPATH], - p[BB_STATE_FALLBACK] - ) - : p[BB_STATE_FALLBACK]; - } - handlerType.execute(parameters); - }); - } - - newProps[boundHandler.propName] = async context => { - for (let runHandler of closuredHandlers) { - await runHandler(context); - } - }; - } - - return newProps - }; - - const rootNewProps = getPropsFromBindings(rootState, rootBindings); - - component.$set(rootNewProps); - }); - - return unsubscribe - }; - - const bindings = getBindings(rootProps, rootInitialProps); - - return { - initialProps: rootInitialProps, - bind: bind(bindings), - boundProps: bindings.boundProps, - contextBoundProps: bindings.contextBoundProps, - } - }; - - const BindingPath = prop => prop[BB_STATE_BINDINGPATH]; - const BindingFallback = prop => prop[BB_STATE_FALLBACK]; - const BindingSource = prop => prop[BB_STATE_BINDINGSOURCE]; - - const renderComponent = ({ - componentConstructor, - uiFunctions, - htmlElement, - anchor, - props, - initialProps, - bb, - parentNode, - }) => { - const func = initialProps._id ? uiFunctions[initialProps._id] : undefined; - - const parentContext = (parentNode && parentNode.context) || {}; - - let renderedNodes = []; - const render = context => { - let componentContext = parentContext; - if (context) { - componentContext = { ...componentContext }; - componentContext.$parent = parentContext; - } - - const thisNode = createTreeNode(); - thisNode.context = componentContext; - thisNode.parentNode = parentNode; - thisNode.props = props; - - parentNode.children.push(thisNode); - renderedNodes.push(thisNode); - - initialProps._bb = bb(thisNode, props); - - thisNode.component = new componentConstructor({ - target: htmlElement, - props: initialProps, - hydrate: false, - anchor, - }); - - thisNode.rootElement = htmlElement.children[htmlElement.children.length - 1]; - - if (initialProps._id) { - thisNode.rootElement.classList.add(`pos-${initialProps._id}`); - } - }; - - if (func) { - func(render, parentContext); - } else { - render(); - } - - return renderedNodes - }; - - const createTreeNode = () => ({ - context: {}, - props: {}, - rootElement: null, - parentNode: null, - children: [], - component: null, - unsubscribe: () => {}, - get destroy() { - const node = this; - return () => { - if (node.unsubscribe) node.unsubscribe(); - if (node.component && node.component.$destroy) node.component.$destroy(); - if (node.children) { - for (let child of node.children) { - child.destroy(); - } - } - } - }, - }); - - const screenSlotComponent = window => { - return function(opts) { - const node = window.document.createElement("DIV"); - const $set = props => { - props._bb.hydrateChildren(props._children, node); - }; - const $destroy = () => { - if (opts.target && node) opts.target.removeChild(node); - }; - this.$set = $set; - this.$destroy = $destroy; - opts.target.appendChild(node); - } + return getContext(treeNode.parentNode)(key) }; - const builtinLibName = "##builtin"; - - const isScreenSlot = componentName => - componentName === "##builtin/screenslot"; - - const builtins = window => ({ - screenslot: screenSlotComponent(window), - }); - - const initialiseChildren = initialiseOpts => ( - childrenProps, - htmlElement, - anchor = null - ) => { - const { - uiFunctions, - bb, - coreApi, - store, - componentLibraries, - treeNode, - frontendDefinition, - hydrate, - onScreenSlotRendered, - } = initialiseOpts; - - for (let childNode of treeNode.children) { - childNode.destroy(); - } - - if (hydrate) { - while (htmlElement.firstChild) { - htmlElement.removeChild(htmlElement.firstChild); - } - } - - htmlElement.classList.add(`lay-${treeNode.props._id}`); - - const renderedComponents = []; - for (let childProps of childrenProps) { - const { componentName, libName } = splitName(childProps._component); - - if (!componentName || !libName) return - - const { initialProps, bind } = setupBinding( - store, - childProps, - coreApi, - frontendDefinition.appRootPath - ); - - const componentConstructor = componentLibraries[libName][componentName]; - - const renderedComponentsThisIteration = renderComponent({ - props: childProps, - parentNode: treeNode, - componentConstructor, - uiFunctions, - htmlElement, - anchor, - initialProps, - bb, - }); - - if ( - onScreenSlotRendered && - isScreenSlot(childProps._component) && - renderedComponentsThisIteration.length > 0 - ) { - // assuming there is only ever one screen slot - onScreenSlotRendered(renderedComponentsThisIteration[0]); - } - - for (let comp of renderedComponentsThisIteration) { - comp.unsubscribe = bind(comp.component); - renderedComponents.push(comp); - } - } - - return renderedComponents - }; - - const splitName = fullname => { - const componentName = $(fullname, [fp_3("/"), fp_5]); - - const libName = fullname.substring( - 0, - fullname.length - componentName.length - 1 - ); - - return { libName, componentName } - }; - - function regexparam (str, loose) { - if (str instanceof RegExp) return { keys:false, pattern:str }; - var c, o, tmp, ext, keys=[], pattern='', arr = str.split('/'); - arr[0] || arr.shift(); - - while (tmp = arr.shift()) { - c = tmp[0]; - if (c === '*') { - keys.push('wild'); - pattern += '/(.*)'; - } else if (c === ':') { - o = tmp.indexOf('?', 1); - ext = tmp.indexOf('.', 1); - keys.push( tmp.substring(1, !!~o ? o : !!~ext ? ext : tmp.length) ); - pattern += !!~o && !~ext ? '(?:/([^/]+?))?' : '/([^/]+?)'; - if (!!~ext) pattern += (!!~o ? '?' : '') + '\\' + tmp.substring(ext); - } else { - pattern += '/' + tmp; - } - } - - return { - keys: keys, - pattern: new RegExp('^' + pattern + (loose ? '(?=$|\/)' : '\/?$'), 'i') - }; - } - - const screenRouter = (screens, onScreenSelected) => { - const routes = screens.map(s => s.route); - let fallback = routes.findIndex(([p]) => p === "*"); - if (fallback < 0) fallback = 0; - - let current; - - function route(url) { - const _url = url.state || url; - current = routes.findIndex( - p => p !== "*" && new RegExp("^" + p + "$").test(_url) - ); - - const params = {}; - - if (current === -1) { - routes.forEach(([p], i) => { - const pm = regexparam(p); - const matches = pm.pattern.exec(_url); - - if (!matches) return - - let j = 0; - while (j < pm.keys.length) { - params[pm.keys[j]] = matches[++j] || null; - } - - current = i; - }); - } - - const storeInitial = {}; - const store = writable(storeInitial); - - if (current !== -1) { - onScreenSelected(screens[current], store, _url); - } else if (fallback) { - onScreenSelected(screens[fallback], store, _url); - } - - !url.state && history.pushState(_url, null, _url); - } - - function click(e) { - const x = e.target.closest("a"); - const y = x && x.getAttribute("href"); - - if ( - e.ctrlKey || - e.metaKey || - e.altKey || - e.shiftKey || - e.button || - e.defaultPrevented - ) - return - - if (!y || x.target || x.host !== location.host) return - - e.preventDefault(); - route(y); - } - - addEventListener("popstate", route); - addEventListener("pushstate", route); - addEventListener("click", click); - - return route - }; - - const createApp = ( - document, - componentLibraries, + const bbFactory = ({ + store, + getCurrentState, frontendDefinition, - backendDefinition, - user, + componentLibraries, uiFunctions, - screens - ) => { - const coreApi = createCoreApi(backendDefinition, user); - backendDefinition.hierarchy = coreApi.templateApi.constructHierarchy( - backendDefinition.hierarchy - ); - const pageStore = writable({ - _bbuser: user, - }); - + onScreenSlotRendered, + }) => { const relativeUrl = url => frontendDefinition.appRootPath ? frontendDefinition.appRootPath + "/" + trimSlash(url) @@ -22534,118 +24644,408 @@ var app = (function (exports) { if (isFunction(event)) event(context); }; - let routeTo; - let currentScreenStore; - let currentScreenUbsubscribe; - let currentUrl; - - const onScreenSlotRendered = screenSlotNode => { - const onScreenSelected = (screen, store, url) => { - const { getInitialiseParams, unsubscribe } = initialiseChildrenParams( - store - ); - const initialiseChildParams = getInitialiseParams(true, screenSlotNode); - initialiseChildren(initialiseChildParams)( - [screen.props], - screenSlotNode.rootElement - ); - if (currentScreenUbsubscribe) currentScreenUbsubscribe(); - currentScreenUbsubscribe = unsubscribe; - currentScreenStore = store; - currentUrl = url; - }; - - routeTo = screenRouter(screens, onScreenSelected); - routeTo(currentUrl || window.location.pathname); - }; - - const initialiseChildrenParams = store => { - let currentState = null; - const unsubscribe = store.subscribe(s => { - currentState = s; - }); - - const getInitialiseParams = (hydrate, treeNode) => ({ - bb: getBbClientApi, - coreApi, - store, - document, + return (treeNode, setupState) => { + const attachParams = { componentLibraries, - frontendDefinition, - hydrate, uiFunctions, treeNode, onScreenSlotRendered, + setupState, + getCurrentState, + }; + + return { + attachChildren: attachChildren(attachParams), + context: treeNode.context, + props: treeNode.props, + call: safeCallEvent, + setStateFromBinding: (binding, value) => + setStateFromBinding(store, binding, value), + setState: (path, value) => setState(store, path, value), + getStateOrValue: (prop, currentContext) => + getStateOrValue(getCurrentState(), prop, currentContext), + getContext: getContext(treeNode), + setContext: setContext(treeNode), + store: store, + relativeUrl, + api, + isBound, + parent, + } + } + }; + + const doNothing = () => {}; + doNothing.isPlaceholder = true; + + const isMetaProp = propName => + propName === "_component" || + propName === "_children" || + propName === "_id" || + propName === "_style" || + propName === "_code" || + propName === "_codeMeta"; + + const createStateManager = ({ + store, + coreApi, + appRootPath, + frontendDefinition, + componentLibraries, + uiFunctions, + onScreenSlotRendered, + routeTo, + }) => { + let handlerTypes = eventHandlers(store, coreApi, appRootPath, routeTo); + let currentState; + + // any nodes that have props that are bound to the store + let nodesBoundByProps = []; + + // any node whose children depend on code, that uses the store + let nodesWithCodeBoundChildren = []; + + const getCurrentState = () => currentState; + const registerBindings = _registerBindings( + nodesBoundByProps, + nodesWithCodeBoundChildren + ); + const bb = bbFactory({ + store, + getCurrentState, + frontendDefinition, + componentLibraries, + uiFunctions, + onScreenSlotRendered, + }); + + const setup = _setup(handlerTypes, getCurrentState, registerBindings, bb); + + const unsubscribe = store.subscribe( + onStoreStateUpdated({ + setCurrentState: s => (currentState = s), + getCurrentState, + nodesWithCodeBoundChildren, + nodesBoundByProps, + uiFunctions, + componentLibraries, + onScreenSlotRendered, + setupState: setup, + }) + ); + + return { + setup, + destroy: () => unsubscribe(), + getCurrentState, + store, + } + }; + + const onStoreStateUpdated = ({ + setCurrentState, + getCurrentState, + nodesWithCodeBoundChildren, + nodesBoundByProps, + uiFunctions, + componentLibraries, + onScreenSlotRendered, + setupState, + }) => s => { + setCurrentState(s); + + // the original array gets changed by components' destroy() + // so we make a clone and check if they are still in the original + const nodesWithBoundChildren_clone = [...nodesWithCodeBoundChildren]; + for (let node of nodesWithBoundChildren_clone) { + if (!nodesWithCodeBoundChildren.includes(node)) continue + attachChildren({ + uiFunctions, + componentLibraries, + treeNode: node, + onScreenSlotRendered, + setupState, + getCurrentState, + })(node.rootElement, { hydrate: true, force: true }); + } + + for (let node of nodesBoundByProps) { + setNodeState(s, node); + } + }; + + const _registerBindings = (nodesBoundByProps, nodesWithCodeBoundChildren) => ( + node, + bindings + ) => { + if (bindings.length > 0) { + node.bindings = bindings; + nodesBoundByProps.push(node); + const onDestroy = () => { + nodesBoundByProps = nodesBoundByProps.filter(n => n === node); + node.onDestroy = node.onDestroy.filter(d => d === onDestroy); + }; + node.onDestroy.push(onDestroy); + } + if ( + node.props._children && + node.props._children.filter(c => c._codeMeta && c._codeMeta.dependsOnStore) + .length > 0 + ) { + nodesWithCodeBoundChildren.push(node); + const onDestroy = () => { + nodesWithCodeBoundChildren = nodesWithCodeBoundChildren.filter( + n => n === node + ); + node.onDestroy = node.onDestroy.filter(d => d === onDestroy); + }; + node.onDestroy.push(onDestroy); + } + }; + + const setNodeState = (storeState, node) => { + if (!node.component) return + const newProps = { ...node.bindings.initialProps }; + + for (let binding of node.bindings) { + const val = getState(storeState, binding.path, binding.fallback); + + if (val === undefined && newProps[binding.propName] !== undefined) { + delete newProps[binding.propName]; + } + + if (val !== undefined) { + newProps[binding.propName] = val; + } + } + + node.component.$set(newProps); + }; + + const _setup = ( + handlerTypes, + getCurrentState, + registerBindings, + bb + ) => node => { + const props = node.props; + const context = node.context || {}; + const initialProps = { ...props }; + const storeBoundProps = []; + const currentStoreState = getCurrentState(); + + for (let propName in props) { + if (isMetaProp(propName)) continue + + const propValue = props[propName]; + + const binding = parseBinding(propValue); + const isBound = !!binding; + + if (isBound) binding.propName = propName; + + if (isBound && binding.source === "state") { + storeBoundProps.push(binding); + + initialProps[propName] = !currentStoreState + ? binding.fallback + : getState( + currentStoreState, + binding.path, + binding.fallback, + binding.source + ); + } + + if (isBound && binding.source === "context") { + initialProps[propName] = !context + ? propValue + : getState(context, binding.path, binding.fallback, binding.source); + } + + if (isEventType(propValue)) { + const handlersInfos = []; + for (let event of propValue) { + const handlerInfo = { + handlerType: event[EVENT_TYPE_MEMBER_NAME], + parameters: event.parameters, + }; + const resolvedParams = {}; + for (let paramName in handlerInfo.parameters) { + const paramValue = handlerInfo.parameters[paramName]; + const paramBinding = parseBinding(paramValue); + if (!paramBinding) { + resolvedParams[paramName] = () => paramValue; + continue + } + + let paramValueSource; + + if (paramBinding.source === "context") paramValueSource = context; + if (paramBinding.source === "state") + paramValueSource = getCurrentState(); + if (paramBinding.source === "context") paramValueSource = context; + + // The new dynamic event parameter bound to the relevant source + resolvedParams[paramName] = () => + getState(paramValueSource, paramBinding.path, paramBinding.fallback); + } + + handlerInfo.parameters = resolvedParams; + handlersInfos.push(handlerInfo); + } + + if (handlersInfos.length === 0) initialProps[propName] = doNothing; + else { + initialProps[propName] = async context => { + for (let handlerInfo of handlersInfos) { + const handler = makeHandler(handlerTypes, handlerInfo); + await handler(context); + } + }; + } + } + } + + registerBindings(node, storeBoundProps); + + const setup = _setup(handlerTypes, getCurrentState, registerBindings, bb); + initialProps._bb = bb(node, setup); + + return initialProps + }; + + const makeHandler = (handlerTypes, handlerInfo) => { + const handlerType = handlerTypes[handlerInfo.handlerType]; + return async context => { + const parameters = {}; + for (let paramName in handlerInfo.parameters) { + parameters[paramName] = handlerInfo.parameters[paramName](context); + } + await handlerType.execute(parameters); + } + }; + + const createApp = ( + componentLibraries, + frontendDefinition, + backendDefinition, + user, + uiFunctions, + window + ) => { + const coreApi = createCoreApi(backendDefinition, user); + backendDefinition.hierarchy = coreApi.templateApi.constructHierarchy( + backendDefinition.hierarchy + ); + + let routeTo; + let currentUrl; + let screenStateManager; + + const onScreenSlotRendered = screenSlotNode => { + const onScreenSelected = (screen, store, url) => { + const stateManager = createStateManager({ + store, + coreApi, + frontendDefinition, + componentLibraries, + uiFunctions, + onScreenSlotRendered: () => {}, + routeTo, + appRootPath: frontendDefinition.appRootPath, + }); + const getAttchChildrenParams = attachChildrenParams(stateManager); + screenSlotNode.props._children = [screen.props]; + const initialiseChildParams = getAttchChildrenParams(screenSlotNode); + attachChildren(initialiseChildParams)(screenSlotNode.rootElement, { + hydrate: true, + force: true, + }); + if (screenStateManager) screenStateManager.destroy(); + screenStateManager = stateManager; + currentUrl = url; + }; + + routeTo = screenRouter( + frontendDefinition.screens, + onScreenSelected, + frontendDefinition.appRootPath + ); + const fallbackPath = window.location.pathname.replace( + frontendDefinition.appRootPath, + "" + ); + routeTo(currentUrl || fallbackPath); + }; + + const attachChildrenParams = stateManager => { + const getInitialiseParams = treeNode => ({ + componentLibraries, + uiFunctions, + treeNode, + onScreenSlotRendered, + setupState: stateManager.setup, + getCurrentState: stateManager.getCurrentState, }); - const getBbClientApi = (treeNode, componentProps) => { - return { - hydrateChildren: initialiseChildren( - getInitialiseParams(true, treeNode) - ), - appendChildren: initialiseChildren( - getInitialiseParams(false, treeNode) - ), - insertChildren: (props, htmlElement, anchor) => - initialiseChildren(getInitialiseParams(false, treeNode))( - props, - htmlElement, - anchor - ), - context: treeNode.context, - props: componentProps, - call: safeCallEvent, - setStateFromBinding: (binding, value) => - setStateFromBinding(store, binding, value), - setState: (path, value) => setState(store, path, value), - getStateOrValue: (prop, currentContext) => - getStateOrValue(currentState, prop, currentContext), - store, - relativeUrl, - api, - isBound, - parent, - } - }; - return { getInitialiseParams, unsubscribe } + return getInitialiseParams }; let rootTreeNode; + const pageStateManager = createStateManager({ + store: writable({ _bbuser: user }), + coreApi, + frontendDefinition, + componentLibraries, + uiFunctions, + onScreenSlotRendered, + appRootPath: frontendDefinition.appRootPath, + // seems weird, but the routeTo variable may not be available at this point + routeTo: url => routeTo(url), + }); const initialisePage = (page, target, urlPath) => { currentUrl = urlPath; rootTreeNode = createTreeNode(); - const { getInitialiseParams } = initialiseChildrenParams(pageStore); - const initChildParams = getInitialiseParams(true, rootTreeNode); + rootTreeNode.props = { + _children: [page.props], + }; + rootTreeNode.rootElement = target; + const getInitialiseParams = attachChildrenParams(pageStateManager); + const initChildParams = getInitialiseParams(rootTreeNode); - initialiseChildren(initChildParams)([page.props], target); + attachChildren(initChildParams)(target, { + hydrate: true, + force: true, + }); return rootTreeNode }; return { initialisePage, - screenStore: () => currentScreenStore, - pageStore: () => pageStore, + screenStore: () => screenStateManager.store, + pageStore: () => pageStateManager.store, routeTo: () => routeTo, rootNode: () => rootTreeNode, } }; - const loadBudibase = async ({ - componentLibraries, - page, - screens, - window, - localStorage, - uiFunctions, - }) => { - const backendDefinition = window["##BUDIBASE_BACKEND_DEFINITION##"]; - const frontendDefinition = window["##BUDIBASE_FRONTEND_DEFINITION##"]; - const uiFunctionsFromWindow = window["##BUDIBASE_FRONTEND_FUNCTIONS##"]; - uiFunctions = uiFunctionsFromWindow || uiFunctions; + /** + * create a web application from static budibase definition files. + * @param {object} opts - configuration options for budibase client libary + */ + const loadBudibase = async opts => { + let componentLibraries = opts && opts.componentLibraries; + const _window = (opts && opts.window) || window; + const _localStorage = (opts && opts.localStorage) || localStorage; - const userFromStorage = localStorage.getItem("budibase:user"); + const backendDefinition = _window["##BUDIBASE_BACKEND_DEFINITION##"]; + const frontendDefinition = _window["##BUDIBASE_FRONTEND_DEFINITION##"]; + const uiFunctions = _window["##BUDIBASE_FRONTEND_FUNCTIONS##"]; + + const userFromStorage = _localStorage.getItem("budibase:user"); const user = userFromStorage ? JSON.parse(userFromStorage) @@ -22656,14 +25056,14 @@ var app = (function (exports) { temp: false, }; - const rootPath = + frontendDefinition.appRootPath = frontendDefinition.appRootPath === "" ? "" : "/" + trimSlash(frontendDefinition.appRootPath); if (!componentLibraries) { - - const componentLibraryUrl = lib => rootPath + "/" + trimSlash(lib); + const componentLibraryUrl = lib => + frontendDefinition.appRootPath + "/" + trimSlash(lib); componentLibraries = {}; for (let lib of frontendDefinition.componentLibraries) { @@ -22673,36 +25073,33 @@ var app = (function (exports) { } } - componentLibraries[builtinLibName] = builtins(window); + componentLibraries[builtinLibName] = builtins(_window); - if (!page) { - page = frontendDefinition.page; - } - - if (!screens) { - screens = frontendDefinition.screens; - } - - const { initialisePage, screenStore, pageStore, routeTo, rootNode } = createApp( - window.document, + const { + initialisePage, + screenStore, + pageStore, + routeTo, + rootNode, + } = createApp( componentLibraries, frontendDefinition, backendDefinition, user, uiFunctions || {}, - screens - ); + _window); - const route = window.location - ? window.location.pathname.replace(rootPath, "") - : ""; + const route = _window.location + ? _window.location.pathname.replace(frontendDefinition.appRootPath, "") + : ""; + + initialisePage(frontendDefinition.page, _window.document.body, route); return { - rootNode: initialisePage(page, window.document.body, route), screenStore, pageStore, routeTo, - rootNode + rootNode, } }; diff --git a/packages/server/appPackages/_master/public/unauthenticated/budibase-client.js.map b/packages/server/appPackages/_master/public/unauthenticated/budibase-client.js.map index 5093ed0c14..a79f50e7e9 100644 --- a/packages/server/appPackages/_master/public/unauthenticated/budibase-client.js.map +++ b/packages/server/appPackages/_master/public/unauthenticated/budibase-client.js.map @@ -1 +1 @@ -{"version":3,"file":"budibase-client.js","sources":["../node_modules/svelte/internal/index.mjs","../node_modules/svelte/store/index.mjs","../src/core/createCoreApp.js","../node_modules/lodash/lodash.min.js","../node_modules/lodash/fp/_mapping.js","../node_modules/lodash/fp/placeholder.js","../node_modules/lodash/fp/_baseConvert.js","../node_modules/lodash/fp.js","../node_modules/shortid/lib/random/random-from-seed.js","../node_modules/shortid/lib/alphabet.js","../node_modules/shortid/lib/random/random-byte-browser.js","../node_modules/nanoid/format.js","../node_modules/shortid/lib/generate.js","../node_modules/shortid/lib/build.js","../node_modules/shortid/lib/is-valid.js","../node_modules/shortid/lib/index.js","../node_modules/shortid/index.js","../node_modules/lodash/lodash.js","../../core/src/common/events.js","../../core/src/common/errors.js","../../core/src/common/apiWrapper.js","../node_modules/rollup-plugin-node-globals/src/global.js","../node_modules/process-es6/browser.js","../node_modules/rollup-plugin-node-builtins/src/es6/empty.js","../../core/node_modules/bcryptjs/dist/bcrypt.js","../../core/src/common/index.js","../../core/src/common/validationCommon.js","../node_modules/@nx-js/compiler-util/dist/es.es5.js","../../core/src/indexing/evaluate.js","../../core/src/templateApi/indexes.js","../../core/src/templateApi/hierarchy.js","../../core/src/types/typeHelpers.js","../../core/src/types/string.js","../../core/src/types/bool.js","../../core/src/types/number.js","../../core/src/types/datetime.js","../../core/src/types/array.js","../../core/src/types/reference.js","../../core/src/types/file.js","../../core/src/types/index.js","../../core/src/authApi/authCommon.js","../../core/src/authApi/isAuthorized.js","../../core/src/authApi/permissions.js","../../core/src/recordApi/getNew.js","../../core/src/templateApi/createNodes.js","../src/core/index.js","../src/state/isState.js","../src/state/getState.js","../src/state/setState.js","../src/common/trimSlash.js","../src/state/standardState.js","../src/api/loadRecord.js","../src/api/listRecords.js","../src/api/authenticate.js","../src/api/saveRecord.js","../src/api/index.js","../src/state/coreHandlers.js","../src/state/eventHandlers.js","../src/state/stateBinding.js","../src/render/renderComponent.js","../src/render/screenSlotComponent.js","../src/render/builtinComponents.js","../src/render/initialiseChildren.js","../node_modules/regexparam/dist/regexparam.mjs","../src/render/screenRouter.js","../src/createApp.js","../src/index.js"],"sourcesContent":["function noop() { }\nconst identity = x => x;\nfunction assign(tar, src) {\n // @ts-ignore\n for (const k in src)\n tar[k] = src[k];\n return tar;\n}\nfunction is_promise(value) {\n return value && typeof value === 'object' && typeof value.then === 'function';\n}\nfunction add_location(element, file, line, column, char) {\n element.__svelte_meta = {\n loc: { file, line, column, char }\n };\n}\nfunction run(fn) {\n return fn();\n}\nfunction blank_object() {\n return Object.create(null);\n}\nfunction run_all(fns) {\n fns.forEach(run);\n}\nfunction is_function(thing) {\n return typeof thing === 'function';\n}\nfunction safe_not_equal(a, b) {\n return a != a ? b == b : a !== b || ((a && typeof a === 'object') || typeof a === 'function');\n}\nfunction not_equal(a, b) {\n return a != a ? b == b : a !== b;\n}\nfunction validate_store(store, name) {\n if (!store || typeof store.subscribe !== 'function') {\n throw new Error(`'${name}' is not a store with a 'subscribe' method`);\n }\n}\nfunction subscribe(store, callback) {\n const unsub = store.subscribe(callback);\n return unsub.unsubscribe ? () => unsub.unsubscribe() : unsub;\n}\nfunction get_store_value(store) {\n let value;\n subscribe(store, _ => value = _)();\n return value;\n}\nfunction component_subscribe(component, store, callback) {\n component.$$.on_destroy.push(subscribe(store, callback));\n}\nfunction create_slot(definition, ctx, fn) {\n if (definition) {\n const slot_ctx = get_slot_context(definition, ctx, fn);\n return definition[0](slot_ctx);\n }\n}\nfunction get_slot_context(definition, ctx, fn) {\n return definition[1]\n ? assign({}, assign(ctx.$$scope.ctx, definition[1](fn ? fn(ctx) : {})))\n : ctx.$$scope.ctx;\n}\nfunction get_slot_changes(definition, ctx, changed, fn) {\n return definition[1]\n ? assign({}, assign(ctx.$$scope.changed || {}, definition[1](fn ? fn(changed) : {})))\n : ctx.$$scope.changed || {};\n}\nfunction exclude_internal_props(props) {\n const result = {};\n for (const k in props)\n if (k[0] !== '$')\n result[k] = props[k];\n return result;\n}\nfunction once(fn) {\n let ran = false;\n return function (...args) {\n if (ran)\n return;\n ran = true;\n fn.call(this, ...args);\n };\n}\nfunction null_to_empty(value) {\n return value == null ? '' : value;\n}\nfunction set_store_value(store, ret, value = ret) {\n store.set(value);\n return ret;\n}\n\nconst is_client = typeof window !== 'undefined';\nlet now = is_client\n ? () => window.performance.now()\n : () => Date.now();\nlet raf = is_client ? cb => requestAnimationFrame(cb) : noop;\n// used internally for testing\nfunction set_now(fn) {\n now = fn;\n}\nfunction set_raf(fn) {\n raf = fn;\n}\n\nconst tasks = new Set();\nlet running = false;\nfunction run_tasks() {\n tasks.forEach(task => {\n if (!task[0](now())) {\n tasks.delete(task);\n task[1]();\n }\n });\n running = tasks.size > 0;\n if (running)\n raf(run_tasks);\n}\nfunction clear_loops() {\n // for testing...\n tasks.forEach(task => tasks.delete(task));\n running = false;\n}\nfunction loop(fn) {\n let task;\n if (!running) {\n running = true;\n raf(run_tasks);\n }\n return {\n promise: new Promise(fulfil => {\n tasks.add(task = [fn, fulfil]);\n }),\n abort() {\n tasks.delete(task);\n }\n };\n}\n\nfunction append(target, node) {\n target.appendChild(node);\n}\nfunction insert(target, node, anchor) {\n target.insertBefore(node, anchor || null);\n}\nfunction detach(node) {\n node.parentNode.removeChild(node);\n}\nfunction destroy_each(iterations, detaching) {\n for (let i = 0; i < iterations.length; i += 1) {\n if (iterations[i])\n iterations[i].d(detaching);\n }\n}\nfunction element(name) {\n return document.createElement(name);\n}\nfunction element_is(name, is) {\n return document.createElement(name, { is });\n}\nfunction object_without_properties(obj, exclude) {\n // eslint-disable-next-line @typescript-eslint/no-object-literal-type-assertion\n const target = {};\n for (const k in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, k)\n // @ts-ignore\n && exclude.indexOf(k) === -1) {\n // @ts-ignore\n target[k] = obj[k];\n }\n }\n return target;\n}\nfunction svg_element(name) {\n return document.createElementNS('http://www.w3.org/2000/svg', name);\n}\nfunction text(data) {\n return document.createTextNode(data);\n}\nfunction space() {\n return text(' ');\n}\nfunction empty() {\n return text('');\n}\nfunction listen(node, event, handler, options) {\n node.addEventListener(event, handler, options);\n return () => node.removeEventListener(event, handler, options);\n}\nfunction prevent_default(fn) {\n return function (event) {\n event.preventDefault();\n // @ts-ignore\n return fn.call(this, event);\n };\n}\nfunction stop_propagation(fn) {\n return function (event) {\n event.stopPropagation();\n // @ts-ignore\n return fn.call(this, event);\n };\n}\nfunction self(fn) {\n return function (event) {\n // @ts-ignore\n if (event.target === this)\n fn.call(this, event);\n };\n}\nfunction attr(node, attribute, value) {\n if (value == null)\n node.removeAttribute(attribute);\n else\n node.setAttribute(attribute, value);\n}\nfunction set_attributes(node, attributes) {\n for (const key in attributes) {\n if (key === 'style') {\n node.style.cssText = attributes[key];\n }\n else if (key in node) {\n node[key] = attributes[key];\n }\n else {\n attr(node, key, attributes[key]);\n }\n }\n}\nfunction set_svg_attributes(node, attributes) {\n for (const key in attributes) {\n attr(node, key, attributes[key]);\n }\n}\nfunction set_custom_element_data(node, prop, value) {\n if (prop in node) {\n node[prop] = value;\n }\n else {\n attr(node, prop, value);\n }\n}\nfunction xlink_attr(node, attribute, value) {\n node.setAttributeNS('http://www.w3.org/1999/xlink', attribute, value);\n}\nfunction get_binding_group_value(group) {\n const value = [];\n for (let i = 0; i < group.length; i += 1) {\n if (group[i].checked)\n value.push(group[i].__value);\n }\n return value;\n}\nfunction to_number(value) {\n return value === '' ? undefined : +value;\n}\nfunction time_ranges_to_array(ranges) {\n const array = [];\n for (let i = 0; i < ranges.length; i += 1) {\n array.push({ start: ranges.start(i), end: ranges.end(i) });\n }\n return array;\n}\nfunction children(element) {\n return Array.from(element.childNodes);\n}\nfunction claim_element(nodes, name, attributes, svg) {\n for (let i = 0; i < nodes.length; i += 1) {\n const node = nodes[i];\n if (node.nodeName === name) {\n for (let j = 0; j < node.attributes.length; j += 1) {\n const attribute = node.attributes[j];\n if (!attributes[attribute.name])\n node.removeAttribute(attribute.name);\n }\n return nodes.splice(i, 1)[0]; // TODO strip unwanted attributes\n }\n }\n return svg ? svg_element(name) : element(name);\n}\nfunction claim_text(nodes, data) {\n for (let i = 0; i < nodes.length; i += 1) {\n const node = nodes[i];\n if (node.nodeType === 3) {\n node.data = '' + data;\n return nodes.splice(i, 1)[0];\n }\n }\n return text(data);\n}\nfunction claim_space(nodes) {\n return claim_text(nodes, ' ');\n}\nfunction set_data(text, data) {\n data = '' + data;\n if (text.data !== data)\n text.data = data;\n}\nfunction set_input_value(input, value) {\n if (value != null || input.value) {\n input.value = value;\n }\n}\nfunction set_input_type(input, type) {\n try {\n input.type = type;\n }\n catch (e) {\n // do nothing\n }\n}\nfunction set_style(node, key, value, important) {\n node.style.setProperty(key, value, important ? 'important' : '');\n}\nfunction select_option(select, value) {\n for (let i = 0; i < select.options.length; i += 1) {\n const option = select.options[i];\n if (option.__value === value) {\n option.selected = true;\n return;\n }\n }\n}\nfunction select_options(select, value) {\n for (let i = 0; i < select.options.length; i += 1) {\n const option = select.options[i];\n option.selected = ~value.indexOf(option.__value);\n }\n}\nfunction select_value(select) {\n const selected_option = select.querySelector(':checked') || select.options[0];\n return selected_option && selected_option.__value;\n}\nfunction select_multiple_value(select) {\n return [].map.call(select.querySelectorAll(':checked'), option => option.__value);\n}\nfunction add_resize_listener(element, fn) {\n if (getComputedStyle(element).position === 'static') {\n element.style.position = 'relative';\n }\n const object = document.createElement('object');\n object.setAttribute('style', 'display: block; position: absolute; top: 0; left: 0; height: 100%; width: 100%; overflow: hidden; pointer-events: none; z-index: -1;');\n object.type = 'text/html';\n object.tabIndex = -1;\n let win;\n object.onload = () => {\n win = object.contentDocument.defaultView;\n win.addEventListener('resize', fn);\n };\n if (/Trident/.test(navigator.userAgent)) {\n element.appendChild(object);\n object.data = 'about:blank';\n }\n else {\n object.data = 'about:blank';\n element.appendChild(object);\n }\n return {\n cancel: () => {\n win && win.removeEventListener && win.removeEventListener('resize', fn);\n element.removeChild(object);\n }\n };\n}\nfunction toggle_class(element, name, toggle) {\n element.classList[toggle ? 'add' : 'remove'](name);\n}\nfunction custom_event(type, detail) {\n const e = document.createEvent('CustomEvent');\n e.initCustomEvent(type, false, false, detail);\n return e;\n}\nclass HtmlTag {\n constructor(html, anchor = null) {\n this.e = element('div');\n this.a = anchor;\n this.u(html);\n }\n m(target, anchor = null) {\n for (let i = 0; i < this.n.length; i += 1) {\n insert(target, this.n[i], anchor);\n }\n this.t = target;\n }\n u(html) {\n this.e.innerHTML = html;\n this.n = Array.from(this.e.childNodes);\n }\n p(html) {\n this.d();\n this.u(html);\n this.m(this.t, this.a);\n }\n d() {\n this.n.forEach(detach);\n }\n}\n\nlet stylesheet;\nlet active = 0;\nlet current_rules = {};\n// https://github.com/darkskyapp/string-hash/blob/master/index.js\nfunction hash(str) {\n let hash = 5381;\n let i = str.length;\n while (i--)\n hash = ((hash << 5) - hash) ^ str.charCodeAt(i);\n return hash >>> 0;\n}\nfunction create_rule(node, a, b, duration, delay, ease, fn, uid = 0) {\n const step = 16.666 / duration;\n let keyframes = '{\\n';\n for (let p = 0; p <= 1; p += step) {\n const t = a + (b - a) * ease(p);\n keyframes += p * 100 + `%{${fn(t, 1 - t)}}\\n`;\n }\n const rule = keyframes + `100% {${fn(b, 1 - b)}}\\n}`;\n const name = `__svelte_${hash(rule)}_${uid}`;\n if (!current_rules[name]) {\n if (!stylesheet) {\n const style = element('style');\n document.head.appendChild(style);\n stylesheet = style.sheet;\n }\n current_rules[name] = true;\n stylesheet.insertRule(`@keyframes ${name} ${rule}`, stylesheet.cssRules.length);\n }\n const animation = node.style.animation || '';\n node.style.animation = `${animation ? `${animation}, ` : ``}${name} ${duration}ms linear ${delay}ms 1 both`;\n active += 1;\n return name;\n}\nfunction delete_rule(node, name) {\n node.style.animation = (node.style.animation || '')\n .split(', ')\n .filter(name\n ? anim => anim.indexOf(name) < 0 // remove specific animation\n : anim => anim.indexOf('__svelte') === -1 // remove all Svelte animations\n )\n .join(', ');\n if (name && !--active)\n clear_rules();\n}\nfunction clear_rules() {\n raf(() => {\n if (active)\n return;\n let i = stylesheet.cssRules.length;\n while (i--)\n stylesheet.deleteRule(i);\n current_rules = {};\n });\n}\n\nfunction create_animation(node, from, fn, params) {\n if (!from)\n return noop;\n const to = node.getBoundingClientRect();\n if (from.left === to.left && from.right === to.right && from.top === to.top && from.bottom === to.bottom)\n return noop;\n const { delay = 0, duration = 300, easing = identity, \n // @ts-ignore todo: should this be separated from destructuring? Or start/end added to public api and documentation?\n start: start_time = now() + delay, \n // @ts-ignore todo:\n end = start_time + duration, tick = noop, css } = fn(node, { from, to }, params);\n let running = true;\n let started = false;\n let name;\n function start() {\n if (css) {\n name = create_rule(node, 0, 1, duration, delay, easing, css);\n }\n if (!delay) {\n started = true;\n }\n }\n function stop() {\n if (css)\n delete_rule(node, name);\n running = false;\n }\n loop(now => {\n if (!started && now >= start_time) {\n started = true;\n }\n if (started && now >= end) {\n tick(1, 0);\n stop();\n }\n if (!running) {\n return false;\n }\n if (started) {\n const p = now - start_time;\n const t = 0 + 1 * easing(p / duration);\n tick(t, 1 - t);\n }\n return true;\n });\n start();\n tick(0, 1);\n return stop;\n}\nfunction fix_position(node) {\n const style = getComputedStyle(node);\n if (style.position !== 'absolute' && style.position !== 'fixed') {\n const { width, height } = style;\n const a = node.getBoundingClientRect();\n node.style.position = 'absolute';\n node.style.width = width;\n node.style.height = height;\n add_transform(node, a);\n }\n}\nfunction add_transform(node, a) {\n const b = node.getBoundingClientRect();\n if (a.left !== b.left || a.top !== b.top) {\n const style = getComputedStyle(node);\n const transform = style.transform === 'none' ? '' : style.transform;\n node.style.transform = `${transform} translate(${a.left - b.left}px, ${a.top - b.top}px)`;\n }\n}\n\nlet current_component;\nfunction set_current_component(component) {\n current_component = component;\n}\nfunction get_current_component() {\n if (!current_component)\n throw new Error(`Function called outside component initialization`);\n return current_component;\n}\nfunction beforeUpdate(fn) {\n get_current_component().$$.before_update.push(fn);\n}\nfunction onMount(fn) {\n get_current_component().$$.on_mount.push(fn);\n}\nfunction afterUpdate(fn) {\n get_current_component().$$.after_update.push(fn);\n}\nfunction onDestroy(fn) {\n get_current_component().$$.on_destroy.push(fn);\n}\nfunction createEventDispatcher() {\n const component = current_component;\n return (type, detail) => {\n const callbacks = component.$$.callbacks[type];\n if (callbacks) {\n // TODO are there situations where events could be dispatched\n // in a server (non-DOM) environment?\n const event = custom_event(type, detail);\n callbacks.slice().forEach(fn => {\n fn.call(component, event);\n });\n }\n };\n}\nfunction setContext(key, context) {\n get_current_component().$$.context.set(key, context);\n}\nfunction getContext(key) {\n return get_current_component().$$.context.get(key);\n}\n// TODO figure out if we still want to support\n// shorthand events, or if we want to implement\n// a real bubbling mechanism\nfunction bubble(component, event) {\n const callbacks = component.$$.callbacks[event.type];\n if (callbacks) {\n callbacks.slice().forEach(fn => fn(event));\n }\n}\n\nconst dirty_components = [];\nconst intros = { enabled: false };\nconst binding_callbacks = [];\nconst render_callbacks = [];\nconst flush_callbacks = [];\nconst resolved_promise = Promise.resolve();\nlet update_scheduled = false;\nfunction schedule_update() {\n if (!update_scheduled) {\n update_scheduled = true;\n resolved_promise.then(flush);\n }\n}\nfunction tick() {\n schedule_update();\n return resolved_promise;\n}\nfunction add_render_callback(fn) {\n render_callbacks.push(fn);\n}\nfunction add_flush_callback(fn) {\n flush_callbacks.push(fn);\n}\nfunction flush() {\n const seen_callbacks = new Set();\n do {\n // first, call beforeUpdate functions\n // and update components\n while (dirty_components.length) {\n const component = dirty_components.shift();\n set_current_component(component);\n update(component.$$);\n }\n while (binding_callbacks.length)\n binding_callbacks.pop()();\n // then, once components are updated, call\n // afterUpdate functions. This may cause\n // subsequent updates...\n for (let i = 0; i < render_callbacks.length; i += 1) {\n const callback = render_callbacks[i];\n if (!seen_callbacks.has(callback)) {\n callback();\n // ...so guard against infinite loops\n seen_callbacks.add(callback);\n }\n }\n render_callbacks.length = 0;\n } while (dirty_components.length);\n while (flush_callbacks.length) {\n flush_callbacks.pop()();\n }\n update_scheduled = false;\n}\nfunction update($$) {\n if ($$.fragment) {\n $$.update($$.dirty);\n run_all($$.before_update);\n $$.fragment.p($$.dirty, $$.ctx);\n $$.dirty = null;\n $$.after_update.forEach(add_render_callback);\n }\n}\n\nlet promise;\nfunction wait() {\n if (!promise) {\n promise = Promise.resolve();\n promise.then(() => {\n promise = null;\n });\n }\n return promise;\n}\nfunction dispatch(node, direction, kind) {\n node.dispatchEvent(custom_event(`${direction ? 'intro' : 'outro'}${kind}`));\n}\nconst outroing = new Set();\nlet outros;\nfunction group_outros() {\n outros = {\n r: 0,\n c: [],\n p: outros // parent group\n };\n}\nfunction check_outros() {\n if (!outros.r) {\n run_all(outros.c);\n }\n outros = outros.p;\n}\nfunction transition_in(block, local) {\n if (block && block.i) {\n outroing.delete(block);\n block.i(local);\n }\n}\nfunction transition_out(block, local, detach, callback) {\n if (block && block.o) {\n if (outroing.has(block))\n return;\n outroing.add(block);\n outros.c.push(() => {\n outroing.delete(block);\n if (callback) {\n if (detach)\n block.d(1);\n callback();\n }\n });\n block.o(local);\n }\n}\nconst null_transition = { duration: 0 };\nfunction create_in_transition(node, fn, params) {\n let config = fn(node, params);\n let running = false;\n let animation_name;\n let task;\n let uid = 0;\n function cleanup() {\n if (animation_name)\n delete_rule(node, animation_name);\n }\n function go() {\n const { delay = 0, duration = 300, easing = identity, tick = noop, css } = config || null_transition;\n if (css)\n animation_name = create_rule(node, 0, 1, duration, delay, easing, css, uid++);\n tick(0, 1);\n const start_time = now() + delay;\n const end_time = start_time + duration;\n if (task)\n task.abort();\n running = true;\n add_render_callback(() => dispatch(node, true, 'start'));\n task = loop(now => {\n if (running) {\n if (now >= end_time) {\n tick(1, 0);\n dispatch(node, true, 'end');\n cleanup();\n return running = false;\n }\n if (now >= start_time) {\n const t = easing((now - start_time) / duration);\n tick(t, 1 - t);\n }\n }\n return running;\n });\n }\n let started = false;\n return {\n start() {\n if (started)\n return;\n delete_rule(node);\n if (is_function(config)) {\n config = config();\n wait().then(go);\n }\n else {\n go();\n }\n },\n invalidate() {\n started = false;\n },\n end() {\n if (running) {\n cleanup();\n running = false;\n }\n }\n };\n}\nfunction create_out_transition(node, fn, params) {\n let config = fn(node, params);\n let running = true;\n let animation_name;\n const group = outros;\n group.r += 1;\n function go() {\n const { delay = 0, duration = 300, easing = identity, tick = noop, css } = config || null_transition;\n if (css)\n animation_name = create_rule(node, 1, 0, duration, delay, easing, css);\n const start_time = now() + delay;\n const end_time = start_time + duration;\n add_render_callback(() => dispatch(node, false, 'start'));\n loop(now => {\n if (running) {\n if (now >= end_time) {\n tick(0, 1);\n dispatch(node, false, 'end');\n if (!--group.r) {\n // this will result in `end()` being called,\n // so we don't need to clean up here\n run_all(group.c);\n }\n return false;\n }\n if (now >= start_time) {\n const t = easing((now - start_time) / duration);\n tick(1 - t, t);\n }\n }\n return running;\n });\n }\n if (is_function(config)) {\n wait().then(() => {\n // @ts-ignore\n config = config();\n go();\n });\n }\n else {\n go();\n }\n return {\n end(reset) {\n if (reset && config.tick) {\n config.tick(1, 0);\n }\n if (running) {\n if (animation_name)\n delete_rule(node, animation_name);\n running = false;\n }\n }\n };\n}\nfunction create_bidirectional_transition(node, fn, params, intro) {\n let config = fn(node, params);\n let t = intro ? 0 : 1;\n let running_program = null;\n let pending_program = null;\n let animation_name = null;\n function clear_animation() {\n if (animation_name)\n delete_rule(node, animation_name);\n }\n function init(program, duration) {\n const d = program.b - t;\n duration *= Math.abs(d);\n return {\n a: t,\n b: program.b,\n d,\n duration,\n start: program.start,\n end: program.start + duration,\n group: program.group\n };\n }\n function go(b) {\n const { delay = 0, duration = 300, easing = identity, tick = noop, css } = config || null_transition;\n const program = {\n start: now() + delay,\n b\n };\n if (!b) {\n // @ts-ignore todo: improve typings\n program.group = outros;\n outros.r += 1;\n }\n if (running_program) {\n pending_program = program;\n }\n else {\n // if this is an intro, and there's a delay, we need to do\n // an initial tick and/or apply CSS animation immediately\n if (css) {\n clear_animation();\n animation_name = create_rule(node, t, b, duration, delay, easing, css);\n }\n if (b)\n tick(0, 1);\n running_program = init(program, duration);\n add_render_callback(() => dispatch(node, b, 'start'));\n loop(now => {\n if (pending_program && now > pending_program.start) {\n running_program = init(pending_program, duration);\n pending_program = null;\n dispatch(node, running_program.b, 'start');\n if (css) {\n clear_animation();\n animation_name = create_rule(node, t, running_program.b, running_program.duration, 0, easing, config.css);\n }\n }\n if (running_program) {\n if (now >= running_program.end) {\n tick(t = running_program.b, 1 - t);\n dispatch(node, running_program.b, 'end');\n if (!pending_program) {\n // we're done\n if (running_program.b) {\n // intro — we can tidy up immediately\n clear_animation();\n }\n else {\n // outro — needs to be coordinated\n if (!--running_program.group.r)\n run_all(running_program.group.c);\n }\n }\n running_program = null;\n }\n else if (now >= running_program.start) {\n const p = now - running_program.start;\n t = running_program.a + running_program.d * easing(p / running_program.duration);\n tick(t, 1 - t);\n }\n }\n return !!(running_program || pending_program);\n });\n }\n }\n return {\n run(b) {\n if (is_function(config)) {\n wait().then(() => {\n // @ts-ignore\n config = config();\n go(b);\n });\n }\n else {\n go(b);\n }\n },\n end() {\n clear_animation();\n running_program = pending_program = null;\n }\n };\n}\n\nfunction handle_promise(promise, info) {\n const token = info.token = {};\n function update(type, index, key, value) {\n if (info.token !== token)\n return;\n info.resolved = key && { [key]: value };\n const child_ctx = assign(assign({}, info.ctx), info.resolved);\n const block = type && (info.current = type)(child_ctx);\n if (info.block) {\n if (info.blocks) {\n info.blocks.forEach((block, i) => {\n if (i !== index && block) {\n group_outros();\n transition_out(block, 1, 1, () => {\n info.blocks[i] = null;\n });\n check_outros();\n }\n });\n }\n else {\n info.block.d(1);\n }\n block.c();\n transition_in(block, 1);\n block.m(info.mount(), info.anchor);\n flush();\n }\n info.block = block;\n if (info.blocks)\n info.blocks[index] = block;\n }\n if (is_promise(promise)) {\n const current_component = get_current_component();\n promise.then(value => {\n set_current_component(current_component);\n update(info.then, 1, info.value, value);\n set_current_component(null);\n }, error => {\n set_current_component(current_component);\n update(info.catch, 2, info.error, error);\n set_current_component(null);\n });\n // if we previously had a then/catch block, destroy it\n if (info.current !== info.pending) {\n update(info.pending, 0);\n return true;\n }\n }\n else {\n if (info.current !== info.then) {\n update(info.then, 1, info.value, promise);\n return true;\n }\n info.resolved = { [info.value]: promise };\n }\n}\n\nconst globals = (typeof window !== 'undefined' ? window : global);\n\nfunction destroy_block(block, lookup) {\n block.d(1);\n lookup.delete(block.key);\n}\nfunction outro_and_destroy_block(block, lookup) {\n transition_out(block, 1, 1, () => {\n lookup.delete(block.key);\n });\n}\nfunction fix_and_destroy_block(block, lookup) {\n block.f();\n destroy_block(block, lookup);\n}\nfunction fix_and_outro_and_destroy_block(block, lookup) {\n block.f();\n outro_and_destroy_block(block, lookup);\n}\nfunction update_keyed_each(old_blocks, changed, get_key, dynamic, ctx, list, lookup, node, destroy, create_each_block, next, get_context) {\n let o = old_blocks.length;\n let n = list.length;\n let i = o;\n const old_indexes = {};\n while (i--)\n old_indexes[old_blocks[i].key] = i;\n const new_blocks = [];\n const new_lookup = new Map();\n const deltas = new Map();\n i = n;\n while (i--) {\n const child_ctx = get_context(ctx, list, i);\n const key = get_key(child_ctx);\n let block = lookup.get(key);\n if (!block) {\n block = create_each_block(key, child_ctx);\n block.c();\n }\n else if (dynamic) {\n block.p(changed, child_ctx);\n }\n new_lookup.set(key, new_blocks[i] = block);\n if (key in old_indexes)\n deltas.set(key, Math.abs(i - old_indexes[key]));\n }\n const will_move = new Set();\n const did_move = new Set();\n function insert(block) {\n transition_in(block, 1);\n block.m(node, next);\n lookup.set(block.key, block);\n next = block.first;\n n--;\n }\n while (o && n) {\n const new_block = new_blocks[n - 1];\n const old_block = old_blocks[o - 1];\n const new_key = new_block.key;\n const old_key = old_block.key;\n if (new_block === old_block) {\n // do nothing\n next = new_block.first;\n o--;\n n--;\n }\n else if (!new_lookup.has(old_key)) {\n // remove old block\n destroy(old_block, lookup);\n o--;\n }\n else if (!lookup.has(new_key) || will_move.has(new_key)) {\n insert(new_block);\n }\n else if (did_move.has(old_key)) {\n o--;\n }\n else if (deltas.get(new_key) > deltas.get(old_key)) {\n did_move.add(new_key);\n insert(new_block);\n }\n else {\n will_move.add(old_key);\n o--;\n }\n }\n while (o--) {\n const old_block = old_blocks[o];\n if (!new_lookup.has(old_block.key))\n destroy(old_block, lookup);\n }\n while (n)\n insert(new_blocks[n - 1]);\n return new_blocks;\n}\nfunction measure(blocks) {\n const rects = {};\n let i = blocks.length;\n while (i--)\n rects[blocks[i].key] = blocks[i].node.getBoundingClientRect();\n return rects;\n}\n\nfunction get_spread_update(levels, updates) {\n const update = {};\n const to_null_out = {};\n const accounted_for = { $$scope: 1 };\n let i = levels.length;\n while (i--) {\n const o = levels[i];\n const n = updates[i];\n if (n) {\n for (const key in o) {\n if (!(key in n))\n to_null_out[key] = 1;\n }\n for (const key in n) {\n if (!accounted_for[key]) {\n update[key] = n[key];\n accounted_for[key] = 1;\n }\n }\n levels[i] = n;\n }\n else {\n for (const key in o) {\n accounted_for[key] = 1;\n }\n }\n }\n for (const key in to_null_out) {\n if (!(key in update))\n update[key] = undefined;\n }\n return update;\n}\nfunction get_spread_object(spread_props) {\n return typeof spread_props === 'object' && spread_props !== null ? spread_props : {};\n}\n\nconst invalid_attribute_name_character = /[\\s'\">/=\\u{FDD0}-\\u{FDEF}\\u{FFFE}\\u{FFFF}\\u{1FFFE}\\u{1FFFF}\\u{2FFFE}\\u{2FFFF}\\u{3FFFE}\\u{3FFFF}\\u{4FFFE}\\u{4FFFF}\\u{5FFFE}\\u{5FFFF}\\u{6FFFE}\\u{6FFFF}\\u{7FFFE}\\u{7FFFF}\\u{8FFFE}\\u{8FFFF}\\u{9FFFE}\\u{9FFFF}\\u{AFFFE}\\u{AFFFF}\\u{BFFFE}\\u{BFFFF}\\u{CFFFE}\\u{CFFFF}\\u{DFFFE}\\u{DFFFF}\\u{EFFFE}\\u{EFFFF}\\u{FFFFE}\\u{FFFFF}\\u{10FFFE}\\u{10FFFF}]/u;\n// https://html.spec.whatwg.org/multipage/syntax.html#attributes-2\n// https://infra.spec.whatwg.org/#noncharacter\nfunction spread(args) {\n const attributes = Object.assign({}, ...args);\n let str = '';\n Object.keys(attributes).forEach(name => {\n if (invalid_attribute_name_character.test(name))\n return;\n const value = attributes[name];\n if (value === undefined)\n return;\n if (value === true)\n str += \" \" + name;\n const escaped = String(value)\n .replace(/\"/g, '"')\n .replace(/'/g, ''');\n str += \" \" + name + \"=\" + JSON.stringify(escaped);\n });\n return str;\n}\nconst escaped = {\n '\"': '"',\n \"'\": ''',\n '&': '&',\n '<': '<',\n '>': '>'\n};\nfunction escape(html) {\n return String(html).replace(/[\"'&<>]/g, match => escaped[match]);\n}\nfunction each(items, fn) {\n let str = '';\n for (let i = 0; i < items.length; i += 1) {\n str += fn(items[i], i);\n }\n return str;\n}\nconst missing_component = {\n $$render: () => ''\n};\nfunction validate_component(component, name) {\n if (!component || !component.$$render) {\n if (name === 'svelte:component')\n name += ' this={...}';\n throw new Error(`<${name}> is not a valid SSR component. You may need to review your build config to ensure that dependencies are compiled, rather than imported as pre-compiled modules`);\n }\n return component;\n}\nfunction debug(file, line, column, values) {\n console.log(`{@debug} ${file ? file + ' ' : ''}(${line}:${column})`); // eslint-disable-line no-console\n console.log(values); // eslint-disable-line no-console\n return '';\n}\nlet on_destroy;\nfunction create_ssr_component(fn) {\n function $$render(result, props, bindings, slots) {\n const parent_component = current_component;\n const $$ = {\n on_destroy,\n context: new Map(parent_component ? parent_component.$$.context : []),\n // these will be immediately discarded\n on_mount: [],\n before_update: [],\n after_update: [],\n callbacks: blank_object()\n };\n set_current_component({ $$ });\n const html = fn(result, props, bindings, slots);\n set_current_component(parent_component);\n return html;\n }\n return {\n render: (props = {}, options = {}) => {\n on_destroy = [];\n const result = { head: '', css: new Set() };\n const html = $$render(result, props, {}, options);\n run_all(on_destroy);\n return {\n html,\n css: {\n code: Array.from(result.css).map(css => css.code).join('\\n'),\n map: null // TODO\n },\n head: result.head\n };\n },\n $$render\n };\n}\nfunction add_attribute(name, value, boolean) {\n if (value == null || (boolean && !value))\n return '';\n return ` ${name}${value === true ? '' : `=${typeof value === 'string' ? JSON.stringify(escape(value)) : `\"${value}\"`}`}`;\n}\nfunction add_classes(classes) {\n return classes ? ` class=\"${classes}\"` : ``;\n}\n\nfunction bind(component, name, callback) {\n if (component.$$.props.indexOf(name) === -1)\n return;\n component.$$.bound[name] = callback;\n callback(component.$$.ctx[name]);\n}\nfunction mount_component(component, target, anchor) {\n const { fragment, on_mount, on_destroy, after_update } = component.$$;\n fragment.m(target, anchor);\n // onMount happens before the initial afterUpdate\n add_render_callback(() => {\n const new_on_destroy = on_mount.map(run).filter(is_function);\n if (on_destroy) {\n on_destroy.push(...new_on_destroy);\n }\n else {\n // Edge case - component was destroyed immediately,\n // most likely as a result of a binding initialising\n run_all(new_on_destroy);\n }\n component.$$.on_mount = [];\n });\n after_update.forEach(add_render_callback);\n}\nfunction destroy_component(component, detaching) {\n if (component.$$.fragment) {\n run_all(component.$$.on_destroy);\n component.$$.fragment.d(detaching);\n // TODO null out other refs, including component.$$ (but need to\n // preserve final state?)\n component.$$.on_destroy = component.$$.fragment = null;\n component.$$.ctx = {};\n }\n}\nfunction make_dirty(component, key) {\n if (!component.$$.dirty) {\n dirty_components.push(component);\n schedule_update();\n component.$$.dirty = blank_object();\n }\n component.$$.dirty[key] = true;\n}\nfunction init(component, options, instance, create_fragment, not_equal, prop_names) {\n const parent_component = current_component;\n set_current_component(component);\n const props = options.props || {};\n const $$ = component.$$ = {\n fragment: null,\n ctx: null,\n // state\n props: prop_names,\n update: noop,\n not_equal,\n bound: blank_object(),\n // lifecycle\n on_mount: [],\n on_destroy: [],\n before_update: [],\n after_update: [],\n context: new Map(parent_component ? parent_component.$$.context : []),\n // everything else\n callbacks: blank_object(),\n dirty: null\n };\n let ready = false;\n $$.ctx = instance\n ? instance(component, props, (key, ret, value = ret) => {\n if ($$.ctx && not_equal($$.ctx[key], $$.ctx[key] = value)) {\n if ($$.bound[key])\n $$.bound[key](value);\n if (ready)\n make_dirty(component, key);\n }\n return ret;\n })\n : props;\n $$.update();\n ready = true;\n run_all($$.before_update);\n $$.fragment = create_fragment($$.ctx);\n if (options.target) {\n if (options.hydrate) {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n $$.fragment.l(children(options.target));\n }\n else {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n $$.fragment.c();\n }\n if (options.intro)\n transition_in(component.$$.fragment);\n mount_component(component, options.target, options.anchor);\n flush();\n }\n set_current_component(parent_component);\n}\nlet SvelteElement;\nif (typeof HTMLElement !== 'undefined') {\n SvelteElement = class extends HTMLElement {\n constructor() {\n super();\n this.attachShadow({ mode: 'open' });\n }\n connectedCallback() {\n // @ts-ignore todo: improve typings\n for (const key in this.$$.slotted) {\n // @ts-ignore todo: improve typings\n this.appendChild(this.$$.slotted[key]);\n }\n }\n attributeChangedCallback(attr, _oldValue, newValue) {\n this[attr] = newValue;\n }\n $destroy() {\n destroy_component(this, 1);\n this.$destroy = noop;\n }\n $on(type, callback) {\n // TODO should this delegate to addEventListener?\n const callbacks = (this.$$.callbacks[type] || (this.$$.callbacks[type] = []));\n callbacks.push(callback);\n return () => {\n const index = callbacks.indexOf(callback);\n if (index !== -1)\n callbacks.splice(index, 1);\n };\n }\n $set() {\n // overridden by instance, if it has props\n }\n };\n}\nclass SvelteComponent {\n $destroy() {\n destroy_component(this, 1);\n this.$destroy = noop;\n }\n $on(type, callback) {\n const callbacks = (this.$$.callbacks[type] || (this.$$.callbacks[type] = []));\n callbacks.push(callback);\n return () => {\n const index = callbacks.indexOf(callback);\n if (index !== -1)\n callbacks.splice(index, 1);\n };\n }\n $set() {\n // overridden by instance, if it has props\n }\n}\n\nfunction dispatch_dev(type, detail) {\n document.dispatchEvent(custom_event(type, detail));\n}\nfunction append_dev(target, node) {\n dispatch_dev(\"SvelteDOMInsert\", { target, node });\n append(target, node);\n}\nfunction insert_dev(target, node, anchor) {\n dispatch_dev(\"SvelteDOMInsert\", { target, node, anchor });\n insert(target, node, anchor);\n}\nfunction detach_dev(node) {\n dispatch_dev(\"SvelteDOMRemove\", { node });\n detach(node);\n}\nfunction detach_between_dev(before, after) {\n while (before.nextSibling && before.nextSibling !== after) {\n detach_dev(before.nextSibling);\n }\n}\nfunction detach_before_dev(after) {\n while (after.previousSibling) {\n detach_dev(after.previousSibling);\n }\n}\nfunction detach_after_dev(before) {\n while (before.nextSibling) {\n detach_dev(before.nextSibling);\n }\n}\nfunction listen_dev(node, event, handler, options, has_prevent_default, has_stop_propagation) {\n const modifiers = options === true ? [\"capture\"] : options ? Array.from(Object.keys(options)) : [];\n if (has_prevent_default)\n modifiers.push('preventDefault');\n if (has_stop_propagation)\n modifiers.push('stopPropagation');\n dispatch_dev(\"SvelteDOMAddEventListener\", { node, event, handler, modifiers });\n const dispose = listen(node, event, handler, options);\n return () => {\n dispatch_dev(\"SvelteDOMRemoveEventListener\", { node, event, handler, modifiers });\n dispose();\n };\n}\nfunction attr_dev(node, attribute, value) {\n attr(node, attribute, value);\n if (value == null)\n dispatch_dev(\"SvelteDOMRemoveAttribute\", { node, attribute });\n else\n dispatch_dev(\"SvelteDOMSetAttribute\", { node, attribute, value });\n}\nfunction prop_dev(node, property, value) {\n node[property] = value;\n dispatch_dev(\"SvelteDOMSetProperty\", { node, property, value });\n}\nfunction dataset_dev(node, property, value) {\n node.dataset[property] = value;\n dispatch_dev(\"SvelteDOMSetDataset\", { node, property, value });\n}\nfunction set_data_dev(text, data) {\n data = '' + data;\n if (text.data === data)\n return;\n dispatch_dev(\"SvelteDOMSetData\", { node: text, data });\n text.data = data;\n}\nclass SvelteComponentDev extends SvelteComponent {\n constructor(options) {\n if (!options || (!options.target && !options.$$inline)) {\n throw new Error(`'target' is a required option`);\n }\n super();\n }\n $destroy() {\n super.$destroy();\n this.$destroy = () => {\n console.warn(`Component was already destroyed`); // eslint-disable-line no-console\n };\n }\n}\n\nexport { HtmlTag, SvelteComponent, SvelteComponentDev, SvelteElement, add_attribute, add_classes, add_flush_callback, add_location, add_render_callback, add_resize_listener, add_transform, afterUpdate, append, append_dev, assign, attr, attr_dev, beforeUpdate, bind, binding_callbacks, blank_object, bubble, check_outros, children, claim_element, claim_space, claim_text, clear_loops, component_subscribe, createEventDispatcher, create_animation, create_bidirectional_transition, create_in_transition, create_out_transition, create_slot, create_ssr_component, current_component, custom_event, dataset_dev, debug, destroy_block, destroy_component, destroy_each, detach, detach_after_dev, detach_before_dev, detach_between_dev, detach_dev, dirty_components, dispatch_dev, each, element, element_is, empty, escape, escaped, exclude_internal_props, fix_and_destroy_block, fix_and_outro_and_destroy_block, fix_position, flush, getContext, get_binding_group_value, get_current_component, get_slot_changes, get_slot_context, get_spread_object, get_spread_update, get_store_value, globals, group_outros, handle_promise, identity, init, insert, insert_dev, intros, invalid_attribute_name_character, is_client, is_function, is_promise, listen, listen_dev, loop, measure, missing_component, mount_component, noop, not_equal, now, null_to_empty, object_without_properties, onDestroy, onMount, once, outro_and_destroy_block, prevent_default, prop_dev, raf, run, run_all, safe_not_equal, schedule_update, select_multiple_value, select_option, select_options, select_value, self, setContext, set_attributes, set_current_component, set_custom_element_data, set_data, set_data_dev, set_input_type, set_input_value, set_now, set_raf, set_store_value, set_style, set_svg_attributes, space, spread, stop_propagation, subscribe, svg_element, text, tick, time_ranges_to_array, to_number, toggle_class, transition_in, transition_out, update_keyed_each, validate_component, validate_store, xlink_attr };\n","import { safe_not_equal, noop, run_all, is_function } from '../internal';\nexport { get_store_value as get } from '../internal';\n\nconst subscriber_queue = [];\n/**\n * Creates a `Readable` store that allows reading by subscription.\n * @param value initial value\n * @param {StartStopNotifier}start start and stop notifications for subscriptions\n */\nfunction readable(value, start) {\n return {\n subscribe: writable(value, start).subscribe,\n };\n}\n/**\n * Create a `Writable` store that allows both updating and reading by subscription.\n * @param {*=}value initial value\n * @param {StartStopNotifier=}start start and stop notifications for subscriptions\n */\nfunction writable(value, start = noop) {\n let stop;\n const subscribers = [];\n function set(new_value) {\n if (safe_not_equal(value, new_value)) {\n value = new_value;\n if (stop) { // store is ready\n const run_queue = !subscriber_queue.length;\n for (let i = 0; i < subscribers.length; i += 1) {\n const s = subscribers[i];\n s[1]();\n subscriber_queue.push(s, value);\n }\n if (run_queue) {\n for (let i = 0; i < subscriber_queue.length; i += 2) {\n subscriber_queue[i][0](subscriber_queue[i + 1]);\n }\n subscriber_queue.length = 0;\n }\n }\n }\n }\n function update(fn) {\n set(fn(value));\n }\n function subscribe(run, invalidate = noop) {\n const subscriber = [run, invalidate];\n subscribers.push(subscriber);\n if (subscribers.length === 1) {\n stop = start(set) || noop;\n }\n run(value);\n return () => {\n const index = subscribers.indexOf(subscriber);\n if (index !== -1) {\n subscribers.splice(index, 1);\n }\n if (subscribers.length === 0) {\n stop();\n stop = null;\n }\n };\n }\n return { set, update, subscribe };\n}\n/**\n * Derived value store by synchronizing one or more readable stores and\n * applying an aggregation function over its input values.\n * @param {Stores} stores input stores\n * @param {function(Stores=, function(*)=):*}fn function callback that aggregates the values\n * @param {*=}initial_value when used asynchronously\n */\nfunction derived(stores, fn, initial_value) {\n const single = !Array.isArray(stores);\n const stores_array = single\n ? [stores]\n : stores;\n const auto = fn.length < 2;\n return readable(initial_value, (set) => {\n let inited = false;\n const values = [];\n let pending = 0;\n let cleanup = noop;\n const sync = () => {\n if (pending) {\n return;\n }\n cleanup();\n const result = fn(single ? values[0] : values, set);\n if (auto) {\n set(result);\n }\n else {\n cleanup = is_function(result) ? result : noop;\n }\n };\n const unsubscribers = stores_array.map((store, i) => store.subscribe((value) => {\n values[i] = value;\n pending &= ~(1 << i);\n if (inited) {\n sync();\n }\n }, () => {\n pending |= (1 << i);\n }));\n inited = true;\n sync();\n return function stop() {\n run_all(unsubscribers);\n cleanup();\n };\n });\n}\n\nexport { derived, readable, writable };\n","export const createCoreApp = (backendDefinition, user) => {\r\n const app = {\r\n datastore: null,\r\n crypto: null,\r\n publish: () => {},\r\n hierarchy: backendDefinition.hierarchy,\r\n actions: backendDefinition.actions,\r\n user,\r\n }\r\n\r\n return app\r\n}\r\n","/**\n * @license\n * Lodash lodash.com/license | Underscore.js 1.8.3 underscorejs.org/LICENSE\n */\n;(function(){function n(n,t,r){switch(r.length){case 0:return n.call(t);case 1:return n.call(t,r[0]);case 2:return n.call(t,r[0],r[1]);case 3:return n.call(t,r[0],r[1],r[2])}return n.apply(t,r)}function t(n,t,r,e){for(var u=-1,i=null==n?0:n.length;++u\"']/g,G=RegExp(V.source),H=RegExp(K.source),J=/<%-([\\s\\S]+?)%>/g,Y=/<%([\\s\\S]+?)%>/g,Q=/<%=([\\s\\S]+?)%>/g,X=/\\.|\\[(?:[^[\\]]*|([\"'])(?:(?!\\1)[^\\\\]|\\\\.)*?\\1)\\]/,nn=/^\\w*$/,tn=/[^.[\\]]+|\\[(?:(-?\\d+(?:\\.\\d+)?)|([\"'])((?:(?!\\2)[^\\\\]|\\\\.)*?)\\2)\\]|(?=(?:\\.|\\[\\])(?:\\.|\\[\\]|$))/g,rn=/[\\\\^$.*+?()[\\]{}|]/g,en=RegExp(rn.source),un=/^\\s+|\\s+$/g,on=/^\\s+/,fn=/\\s+$/,cn=/\\{(?:\\n\\/\\* \\[wrapped with .+\\] \\*\\/)?\\n?/,an=/\\{\\n\\/\\* \\[wrapped with (.+)\\] \\*/,ln=/,? & /,sn=/[^\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\x7f]+/g,hn=/\\\\(\\\\)?/g,pn=/\\$\\{([^\\\\}]*(?:\\\\.[^\\\\}]*)*)\\}/g,_n=/\\w*$/,vn=/^[-+]0x[0-9a-f]+$/i,gn=/^0b[01]+$/i,dn=/^\\[object .+?Constructor\\]$/,yn=/^0o[0-7]+$/i,bn=/^(?:0|[1-9]\\d*)$/,xn=/[\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\xff\\u0100-\\u017f]/g,jn=/($^)/,wn=/['\\n\\r\\u2028\\u2029\\\\]/g,mn=\"[\\\\ufe0e\\\\ufe0f]?(?:[\\\\u0300-\\\\u036f\\\\ufe20-\\\\ufe2f\\\\u20d0-\\\\u20ff]|\\\\ud83c[\\\\udffb-\\\\udfff])?(?:\\\\u200d(?:[^\\\\ud800-\\\\udfff]|(?:\\\\ud83c[\\\\udde6-\\\\uddff]){2}|[\\\\ud800-\\\\udbff][\\\\udc00-\\\\udfff])[\\\\ufe0e\\\\ufe0f]?(?:[\\\\u0300-\\\\u036f\\\\ufe20-\\\\ufe2f\\\\u20d0-\\\\u20ff]|\\\\ud83c[\\\\udffb-\\\\udfff])?)*\",An=\"(?:[\\\\u2700-\\\\u27bf]|(?:\\\\ud83c[\\\\udde6-\\\\uddff]){2}|[\\\\ud800-\\\\udbff][\\\\udc00-\\\\udfff])\"+mn,En=\"(?:[^\\\\ud800-\\\\udfff][\\\\u0300-\\\\u036f\\\\ufe20-\\\\ufe2f\\\\u20d0-\\\\u20ff]?|[\\\\u0300-\\\\u036f\\\\ufe20-\\\\ufe2f\\\\u20d0-\\\\u20ff]|(?:\\\\ud83c[\\\\udde6-\\\\uddff]){2}|[\\\\ud800-\\\\udbff][\\\\udc00-\\\\udfff]|[\\\\ud800-\\\\udfff])\",kn=RegExp(\"['\\u2019]\",\"g\"),Sn=RegExp(\"[\\\\u0300-\\\\u036f\\\\ufe20-\\\\ufe2f\\\\u20d0-\\\\u20ff]\",\"g\"),On=RegExp(\"\\\\ud83c[\\\\udffb-\\\\udfff](?=\\\\ud83c[\\\\udffb-\\\\udfff])|\"+En+mn,\"g\"),In=RegExp([\"[A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde]?[a-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xff]+(?:['\\u2019](?:d|ll|m|re|s|t|ve))?(?=[\\\\xac\\\\xb1\\\\xd7\\\\xf7\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf\\\\u2000-\\\\u206f \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000]|[A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde]|$)|(?:[A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde]|[^\\\\ud800-\\\\udfff\\\\xac\\\\xb1\\\\xd7\\\\xf7\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf\\\\u2000-\\\\u206f \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000\\\\d+\\\\u2700-\\\\u27bfa-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xffA-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde])+(?:['\\u2019](?:D|LL|M|RE|S|T|VE))?(?=[\\\\xac\\\\xb1\\\\xd7\\\\xf7\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf\\\\u2000-\\\\u206f \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000]|[A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde](?:[a-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xff]|[^\\\\ud800-\\\\udfff\\\\xac\\\\xb1\\\\xd7\\\\xf7\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf\\\\u2000-\\\\u206f \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000\\\\d+\\\\u2700-\\\\u27bfa-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xffA-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde])|$)|[A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde]?(?:[a-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xff]|[^\\\\ud800-\\\\udfff\\\\xac\\\\xb1\\\\xd7\\\\xf7\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf\\\\u2000-\\\\u206f \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000\\\\d+\\\\u2700-\\\\u27bfa-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xffA-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde])+(?:['\\u2019](?:d|ll|m|re|s|t|ve))?|[A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde]+(?:['\\u2019](?:D|LL|M|RE|S|T|VE))?|\\\\d*(?:1ST|2ND|3RD|(?![123])\\\\dTH)(?=\\\\b|[a-z_])|\\\\d*(?:1st|2nd|3rd|(?![123])\\\\dth)(?=\\\\b|[A-Z_])|\\\\d+\",An].join(\"|\"),\"g\"),Rn=RegExp(\"[\\\\u200d\\\\ud800-\\\\udfff\\\\u0300-\\\\u036f\\\\ufe20-\\\\ufe2f\\\\u20d0-\\\\u20ff\\\\ufe0e\\\\ufe0f]\"),zn=/[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/,Wn=\"Array Buffer DataView Date Error Float32Array Float64Array Function Int8Array Int16Array Int32Array Map Math Object Promise RegExp Set String Symbol TypeError Uint8Array Uint8ClampedArray Uint16Array Uint32Array WeakMap _ clearTimeout isFinite parseInt setTimeout\".split(\" \"),Bn={};\nBn[\"[object Float32Array]\"]=Bn[\"[object Float64Array]\"]=Bn[\"[object Int8Array]\"]=Bn[\"[object Int16Array]\"]=Bn[\"[object Int32Array]\"]=Bn[\"[object Uint8Array]\"]=Bn[\"[object Uint8ClampedArray]\"]=Bn[\"[object Uint16Array]\"]=Bn[\"[object Uint32Array]\"]=true,Bn[\"[object Arguments]\"]=Bn[\"[object Array]\"]=Bn[\"[object ArrayBuffer]\"]=Bn[\"[object Boolean]\"]=Bn[\"[object DataView]\"]=Bn[\"[object Date]\"]=Bn[\"[object Error]\"]=Bn[\"[object Function]\"]=Bn[\"[object Map]\"]=Bn[\"[object Number]\"]=Bn[\"[object Object]\"]=Bn[\"[object RegExp]\"]=Bn[\"[object Set]\"]=Bn[\"[object String]\"]=Bn[\"[object WeakMap]\"]=false;\nvar Ln={};Ln[\"[object Arguments]\"]=Ln[\"[object Array]\"]=Ln[\"[object ArrayBuffer]\"]=Ln[\"[object DataView]\"]=Ln[\"[object Boolean]\"]=Ln[\"[object Date]\"]=Ln[\"[object Float32Array]\"]=Ln[\"[object Float64Array]\"]=Ln[\"[object Int8Array]\"]=Ln[\"[object Int16Array]\"]=Ln[\"[object Int32Array]\"]=Ln[\"[object Map]\"]=Ln[\"[object Number]\"]=Ln[\"[object Object]\"]=Ln[\"[object RegExp]\"]=Ln[\"[object Set]\"]=Ln[\"[object String]\"]=Ln[\"[object Symbol]\"]=Ln[\"[object Uint8Array]\"]=Ln[\"[object Uint8ClampedArray]\"]=Ln[\"[object Uint16Array]\"]=Ln[\"[object Uint32Array]\"]=true,\nLn[\"[object Error]\"]=Ln[\"[object Function]\"]=Ln[\"[object WeakMap]\"]=false;var Un={\"\\\\\":\"\\\\\",\"'\":\"'\",\"\\n\":\"n\",\"\\r\":\"r\",\"\\u2028\":\"u2028\",\"\\u2029\":\"u2029\"},Cn=parseFloat,Dn=parseInt,Mn=typeof global==\"object\"&&global&&global.Object===Object&&global,Tn=typeof self==\"object\"&&self&&self.Object===Object&&self,$n=Mn||Tn||Function(\"return this\")(),Fn=typeof exports==\"object\"&&exports&&!exports.nodeType&&exports,Nn=Fn&&typeof module==\"object\"&&module&&!module.nodeType&&module,Pn=Nn&&Nn.exports===Fn,Zn=Pn&&Mn.process,qn=function(){\ntry{var n=Nn&&Nn.f&&Nn.f(\"util\").types;return n?n:Zn&&Zn.binding&&Zn.binding(\"util\")}catch(n){}}(),Vn=qn&&qn.isArrayBuffer,Kn=qn&&qn.isDate,Gn=qn&&qn.isMap,Hn=qn&&qn.isRegExp,Jn=qn&&qn.isSet,Yn=qn&&qn.isTypedArray,Qn=b(\"length\"),Xn=x({\"\\xc0\":\"A\",\"\\xc1\":\"A\",\"\\xc2\":\"A\",\"\\xc3\":\"A\",\"\\xc4\":\"A\",\"\\xc5\":\"A\",\"\\xe0\":\"a\",\"\\xe1\":\"a\",\"\\xe2\":\"a\",\"\\xe3\":\"a\",\"\\xe4\":\"a\",\"\\xe5\":\"a\",\"\\xc7\":\"C\",\"\\xe7\":\"c\",\"\\xd0\":\"D\",\"\\xf0\":\"d\",\"\\xc8\":\"E\",\"\\xc9\":\"E\",\"\\xca\":\"E\",\"\\xcb\":\"E\",\"\\xe8\":\"e\",\"\\xe9\":\"e\",\"\\xea\":\"e\",\"\\xeb\":\"e\",\"\\xcc\":\"I\",\n\"\\xcd\":\"I\",\"\\xce\":\"I\",\"\\xcf\":\"I\",\"\\xec\":\"i\",\"\\xed\":\"i\",\"\\xee\":\"i\",\"\\xef\":\"i\",\"\\xd1\":\"N\",\"\\xf1\":\"n\",\"\\xd2\":\"O\",\"\\xd3\":\"O\",\"\\xd4\":\"O\",\"\\xd5\":\"O\",\"\\xd6\":\"O\",\"\\xd8\":\"O\",\"\\xf2\":\"o\",\"\\xf3\":\"o\",\"\\xf4\":\"o\",\"\\xf5\":\"o\",\"\\xf6\":\"o\",\"\\xf8\":\"o\",\"\\xd9\":\"U\",\"\\xda\":\"U\",\"\\xdb\":\"U\",\"\\xdc\":\"U\",\"\\xf9\":\"u\",\"\\xfa\":\"u\",\"\\xfb\":\"u\",\"\\xfc\":\"u\",\"\\xdd\":\"Y\",\"\\xfd\":\"y\",\"\\xff\":\"y\",\"\\xc6\":\"Ae\",\"\\xe6\":\"ae\",\"\\xde\":\"Th\",\"\\xfe\":\"th\",\"\\xdf\":\"ss\",\"\\u0100\":\"A\",\"\\u0102\":\"A\",\"\\u0104\":\"A\",\"\\u0101\":\"a\",\"\\u0103\":\"a\",\"\\u0105\":\"a\",\"\\u0106\":\"C\",\n\"\\u0108\":\"C\",\"\\u010a\":\"C\",\"\\u010c\":\"C\",\"\\u0107\":\"c\",\"\\u0109\":\"c\",\"\\u010b\":\"c\",\"\\u010d\":\"c\",\"\\u010e\":\"D\",\"\\u0110\":\"D\",\"\\u010f\":\"d\",\"\\u0111\":\"d\",\"\\u0112\":\"E\",\"\\u0114\":\"E\",\"\\u0116\":\"E\",\"\\u0118\":\"E\",\"\\u011a\":\"E\",\"\\u0113\":\"e\",\"\\u0115\":\"e\",\"\\u0117\":\"e\",\"\\u0119\":\"e\",\"\\u011b\":\"e\",\"\\u011c\":\"G\",\"\\u011e\":\"G\",\"\\u0120\":\"G\",\"\\u0122\":\"G\",\"\\u011d\":\"g\",\"\\u011f\":\"g\",\"\\u0121\":\"g\",\"\\u0123\":\"g\",\"\\u0124\":\"H\",\"\\u0126\":\"H\",\"\\u0125\":\"h\",\"\\u0127\":\"h\",\"\\u0128\":\"I\",\"\\u012a\":\"I\",\"\\u012c\":\"I\",\"\\u012e\":\"I\",\"\\u0130\":\"I\",\"\\u0129\":\"i\",\n\"\\u012b\":\"i\",\"\\u012d\":\"i\",\"\\u012f\":\"i\",\"\\u0131\":\"i\",\"\\u0134\":\"J\",\"\\u0135\":\"j\",\"\\u0136\":\"K\",\"\\u0137\":\"k\",\"\\u0138\":\"k\",\"\\u0139\":\"L\",\"\\u013b\":\"L\",\"\\u013d\":\"L\",\"\\u013f\":\"L\",\"\\u0141\":\"L\",\"\\u013a\":\"l\",\"\\u013c\":\"l\",\"\\u013e\":\"l\",\"\\u0140\":\"l\",\"\\u0142\":\"l\",\"\\u0143\":\"N\",\"\\u0145\":\"N\",\"\\u0147\":\"N\",\"\\u014a\":\"N\",\"\\u0144\":\"n\",\"\\u0146\":\"n\",\"\\u0148\":\"n\",\"\\u014b\":\"n\",\"\\u014c\":\"O\",\"\\u014e\":\"O\",\"\\u0150\":\"O\",\"\\u014d\":\"o\",\"\\u014f\":\"o\",\"\\u0151\":\"o\",\"\\u0154\":\"R\",\"\\u0156\":\"R\",\"\\u0158\":\"R\",\"\\u0155\":\"r\",\"\\u0157\":\"r\",\"\\u0159\":\"r\",\n\"\\u015a\":\"S\",\"\\u015c\":\"S\",\"\\u015e\":\"S\",\"\\u0160\":\"S\",\"\\u015b\":\"s\",\"\\u015d\":\"s\",\"\\u015f\":\"s\",\"\\u0161\":\"s\",\"\\u0162\":\"T\",\"\\u0164\":\"T\",\"\\u0166\":\"T\",\"\\u0163\":\"t\",\"\\u0165\":\"t\",\"\\u0167\":\"t\",\"\\u0168\":\"U\",\"\\u016a\":\"U\",\"\\u016c\":\"U\",\"\\u016e\":\"U\",\"\\u0170\":\"U\",\"\\u0172\":\"U\",\"\\u0169\":\"u\",\"\\u016b\":\"u\",\"\\u016d\":\"u\",\"\\u016f\":\"u\",\"\\u0171\":\"u\",\"\\u0173\":\"u\",\"\\u0174\":\"W\",\"\\u0175\":\"w\",\"\\u0176\":\"Y\",\"\\u0177\":\"y\",\"\\u0178\":\"Y\",\"\\u0179\":\"Z\",\"\\u017b\":\"Z\",\"\\u017d\":\"Z\",\"\\u017a\":\"z\",\"\\u017c\":\"z\",\"\\u017e\":\"z\",\"\\u0132\":\"IJ\",\"\\u0133\":\"ij\",\n\"\\u0152\":\"Oe\",\"\\u0153\":\"oe\",\"\\u0149\":\"'n\",\"\\u017f\":\"s\"}),nt=x({\"&\":\"&\",\"<\":\"<\",\">\":\">\",'\"':\""\",\"'\":\"'\"}),tt=x({\"&\":\"&\",\"<\":\"<\",\">\":\">\",\""\":'\"',\"'\":\"'\"}),rt=function x(mn){function An(n){if(yu(n)&&!ff(n)&&!(n instanceof Un)){if(n instanceof On)return n;if(oi.call(n,\"__wrapped__\"))return Fe(n)}return new On(n)}function En(){}function On(n,t){this.__wrapped__=n,this.__actions__=[],this.__chain__=!!t,this.__index__=0,this.__values__=T}function Un(n){this.__wrapped__=n,\nthis.__actions__=[],this.__dir__=1,this.__filtered__=false,this.__iteratees__=[],this.__takeCount__=4294967295,this.__views__=[]}function Mn(n){var t=-1,r=null==n?0:n.length;for(this.clear();++t=t?n:t)),n}function _t(n,t,e,u,i,o){var f,c=1&t,a=2&t,l=4&t;if(e&&(f=i?e(n,u,i,o):e(n)),f!==T)return f;if(!du(n))return n;if(u=ff(n)){if(f=me(n),!c)return Ur(n,f)}else{var s=vo(n),h=\"[object Function]\"==s||\"[object GeneratorFunction]\"==s;if(af(n))return Ir(n,c);if(\"[object Object]\"==s||\"[object Arguments]\"==s||h&&!i){if(f=a||h?{}:Ae(n),!c)return a?Mr(n,lt(f,n)):Dr(n,at(f,n))}else{if(!Ln[s])return i?n:{};f=Ee(n,s,c)}}if(o||(o=new Zn),\ni=o.get(n))return i;o.set(n,f),pf(n)?n.forEach(function(r){f.add(_t(r,t,e,r,n,o))}):sf(n)&&n.forEach(function(r,u){f.set(u,_t(r,t,e,u,n,o))});var a=l?a?ve:_e:a?Bu:Wu,p=u?T:a(n);return r(p||n,function(r,u){p&&(u=r,r=n[u]),ot(f,u,_t(r,t,e,u,n,o))}),f}function vt(n){var t=Wu(n);return function(r){return gt(r,n,t)}}function gt(n,t,r){var e=r.length;if(null==n)return!e;for(n=Qu(n);e--;){var u=r[e],i=t[u],o=n[u];if(o===T&&!(u in n)||!i(o))return false}return true}function dt(n,t,r){if(typeof n!=\"function\")throw new ti(\"Expected a function\");\nreturn bo(function(){n.apply(T,r)},t)}function yt(n,t,r,e){var u=-1,i=o,a=true,l=n.length,s=[],h=t.length;if(!l)return s;r&&(t=c(t,k(r))),e?(i=f,a=false):200<=t.length&&(i=O,a=false,t=new Nn(t));n:for(;++ut}function Rt(n,t){return null!=n&&oi.call(n,t)}function zt(n,t){return null!=n&&t in Qu(n)}function Wt(n,t,r){for(var e=r?f:o,u=n[0].length,i=n.length,a=i,l=Ku(i),s=1/0,h=[];a--;){var p=n[a];a&&t&&(p=c(p,k(t))),s=Ci(p.length,s),\nl[a]=!r&&(t||120<=u&&120<=p.length)?new Nn(a&&p):T}var p=n[0],_=-1,v=l[0];n:for(;++_r.length?t:kt(t,hr(r,0,-1)),r=null==t?t:t[Me(Ve(r))],null==r?T:n(r,t,e)}function Ut(n){return yu(n)&&\"[object Arguments]\"==Ot(n)}function Ct(n){\nreturn yu(n)&&\"[object ArrayBuffer]\"==Ot(n)}function Dt(n){return yu(n)&&\"[object Date]\"==Ot(n)}function Mt(n,t,r,e,u){if(n===t)t=true;else if(null==n||null==t||!yu(n)&&!yu(t))t=n!==n&&t!==t;else n:{var i=ff(n),o=ff(t),f=i?\"[object Array]\":vo(n),c=o?\"[object Array]\":vo(t),f=\"[object Arguments]\"==f?\"[object Object]\":f,c=\"[object Arguments]\"==c?\"[object Object]\":c,a=\"[object Object]\"==f,o=\"[object Object]\"==c;if((c=f==c)&&af(n)){if(!af(t)){t=false;break n}i=true,a=false}if(c&&!a)u||(u=new Zn),t=i||_f(n)?se(n,t,r,e,Mt,u):he(n,t,f,r,e,Mt,u);else{\nif(!(1&r)&&(i=a&&oi.call(n,\"__wrapped__\"),f=o&&oi.call(t,\"__wrapped__\"),i||f)){n=i?n.value():n,t=f?t.value():t,u||(u=new Zn),t=Mt(n,t,r,e,u);break n}if(c)t:if(u||(u=new Zn),i=1&r,f=_e(n),o=f.length,c=_e(t).length,o==c||i){for(a=o;a--;){var l=f[a];if(!(i?l in t:oi.call(t,l))){t=false;break t}}if((c=u.get(n))&&u.get(t))t=c==t;else{c=true,u.set(n,t),u.set(t,n);for(var s=i;++at?r:0,Se(t,r)?n[t]:T}function Xt(n,t,r){var e=-1;return t=c(t.length?t:[$u],k(ye())),n=Gt(n,function(n){return{\na:c(t,function(t){return t(n)}),b:++e,c:n}}),w(n,function(n,t){var e;n:{e=-1;for(var u=n.a,i=t.a,o=u.length,f=r.length;++e=f?c:c*(\"desc\"==r[e]?-1:1);break n}}e=n.b-t.b}return e})}function nr(n,t){return tr(n,t,function(t,r){return zu(n,r)})}function tr(n,t,r){for(var e=-1,u=t.length,i={};++et||9007199254740991t&&(t=-t>u?0:u+t),r=r>u?u:r,0>r&&(r+=u),u=t>r?0:r-t>>>0,t>>>=0,r=Ku(u);++e=u){for(;e>>1,o=n[i];null!==o&&!wu(o)&&(r?o<=t:ot.length?n:kt(n,hr(t,0,-1)),null==n||delete n[Me(Ve(t))]}function jr(n,t,r,e){for(var u=n.length,i=e?u:-1;(e?i--:++ie)return e?br(n[0]):[];for(var u=-1,i=Ku(e);++u=e?n:hr(n,t,r)}function Ir(n,t){if(t)return n.slice();var r=n.length,r=gi?gi(r):new n.constructor(r);return n.copy(r),r}function Rr(n){var t=new n.constructor(n.byteLength);return new vi(t).set(new vi(n)),\nt}function zr(n,t){return new n.constructor(t?Rr(n.buffer):n.buffer,n.byteOffset,n.length)}function Wr(n,t){if(n!==t){var r=n!==T,e=null===n,u=n===n,i=wu(n),o=t!==T,f=null===t,c=t===t,a=wu(t);if(!f&&!a&&!i&&n>t||i&&o&&c&&!f&&!a||e&&o&&c||!r&&c||!u)return 1;if(!e&&!i&&!a&&nu?T:i,u=1),t=Qu(t);++eo&&f[0]!==a&&f[o-1]!==a?[]:L(f,a),\no-=c.length,or?r?or(t,n):t:(r=or(t,Oi(n/D(t))),Rn.test(t)?Or(M(r),0,n).join(\"\"):r.slice(0,n))}function te(t,r,e,u){function i(){for(var r=-1,c=arguments.length,a=-1,l=u.length,s=Ku(l+c),h=this&&this!==$n&&this instanceof i?f:t;++at||e)&&(1&n&&(i[2]=h[2],t|=1&r?0:4),(r=h[3])&&(e=i[3],i[3]=e?Br(e,r,h[4]):r,i[4]=e?L(i[3],\"__lodash_placeholder__\"):h[4]),(r=h[5])&&(e=i[5],i[5]=e?Lr(e,r,h[6]):r,i[6]=e?L(i[5],\"__lodash_placeholder__\"):h[6]),(r=h[7])&&(i[7]=r),128&n&&(i[8]=null==i[8]?h[8]:Ci(i[8],h[8])),null==i[9]&&(i[9]=h[9]),i[0]=h[0],i[1]=t),n=i[0],\nt=i[1],r=i[2],e=i[3],u=i[4],f=i[9]=i[9]===T?c?0:n.length:Ui(i[9]-a,0),!f&&24&t&&(t&=-25),Ue((h?co:yo)(t&&1!=t?8==t||16==t?Kr(n,t,f):32!=t&&33!=t||u.length?Jr.apply(T,i):te(n,t,r,e):Pr(n,t,r),i),n,t)}function ce(n,t,r,e){return n===T||lu(n,ei[r])&&!oi.call(e,r)?t:n}function ae(n,t,r,e,u,i){return du(n)&&du(t)&&(i.set(t,n),Yt(n,t,T,ae,i),i.delete(t)),n}function le(n){return xu(n)?T:n}function se(n,t,r,e,u,i){var o=1&r,f=n.length,c=t.length;if(f!=c&&!(o&&c>f))return false;if((c=i.get(n))&&i.get(t))return c==t;\nvar c=-1,a=true,l=2&r?new Nn:T;for(i.set(n,t),i.set(t,n);++cr&&(r=Ui(e+r,0)),_(n,ye(t,3),r)):-1}function Pe(n,t,r){var e=null==n?0:n.length;if(!e)return-1;var u=e-1;return r!==T&&(u=Eu(r),u=0>r?Ui(e+u,0):Ci(u,e-1)),\n_(n,ye(t,3),u,true)}function Ze(n){return(null==n?0:n.length)?wt(n,1):[]}function qe(n){return n&&n.length?n[0]:T}function Ve(n){var t=null==n?0:n.length;return t?n[t-1]:T}function Ke(n,t){return n&&n.length&&t&&t.length?er(n,t):n}function Ge(n){return null==n?n:$i.call(n)}function He(n){if(!n||!n.length)return[];var t=0;return n=i(n,function(n){if(hu(n))return t=Ui(n.length,t),true}),A(t,function(t){return c(n,b(t))})}function Je(t,r){if(!t||!t.length)return[];var e=He(t);return null==r?e:c(e,function(t){\nreturn n(r,T,t)})}function Ye(n){return n=An(n),n.__chain__=true,n}function Qe(n,t){return t(n)}function Xe(){return this}function nu(n,t){return(ff(n)?r:uo)(n,ye(t,3))}function tu(n,t){return(ff(n)?e:io)(n,ye(t,3))}function ru(n,t){return(ff(n)?c:Gt)(n,ye(t,3))}function eu(n,t,r){return t=r?T:t,t=n&&null==t?n.length:t,fe(n,128,T,T,T,T,t)}function uu(n,t){var r;if(typeof t!=\"function\")throw new ti(\"Expected a function\");return n=Eu(n),function(){return 0<--n&&(r=t.apply(this,arguments)),1>=n&&(t=T),\nr}}function iu(n,t,r){return t=r?T:t,n=fe(n,8,T,T,T,T,T,t),n.placeholder=iu.placeholder,n}function ou(n,t,r){return t=r?T:t,n=fe(n,16,T,T,T,T,T,t),n.placeholder=ou.placeholder,n}function fu(n,t,r){function e(t){var r=c,e=a;return c=a=T,_=t,s=n.apply(e,r)}function u(n){var r=n-p;return n-=_,p===T||r>=t||0>r||g&&n>=l}function i(){var n=Go();if(u(n))return o(n);var r,e=bo;r=n-_,n=t-(n-p),r=g?Ci(n,l-r):n,h=e(i,r)}function o(n){return h=T,d&&c?e(n):(c=a=T,s)}function f(){var n=Go(),r=u(n);if(c=arguments,\na=this,p=n,r){if(h===T)return _=n=p,h=bo(i,t),v?e(n):s;if(g)return lo(h),h=bo(i,t),e(p)}return h===T&&(h=bo(i,t)),s}var c,a,l,s,h,p,_=0,v=false,g=false,d=true;if(typeof n!=\"function\")throw new ti(\"Expected a function\");return t=Su(t)||0,du(r)&&(v=!!r.leading,l=(g=\"maxWait\"in r)?Ui(Su(r.maxWait)||0,t):l,d=\"trailing\"in r?!!r.trailing:d),f.cancel=function(){h!==T&&lo(h),_=0,c=p=a=h=T},f.flush=function(){return h===T?s:o(Go())},f}function cu(n,t){function r(){var e=arguments,u=t?t.apply(this,e):e[0],i=r.cache;\nreturn i.has(u)?i.get(u):(e=n.apply(this,e),r.cache=i.set(u,e)||i,e)}if(typeof n!=\"function\"||null!=t&&typeof t!=\"function\")throw new ti(\"Expected a function\");return r.cache=new(cu.Cache||Fn),r}function au(n){if(typeof n!=\"function\")throw new ti(\"Expected a function\");return function(){var t=arguments;switch(t.length){case 0:return!n.call(this);case 1:return!n.call(this,t[0]);case 2:return!n.call(this,t[0],t[1]);case 3:return!n.call(this,t[0],t[1],t[2])}return!n.apply(this,t)}}function lu(n,t){return n===t||n!==n&&t!==t;\n}function su(n){return null!=n&&gu(n.length)&&!_u(n)}function hu(n){return yu(n)&&su(n)}function pu(n){if(!yu(n))return false;var t=Ot(n);return\"[object Error]\"==t||\"[object DOMException]\"==t||typeof n.message==\"string\"&&typeof n.name==\"string\"&&!xu(n)}function _u(n){return!!du(n)&&(n=Ot(n),\"[object Function]\"==n||\"[object GeneratorFunction]\"==n||\"[object AsyncFunction]\"==n||\"[object Proxy]\"==n)}function vu(n){return typeof n==\"number\"&&n==Eu(n)}function gu(n){return typeof n==\"number\"&&-1=n;\n}function du(n){var t=typeof n;return null!=n&&(\"object\"==t||\"function\"==t)}function yu(n){return null!=n&&typeof n==\"object\"}function bu(n){return typeof n==\"number\"||yu(n)&&\"[object Number]\"==Ot(n)}function xu(n){return!(!yu(n)||\"[object Object]\"!=Ot(n))&&(n=di(n),null===n||(n=oi.call(n,\"constructor\")&&n.constructor,typeof n==\"function\"&&n instanceof n&&ii.call(n)==li))}function ju(n){return typeof n==\"string\"||!ff(n)&&yu(n)&&\"[object String]\"==Ot(n)}function wu(n){return typeof n==\"symbol\"||yu(n)&&\"[object Symbol]\"==Ot(n);\n}function mu(n){if(!n)return[];if(su(n))return ju(n)?M(n):Ur(n);if(wi&&n[wi]){n=n[wi]();for(var t,r=[];!(t=n.next()).done;)r.push(t.value);return r}return t=vo(n),(\"[object Map]\"==t?W:\"[object Set]\"==t?U:Uu)(n)}function Au(n){return n?(n=Su(n),n===$||n===-$?1.7976931348623157e308*(0>n?-1:1):n===n?n:0):0===n?n:0}function Eu(n){n=Au(n);var t=n%1;return n===n?t?n-t:n:0}function ku(n){return n?pt(Eu(n),0,4294967295):0}function Su(n){if(typeof n==\"number\")return n;if(wu(n))return F;if(du(n)&&(n=typeof n.valueOf==\"function\"?n.valueOf():n,\nn=du(n)?n+\"\":n),typeof n!=\"string\")return 0===n?n:+n;n=n.replace(un,\"\");var t=gn.test(n);return t||yn.test(n)?Dn(n.slice(2),t?2:8):vn.test(n)?F:+n}function Ou(n){return Cr(n,Bu(n))}function Iu(n){return null==n?\"\":yr(n)}function Ru(n,t,r){return n=null==n?T:kt(n,t),n===T?r:n}function zu(n,t){return null!=n&&we(n,t,zt)}function Wu(n){return su(n)?qn(n):Vt(n)}function Bu(n){if(su(n))n=qn(n,true);else if(du(n)){var t,r=ze(n),e=[];for(t in n)(\"constructor\"!=t||!r&&oi.call(n,t))&&e.push(t);n=e}else{if(t=[],\nnull!=n)for(r in Qu(n))t.push(r);n=t}return n}function Lu(n,t){if(null==n)return{};var r=c(ve(n),function(n){return[n]});return t=ye(t),tr(n,r,function(n,r){return t(n,r[0])})}function Uu(n){return null==n?[]:S(n,Wu(n))}function Cu(n){return $f(Iu(n).toLowerCase())}function Du(n){return(n=Iu(n))&&n.replace(xn,Xn).replace(Sn,\"\")}function Mu(n,t,r){return n=Iu(n),t=r?T:t,t===T?zn.test(n)?n.match(In)||[]:n.match(sn)||[]:n.match(t)||[]}function Tu(n){return function(){return n}}function $u(n){return n;\n}function Fu(n){return qt(typeof n==\"function\"?n:_t(n,1))}function Nu(n,t,e){var u=Wu(t),i=Et(t,u);null!=e||du(t)&&(i.length||!u.length)||(e=t,t=n,n=this,i=Et(t,Wu(t)));var o=!(du(e)&&\"chain\"in e&&!e.chain),f=_u(n);return r(i,function(r){var e=t[r];n[r]=e,f&&(n.prototype[r]=function(){var t=this.__chain__;if(o||t){var r=n(this.__wrapped__);return(r.__actions__=Ur(this.__actions__)).push({func:e,args:arguments,thisArg:n}),r.__chain__=t,r}return e.apply(n,a([this.value()],arguments))})}),n}function Pu(){}\nfunction Zu(n){return Ie(n)?b(Me(n)):rr(n)}function qu(){return[]}function Vu(){return false}mn=null==mn?$n:rt.defaults($n.Object(),mn,rt.pick($n,Wn));var Ku=mn.Array,Gu=mn.Date,Hu=mn.Error,Ju=mn.Function,Yu=mn.Math,Qu=mn.Object,Xu=mn.RegExp,ni=mn.String,ti=mn.TypeError,ri=Ku.prototype,ei=Qu.prototype,ui=mn[\"__core-js_shared__\"],ii=Ju.prototype.toString,oi=ei.hasOwnProperty,fi=0,ci=function(){var n=/[^.]+$/.exec(ui&&ui.keys&&ui.keys.IE_PROTO||\"\");return n?\"Symbol(src)_1.\"+n:\"\"}(),ai=ei.toString,li=ii.call(Qu),si=$n._,hi=Xu(\"^\"+ii.call(oi).replace(rn,\"\\\\$&\").replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g,\"$1.*?\")+\"$\"),pi=Pn?mn.Buffer:T,_i=mn.Symbol,vi=mn.Uint8Array,gi=pi?pi.g:T,di=B(Qu.getPrototypeOf,Qu),yi=Qu.create,bi=ei.propertyIsEnumerable,xi=ri.splice,ji=_i?_i.isConcatSpreadable:T,wi=_i?_i.iterator:T,mi=_i?_i.toStringTag:T,Ai=function(){\ntry{var n=je(Qu,\"defineProperty\");return n({},\"\",{}),n}catch(n){}}(),Ei=mn.clearTimeout!==$n.clearTimeout&&mn.clearTimeout,ki=Gu&&Gu.now!==$n.Date.now&&Gu.now,Si=mn.setTimeout!==$n.setTimeout&&mn.setTimeout,Oi=Yu.ceil,Ii=Yu.floor,Ri=Qu.getOwnPropertySymbols,zi=pi?pi.isBuffer:T,Wi=mn.isFinite,Bi=ri.join,Li=B(Qu.keys,Qu),Ui=Yu.max,Ci=Yu.min,Di=Gu.now,Mi=mn.parseInt,Ti=Yu.random,$i=ri.reverse,Fi=je(mn,\"DataView\"),Ni=je(mn,\"Map\"),Pi=je(mn,\"Promise\"),Zi=je(mn,\"Set\"),qi=je(mn,\"WeakMap\"),Vi=je(Qu,\"create\"),Ki=qi&&new qi,Gi={},Hi=Te(Fi),Ji=Te(Ni),Yi=Te(Pi),Qi=Te(Zi),Xi=Te(qi),no=_i?_i.prototype:T,to=no?no.valueOf:T,ro=no?no.toString:T,eo=function(){\nfunction n(){}return function(t){return du(t)?yi?yi(t):(n.prototype=t,t=new n,n.prototype=T,t):{}}}();An.templateSettings={escape:J,evaluate:Y,interpolate:Q,variable:\"\",imports:{_:An}},An.prototype=En.prototype,An.prototype.constructor=An,On.prototype=eo(En.prototype),On.prototype.constructor=On,Un.prototype=eo(En.prototype),Un.prototype.constructor=Un,Mn.prototype.clear=function(){this.__data__=Vi?Vi(null):{},this.size=0},Mn.prototype.delete=function(n){return n=this.has(n)&&delete this.__data__[n],\nthis.size-=n?1:0,n},Mn.prototype.get=function(n){var t=this.__data__;return Vi?(n=t[n],\"__lodash_hash_undefined__\"===n?T:n):oi.call(t,n)?t[n]:T},Mn.prototype.has=function(n){var t=this.__data__;return Vi?t[n]!==T:oi.call(t,n)},Mn.prototype.set=function(n,t){var r=this.__data__;return this.size+=this.has(n)?0:1,r[n]=Vi&&t===T?\"__lodash_hash_undefined__\":t,this},Tn.prototype.clear=function(){this.__data__=[],this.size=0},Tn.prototype.delete=function(n){var t=this.__data__;return n=ft(t,n),!(0>n)&&(n==t.length-1?t.pop():xi.call(t,n,1),\n--this.size,true)},Tn.prototype.get=function(n){var t=this.__data__;return n=ft(t,n),0>n?T:t[n][1]},Tn.prototype.has=function(n){return-1e?(++this.size,r.push([n,t])):r[e][1]=t,this},Fn.prototype.clear=function(){this.size=0,this.__data__={hash:new Mn,map:new(Ni||Tn),string:new Mn}},Fn.prototype.delete=function(n){return n=be(this,n).delete(n),this.size-=n?1:0,n},Fn.prototype.get=function(n){return be(this,n).get(n);\n},Fn.prototype.has=function(n){return be(this,n).has(n)},Fn.prototype.set=function(n,t){var r=be(this,n),e=r.size;return r.set(n,t),this.size+=r.size==e?0:1,this},Nn.prototype.add=Nn.prototype.push=function(n){return this.__data__.set(n,\"__lodash_hash_undefined__\"),this},Nn.prototype.has=function(n){return this.__data__.has(n)},Zn.prototype.clear=function(){this.__data__=new Tn,this.size=0},Zn.prototype.delete=function(n){var t=this.__data__;return n=t.delete(n),this.size=t.size,n},Zn.prototype.get=function(n){\nreturn this.__data__.get(n)},Zn.prototype.has=function(n){return this.__data__.has(n)},Zn.prototype.set=function(n,t){var r=this.__data__;if(r instanceof Tn){var e=r.__data__;if(!Ni||199>e.length)return e.push([n,t]),this.size=++r.size,this;r=this.__data__=new Fn(e)}return r.set(n,t),this.size=r.size,this};var uo=Fr(mt),io=Fr(At,true),oo=Nr(),fo=Nr(true),co=Ki?function(n,t){return Ki.set(n,t),n}:$u,ao=Ai?function(n,t){return Ai(n,\"toString\",{configurable:true,enumerable:false,value:Tu(t),writable:true})}:$u,lo=Ei||function(n){\nreturn $n.clearTimeout(n)},so=Zi&&1/U(new Zi([,-0]))[1]==$?function(n){return new Zi(n)}:Pu,ho=Ki?function(n){return Ki.get(n)}:Pu,po=Ri?function(n){return null==n?[]:(n=Qu(n),i(Ri(n),function(t){return bi.call(n,t)}))}:qu,_o=Ri?function(n){for(var t=[];n;)a(t,po(n)),n=di(n);return t}:qu,vo=Ot;(Fi&&\"[object DataView]\"!=vo(new Fi(new ArrayBuffer(1)))||Ni&&\"[object Map]\"!=vo(new Ni)||Pi&&\"[object Promise]\"!=vo(Pi.resolve())||Zi&&\"[object Set]\"!=vo(new Zi)||qi&&\"[object WeakMap]\"!=vo(new qi))&&(vo=function(n){\nvar t=Ot(n);if(n=(n=\"[object Object]\"==t?n.constructor:T)?Te(n):\"\")switch(n){case Hi:return\"[object DataView]\";case Ji:return\"[object Map]\";case Yi:return\"[object Promise]\";case Qi:return\"[object Set]\";case Xi:return\"[object WeakMap]\"}return t});var go=ui?_u:Vu,yo=Ce(co),bo=Si||function(n,t){return $n.setTimeout(n,t)},xo=Ce(ao),jo=function(n){n=cu(n,function(n){return 500===t.size&&t.clear(),n});var t=n.cache;return n}(function(n){var t=[];return 46===n.charCodeAt(0)&&t.push(\"\"),n.replace(tn,function(n,r,e,u){\nt.push(e?u.replace(hn,\"$1\"):r||n)}),t}),wo=fr(function(n,t){return hu(n)?yt(n,wt(t,1,hu,true)):[]}),mo=fr(function(n,t){var r=Ve(t);return hu(r)&&(r=T),hu(n)?yt(n,wt(t,1,hu,true),ye(r,2)):[]}),Ao=fr(function(n,t){var r=Ve(t);return hu(r)&&(r=T),hu(n)?yt(n,wt(t,1,hu,true),T,r):[]}),Eo=fr(function(n){var t=c(n,Er);return t.length&&t[0]===n[0]?Wt(t):[]}),ko=fr(function(n){var t=Ve(n),r=c(n,Er);return t===Ve(r)?t=T:r.pop(),r.length&&r[0]===n[0]?Wt(r,ye(t,2)):[]}),So=fr(function(n){var t=Ve(n),r=c(n,Er);return(t=typeof t==\"function\"?t:T)&&r.pop(),\nr.length&&r[0]===n[0]?Wt(r,T,t):[]}),Oo=fr(Ke),Io=pe(function(n,t){var r=null==n?0:n.length,e=ht(n,t);return ur(n,c(t,function(n){return Se(n,r)?+n:n}).sort(Wr)),e}),Ro=fr(function(n){return br(wt(n,1,hu,true))}),zo=fr(function(n){var t=Ve(n);return hu(t)&&(t=T),br(wt(n,1,hu,true),ye(t,2))}),Wo=fr(function(n){var t=Ve(n),t=typeof t==\"function\"?t:T;return br(wt(n,1,hu,true),T,t)}),Bo=fr(function(n,t){return hu(n)?yt(n,t):[]}),Lo=fr(function(n){return mr(i(n,hu))}),Uo=fr(function(n){var t=Ve(n);return hu(t)&&(t=T),\nmr(i(n,hu),ye(t,2))}),Co=fr(function(n){var t=Ve(n),t=typeof t==\"function\"?t:T;return mr(i(n,hu),T,t)}),Do=fr(He),Mo=fr(function(n){var t=n.length,t=1=t}),of=Ut(function(){return arguments}())?Ut:function(n){return yu(n)&&oi.call(n,\"callee\")&&!bi.call(n,\"callee\")},ff=Ku.isArray,cf=Vn?k(Vn):Ct,af=zi||Vu,lf=Kn?k(Kn):Dt,sf=Gn?k(Gn):Tt,hf=Hn?k(Hn):Nt,pf=Jn?k(Jn):Pt,_f=Yn?k(Yn):Zt,vf=ee(Kt),gf=ee(function(n,t){return n<=t}),df=$r(function(n,t){\nif(ze(t)||su(t))Cr(t,Wu(t),n);else for(var r in t)oi.call(t,r)&&ot(n,r,t[r])}),yf=$r(function(n,t){Cr(t,Bu(t),n)}),bf=$r(function(n,t,r,e){Cr(t,Bu(t),n,e)}),xf=$r(function(n,t,r,e){Cr(t,Wu(t),n,e)}),jf=pe(ht),wf=fr(function(n,t){n=Qu(n);var r=-1,e=t.length,u=2--n)return t.apply(this,arguments)}},An.ary=eu,An.assign=df,An.assignIn=yf,An.assignInWith=bf,An.assignWith=xf,An.at=jf,An.before=uu,An.bind=Ho,An.bindAll=Nf,An.bindKey=Jo,An.castArray=function(){if(!arguments.length)return[];var n=arguments[0];return ff(n)?n:[n]},An.chain=Ye,An.chunk=function(n,t,r){if(t=(r?Oe(n,t,r):t===T)?1:Ui(Eu(t),0),r=null==n?0:n.length,!r||1>t)return[];for(var e=0,u=0,i=Ku(Oi(r/t));et?0:t,e)):[]},An.dropRight=function(n,t,r){var e=null==n?0:n.length;return e?(t=r||t===T?1:Eu(t),t=e-t,hr(n,0,0>t?0:t)):[]},An.dropRightWhile=function(n,t){return n&&n.length?jr(n,ye(t,3),true,true):[];\n},An.dropWhile=function(n,t){return n&&n.length?jr(n,ye(t,3),true):[]},An.fill=function(n,t,r,e){var u=null==n?0:n.length;if(!u)return[];for(r&&typeof r!=\"number\"&&Oe(n,t,r)&&(r=0,e=u),u=n.length,r=Eu(r),0>r&&(r=-r>u?0:u+r),e=e===T||e>u?u:Eu(e),0>e&&(e+=u),e=r>e?0:ku(e);r>>0,r?(n=Iu(n))&&(typeof t==\"string\"||null!=t&&!hf(t))&&(t=yr(t),!t&&Rn.test(n))?Or(M(n),0,r):n.split(t,r):[]},An.spread=function(t,r){if(typeof t!=\"function\")throw new ti(\"Expected a function\");return r=null==r?0:Ui(Eu(r),0),\nfr(function(e){var u=e[r];return e=Or(e,0,r),u&&a(e,u),n(t,this,e)})},An.tail=function(n){var t=null==n?0:n.length;return t?hr(n,1,t):[]},An.take=function(n,t,r){return n&&n.length?(t=r||t===T?1:Eu(t),hr(n,0,0>t?0:t)):[]},An.takeRight=function(n,t,r){var e=null==n?0:n.length;return e?(t=r||t===T?1:Eu(t),t=e-t,hr(n,0>t?0:t,e)):[]},An.takeRightWhile=function(n,t){return n&&n.length?jr(n,ye(t,3),false,true):[]},An.takeWhile=function(n,t){return n&&n.length?jr(n,ye(t,3)):[]},An.tap=function(n,t){return t(n),\nn},An.throttle=function(n,t,r){var e=true,u=true;if(typeof n!=\"function\")throw new ti(\"Expected a function\");return du(r)&&(e=\"leading\"in r?!!r.leading:e,u=\"trailing\"in r?!!r.trailing:u),fu(n,t,{leading:e,maxWait:t,trailing:u})},An.thru=Qe,An.toArray=mu,An.toPairs=zf,An.toPairsIn=Wf,An.toPath=function(n){return ff(n)?c(n,Me):wu(n)?[n]:Ur(jo(Iu(n)))},An.toPlainObject=Ou,An.transform=function(n,t,e){var u=ff(n),i=u||af(n)||_f(n);if(t=ye(t,4),null==e){var o=n&&n.constructor;e=i?u?new o:[]:du(n)&&_u(o)?eo(di(n)):{};\n}return(i?r:mt)(n,function(n,r,u){return t(e,n,r,u)}),e},An.unary=function(n){return eu(n,1)},An.union=Ro,An.unionBy=zo,An.unionWith=Wo,An.uniq=function(n){return n&&n.length?br(n):[]},An.uniqBy=function(n,t){return n&&n.length?br(n,ye(t,2)):[]},An.uniqWith=function(n,t){return t=typeof t==\"function\"?t:T,n&&n.length?br(n,T,t):[]},An.unset=function(n,t){return null==n||xr(n,t)},An.unzip=He,An.unzipWith=Je,An.update=function(n,t,r){return null==n?n:lr(n,t,kr(r)(kt(n,t)),void 0)},An.updateWith=function(n,t,r,e){\nreturn e=typeof e==\"function\"?e:T,null!=n&&(n=lr(n,t,kr(r)(kt(n,t)),e)),n},An.values=Uu,An.valuesIn=function(n){return null==n?[]:S(n,Bu(n))},An.without=Bo,An.words=Mu,An.wrap=function(n,t){return nf(kr(t),n)},An.xor=Lo,An.xorBy=Uo,An.xorWith=Co,An.zip=Do,An.zipObject=function(n,t){return Ar(n||[],t||[],ot)},An.zipObjectDeep=function(n,t){return Ar(n||[],t||[],lr)},An.zipWith=Mo,An.entries=zf,An.entriesIn=Wf,An.extend=yf,An.extendWith=bf,Nu(An,An),An.add=Qf,An.attempt=Ff,An.camelCase=Bf,An.capitalize=Cu,\nAn.ceil=Xf,An.clamp=function(n,t,r){return r===T&&(r=t,t=T),r!==T&&(r=Su(r),r=r===r?r:0),t!==T&&(t=Su(t),t=t===t?t:0),pt(Su(n),t,r)},An.clone=function(n){return _t(n,4)},An.cloneDeep=function(n){return _t(n,5)},An.cloneDeepWith=function(n,t){return t=typeof t==\"function\"?t:T,_t(n,5,t)},An.cloneWith=function(n,t){return t=typeof t==\"function\"?t:T,_t(n,4,t)},An.conformsTo=function(n,t){return null==t||gt(n,t,Wu(t))},An.deburr=Du,An.defaultTo=function(n,t){return null==n||n!==n?t:n},An.divide=nc,An.endsWith=function(n,t,r){\nn=Iu(n),t=yr(t);var e=n.length,e=r=r===T?e:pt(Eu(r),0,e);return r-=t.length,0<=r&&n.slice(r,e)==t},An.eq=lu,An.escape=function(n){return(n=Iu(n))&&H.test(n)?n.replace(K,nt):n},An.escapeRegExp=function(n){return(n=Iu(n))&&en.test(n)?n.replace(rn,\"\\\\$&\"):n},An.every=function(n,t,r){var e=ff(n)?u:bt;return r&&Oe(n,t,r)&&(t=T),e(n,ye(t,3))},An.find=Fo,An.findIndex=Ne,An.findKey=function(n,t){return p(n,ye(t,3),mt)},An.findLast=No,An.findLastIndex=Pe,An.findLastKey=function(n,t){return p(n,ye(t,3),At);\n},An.floor=tc,An.forEach=nu,An.forEachRight=tu,An.forIn=function(n,t){return null==n?n:oo(n,ye(t,3),Bu)},An.forInRight=function(n,t){return null==n?n:fo(n,ye(t,3),Bu)},An.forOwn=function(n,t){return n&&mt(n,ye(t,3))},An.forOwnRight=function(n,t){return n&&At(n,ye(t,3))},An.get=Ru,An.gt=ef,An.gte=uf,An.has=function(n,t){return null!=n&&we(n,t,Rt)},An.hasIn=zu,An.head=qe,An.identity=$u,An.includes=function(n,t,r,e){return n=su(n)?n:Uu(n),r=r&&!e?Eu(r):0,e=n.length,0>r&&(r=Ui(e+r,0)),ju(n)?r<=e&&-1r&&(r=Ui(e+r,0)),v(n,t,r)):-1},An.inRange=function(n,t,r){return t=Au(t),r===T?(r=t,t=0):r=Au(r),n=Su(n),n>=Ci(t,r)&&n=n},An.isSet=pf,An.isString=ju,An.isSymbol=wu,An.isTypedArray=_f,An.isUndefined=function(n){return n===T},An.isWeakMap=function(n){return yu(n)&&\"[object WeakMap]\"==vo(n)},An.isWeakSet=function(n){return yu(n)&&\"[object WeakSet]\"==Ot(n)},An.join=function(n,t){return null==n?\"\":Bi.call(n,t)},An.kebabCase=Lf,An.last=Ve,An.lastIndexOf=function(n,t,r){var e=null==n?0:n.length;if(!e)return-1;var u=e;if(r!==T&&(u=Eu(r),u=0>u?Ui(e+u,0):Ci(u,e-1)),\nt===t){for(r=u+1;r--&&n[r]!==t;);n=r}else n=_(n,d,u,true);return n},An.lowerCase=Uf,An.lowerFirst=Cf,An.lt=vf,An.lte=gf,An.max=function(n){return n&&n.length?xt(n,$u,It):T},An.maxBy=function(n,t){return n&&n.length?xt(n,ye(t,2),It):T},An.mean=function(n){return y(n,$u)},An.meanBy=function(n,t){return y(n,ye(t,2))},An.min=function(n){return n&&n.length?xt(n,$u,Kt):T},An.minBy=function(n,t){return n&&n.length?xt(n,ye(t,2),Kt):T},An.stubArray=qu,An.stubFalse=Vu,An.stubObject=function(){return{}},An.stubString=function(){\nreturn\"\"},An.stubTrue=function(){return true},An.multiply=rc,An.nth=function(n,t){return n&&n.length?Qt(n,Eu(t)):T},An.noConflict=function(){return $n._===this&&($n._=si),this},An.noop=Pu,An.now=Go,An.pad=function(n,t,r){n=Iu(n);var e=(t=Eu(t))?D(n):0;return!t||e>=t?n:(t=(t-e)/2,ne(Ii(t),r)+n+ne(Oi(t),r))},An.padEnd=function(n,t,r){n=Iu(n);var e=(t=Eu(t))?D(n):0;return t&&et){var e=n;n=t,t=e}return r||n%1||t%1?(r=Ti(),Ci(n+r*(t-n+Cn(\"1e-\"+((r+\"\").length-1))),t)):ir(n,t)},An.reduce=function(n,t,r){var e=ff(n)?l:j,u=3>arguments.length;return e(n,ye(t,4),r,u,uo)},An.reduceRight=function(n,t,r){var e=ff(n)?s:j,u=3>arguments.length;\nreturn e(n,ye(t,4),r,u,io)},An.repeat=function(n,t,r){return t=(r?Oe(n,t,r):t===T)?1:Eu(t),or(Iu(n),t)},An.replace=function(){var n=arguments,t=Iu(n[0]);return 3>n.length?t:t.replace(n[1],n[2])},An.result=function(n,t,r){t=Sr(t,n);var e=-1,u=t.length;for(u||(u=1,n=T);++en||9007199254740991=i)return n;if(i=r-D(e),1>i)return e;if(r=o?Or(o,0,i).join(\"\"):n.slice(0,i),u===T)return r+e;if(o&&(i+=r.length-i),hf(u)){if(n.slice(i).search(u)){\nvar f=r;for(u.global||(u=Xu(u.source,Iu(_n.exec(u))+\"g\")),u.lastIndex=0;o=u.exec(f);)var c=o.index;r=r.slice(0,c===T?i:c)}}else n.indexOf(yr(u),i)!=i&&(u=r.lastIndexOf(u),-1e.__dir__?\"Right\":\"\")}),e},Un.prototype[n+\"Right\"]=function(t){return this.reverse()[n](t).reverse()}}),r([\"filter\",\"map\",\"takeWhile\"],function(n,t){\nvar r=t+1,e=1==r||3==r;Un.prototype[n]=function(n){var t=this.clone();return t.__iteratees__.push({iteratee:ye(n,3),type:r}),t.__filtered__=t.__filtered__||e,t}}),r([\"head\",\"last\"],function(n,t){var r=\"take\"+(t?\"Right\":\"\");Un.prototype[n]=function(){return this[r](1).value()[0]}}),r([\"initial\",\"tail\"],function(n,t){var r=\"drop\"+(t?\"\":\"Right\");Un.prototype[n]=function(){return this.__filtered__?new Un(this):this[r](1)}}),Un.prototype.compact=function(){return this.filter($u)},Un.prototype.find=function(n){\nreturn this.filter(n).head()},Un.prototype.findLast=function(n){return this.reverse().find(n)},Un.prototype.invokeMap=fr(function(n,t){return typeof n==\"function\"?new Un(this):this.map(function(r){return Lt(r,n,t)})}),Un.prototype.reject=function(n){return this.filter(au(ye(n)))},Un.prototype.slice=function(n,t){n=Eu(n);var r=this;return r.__filtered__&&(0t)?new Un(r):(0>n?r=r.takeRight(-n):n&&(r=r.drop(n)),t!==T&&(t=Eu(t),r=0>t?r.dropRight(-t):r.take(t-n)),r)},Un.prototype.takeRightWhile=function(n){\nreturn this.reverse().takeWhile(n).reverse()},Un.prototype.toArray=function(){return this.take(4294967295)},mt(Un.prototype,function(n,t){var r=/^(?:filter|find|map|reject)|While$/.test(t),e=/^(?:head|last)$/.test(t),u=An[e?\"take\"+(\"last\"==t?\"Right\":\"\"):t],i=e||/^find/.test(t);u&&(An.prototype[t]=function(){function t(n){return n=u.apply(An,a([n],f)),e&&h?n[0]:n}var o=this.__wrapped__,f=e?[1]:arguments,c=o instanceof Un,l=f[0],s=c||ff(o);s&&r&&typeof l==\"function\"&&1!=l.length&&(c=s=false);var h=this.__chain__,p=!!this.__actions__.length,l=i&&!h,c=c&&!p;\nreturn!i&&s?(o=c?o:new Un(this),o=n.apply(o,f),o.__actions__.push({func:Qe,args:[t],thisArg:T}),new On(o,h)):l&&c?n.apply(this,f):(o=this.thru(t),l?e?o.value()[0]:o.value():o)})}),r(\"pop push shift sort splice unshift\".split(\" \"),function(n){var t=ri[n],r=/^(?:push|sort|unshift)$/.test(n)?\"tap\":\"thru\",e=/^(?:pop|shift)$/.test(n);An.prototype[n]=function(){var n=arguments;if(e&&!this.__chain__){var u=this.value();return t.apply(ff(u)?u:[],n)}return this[r](function(r){return t.apply(ff(r)?r:[],n)});\n}}),mt(Un.prototype,function(n,t){var r=An[t];if(r){var e=r.name+\"\";oi.call(Gi,e)||(Gi[e]=[]),Gi[e].push({name:t,func:r})}}),Gi[Jr(T,2).name]=[{name:\"wrapper\",func:T}],Un.prototype.clone=function(){var n=new Un(this.__wrapped__);return n.__actions__=Ur(this.__actions__),n.__dir__=this.__dir__,n.__filtered__=this.__filtered__,n.__iteratees__=Ur(this.__iteratees__),n.__takeCount__=this.__takeCount__,n.__views__=Ur(this.__views__),n},Un.prototype.reverse=function(){if(this.__filtered__){var n=new Un(this);\nn.__dir__=-1,n.__filtered__=true}else n=this.clone(),n.__dir__*=-1;return n},Un.prototype.value=function(){var n,t=this.__wrapped__.value(),r=this.__dir__,e=ff(t),u=0>r,i=e?t.length:0;n=i;for(var o=this.__views__,f=0,c=-1,a=o.length;++c=this.__values__.length;return{done:n,value:n?T:this.__values__[this.__index__++]}},An.prototype.plant=function(n){\nfor(var t,r=this;r instanceof En;){var e=Fe(r);e.__index__=0,e.__values__=T,t?u.__wrapped__=e:t=e;var u=e,r=r.__wrapped__}return u.__wrapped__=n,t},An.prototype.reverse=function(){var n=this.__wrapped__;return n instanceof Un?(this.__actions__.length&&(n=new Un(this)),n=n.reverse(),n.__actions__.push({func:Qe,args:[Ge],thisArg:T}),new On(n,this.__chain__)):this.thru(Ge)},An.prototype.toJSON=An.prototype.valueOf=An.prototype.value=function(){return wr(this.__wrapped__,this.__actions__)},An.prototype.first=An.prototype.head,\nwi&&(An.prototype[wi]=Xe),An}();typeof define==\"function\"&&typeof define.amd==\"object\"&&define.amd?($n._=rt, define(function(){return rt})):Nn?((Nn.exports=rt)._=rt,Fn._=rt):$n._=rt}).call(this);","/** Used to map aliases to their real names. */\nexports.aliasToReal = {\n\n // Lodash aliases.\n 'each': 'forEach',\n 'eachRight': 'forEachRight',\n 'entries': 'toPairs',\n 'entriesIn': 'toPairsIn',\n 'extend': 'assignIn',\n 'extendAll': 'assignInAll',\n 'extendAllWith': 'assignInAllWith',\n 'extendWith': 'assignInWith',\n 'first': 'head',\n\n // Methods that are curried variants of others.\n 'conforms': 'conformsTo',\n 'matches': 'isMatch',\n 'property': 'get',\n\n // Ramda aliases.\n '__': 'placeholder',\n 'F': 'stubFalse',\n 'T': 'stubTrue',\n 'all': 'every',\n 'allPass': 'overEvery',\n 'always': 'constant',\n 'any': 'some',\n 'anyPass': 'overSome',\n 'apply': 'spread',\n 'assoc': 'set',\n 'assocPath': 'set',\n 'complement': 'negate',\n 'compose': 'flowRight',\n 'contains': 'includes',\n 'dissoc': 'unset',\n 'dissocPath': 'unset',\n 'dropLast': 'dropRight',\n 'dropLastWhile': 'dropRightWhile',\n 'equals': 'isEqual',\n 'identical': 'eq',\n 'indexBy': 'keyBy',\n 'init': 'initial',\n 'invertObj': 'invert',\n 'juxt': 'over',\n 'omitAll': 'omit',\n 'nAry': 'ary',\n 'path': 'get',\n 'pathEq': 'matchesProperty',\n 'pathOr': 'getOr',\n 'paths': 'at',\n 'pickAll': 'pick',\n 'pipe': 'flow',\n 'pluck': 'map',\n 'prop': 'get',\n 'propEq': 'matchesProperty',\n 'propOr': 'getOr',\n 'props': 'at',\n 'symmetricDifference': 'xor',\n 'symmetricDifferenceBy': 'xorBy',\n 'symmetricDifferenceWith': 'xorWith',\n 'takeLast': 'takeRight',\n 'takeLastWhile': 'takeRightWhile',\n 'unapply': 'rest',\n 'unnest': 'flatten',\n 'useWith': 'overArgs',\n 'where': 'conformsTo',\n 'whereEq': 'isMatch',\n 'zipObj': 'zipObject'\n};\n\n/** Used to map ary to method names. */\nexports.aryMethod = {\n '1': [\n 'assignAll', 'assignInAll', 'attempt', 'castArray', 'ceil', 'create',\n 'curry', 'curryRight', 'defaultsAll', 'defaultsDeepAll', 'floor', 'flow',\n 'flowRight', 'fromPairs', 'invert', 'iteratee', 'memoize', 'method', 'mergeAll',\n 'methodOf', 'mixin', 'nthArg', 'over', 'overEvery', 'overSome','rest', 'reverse',\n 'round', 'runInContext', 'spread', 'template', 'trim', 'trimEnd', 'trimStart',\n 'uniqueId', 'words', 'zipAll'\n ],\n '2': [\n 'add', 'after', 'ary', 'assign', 'assignAllWith', 'assignIn', 'assignInAllWith',\n 'at', 'before', 'bind', 'bindAll', 'bindKey', 'chunk', 'cloneDeepWith',\n 'cloneWith', 'concat', 'conformsTo', 'countBy', 'curryN', 'curryRightN',\n 'debounce', 'defaults', 'defaultsDeep', 'defaultTo', 'delay', 'difference',\n 'divide', 'drop', 'dropRight', 'dropRightWhile', 'dropWhile', 'endsWith', 'eq',\n 'every', 'filter', 'find', 'findIndex', 'findKey', 'findLast', 'findLastIndex',\n 'findLastKey', 'flatMap', 'flatMapDeep', 'flattenDepth', 'forEach',\n 'forEachRight', 'forIn', 'forInRight', 'forOwn', 'forOwnRight', 'get',\n 'groupBy', 'gt', 'gte', 'has', 'hasIn', 'includes', 'indexOf', 'intersection',\n 'invertBy', 'invoke', 'invokeMap', 'isEqual', 'isMatch', 'join', 'keyBy',\n 'lastIndexOf', 'lt', 'lte', 'map', 'mapKeys', 'mapValues', 'matchesProperty',\n 'maxBy', 'meanBy', 'merge', 'mergeAllWith', 'minBy', 'multiply', 'nth', 'omit',\n 'omitBy', 'overArgs', 'pad', 'padEnd', 'padStart', 'parseInt', 'partial',\n 'partialRight', 'partition', 'pick', 'pickBy', 'propertyOf', 'pull', 'pullAll',\n 'pullAt', 'random', 'range', 'rangeRight', 'rearg', 'reject', 'remove',\n 'repeat', 'restFrom', 'result', 'sampleSize', 'some', 'sortBy', 'sortedIndex',\n 'sortedIndexOf', 'sortedLastIndex', 'sortedLastIndexOf', 'sortedUniqBy',\n 'split', 'spreadFrom', 'startsWith', 'subtract', 'sumBy', 'take', 'takeRight',\n 'takeRightWhile', 'takeWhile', 'tap', 'throttle', 'thru', 'times', 'trimChars',\n 'trimCharsEnd', 'trimCharsStart', 'truncate', 'union', 'uniqBy', 'uniqWith',\n 'unset', 'unzipWith', 'without', 'wrap', 'xor', 'zip', 'zipObject',\n 'zipObjectDeep'\n ],\n '3': [\n 'assignInWith', 'assignWith', 'clamp', 'differenceBy', 'differenceWith',\n 'findFrom', 'findIndexFrom', 'findLastFrom', 'findLastIndexFrom', 'getOr',\n 'includesFrom', 'indexOfFrom', 'inRange', 'intersectionBy', 'intersectionWith',\n 'invokeArgs', 'invokeArgsMap', 'isEqualWith', 'isMatchWith', 'flatMapDepth',\n 'lastIndexOfFrom', 'mergeWith', 'orderBy', 'padChars', 'padCharsEnd',\n 'padCharsStart', 'pullAllBy', 'pullAllWith', 'rangeStep', 'rangeStepRight',\n 'reduce', 'reduceRight', 'replace', 'set', 'slice', 'sortedIndexBy',\n 'sortedLastIndexBy', 'transform', 'unionBy', 'unionWith', 'update', 'xorBy',\n 'xorWith', 'zipWith'\n ],\n '4': [\n 'fill', 'setWith', 'updateWith'\n ]\n};\n\n/** Used to map ary to rearg configs. */\nexports.aryRearg = {\n '2': [1, 0],\n '3': [2, 0, 1],\n '4': [3, 2, 0, 1]\n};\n\n/** Used to map method names to their iteratee ary. */\nexports.iterateeAry = {\n 'dropRightWhile': 1,\n 'dropWhile': 1,\n 'every': 1,\n 'filter': 1,\n 'find': 1,\n 'findFrom': 1,\n 'findIndex': 1,\n 'findIndexFrom': 1,\n 'findKey': 1,\n 'findLast': 1,\n 'findLastFrom': 1,\n 'findLastIndex': 1,\n 'findLastIndexFrom': 1,\n 'findLastKey': 1,\n 'flatMap': 1,\n 'flatMapDeep': 1,\n 'flatMapDepth': 1,\n 'forEach': 1,\n 'forEachRight': 1,\n 'forIn': 1,\n 'forInRight': 1,\n 'forOwn': 1,\n 'forOwnRight': 1,\n 'map': 1,\n 'mapKeys': 1,\n 'mapValues': 1,\n 'partition': 1,\n 'reduce': 2,\n 'reduceRight': 2,\n 'reject': 1,\n 'remove': 1,\n 'some': 1,\n 'takeRightWhile': 1,\n 'takeWhile': 1,\n 'times': 1,\n 'transform': 2\n};\n\n/** Used to map method names to iteratee rearg configs. */\nexports.iterateeRearg = {\n 'mapKeys': [1],\n 'reduceRight': [1, 0]\n};\n\n/** Used to map method names to rearg configs. */\nexports.methodRearg = {\n 'assignInAllWith': [1, 0],\n 'assignInWith': [1, 2, 0],\n 'assignAllWith': [1, 0],\n 'assignWith': [1, 2, 0],\n 'differenceBy': [1, 2, 0],\n 'differenceWith': [1, 2, 0],\n 'getOr': [2, 1, 0],\n 'intersectionBy': [1, 2, 0],\n 'intersectionWith': [1, 2, 0],\n 'isEqualWith': [1, 2, 0],\n 'isMatchWith': [2, 1, 0],\n 'mergeAllWith': [1, 0],\n 'mergeWith': [1, 2, 0],\n 'padChars': [2, 1, 0],\n 'padCharsEnd': [2, 1, 0],\n 'padCharsStart': [2, 1, 0],\n 'pullAllBy': [2, 1, 0],\n 'pullAllWith': [2, 1, 0],\n 'rangeStep': [1, 2, 0],\n 'rangeStepRight': [1, 2, 0],\n 'setWith': [3, 1, 2, 0],\n 'sortedIndexBy': [2, 1, 0],\n 'sortedLastIndexBy': [2, 1, 0],\n 'unionBy': [1, 2, 0],\n 'unionWith': [1, 2, 0],\n 'updateWith': [3, 1, 2, 0],\n 'xorBy': [1, 2, 0],\n 'xorWith': [1, 2, 0],\n 'zipWith': [1, 2, 0]\n};\n\n/** Used to map method names to spread configs. */\nexports.methodSpread = {\n 'assignAll': { 'start': 0 },\n 'assignAllWith': { 'start': 0 },\n 'assignInAll': { 'start': 0 },\n 'assignInAllWith': { 'start': 0 },\n 'defaultsAll': { 'start': 0 },\n 'defaultsDeepAll': { 'start': 0 },\n 'invokeArgs': { 'start': 2 },\n 'invokeArgsMap': { 'start': 2 },\n 'mergeAll': { 'start': 0 },\n 'mergeAllWith': { 'start': 0 },\n 'partial': { 'start': 1 },\n 'partialRight': { 'start': 1 },\n 'without': { 'start': 1 },\n 'zipAll': { 'start': 0 }\n};\n\n/** Used to identify methods which mutate arrays or objects. */\nexports.mutate = {\n 'array': {\n 'fill': true,\n 'pull': true,\n 'pullAll': true,\n 'pullAllBy': true,\n 'pullAllWith': true,\n 'pullAt': true,\n 'remove': true,\n 'reverse': true\n },\n 'object': {\n 'assign': true,\n 'assignAll': true,\n 'assignAllWith': true,\n 'assignIn': true,\n 'assignInAll': true,\n 'assignInAllWith': true,\n 'assignInWith': true,\n 'assignWith': true,\n 'defaults': true,\n 'defaultsAll': true,\n 'defaultsDeep': true,\n 'defaultsDeepAll': true,\n 'merge': true,\n 'mergeAll': true,\n 'mergeAllWith': true,\n 'mergeWith': true,\n },\n 'set': {\n 'set': true,\n 'setWith': true,\n 'unset': true,\n 'update': true,\n 'updateWith': true\n }\n};\n\n/** Used to map real names to their aliases. */\nexports.realToAlias = (function() {\n var hasOwnProperty = Object.prototype.hasOwnProperty,\n object = exports.aliasToReal,\n result = {};\n\n for (var key in object) {\n var value = object[key];\n if (hasOwnProperty.call(result, value)) {\n result[value].push(key);\n } else {\n result[value] = [key];\n }\n }\n return result;\n}());\n\n/** Used to map method names to other names. */\nexports.remap = {\n 'assignAll': 'assign',\n 'assignAllWith': 'assignWith',\n 'assignInAll': 'assignIn',\n 'assignInAllWith': 'assignInWith',\n 'curryN': 'curry',\n 'curryRightN': 'curryRight',\n 'defaultsAll': 'defaults',\n 'defaultsDeepAll': 'defaultsDeep',\n 'findFrom': 'find',\n 'findIndexFrom': 'findIndex',\n 'findLastFrom': 'findLast',\n 'findLastIndexFrom': 'findLastIndex',\n 'getOr': 'get',\n 'includesFrom': 'includes',\n 'indexOfFrom': 'indexOf',\n 'invokeArgs': 'invoke',\n 'invokeArgsMap': 'invokeMap',\n 'lastIndexOfFrom': 'lastIndexOf',\n 'mergeAll': 'merge',\n 'mergeAllWith': 'mergeWith',\n 'padChars': 'pad',\n 'padCharsEnd': 'padEnd',\n 'padCharsStart': 'padStart',\n 'propertyOf': 'get',\n 'rangeStep': 'range',\n 'rangeStepRight': 'rangeRight',\n 'restFrom': 'rest',\n 'spreadFrom': 'spread',\n 'trimChars': 'trim',\n 'trimCharsEnd': 'trimEnd',\n 'trimCharsStart': 'trimStart',\n 'zipAll': 'zip'\n};\n\n/** Used to track methods that skip fixing their arity. */\nexports.skipFixed = {\n 'castArray': true,\n 'flow': true,\n 'flowRight': true,\n 'iteratee': true,\n 'mixin': true,\n 'rearg': true,\n 'runInContext': true\n};\n\n/** Used to track methods that skip rearranging arguments. */\nexports.skipRearg = {\n 'add': true,\n 'assign': true,\n 'assignIn': true,\n 'bind': true,\n 'bindKey': true,\n 'concat': true,\n 'difference': true,\n 'divide': true,\n 'eq': true,\n 'gt': true,\n 'gte': true,\n 'isEqual': true,\n 'lt': true,\n 'lte': true,\n 'matchesProperty': true,\n 'merge': true,\n 'multiply': true,\n 'overArgs': true,\n 'partial': true,\n 'partialRight': true,\n 'propertyOf': true,\n 'random': true,\n 'range': true,\n 'rangeRight': true,\n 'subtract': true,\n 'zip': true,\n 'zipObject': true,\n 'zipObjectDeep': true\n};\n","/**\n * The default argument placeholder value for methods.\n *\n * @type {Object}\n */\nmodule.exports = {};\n","var mapping = require('./_mapping'),\n fallbackHolder = require('./placeholder');\n\n/** Built-in value reference. */\nvar push = Array.prototype.push;\n\n/**\n * Creates a function, with an arity of `n`, that invokes `func` with the\n * arguments it receives.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} n The arity of the new function.\n * @returns {Function} Returns the new function.\n */\nfunction baseArity(func, n) {\n return n == 2\n ? function(a, b) { return func.apply(undefined, arguments); }\n : function(a) { return func.apply(undefined, arguments); };\n}\n\n/**\n * Creates a function that invokes `func`, with up to `n` arguments, ignoring\n * any additional arguments.\n *\n * @private\n * @param {Function} func The function to cap arguments for.\n * @param {number} n The arity cap.\n * @returns {Function} Returns the new function.\n */\nfunction baseAry(func, n) {\n return n == 2\n ? function(a, b) { return func(a, b); }\n : function(a) { return func(a); };\n}\n\n/**\n * Creates a clone of `array`.\n *\n * @private\n * @param {Array} array The array to clone.\n * @returns {Array} Returns the cloned array.\n */\nfunction cloneArray(array) {\n var length = array ? array.length : 0,\n result = Array(length);\n\n while (length--) {\n result[length] = array[length];\n }\n return result;\n}\n\n/**\n * Creates a function that clones a given object using the assignment `func`.\n *\n * @private\n * @param {Function} func The assignment function.\n * @returns {Function} Returns the new cloner function.\n */\nfunction createCloner(func) {\n return function(object) {\n return func({}, object);\n };\n}\n\n/**\n * A specialized version of `_.spread` which flattens the spread array into\n * the arguments of the invoked `func`.\n *\n * @private\n * @param {Function} func The function to spread arguments over.\n * @param {number} start The start position of the spread.\n * @returns {Function} Returns the new function.\n */\nfunction flatSpread(func, start) {\n return function() {\n var length = arguments.length,\n lastIndex = length - 1,\n args = Array(length);\n\n while (length--) {\n args[length] = arguments[length];\n }\n var array = args[start],\n otherArgs = args.slice(0, start);\n\n if (array) {\n push.apply(otherArgs, array);\n }\n if (start != lastIndex) {\n push.apply(otherArgs, args.slice(start + 1));\n }\n return func.apply(this, otherArgs);\n };\n}\n\n/**\n * Creates a function that wraps `func` and uses `cloner` to clone the first\n * argument it receives.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} cloner The function to clone arguments.\n * @returns {Function} Returns the new immutable function.\n */\nfunction wrapImmutable(func, cloner) {\n return function() {\n var length = arguments.length;\n if (!length) {\n return;\n }\n var args = Array(length);\n while (length--) {\n args[length] = arguments[length];\n }\n var result = args[0] = cloner.apply(undefined, args);\n func.apply(undefined, args);\n return result;\n };\n}\n\n/**\n * The base implementation of `convert` which accepts a `util` object of methods\n * required to perform conversions.\n *\n * @param {Object} util The util object.\n * @param {string} name The name of the function to convert.\n * @param {Function} func The function to convert.\n * @param {Object} [options] The options object.\n * @param {boolean} [options.cap=true] Specify capping iteratee arguments.\n * @param {boolean} [options.curry=true] Specify currying.\n * @param {boolean} [options.fixed=true] Specify fixed arity.\n * @param {boolean} [options.immutable=true] Specify immutable operations.\n * @param {boolean} [options.rearg=true] Specify rearranging arguments.\n * @returns {Function|Object} Returns the converted function or object.\n */\nfunction baseConvert(util, name, func, options) {\n var isLib = typeof name == 'function',\n isObj = name === Object(name);\n\n if (isObj) {\n options = func;\n func = name;\n name = undefined;\n }\n if (func == null) {\n throw new TypeError;\n }\n options || (options = {});\n\n var config = {\n 'cap': 'cap' in options ? options.cap : true,\n 'curry': 'curry' in options ? options.curry : true,\n 'fixed': 'fixed' in options ? options.fixed : true,\n 'immutable': 'immutable' in options ? options.immutable : true,\n 'rearg': 'rearg' in options ? options.rearg : true\n };\n\n var defaultHolder = isLib ? func : fallbackHolder,\n forceCurry = ('curry' in options) && options.curry,\n forceFixed = ('fixed' in options) && options.fixed,\n forceRearg = ('rearg' in options) && options.rearg,\n pristine = isLib ? func.runInContext() : undefined;\n\n var helpers = isLib ? func : {\n 'ary': util.ary,\n 'assign': util.assign,\n 'clone': util.clone,\n 'curry': util.curry,\n 'forEach': util.forEach,\n 'isArray': util.isArray,\n 'isError': util.isError,\n 'isFunction': util.isFunction,\n 'isWeakMap': util.isWeakMap,\n 'iteratee': util.iteratee,\n 'keys': util.keys,\n 'rearg': util.rearg,\n 'toInteger': util.toInteger,\n 'toPath': util.toPath\n };\n\n var ary = helpers.ary,\n assign = helpers.assign,\n clone = helpers.clone,\n curry = helpers.curry,\n each = helpers.forEach,\n isArray = helpers.isArray,\n isError = helpers.isError,\n isFunction = helpers.isFunction,\n isWeakMap = helpers.isWeakMap,\n keys = helpers.keys,\n rearg = helpers.rearg,\n toInteger = helpers.toInteger,\n toPath = helpers.toPath;\n\n var aryMethodKeys = keys(mapping.aryMethod);\n\n var wrappers = {\n 'castArray': function(castArray) {\n return function() {\n var value = arguments[0];\n return isArray(value)\n ? castArray(cloneArray(value))\n : castArray.apply(undefined, arguments);\n };\n },\n 'iteratee': function(iteratee) {\n return function() {\n var func = arguments[0],\n arity = arguments[1],\n result = iteratee(func, arity),\n length = result.length;\n\n if (config.cap && typeof arity == 'number') {\n arity = arity > 2 ? (arity - 2) : 1;\n return (length && length <= arity) ? result : baseAry(result, arity);\n }\n return result;\n };\n },\n 'mixin': function(mixin) {\n return function(source) {\n var func = this;\n if (!isFunction(func)) {\n return mixin(func, Object(source));\n }\n var pairs = [];\n each(keys(source), function(key) {\n if (isFunction(source[key])) {\n pairs.push([key, func.prototype[key]]);\n }\n });\n\n mixin(func, Object(source));\n\n each(pairs, function(pair) {\n var value = pair[1];\n if (isFunction(value)) {\n func.prototype[pair[0]] = value;\n } else {\n delete func.prototype[pair[0]];\n }\n });\n return func;\n };\n },\n 'nthArg': function(nthArg) {\n return function(n) {\n var arity = n < 0 ? 1 : (toInteger(n) + 1);\n return curry(nthArg(n), arity);\n };\n },\n 'rearg': function(rearg) {\n return function(func, indexes) {\n var arity = indexes ? indexes.length : 0;\n return curry(rearg(func, indexes), arity);\n };\n },\n 'runInContext': function(runInContext) {\n return function(context) {\n return baseConvert(util, runInContext(context), options);\n };\n }\n };\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * Casts `func` to a function with an arity capped iteratee if needed.\n *\n * @private\n * @param {string} name The name of the function to inspect.\n * @param {Function} func The function to inspect.\n * @returns {Function} Returns the cast function.\n */\n function castCap(name, func) {\n if (config.cap) {\n var indexes = mapping.iterateeRearg[name];\n if (indexes) {\n return iterateeRearg(func, indexes);\n }\n var n = !isLib && mapping.iterateeAry[name];\n if (n) {\n return iterateeAry(func, n);\n }\n }\n return func;\n }\n\n /**\n * Casts `func` to a curried function if needed.\n *\n * @private\n * @param {string} name The name of the function to inspect.\n * @param {Function} func The function to inspect.\n * @param {number} n The arity of `func`.\n * @returns {Function} Returns the cast function.\n */\n function castCurry(name, func, n) {\n return (forceCurry || (config.curry && n > 1))\n ? curry(func, n)\n : func;\n }\n\n /**\n * Casts `func` to a fixed arity function if needed.\n *\n * @private\n * @param {string} name The name of the function to inspect.\n * @param {Function} func The function to inspect.\n * @param {number} n The arity cap.\n * @returns {Function} Returns the cast function.\n */\n function castFixed(name, func, n) {\n if (config.fixed && (forceFixed || !mapping.skipFixed[name])) {\n var data = mapping.methodSpread[name],\n start = data && data.start;\n\n return start === undefined ? ary(func, n) : flatSpread(func, start);\n }\n return func;\n }\n\n /**\n * Casts `func` to an rearged function if needed.\n *\n * @private\n * @param {string} name The name of the function to inspect.\n * @param {Function} func The function to inspect.\n * @param {number} n The arity of `func`.\n * @returns {Function} Returns the cast function.\n */\n function castRearg(name, func, n) {\n return (config.rearg && n > 1 && (forceRearg || !mapping.skipRearg[name]))\n ? rearg(func, mapping.methodRearg[name] || mapping.aryRearg[n])\n : func;\n }\n\n /**\n * Creates a clone of `object` by `path`.\n *\n * @private\n * @param {Object} object The object to clone.\n * @param {Array|string} path The path to clone by.\n * @returns {Object} Returns the cloned object.\n */\n function cloneByPath(object, path) {\n path = toPath(path);\n\n var index = -1,\n length = path.length,\n lastIndex = length - 1,\n result = clone(Object(object)),\n nested = result;\n\n while (nested != null && ++index < length) {\n var key = path[index],\n value = nested[key];\n\n if (value != null &&\n !(isFunction(value) || isError(value) || isWeakMap(value))) {\n nested[key] = clone(index == lastIndex ? value : Object(value));\n }\n nested = nested[key];\n }\n return result;\n }\n\n /**\n * Converts `lodash` to an immutable auto-curried iteratee-first data-last\n * version with conversion `options` applied.\n *\n * @param {Object} [options] The options object. See `baseConvert` for more details.\n * @returns {Function} Returns the converted `lodash`.\n */\n function convertLib(options) {\n return _.runInContext.convert(options)(undefined);\n }\n\n /**\n * Create a converter function for `func` of `name`.\n *\n * @param {string} name The name of the function to convert.\n * @param {Function} func The function to convert.\n * @returns {Function} Returns the new converter function.\n */\n function createConverter(name, func) {\n var realName = mapping.aliasToReal[name] || name,\n methodName = mapping.remap[realName] || realName,\n oldOptions = options;\n\n return function(options) {\n var newUtil = isLib ? pristine : helpers,\n newFunc = isLib ? pristine[methodName] : func,\n newOptions = assign(assign({}, oldOptions), options);\n\n return baseConvert(newUtil, realName, newFunc, newOptions);\n };\n }\n\n /**\n * Creates a function that wraps `func` to invoke its iteratee, with up to `n`\n * arguments, ignoring any additional arguments.\n *\n * @private\n * @param {Function} func The function to cap iteratee arguments for.\n * @param {number} n The arity cap.\n * @returns {Function} Returns the new function.\n */\n function iterateeAry(func, n) {\n return overArg(func, function(func) {\n return typeof func == 'function' ? baseAry(func, n) : func;\n });\n }\n\n /**\n * Creates a function that wraps `func` to invoke its iteratee with arguments\n * arranged according to the specified `indexes` where the argument value at\n * the first index is provided as the first argument, the argument value at\n * the second index is provided as the second argument, and so on.\n *\n * @private\n * @param {Function} func The function to rearrange iteratee arguments for.\n * @param {number[]} indexes The arranged argument indexes.\n * @returns {Function} Returns the new function.\n */\n function iterateeRearg(func, indexes) {\n return overArg(func, function(func) {\n var n = indexes.length;\n return baseArity(rearg(baseAry(func, n), indexes), n);\n });\n }\n\n /**\n * Creates a function that invokes `func` with its first argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\n function overArg(func, transform) {\n return function() {\n var length = arguments.length;\n if (!length) {\n return func();\n }\n var args = Array(length);\n while (length--) {\n args[length] = arguments[length];\n }\n var index = config.rearg ? 0 : (length - 1);\n args[index] = transform(args[index]);\n return func.apply(undefined, args);\n };\n }\n\n /**\n * Creates a function that wraps `func` and applys the conversions\n * rules by `name`.\n *\n * @private\n * @param {string} name The name of the function to wrap.\n * @param {Function} func The function to wrap.\n * @returns {Function} Returns the converted function.\n */\n function wrap(name, func, placeholder) {\n var result,\n realName = mapping.aliasToReal[name] || name,\n wrapped = func,\n wrapper = wrappers[realName];\n\n if (wrapper) {\n wrapped = wrapper(func);\n }\n else if (config.immutable) {\n if (mapping.mutate.array[realName]) {\n wrapped = wrapImmutable(func, cloneArray);\n }\n else if (mapping.mutate.object[realName]) {\n wrapped = wrapImmutable(func, createCloner(func));\n }\n else if (mapping.mutate.set[realName]) {\n wrapped = wrapImmutable(func, cloneByPath);\n }\n }\n each(aryMethodKeys, function(aryKey) {\n each(mapping.aryMethod[aryKey], function(otherName) {\n if (realName == otherName) {\n var data = mapping.methodSpread[realName],\n afterRearg = data && data.afterRearg;\n\n result = afterRearg\n ? castFixed(realName, castRearg(realName, wrapped, aryKey), aryKey)\n : castRearg(realName, castFixed(realName, wrapped, aryKey), aryKey);\n\n result = castCap(realName, result);\n result = castCurry(realName, result, aryKey);\n return false;\n }\n });\n return !result;\n });\n\n result || (result = wrapped);\n if (result == func) {\n result = forceCurry ? curry(result, 1) : function() {\n return func.apply(this, arguments);\n };\n }\n result.convert = createConverter(realName, func);\n result.placeholder = func.placeholder = placeholder;\n\n return result;\n }\n\n /*--------------------------------------------------------------------------*/\n\n if (!isObj) {\n return wrap(name, func, defaultHolder);\n }\n var _ = func;\n\n // Convert methods by ary cap.\n var pairs = [];\n each(aryMethodKeys, function(aryKey) {\n each(mapping.aryMethod[aryKey], function(key) {\n var func = _[mapping.remap[key] || key];\n if (func) {\n pairs.push([key, wrap(key, func, _)]);\n }\n });\n });\n\n // Convert remaining methods.\n each(keys(_), function(key) {\n var func = _[key];\n if (typeof func == 'function') {\n var length = pairs.length;\n while (length--) {\n if (pairs[length][0] == key) {\n return;\n }\n }\n func.convert = createConverter(key, func);\n pairs.push([key, func]);\n }\n });\n\n // Assign to `_` leaving `_.prototype` unchanged to allow chaining.\n each(pairs, function(pair) {\n _[pair[0]] = pair[1];\n });\n\n _.convert = convertLib;\n _.placeholder = _;\n\n // Assign aliases.\n each(keys(_), function(key) {\n each(mapping.realToAlias[key] || [], function(alias) {\n _[alias] = _[key];\n });\n });\n\n return _;\n}\n\nmodule.exports = baseConvert;\n","var _ = require('./lodash.min').runInContext();\nmodule.exports = require('./fp/_baseConvert')(_, _);\n","'use strict';\n\n// Found this seed-based random generator somewhere\n// Based on The Central Randomizer 1.3 (C) 1997 by Paul Houle (houle@msc.cornell.edu)\n\nvar seed = 1;\n\n/**\n * return a random number based on a seed\n * @param seed\n * @returns {number}\n */\nfunction getNextValue() {\n seed = (seed * 9301 + 49297) % 233280;\n return seed/(233280.0);\n}\n\nfunction setSeed(_seed_) {\n seed = _seed_;\n}\n\nmodule.exports = {\n nextValue: getNextValue,\n seed: setSeed\n};\n","'use strict';\n\nvar randomFromSeed = require('./random/random-from-seed');\n\nvar ORIGINAL = '0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ_-';\nvar alphabet;\nvar previousSeed;\n\nvar shuffled;\n\nfunction reset() {\n shuffled = false;\n}\n\nfunction setCharacters(_alphabet_) {\n if (!_alphabet_) {\n if (alphabet !== ORIGINAL) {\n alphabet = ORIGINAL;\n reset();\n }\n return;\n }\n\n if (_alphabet_ === alphabet) {\n return;\n }\n\n if (_alphabet_.length !== ORIGINAL.length) {\n throw new Error('Custom alphabet for shortid must be ' + ORIGINAL.length + ' unique characters. You submitted ' + _alphabet_.length + ' characters: ' + _alphabet_);\n }\n\n var unique = _alphabet_.split('').filter(function(item, ind, arr){\n return ind !== arr.lastIndexOf(item);\n });\n\n if (unique.length) {\n throw new Error('Custom alphabet for shortid must be ' + ORIGINAL.length + ' unique characters. These characters were not unique: ' + unique.join(', '));\n }\n\n alphabet = _alphabet_;\n reset();\n}\n\nfunction characters(_alphabet_) {\n setCharacters(_alphabet_);\n return alphabet;\n}\n\nfunction setSeed(seed) {\n randomFromSeed.seed(seed);\n if (previousSeed !== seed) {\n reset();\n previousSeed = seed;\n }\n}\n\nfunction shuffle() {\n if (!alphabet) {\n setCharacters(ORIGINAL);\n }\n\n var sourceArray = alphabet.split('');\n var targetArray = [];\n var r = randomFromSeed.nextValue();\n var characterIndex;\n\n while (sourceArray.length > 0) {\n r = randomFromSeed.nextValue();\n characterIndex = Math.floor(r * sourceArray.length);\n targetArray.push(sourceArray.splice(characterIndex, 1)[0]);\n }\n return targetArray.join('');\n}\n\nfunction getShuffled() {\n if (shuffled) {\n return shuffled;\n }\n shuffled = shuffle();\n return shuffled;\n}\n\n/**\n * lookup shuffled letter\n * @param index\n * @returns {string}\n */\nfunction lookup(index) {\n var alphabetShuffled = getShuffled();\n return alphabetShuffled[index];\n}\n\nfunction get () {\n return alphabet || ORIGINAL;\n}\n\nmodule.exports = {\n get: get,\n characters: characters,\n seed: setSeed,\n lookup: lookup,\n shuffled: getShuffled\n};\n","'use strict';\n\nvar crypto = typeof window === 'object' && (window.crypto || window.msCrypto); // IE 11 uses window.msCrypto\n\nvar randomByte;\n\nif (!crypto || !crypto.getRandomValues) {\n randomByte = function(size) {\n var bytes = [];\n for (var i = 0; i < size; i++) {\n bytes.push(Math.floor(Math.random() * 256));\n }\n return bytes;\n };\n} else {\n randomByte = function(size) {\n return crypto.getRandomValues(new Uint8Array(size));\n };\n}\n\nmodule.exports = randomByte;\n","/**\n * Secure random string generator with custom alphabet.\n *\n * Alphabet must contain 256 symbols or less. Otherwise, the generator\n * will not be secure.\n *\n * @param {generator} random The random bytes generator.\n * @param {string} alphabet Symbols to be used in new random string.\n * @param {size} size The number of symbols in new random string.\n *\n * @return {string} Random string.\n *\n * @example\n * const format = require('nanoid/format')\n *\n * function random (size) {\n * const result = []\n * for (let i = 0; i < size; i++) {\n * result.push(randomByte())\n * }\n * return result\n * }\n *\n * format(random, \"abcdef\", 5) //=> \"fbaef\"\n *\n * @name format\n * @function\n */\nmodule.exports = function (random, alphabet, size) {\n var mask = (2 << Math.log(alphabet.length - 1) / Math.LN2) - 1\n var step = Math.ceil(1.6 * mask * size / alphabet.length)\n size = +size\n\n var id = ''\n while (true) {\n var bytes = random(step)\n for (var i = 0; i < step; i++) {\n var byte = bytes[i] & mask\n if (alphabet[byte]) {\n id += alphabet[byte]\n if (id.length === size) return id\n }\n }\n }\n}\n\n/**\n * @callback generator\n * @param {number} bytes The number of bytes to generate.\n * @return {number[]} Random bytes.\n */\n","'use strict';\n\nvar alphabet = require('./alphabet');\nvar random = require('./random/random-byte');\nvar format = require('nanoid/format');\n\nfunction generate(number) {\n var loopCounter = 0;\n var done;\n\n var str = '';\n\n while (!done) {\n str = str + format(random, alphabet.get(), 1);\n done = number < (Math.pow(16, loopCounter + 1 ) );\n loopCounter++;\n }\n return str;\n}\n\nmodule.exports = generate;\n","'use strict';\n\nvar generate = require('./generate');\nvar alphabet = require('./alphabet');\n\n// Ignore all milliseconds before a certain time to reduce the size of the date entropy without sacrificing uniqueness.\n// This number should be updated every year or so to keep the generated id short.\n// To regenerate `new Date() - 0` and bump the version. Always bump the version!\nvar REDUCE_TIME = 1567752802062;\n\n// don't change unless we change the algos or REDUCE_TIME\n// must be an integer and less than 16\nvar version = 7;\n\n// Counter is used when shortid is called multiple times in one second.\nvar counter;\n\n// Remember the last time shortid was called in case counter is needed.\nvar previousSeconds;\n\n/**\n * Generate unique id\n * Returns string id\n */\nfunction build(clusterWorkerId) {\n var str = '';\n\n var seconds = Math.floor((Date.now() - REDUCE_TIME) * 0.001);\n\n if (seconds === previousSeconds) {\n counter++;\n } else {\n counter = 0;\n previousSeconds = seconds;\n }\n\n str = str + generate(version);\n str = str + generate(clusterWorkerId);\n if (counter > 0) {\n str = str + generate(counter);\n }\n str = str + generate(seconds);\n return str;\n}\n\nmodule.exports = build;\n","'use strict';\nvar alphabet = require('./alphabet');\n\nfunction isShortId(id) {\n if (!id || typeof id !== 'string' || id.length < 6 ) {\n return false;\n }\n\n var nonAlphabetic = new RegExp('[^' +\n alphabet.get().replace(/[|\\\\{}()[\\]^$+*?.-]/g, '\\\\$&') +\n ']');\n return !nonAlphabetic.test(id);\n}\n\nmodule.exports = isShortId;\n","'use strict';\n\nvar alphabet = require('./alphabet');\nvar build = require('./build');\nvar isValid = require('./is-valid');\n\n// if you are using cluster or multiple servers use this to make each instance\n// has a unique value for worker\n// Note: I don't know if this is automatically set when using third\n// party cluster solutions such as pm2.\nvar clusterWorkerId = require('./util/cluster-worker-id') || 0;\n\n/**\n * Set the seed.\n * Highly recommended if you don't want people to try to figure out your id schema.\n * exposed as shortid.seed(int)\n * @param seed Integer value to seed the random alphabet. ALWAYS USE THE SAME SEED or you might get overlaps.\n */\nfunction seed(seedValue) {\n alphabet.seed(seedValue);\n return module.exports;\n}\n\n/**\n * Set the cluster worker or machine id\n * exposed as shortid.worker(int)\n * @param workerId worker must be positive integer. Number less than 16 is recommended.\n * returns shortid module so it can be chained.\n */\nfunction worker(workerId) {\n clusterWorkerId = workerId;\n return module.exports;\n}\n\n/**\n *\n * sets new characters to use in the alphabet\n * returns the shuffled alphabet\n */\nfunction characters(newCharacters) {\n if (newCharacters !== undefined) {\n alphabet.characters(newCharacters);\n }\n\n return alphabet.shuffled();\n}\n\n/**\n * Generate unique id\n * Returns string id\n */\nfunction generate() {\n return build(clusterWorkerId);\n}\n\n// Export all other functions as properties of the generate function\nmodule.exports = generate;\nmodule.exports.generate = generate;\nmodule.exports.seed = seed;\nmodule.exports.worker = worker;\nmodule.exports.characters = characters;\nmodule.exports.isValid = isValid;\n","'use strict';\nmodule.exports = require('./lib/index');\n","/**\n * @license\n * Lodash \n * Copyright OpenJS Foundation and other contributors \n * Released under MIT license \n * Based on Underscore.js 1.8.3 \n * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors\n */\n;(function() {\n\n /** Used as a safe reference for `undefined` in pre-ES5 environments. */\n var undefined;\n\n /** Used as the semantic version number. */\n var VERSION = '4.17.15';\n\n /** Used as the size to enable large array optimizations. */\n var LARGE_ARRAY_SIZE = 200;\n\n /** Error message constants. */\n var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.',\n FUNC_ERROR_TEXT = 'Expected a function';\n\n /** Used to stand-in for `undefined` hash values. */\n var HASH_UNDEFINED = '__lodash_hash_undefined__';\n\n /** Used as the maximum memoize cache size. */\n var MAX_MEMOIZE_SIZE = 500;\n\n /** Used as the internal argument placeholder. */\n var PLACEHOLDER = '__lodash_placeholder__';\n\n /** Used to compose bitmasks for cloning. */\n var CLONE_DEEP_FLAG = 1,\n CLONE_FLAT_FLAG = 2,\n CLONE_SYMBOLS_FLAG = 4;\n\n /** Used to compose bitmasks for value comparisons. */\n var COMPARE_PARTIAL_FLAG = 1,\n COMPARE_UNORDERED_FLAG = 2;\n\n /** Used to compose bitmasks for function metadata. */\n var WRAP_BIND_FLAG = 1,\n WRAP_BIND_KEY_FLAG = 2,\n WRAP_CURRY_BOUND_FLAG = 4,\n WRAP_CURRY_FLAG = 8,\n WRAP_CURRY_RIGHT_FLAG = 16,\n WRAP_PARTIAL_FLAG = 32,\n WRAP_PARTIAL_RIGHT_FLAG = 64,\n WRAP_ARY_FLAG = 128,\n WRAP_REARG_FLAG = 256,\n WRAP_FLIP_FLAG = 512;\n\n /** Used as default options for `_.truncate`. */\n var DEFAULT_TRUNC_LENGTH = 30,\n DEFAULT_TRUNC_OMISSION = '...';\n\n /** Used to detect hot functions by number of calls within a span of milliseconds. */\n var HOT_COUNT = 800,\n HOT_SPAN = 16;\n\n /** Used to indicate the type of lazy iteratees. */\n var LAZY_FILTER_FLAG = 1,\n LAZY_MAP_FLAG = 2,\n LAZY_WHILE_FLAG = 3;\n\n /** Used as references for various `Number` constants. */\n var INFINITY = 1 / 0,\n MAX_SAFE_INTEGER = 9007199254740991,\n MAX_INTEGER = 1.7976931348623157e+308,\n NAN = 0 / 0;\n\n /** Used as references for the maximum length and index of an array. */\n var MAX_ARRAY_LENGTH = 4294967295,\n MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1,\n HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1;\n\n /** Used to associate wrap methods with their bit flags. */\n var wrapFlags = [\n ['ary', WRAP_ARY_FLAG],\n ['bind', WRAP_BIND_FLAG],\n ['bindKey', WRAP_BIND_KEY_FLAG],\n ['curry', WRAP_CURRY_FLAG],\n ['curryRight', WRAP_CURRY_RIGHT_FLAG],\n ['flip', WRAP_FLIP_FLAG],\n ['partial', WRAP_PARTIAL_FLAG],\n ['partialRight', WRAP_PARTIAL_RIGHT_FLAG],\n ['rearg', WRAP_REARG_FLAG]\n ];\n\n /** `Object#toString` result references. */\n var argsTag = '[object Arguments]',\n arrayTag = '[object Array]',\n asyncTag = '[object AsyncFunction]',\n boolTag = '[object Boolean]',\n dateTag = '[object Date]',\n domExcTag = '[object DOMException]',\n errorTag = '[object Error]',\n funcTag = '[object Function]',\n genTag = '[object GeneratorFunction]',\n mapTag = '[object Map]',\n numberTag = '[object Number]',\n nullTag = '[object Null]',\n objectTag = '[object Object]',\n promiseTag = '[object Promise]',\n proxyTag = '[object Proxy]',\n regexpTag = '[object RegExp]',\n setTag = '[object Set]',\n stringTag = '[object String]',\n symbolTag = '[object Symbol]',\n undefinedTag = '[object Undefined]',\n weakMapTag = '[object WeakMap]',\n weakSetTag = '[object WeakSet]';\n\n var arrayBufferTag = '[object ArrayBuffer]',\n dataViewTag = '[object DataView]',\n float32Tag = '[object Float32Array]',\n float64Tag = '[object Float64Array]',\n int8Tag = '[object Int8Array]',\n int16Tag = '[object Int16Array]',\n int32Tag = '[object Int32Array]',\n uint8Tag = '[object Uint8Array]',\n uint8ClampedTag = '[object Uint8ClampedArray]',\n uint16Tag = '[object Uint16Array]',\n uint32Tag = '[object Uint32Array]';\n\n /** Used to match empty string literals in compiled template source. */\n var reEmptyStringLeading = /\\b__p \\+= '';/g,\n reEmptyStringMiddle = /\\b(__p \\+=) '' \\+/g,\n reEmptyStringTrailing = /(__e\\(.*?\\)|\\b__t\\)) \\+\\n'';/g;\n\n /** Used to match HTML entities and HTML characters. */\n var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g,\n reUnescapedHtml = /[&<>\"']/g,\n reHasEscapedHtml = RegExp(reEscapedHtml.source),\n reHasUnescapedHtml = RegExp(reUnescapedHtml.source);\n\n /** Used to match template delimiters. */\n var reEscape = /<%-([\\s\\S]+?)%>/g,\n reEvaluate = /<%([\\s\\S]+?)%>/g,\n reInterpolate = /<%=([\\s\\S]+?)%>/g;\n\n /** Used to match property names within property paths. */\n var reIsDeepProp = /\\.|\\[(?:[^[\\]]*|([\"'])(?:(?!\\1)[^\\\\]|\\\\.)*?\\1)\\]/,\n reIsPlainProp = /^\\w*$/,\n rePropName = /[^.[\\]]+|\\[(?:(-?\\d+(?:\\.\\d+)?)|([\"'])((?:(?!\\2)[^\\\\]|\\\\.)*?)\\2)\\]|(?=(?:\\.|\\[\\])(?:\\.|\\[\\]|$))/g;\n\n /**\n * Used to match `RegExp`\n * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).\n */\n var reRegExpChar = /[\\\\^$.*+?()[\\]{}|]/g,\n reHasRegExpChar = RegExp(reRegExpChar.source);\n\n /** Used to match leading and trailing whitespace. */\n var reTrim = /^\\s+|\\s+$/g,\n reTrimStart = /^\\s+/,\n reTrimEnd = /\\s+$/;\n\n /** Used to match wrap detail comments. */\n var reWrapComment = /\\{(?:\\n\\/\\* \\[wrapped with .+\\] \\*\\/)?\\n?/,\n reWrapDetails = /\\{\\n\\/\\* \\[wrapped with (.+)\\] \\*/,\n reSplitDetails = /,? & /;\n\n /** Used to match words composed of alphanumeric characters. */\n var reAsciiWord = /[^\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\x7f]+/g;\n\n /** Used to match backslashes in property paths. */\n var reEscapeChar = /\\\\(\\\\)?/g;\n\n /**\n * Used to match\n * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components).\n */\n var reEsTemplate = /\\$\\{([^\\\\}]*(?:\\\\.[^\\\\}]*)*)\\}/g;\n\n /** Used to match `RegExp` flags from their coerced string values. */\n var reFlags = /\\w*$/;\n\n /** Used to detect bad signed hexadecimal string values. */\n var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;\n\n /** Used to detect binary string values. */\n var reIsBinary = /^0b[01]+$/i;\n\n /** Used to detect host constructors (Safari). */\n var reIsHostCtor = /^\\[object .+?Constructor\\]$/;\n\n /** Used to detect octal string values. */\n var reIsOctal = /^0o[0-7]+$/i;\n\n /** Used to detect unsigned integer values. */\n var reIsUint = /^(?:0|[1-9]\\d*)$/;\n\n /** Used to match Latin Unicode letters (excluding mathematical operators). */\n var reLatin = /[\\xc0-\\xd6\\xd8-\\xf6\\xf8-\\xff\\u0100-\\u017f]/g;\n\n /** Used to ensure capturing order of template delimiters. */\n var reNoMatch = /($^)/;\n\n /** Used to match unescaped characters in compiled string literals. */\n var reUnescapedString = /['\\n\\r\\u2028\\u2029\\\\]/g;\n\n /** Used to compose unicode character classes. */\n var rsAstralRange = '\\\\ud800-\\\\udfff',\n rsComboMarksRange = '\\\\u0300-\\\\u036f',\n reComboHalfMarksRange = '\\\\ufe20-\\\\ufe2f',\n rsComboSymbolsRange = '\\\\u20d0-\\\\u20ff',\n rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange,\n rsDingbatRange = '\\\\u2700-\\\\u27bf',\n rsLowerRange = 'a-z\\\\xdf-\\\\xf6\\\\xf8-\\\\xff',\n rsMathOpRange = '\\\\xac\\\\xb1\\\\xd7\\\\xf7',\n rsNonCharRange = '\\\\x00-\\\\x2f\\\\x3a-\\\\x40\\\\x5b-\\\\x60\\\\x7b-\\\\xbf',\n rsPunctuationRange = '\\\\u2000-\\\\u206f',\n rsSpaceRange = ' \\\\t\\\\x0b\\\\f\\\\xa0\\\\ufeff\\\\n\\\\r\\\\u2028\\\\u2029\\\\u1680\\\\u180e\\\\u2000\\\\u2001\\\\u2002\\\\u2003\\\\u2004\\\\u2005\\\\u2006\\\\u2007\\\\u2008\\\\u2009\\\\u200a\\\\u202f\\\\u205f\\\\u3000',\n rsUpperRange = 'A-Z\\\\xc0-\\\\xd6\\\\xd8-\\\\xde',\n rsVarRange = '\\\\ufe0e\\\\ufe0f',\n rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange;\n\n /** Used to compose unicode capture groups. */\n var rsApos = \"['\\u2019]\",\n rsAstral = '[' + rsAstralRange + ']',\n rsBreak = '[' + rsBreakRange + ']',\n rsCombo = '[' + rsComboRange + ']',\n rsDigits = '\\\\d+',\n rsDingbat = '[' + rsDingbatRange + ']',\n rsLower = '[' + rsLowerRange + ']',\n rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']',\n rsFitz = '\\\\ud83c[\\\\udffb-\\\\udfff]',\n rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')',\n rsNonAstral = '[^' + rsAstralRange + ']',\n rsRegional = '(?:\\\\ud83c[\\\\udde6-\\\\uddff]){2}',\n rsSurrPair = '[\\\\ud800-\\\\udbff][\\\\udc00-\\\\udfff]',\n rsUpper = '[' + rsUpperRange + ']',\n rsZWJ = '\\\\u200d';\n\n /** Used to compose unicode regexes. */\n var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')',\n rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')',\n rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?',\n rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?',\n reOptMod = rsModifier + '?',\n rsOptVar = '[' + rsVarRange + ']?',\n rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*',\n rsOrdLower = '\\\\d*(?:1st|2nd|3rd|(?![123])\\\\dth)(?=\\\\b|[A-Z_])',\n rsOrdUpper = '\\\\d*(?:1ST|2ND|3RD|(?![123])\\\\dTH)(?=\\\\b|[a-z_])',\n rsSeq = rsOptVar + reOptMod + rsOptJoin,\n rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq,\n rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')';\n\n /** Used to match apostrophes. */\n var reApos = RegExp(rsApos, 'g');\n\n /**\n * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and\n * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols).\n */\n var reComboMark = RegExp(rsCombo, 'g');\n\n /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */\n var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g');\n\n /** Used to match complex or compound words. */\n var reUnicodeWord = RegExp([\n rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')',\n rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')',\n rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower,\n rsUpper + '+' + rsOptContrUpper,\n rsOrdUpper,\n rsOrdLower,\n rsDigits,\n rsEmoji\n ].join('|'), 'g');\n\n /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */\n var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']');\n\n /** Used to detect strings that need a more robust regexp to match words. */\n var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/;\n\n /** Used to assign default `context` object properties. */\n var contextProps = [\n 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array',\n 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object',\n 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array',\n 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap',\n '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout'\n ];\n\n /** Used to make template sourceURLs easier to identify. */\n var templateCounter = -1;\n\n /** Used to identify `toStringTag` values of typed arrays. */\n var typedArrayTags = {};\n typedArrayTags[float32Tag] = typedArrayTags[float64Tag] =\n typedArrayTags[int8Tag] = typedArrayTags[int16Tag] =\n typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] =\n typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] =\n typedArrayTags[uint32Tag] = true;\n typedArrayTags[argsTag] = typedArrayTags[arrayTag] =\n typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] =\n typedArrayTags[dataViewTag] = typedArrayTags[dateTag] =\n typedArrayTags[errorTag] = typedArrayTags[funcTag] =\n typedArrayTags[mapTag] = typedArrayTags[numberTag] =\n typedArrayTags[objectTag] = typedArrayTags[regexpTag] =\n typedArrayTags[setTag] = typedArrayTags[stringTag] =\n typedArrayTags[weakMapTag] = false;\n\n /** Used to identify `toStringTag` values supported by `_.clone`. */\n var cloneableTags = {};\n cloneableTags[argsTag] = cloneableTags[arrayTag] =\n cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] =\n cloneableTags[boolTag] = cloneableTags[dateTag] =\n cloneableTags[float32Tag] = cloneableTags[float64Tag] =\n cloneableTags[int8Tag] = cloneableTags[int16Tag] =\n cloneableTags[int32Tag] = cloneableTags[mapTag] =\n cloneableTags[numberTag] = cloneableTags[objectTag] =\n cloneableTags[regexpTag] = cloneableTags[setTag] =\n cloneableTags[stringTag] = cloneableTags[symbolTag] =\n cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] =\n cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;\n cloneableTags[errorTag] = cloneableTags[funcTag] =\n cloneableTags[weakMapTag] = false;\n\n /** Used to map Latin Unicode letters to basic Latin letters. */\n var deburredLetters = {\n // Latin-1 Supplement block.\n '\\xc0': 'A', '\\xc1': 'A', '\\xc2': 'A', '\\xc3': 'A', '\\xc4': 'A', '\\xc5': 'A',\n '\\xe0': 'a', '\\xe1': 'a', '\\xe2': 'a', '\\xe3': 'a', '\\xe4': 'a', '\\xe5': 'a',\n '\\xc7': 'C', '\\xe7': 'c',\n '\\xd0': 'D', '\\xf0': 'd',\n '\\xc8': 'E', '\\xc9': 'E', '\\xca': 'E', '\\xcb': 'E',\n '\\xe8': 'e', '\\xe9': 'e', '\\xea': 'e', '\\xeb': 'e',\n '\\xcc': 'I', '\\xcd': 'I', '\\xce': 'I', '\\xcf': 'I',\n '\\xec': 'i', '\\xed': 'i', '\\xee': 'i', '\\xef': 'i',\n '\\xd1': 'N', '\\xf1': 'n',\n '\\xd2': 'O', '\\xd3': 'O', '\\xd4': 'O', '\\xd5': 'O', '\\xd6': 'O', '\\xd8': 'O',\n '\\xf2': 'o', '\\xf3': 'o', '\\xf4': 'o', '\\xf5': 'o', '\\xf6': 'o', '\\xf8': 'o',\n '\\xd9': 'U', '\\xda': 'U', '\\xdb': 'U', '\\xdc': 'U',\n '\\xf9': 'u', '\\xfa': 'u', '\\xfb': 'u', '\\xfc': 'u',\n '\\xdd': 'Y', '\\xfd': 'y', '\\xff': 'y',\n '\\xc6': 'Ae', '\\xe6': 'ae',\n '\\xde': 'Th', '\\xfe': 'th',\n '\\xdf': 'ss',\n // Latin Extended-A block.\n '\\u0100': 'A', '\\u0102': 'A', '\\u0104': 'A',\n '\\u0101': 'a', '\\u0103': 'a', '\\u0105': 'a',\n '\\u0106': 'C', '\\u0108': 'C', '\\u010a': 'C', '\\u010c': 'C',\n '\\u0107': 'c', '\\u0109': 'c', '\\u010b': 'c', '\\u010d': 'c',\n '\\u010e': 'D', '\\u0110': 'D', '\\u010f': 'd', '\\u0111': 'd',\n '\\u0112': 'E', '\\u0114': 'E', '\\u0116': 'E', '\\u0118': 'E', '\\u011a': 'E',\n '\\u0113': 'e', '\\u0115': 'e', '\\u0117': 'e', '\\u0119': 'e', '\\u011b': 'e',\n '\\u011c': 'G', '\\u011e': 'G', '\\u0120': 'G', '\\u0122': 'G',\n '\\u011d': 'g', '\\u011f': 'g', '\\u0121': 'g', '\\u0123': 'g',\n '\\u0124': 'H', '\\u0126': 'H', '\\u0125': 'h', '\\u0127': 'h',\n '\\u0128': 'I', '\\u012a': 'I', '\\u012c': 'I', '\\u012e': 'I', '\\u0130': 'I',\n '\\u0129': 'i', '\\u012b': 'i', '\\u012d': 'i', '\\u012f': 'i', '\\u0131': 'i',\n '\\u0134': 'J', '\\u0135': 'j',\n '\\u0136': 'K', '\\u0137': 'k', '\\u0138': 'k',\n '\\u0139': 'L', '\\u013b': 'L', '\\u013d': 'L', '\\u013f': 'L', '\\u0141': 'L',\n '\\u013a': 'l', '\\u013c': 'l', '\\u013e': 'l', '\\u0140': 'l', '\\u0142': 'l',\n '\\u0143': 'N', '\\u0145': 'N', '\\u0147': 'N', '\\u014a': 'N',\n '\\u0144': 'n', '\\u0146': 'n', '\\u0148': 'n', '\\u014b': 'n',\n '\\u014c': 'O', '\\u014e': 'O', '\\u0150': 'O',\n '\\u014d': 'o', '\\u014f': 'o', '\\u0151': 'o',\n '\\u0154': 'R', '\\u0156': 'R', '\\u0158': 'R',\n '\\u0155': 'r', '\\u0157': 'r', '\\u0159': 'r',\n '\\u015a': 'S', '\\u015c': 'S', '\\u015e': 'S', '\\u0160': 'S',\n '\\u015b': 's', '\\u015d': 's', '\\u015f': 's', '\\u0161': 's',\n '\\u0162': 'T', '\\u0164': 'T', '\\u0166': 'T',\n '\\u0163': 't', '\\u0165': 't', '\\u0167': 't',\n '\\u0168': 'U', '\\u016a': 'U', '\\u016c': 'U', '\\u016e': 'U', '\\u0170': 'U', '\\u0172': 'U',\n '\\u0169': 'u', '\\u016b': 'u', '\\u016d': 'u', '\\u016f': 'u', '\\u0171': 'u', '\\u0173': 'u',\n '\\u0174': 'W', '\\u0175': 'w',\n '\\u0176': 'Y', '\\u0177': 'y', '\\u0178': 'Y',\n '\\u0179': 'Z', '\\u017b': 'Z', '\\u017d': 'Z',\n '\\u017a': 'z', '\\u017c': 'z', '\\u017e': 'z',\n '\\u0132': 'IJ', '\\u0133': 'ij',\n '\\u0152': 'Oe', '\\u0153': 'oe',\n '\\u0149': \"'n\", '\\u017f': 's'\n };\n\n /** Used to map characters to HTML entities. */\n var htmlEscapes = {\n '&': '&',\n '<': '<',\n '>': '>',\n '\"': '"',\n \"'\": '''\n };\n\n /** Used to map HTML entities to characters. */\n var htmlUnescapes = {\n '&': '&',\n '<': '<',\n '>': '>',\n '"': '\"',\n ''': \"'\"\n };\n\n /** Used to escape characters for inclusion in compiled string literals. */\n var stringEscapes = {\n '\\\\': '\\\\',\n \"'\": \"'\",\n '\\n': 'n',\n '\\r': 'r',\n '\\u2028': 'u2028',\n '\\u2029': 'u2029'\n };\n\n /** Built-in method references without a dependency on `root`. */\n var freeParseFloat = parseFloat,\n freeParseInt = parseInt;\n\n /** Detect free variable `global` from Node.js. */\n var freeGlobal = typeof global == 'object' && global && global.Object === Object && global;\n\n /** Detect free variable `self`. */\n var freeSelf = typeof self == 'object' && self && self.Object === Object && self;\n\n /** Used as a reference to the global object. */\n var root = freeGlobal || freeSelf || Function('return this')();\n\n /** Detect free variable `exports`. */\n var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports;\n\n /** Detect free variable `module`. */\n var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module;\n\n /** Detect the popular CommonJS extension `module.exports`. */\n var moduleExports = freeModule && freeModule.exports === freeExports;\n\n /** Detect free variable `process` from Node.js. */\n var freeProcess = moduleExports && freeGlobal.process;\n\n /** Used to access faster Node.js helpers. */\n var nodeUtil = (function() {\n try {\n // Use `util.types` for Node.js 10+.\n var types = freeModule && freeModule.require && freeModule.require('util').types;\n\n if (types) {\n return types;\n }\n\n // Legacy `process.binding('util')` for Node.js < 10.\n return freeProcess && freeProcess.binding && freeProcess.binding('util');\n } catch (e) {}\n }());\n\n /* Node.js helper references. */\n var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer,\n nodeIsDate = nodeUtil && nodeUtil.isDate,\n nodeIsMap = nodeUtil && nodeUtil.isMap,\n nodeIsRegExp = nodeUtil && nodeUtil.isRegExp,\n nodeIsSet = nodeUtil && nodeUtil.isSet,\n nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * A faster alternative to `Function#apply`, this function invokes `func`\n * with the `this` binding of `thisArg` and the arguments of `args`.\n *\n * @private\n * @param {Function} func The function to invoke.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} args The arguments to invoke `func` with.\n * @returns {*} Returns the result of `func`.\n */\n function apply(func, thisArg, args) {\n switch (args.length) {\n case 0: return func.call(thisArg);\n case 1: return func.call(thisArg, args[0]);\n case 2: return func.call(thisArg, args[0], args[1]);\n case 3: return func.call(thisArg, args[0], args[1], args[2]);\n }\n return func.apply(thisArg, args);\n }\n\n /**\n * A specialized version of `baseAggregator` for arrays.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function arrayAggregator(array, setter, iteratee, accumulator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n var value = array[index];\n setter(accumulator, value, iteratee(value), array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.forEach` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEach(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (iteratee(array[index], index, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.forEachRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns `array`.\n */\n function arrayEachRight(array, iteratee) {\n var length = array == null ? 0 : array.length;\n\n while (length--) {\n if (iteratee(array[length], length, array) === false) {\n break;\n }\n }\n return array;\n }\n\n /**\n * A specialized version of `_.every` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n */\n function arrayEvery(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (!predicate(array[index], index, array)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * A specialized version of `_.filter` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function arrayFilter(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.includes` for arrays without support for\n * specifying an index to search from.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludes(array, value) {\n var length = array == null ? 0 : array.length;\n return !!length && baseIndexOf(array, value, 0) > -1;\n }\n\n /**\n * This function is like `arrayIncludes` except that it accepts a comparator.\n *\n * @private\n * @param {Array} [array] The array to inspect.\n * @param {*} target The value to search for.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {boolean} Returns `true` if `target` is found, else `false`.\n */\n function arrayIncludesWith(array, value, comparator) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (comparator(value, array[index])) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `_.map` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function arrayMap(array, iteratee) {\n var index = -1,\n length = array == null ? 0 : array.length,\n result = Array(length);\n\n while (++index < length) {\n result[index] = iteratee(array[index], index, array);\n }\n return result;\n }\n\n /**\n * Appends the elements of `values` to `array`.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to append.\n * @returns {Array} Returns `array`.\n */\n function arrayPush(array, values) {\n var index = -1,\n length = values.length,\n offset = array.length;\n\n while (++index < length) {\n array[offset + index] = values[index];\n }\n return array;\n }\n\n /**\n * A specialized version of `_.reduce` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the first element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduce(array, iteratee, accumulator, initAccum) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n if (initAccum && length) {\n accumulator = array[++index];\n }\n while (++index < length) {\n accumulator = iteratee(accumulator, array[index], index, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.reduceRight` for arrays without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @param {boolean} [initAccum] Specify using the last element of `array` as\n * the initial value.\n * @returns {*} Returns the accumulated value.\n */\n function arrayReduceRight(array, iteratee, accumulator, initAccum) {\n var length = array == null ? 0 : array.length;\n if (initAccum && length) {\n accumulator = array[--length];\n }\n while (length--) {\n accumulator = iteratee(accumulator, array[length], length, array);\n }\n return accumulator;\n }\n\n /**\n * A specialized version of `_.some` for arrays without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} [array] The array to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function arraySome(array, predicate) {\n var index = -1,\n length = array == null ? 0 : array.length;\n\n while (++index < length) {\n if (predicate(array[index], index, array)) {\n return true;\n }\n }\n return false;\n }\n\n /**\n * Gets the size of an ASCII `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n var asciiSize = baseProperty('length');\n\n /**\n * Converts an ASCII `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function asciiToArray(string) {\n return string.split('');\n }\n\n /**\n * Splits an ASCII `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function asciiWords(string) {\n return string.match(reAsciiWord) || [];\n }\n\n /**\n * The base implementation of methods like `_.findKey` and `_.findLastKey`,\n * without support for iteratee shorthands, which iterates over `collection`\n * using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the found element or its key, else `undefined`.\n */\n function baseFindKey(collection, predicate, eachFunc) {\n var result;\n eachFunc(collection, function(value, key, collection) {\n if (predicate(value, key, collection)) {\n result = key;\n return false;\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.findIndex` and `_.findLastIndex` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} predicate The function invoked per iteration.\n * @param {number} fromIndex The index to search from.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseFindIndex(array, predicate, fromIndex, fromRight) {\n var length = array.length,\n index = fromIndex + (fromRight ? 1 : -1);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (predicate(array[index], index, array)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.indexOf` without `fromIndex` bounds checks.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOf(array, value, fromIndex) {\n return value === value\n ? strictIndexOf(array, value, fromIndex)\n : baseFindIndex(array, baseIsNaN, fromIndex);\n }\n\n /**\n * This function is like `baseIndexOf` except that it accepts a comparator.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @param {Function} comparator The comparator invoked per element.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function baseIndexOfWith(array, value, fromIndex, comparator) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (comparator(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * The base implementation of `_.isNaN` without support for number objects.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n */\n function baseIsNaN(value) {\n return value !== value;\n }\n\n /**\n * The base implementation of `_.mean` and `_.meanBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the mean.\n */\n function baseMean(array, iteratee) {\n var length = array == null ? 0 : array.length;\n return length ? (baseSum(array, iteratee) / length) : NAN;\n }\n\n /**\n * The base implementation of `_.property` without support for deep paths.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function baseProperty(key) {\n return function(object) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.propertyOf` without support for deep paths.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyOf(object) {\n return function(key) {\n return object == null ? undefined : object[key];\n };\n }\n\n /**\n * The base implementation of `_.reduce` and `_.reduceRight`, without support\n * for iteratee shorthands, which iterates over `collection` using `eachFunc`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {*} accumulator The initial value.\n * @param {boolean} initAccum Specify using the first or last element of\n * `collection` as the initial value.\n * @param {Function} eachFunc The function to iterate over `collection`.\n * @returns {*} Returns the accumulated value.\n */\n function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) {\n eachFunc(collection, function(value, index, collection) {\n accumulator = initAccum\n ? (initAccum = false, value)\n : iteratee(accumulator, value, index, collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.sortBy` which uses `comparer` to define the\n * sort order of `array` and replaces criteria objects with their corresponding\n * values.\n *\n * @private\n * @param {Array} array The array to sort.\n * @param {Function} comparer The function to define sort order.\n * @returns {Array} Returns `array`.\n */\n function baseSortBy(array, comparer) {\n var length = array.length;\n\n array.sort(comparer);\n while (length--) {\n array[length] = array[length].value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.sum` and `_.sumBy` without support for\n * iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {number} Returns the sum.\n */\n function baseSum(array, iteratee) {\n var result,\n index = -1,\n length = array.length;\n\n while (++index < length) {\n var current = iteratee(array[index]);\n if (current !== undefined) {\n result = result === undefined ? current : (result + current);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.times` without support for iteratee shorthands\n * or max array length checks.\n *\n * @private\n * @param {number} n The number of times to invoke `iteratee`.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the array of results.\n */\n function baseTimes(n, iteratee) {\n var index = -1,\n result = Array(n);\n\n while (++index < n) {\n result[index] = iteratee(index);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array\n * of key-value pairs for `object` corresponding to the property names of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the key-value pairs.\n */\n function baseToPairs(object, props) {\n return arrayMap(props, function(key) {\n return [key, object[key]];\n });\n }\n\n /**\n * The base implementation of `_.unary` without support for storing metadata.\n *\n * @private\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n */\n function baseUnary(func) {\n return function(value) {\n return func(value);\n };\n }\n\n /**\n * The base implementation of `_.values` and `_.valuesIn` which creates an\n * array of `object` property values corresponding to the property names\n * of `props`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} props The property names to get values for.\n * @returns {Object} Returns the array of property values.\n */\n function baseValues(object, props) {\n return arrayMap(props, function(key) {\n return object[key];\n });\n }\n\n /**\n * Checks if a `cache` value for `key` exists.\n *\n * @private\n * @param {Object} cache The cache to query.\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function cacheHas(cache, key) {\n return cache.has(key);\n }\n\n /**\n * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the first unmatched string symbol.\n */\n function charsStartIndex(strSymbols, chrSymbols) {\n var index = -1,\n length = strSymbols.length;\n\n while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol\n * that is not found in the character symbols.\n *\n * @private\n * @param {Array} strSymbols The string symbols to inspect.\n * @param {Array} chrSymbols The character symbols to find.\n * @returns {number} Returns the index of the last unmatched string symbol.\n */\n function charsEndIndex(strSymbols, chrSymbols) {\n var index = strSymbols.length;\n\n while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {}\n return index;\n }\n\n /**\n * Gets the number of `placeholder` occurrences in `array`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} placeholder The placeholder to search for.\n * @returns {number} Returns the placeholder count.\n */\n function countHolders(array, placeholder) {\n var length = array.length,\n result = 0;\n\n while (length--) {\n if (array[length] === placeholder) {\n ++result;\n }\n }\n return result;\n }\n\n /**\n * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A\n * letters to basic Latin letters.\n *\n * @private\n * @param {string} letter The matched letter to deburr.\n * @returns {string} Returns the deburred letter.\n */\n var deburrLetter = basePropertyOf(deburredLetters);\n\n /**\n * Used by `_.escape` to convert characters to HTML entities.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n var escapeHtmlChar = basePropertyOf(htmlEscapes);\n\n /**\n * Used by `_.template` to escape characters for inclusion in compiled string literals.\n *\n * @private\n * @param {string} chr The matched character to escape.\n * @returns {string} Returns the escaped character.\n */\n function escapeStringChar(chr) {\n return '\\\\' + stringEscapes[chr];\n }\n\n /**\n * Gets the value at `key` of `object`.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function getValue(object, key) {\n return object == null ? undefined : object[key];\n }\n\n /**\n * Checks if `string` contains Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a symbol is found, else `false`.\n */\n function hasUnicode(string) {\n return reHasUnicode.test(string);\n }\n\n /**\n * Checks if `string` contains a word composed of Unicode symbols.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {boolean} Returns `true` if a word is found, else `false`.\n */\n function hasUnicodeWord(string) {\n return reHasUnicodeWord.test(string);\n }\n\n /**\n * Converts `iterator` to an array.\n *\n * @private\n * @param {Object} iterator The iterator to convert.\n * @returns {Array} Returns the converted array.\n */\n function iteratorToArray(iterator) {\n var data,\n result = [];\n\n while (!(data = iterator.next()).done) {\n result.push(data.value);\n }\n return result;\n }\n\n /**\n * Converts `map` to its key-value pairs.\n *\n * @private\n * @param {Object} map The map to convert.\n * @returns {Array} Returns the key-value pairs.\n */\n function mapToArray(map) {\n var index = -1,\n result = Array(map.size);\n\n map.forEach(function(value, key) {\n result[++index] = [key, value];\n });\n return result;\n }\n\n /**\n * Creates a unary function that invokes `func` with its argument transformed.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {Function} transform The argument transform.\n * @returns {Function} Returns the new function.\n */\n function overArg(func, transform) {\n return function(arg) {\n return func(transform(arg));\n };\n }\n\n /**\n * Replaces all `placeholder` elements in `array` with an internal placeholder\n * and returns an array of their indexes.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {*} placeholder The placeholder to replace.\n * @returns {Array} Returns the new array of placeholder indexes.\n */\n function replaceHolders(array, placeholder) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value === placeholder || value === PLACEHOLDER) {\n array[index] = PLACEHOLDER;\n result[resIndex++] = index;\n }\n }\n return result;\n }\n\n /**\n * Converts `set` to an array of its values.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the values.\n */\n function setToArray(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = value;\n });\n return result;\n }\n\n /**\n * Converts `set` to its value-value pairs.\n *\n * @private\n * @param {Object} set The set to convert.\n * @returns {Array} Returns the value-value pairs.\n */\n function setToPairs(set) {\n var index = -1,\n result = Array(set.size);\n\n set.forEach(function(value) {\n result[++index] = [value, value];\n });\n return result;\n }\n\n /**\n * A specialized version of `_.indexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictIndexOf(array, value, fromIndex) {\n var index = fromIndex - 1,\n length = array.length;\n\n while (++index < length) {\n if (array[index] === value) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * A specialized version of `_.lastIndexOf` which performs strict equality\n * comparisons of values, i.e. `===`.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} fromIndex The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function strictLastIndexOf(array, value, fromIndex) {\n var index = fromIndex + 1;\n while (index--) {\n if (array[index] === value) {\n return index;\n }\n }\n return index;\n }\n\n /**\n * Gets the number of symbols in `string`.\n *\n * @private\n * @param {string} string The string to inspect.\n * @returns {number} Returns the string size.\n */\n function stringSize(string) {\n return hasUnicode(string)\n ? unicodeSize(string)\n : asciiSize(string);\n }\n\n /**\n * Converts `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function stringToArray(string) {\n return hasUnicode(string)\n ? unicodeToArray(string)\n : asciiToArray(string);\n }\n\n /**\n * Used by `_.unescape` to convert HTML entities to characters.\n *\n * @private\n * @param {string} chr The matched character to unescape.\n * @returns {string} Returns the unescaped character.\n */\n var unescapeHtmlChar = basePropertyOf(htmlUnescapes);\n\n /**\n * Gets the size of a Unicode `string`.\n *\n * @private\n * @param {string} string The string inspect.\n * @returns {number} Returns the string size.\n */\n function unicodeSize(string) {\n var result = reUnicode.lastIndex = 0;\n while (reUnicode.test(string)) {\n ++result;\n }\n return result;\n }\n\n /**\n * Converts a Unicode `string` to an array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the converted array.\n */\n function unicodeToArray(string) {\n return string.match(reUnicode) || [];\n }\n\n /**\n * Splits a Unicode `string` into an array of its words.\n *\n * @private\n * @param {string} The string to inspect.\n * @returns {Array} Returns the words of `string`.\n */\n function unicodeWords(string) {\n return string.match(reUnicodeWord) || [];\n }\n\n /*--------------------------------------------------------------------------*/\n\n /**\n * Create a new pristine `lodash` function using the `context` object.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Util\n * @param {Object} [context=root] The context object.\n * @returns {Function} Returns a new `lodash` function.\n * @example\n *\n * _.mixin({ 'foo': _.constant('foo') });\n *\n * var lodash = _.runInContext();\n * lodash.mixin({ 'bar': lodash.constant('bar') });\n *\n * _.isFunction(_.foo);\n * // => true\n * _.isFunction(_.bar);\n * // => false\n *\n * lodash.isFunction(lodash.foo);\n * // => false\n * lodash.isFunction(lodash.bar);\n * // => true\n *\n * // Create a suped-up `defer` in Node.js.\n * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer;\n */\n var runInContext = (function runInContext(context) {\n context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps));\n\n /** Built-in constructor references. */\n var Array = context.Array,\n Date = context.Date,\n Error = context.Error,\n Function = context.Function,\n Math = context.Math,\n Object = context.Object,\n RegExp = context.RegExp,\n String = context.String,\n TypeError = context.TypeError;\n\n /** Used for built-in method references. */\n var arrayProto = Array.prototype,\n funcProto = Function.prototype,\n objectProto = Object.prototype;\n\n /** Used to detect overreaching core-js shims. */\n var coreJsData = context['__core-js_shared__'];\n\n /** Used to resolve the decompiled source of functions. */\n var funcToString = funcProto.toString;\n\n /** Used to check objects for own properties. */\n var hasOwnProperty = objectProto.hasOwnProperty;\n\n /** Used to generate unique IDs. */\n var idCounter = 0;\n\n /** Used to detect methods masquerading as native. */\n var maskSrcKey = (function() {\n var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');\n return uid ? ('Symbol(src)_1.' + uid) : '';\n }());\n\n /**\n * Used to resolve the\n * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)\n * of values.\n */\n var nativeObjectToString = objectProto.toString;\n\n /** Used to infer the `Object` constructor. */\n var objectCtorString = funcToString.call(Object);\n\n /** Used to restore the original `_` reference in `_.noConflict`. */\n var oldDash = root._;\n\n /** Used to detect if a method is native. */\n var reIsNative = RegExp('^' +\n funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\\\$&')\n .replace(/hasOwnProperty|(function).*?(?=\\\\\\()| for .+?(?=\\\\\\])/g, '$1.*?') + '$'\n );\n\n /** Built-in value references. */\n var Buffer = moduleExports ? context.Buffer : undefined,\n Symbol = context.Symbol,\n Uint8Array = context.Uint8Array,\n allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined,\n getPrototype = overArg(Object.getPrototypeOf, Object),\n objectCreate = Object.create,\n propertyIsEnumerable = objectProto.propertyIsEnumerable,\n splice = arrayProto.splice,\n spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined,\n symIterator = Symbol ? Symbol.iterator : undefined,\n symToStringTag = Symbol ? Symbol.toStringTag : undefined;\n\n var defineProperty = (function() {\n try {\n var func = getNative(Object, 'defineProperty');\n func({}, '', {});\n return func;\n } catch (e) {}\n }());\n\n /** Mocked built-ins. */\n var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout,\n ctxNow = Date && Date.now !== root.Date.now && Date.now,\n ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout;\n\n /* Built-in method references for those with the same name as other `lodash` methods. */\n var nativeCeil = Math.ceil,\n nativeFloor = Math.floor,\n nativeGetSymbols = Object.getOwnPropertySymbols,\n nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,\n nativeIsFinite = context.isFinite,\n nativeJoin = arrayProto.join,\n nativeKeys = overArg(Object.keys, Object),\n nativeMax = Math.max,\n nativeMin = Math.min,\n nativeNow = Date.now,\n nativeParseInt = context.parseInt,\n nativeRandom = Math.random,\n nativeReverse = arrayProto.reverse;\n\n /* Built-in method references that are verified to be native. */\n var DataView = getNative(context, 'DataView'),\n Map = getNative(context, 'Map'),\n Promise = getNative(context, 'Promise'),\n Set = getNative(context, 'Set'),\n WeakMap = getNative(context, 'WeakMap'),\n nativeCreate = getNative(Object, 'create');\n\n /** Used to store function metadata. */\n var metaMap = WeakMap && new WeakMap;\n\n /** Used to lookup unminified function names. */\n var realNames = {};\n\n /** Used to detect maps, sets, and weakmaps. */\n var dataViewCtorString = toSource(DataView),\n mapCtorString = toSource(Map),\n promiseCtorString = toSource(Promise),\n setCtorString = toSource(Set),\n weakMapCtorString = toSource(WeakMap);\n\n /** Used to convert symbols to primitives and strings. */\n var symbolProto = Symbol ? Symbol.prototype : undefined,\n symbolValueOf = symbolProto ? symbolProto.valueOf : undefined,\n symbolToString = symbolProto ? symbolProto.toString : undefined;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` object which wraps `value` to enable implicit method\n * chain sequences. Methods that operate on and return arrays, collections,\n * and functions can be chained together. Methods that retrieve a single value\n * or may return a primitive value will automatically end the chain sequence\n * and return the unwrapped value. Otherwise, the value must be unwrapped\n * with `_#value`.\n *\n * Explicit chain sequences, which must be unwrapped with `_#value`, may be\n * enabled using `_.chain`.\n *\n * The execution of chained methods is lazy, that is, it's deferred until\n * `_#value` is implicitly or explicitly called.\n *\n * Lazy evaluation allows several methods to support shortcut fusion.\n * Shortcut fusion is an optimization to merge iteratee calls; this avoids\n * the creation of intermediate arrays and can greatly reduce the number of\n * iteratee executions. Sections of a chain sequence qualify for shortcut\n * fusion if the section is applied to an array and iteratees accept only\n * one argument. The heuristic for whether a section qualifies for shortcut\n * fusion is subject to change.\n *\n * Chaining is supported in custom builds as long as the `_#value` method is\n * directly or indirectly included in the build.\n *\n * In addition to lodash methods, wrappers have `Array` and `String` methods.\n *\n * The wrapper `Array` methods are:\n * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift`\n *\n * The wrapper `String` methods are:\n * `replace` and `split`\n *\n * The wrapper methods that support shortcut fusion are:\n * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`,\n * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`,\n * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray`\n *\n * The chainable wrapper methods are:\n * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`,\n * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`,\n * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`,\n * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`,\n * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`,\n * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`,\n * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`,\n * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`,\n * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`,\n * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`,\n * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`,\n * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`,\n * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`,\n * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`,\n * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`,\n * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`,\n * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`,\n * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`,\n * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`,\n * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`,\n * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`,\n * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`,\n * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`,\n * `zipObject`, `zipObjectDeep`, and `zipWith`\n *\n * The wrapper methods that are **not** chainable by default are:\n * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`,\n * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`,\n * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`,\n * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`,\n * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`,\n * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`,\n * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`,\n * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`,\n * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`,\n * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`,\n * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`,\n * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`,\n * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`,\n * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`,\n * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`,\n * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`,\n * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`,\n * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`,\n * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`,\n * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`,\n * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`,\n * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`,\n * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`,\n * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`,\n * `upperFirst`, `value`, and `words`\n *\n * @name _\n * @constructor\n * @category Seq\n * @param {*} value The value to wrap in a `lodash` instance.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2, 3]);\n *\n * // Returns an unwrapped value.\n * wrapped.reduce(_.add);\n * // => 6\n *\n * // Returns a wrapped value.\n * var squares = wrapped.map(square);\n *\n * _.isArray(squares);\n * // => false\n *\n * _.isArray(squares.value());\n * // => true\n */\n function lodash(value) {\n if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) {\n if (value instanceof LodashWrapper) {\n return value;\n }\n if (hasOwnProperty.call(value, '__wrapped__')) {\n return wrapperClone(value);\n }\n }\n return new LodashWrapper(value);\n }\n\n /**\n * The base implementation of `_.create` without support for assigning\n * properties to the created object.\n *\n * @private\n * @param {Object} proto The object to inherit from.\n * @returns {Object} Returns the new object.\n */\n var baseCreate = (function() {\n function object() {}\n return function(proto) {\n if (!isObject(proto)) {\n return {};\n }\n if (objectCreate) {\n return objectCreate(proto);\n }\n object.prototype = proto;\n var result = new object;\n object.prototype = undefined;\n return result;\n };\n }());\n\n /**\n * The function whose prototype chain sequence wrappers inherit from.\n *\n * @private\n */\n function baseLodash() {\n // No operation performed.\n }\n\n /**\n * The base constructor for creating `lodash` wrapper objects.\n *\n * @private\n * @param {*} value The value to wrap.\n * @param {boolean} [chainAll] Enable explicit method chain sequences.\n */\n function LodashWrapper(value, chainAll) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__chain__ = !!chainAll;\n this.__index__ = 0;\n this.__values__ = undefined;\n }\n\n /**\n * By default, the template delimiters used by lodash are like those in\n * embedded Ruby (ERB) as well as ES2015 template strings. Change the\n * following template settings to use alternative delimiters.\n *\n * @static\n * @memberOf _\n * @type {Object}\n */\n lodash.templateSettings = {\n\n /**\n * Used to detect `data` property values to be HTML-escaped.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'escape': reEscape,\n\n /**\n * Used to detect code to be evaluated.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'evaluate': reEvaluate,\n\n /**\n * Used to detect `data` property values to inject.\n *\n * @memberOf _.templateSettings\n * @type {RegExp}\n */\n 'interpolate': reInterpolate,\n\n /**\n * Used to reference the data object in the template text.\n *\n * @memberOf _.templateSettings\n * @type {string}\n */\n 'variable': '',\n\n /**\n * Used to import variables into the compiled template.\n *\n * @memberOf _.templateSettings\n * @type {Object}\n */\n 'imports': {\n\n /**\n * A reference to the `lodash` function.\n *\n * @memberOf _.templateSettings.imports\n * @type {Function}\n */\n '_': lodash\n }\n };\n\n // Ensure wrappers are instances of `baseLodash`.\n lodash.prototype = baseLodash.prototype;\n lodash.prototype.constructor = lodash;\n\n LodashWrapper.prototype = baseCreate(baseLodash.prototype);\n LodashWrapper.prototype.constructor = LodashWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation.\n *\n * @private\n * @constructor\n * @param {*} value The value to wrap.\n */\n function LazyWrapper(value) {\n this.__wrapped__ = value;\n this.__actions__ = [];\n this.__dir__ = 1;\n this.__filtered__ = false;\n this.__iteratees__ = [];\n this.__takeCount__ = MAX_ARRAY_LENGTH;\n this.__views__ = [];\n }\n\n /**\n * Creates a clone of the lazy wrapper object.\n *\n * @private\n * @name clone\n * @memberOf LazyWrapper\n * @returns {Object} Returns the cloned `LazyWrapper` object.\n */\n function lazyClone() {\n var result = new LazyWrapper(this.__wrapped__);\n result.__actions__ = copyArray(this.__actions__);\n result.__dir__ = this.__dir__;\n result.__filtered__ = this.__filtered__;\n result.__iteratees__ = copyArray(this.__iteratees__);\n result.__takeCount__ = this.__takeCount__;\n result.__views__ = copyArray(this.__views__);\n return result;\n }\n\n /**\n * Reverses the direction of lazy iteration.\n *\n * @private\n * @name reverse\n * @memberOf LazyWrapper\n * @returns {Object} Returns the new reversed `LazyWrapper` object.\n */\n function lazyReverse() {\n if (this.__filtered__) {\n var result = new LazyWrapper(this);\n result.__dir__ = -1;\n result.__filtered__ = true;\n } else {\n result = this.clone();\n result.__dir__ *= -1;\n }\n return result;\n }\n\n /**\n * Extracts the unwrapped value from its lazy wrapper.\n *\n * @private\n * @name value\n * @memberOf LazyWrapper\n * @returns {*} Returns the unwrapped value.\n */\n function lazyValue() {\n var array = this.__wrapped__.value(),\n dir = this.__dir__,\n isArr = isArray(array),\n isRight = dir < 0,\n arrLength = isArr ? array.length : 0,\n view = getView(0, arrLength, this.__views__),\n start = view.start,\n end = view.end,\n length = end - start,\n index = isRight ? end : (start - 1),\n iteratees = this.__iteratees__,\n iterLength = iteratees.length,\n resIndex = 0,\n takeCount = nativeMin(length, this.__takeCount__);\n\n if (!isArr || (!isRight && arrLength == length && takeCount == length)) {\n return baseWrapperValue(array, this.__actions__);\n }\n var result = [];\n\n outer:\n while (length-- && resIndex < takeCount) {\n index += dir;\n\n var iterIndex = -1,\n value = array[index];\n\n while (++iterIndex < iterLength) {\n var data = iteratees[iterIndex],\n iteratee = data.iteratee,\n type = data.type,\n computed = iteratee(value);\n\n if (type == LAZY_MAP_FLAG) {\n value = computed;\n } else if (!computed) {\n if (type == LAZY_FILTER_FLAG) {\n continue outer;\n } else {\n break outer;\n }\n }\n }\n result[resIndex++] = value;\n }\n return result;\n }\n\n // Ensure `LazyWrapper` is an instance of `baseLodash`.\n LazyWrapper.prototype = baseCreate(baseLodash.prototype);\n LazyWrapper.prototype.constructor = LazyWrapper;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a hash object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Hash(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the hash.\n *\n * @private\n * @name clear\n * @memberOf Hash\n */\n function hashClear() {\n this.__data__ = nativeCreate ? nativeCreate(null) : {};\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the hash.\n *\n * @private\n * @name delete\n * @memberOf Hash\n * @param {Object} hash The hash to modify.\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function hashDelete(key) {\n var result = this.has(key) && delete this.__data__[key];\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the hash value for `key`.\n *\n * @private\n * @name get\n * @memberOf Hash\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function hashGet(key) {\n var data = this.__data__;\n if (nativeCreate) {\n var result = data[key];\n return result === HASH_UNDEFINED ? undefined : result;\n }\n return hasOwnProperty.call(data, key) ? data[key] : undefined;\n }\n\n /**\n * Checks if a hash value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Hash\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function hashHas(key) {\n var data = this.__data__;\n return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key);\n }\n\n /**\n * Sets the hash `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Hash\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the hash instance.\n */\n function hashSet(key, value) {\n var data = this.__data__;\n this.size += this.has(key) ? 0 : 1;\n data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value;\n return this;\n }\n\n // Add methods to `Hash`.\n Hash.prototype.clear = hashClear;\n Hash.prototype['delete'] = hashDelete;\n Hash.prototype.get = hashGet;\n Hash.prototype.has = hashHas;\n Hash.prototype.set = hashSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an list cache object.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function ListCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the list cache.\n *\n * @private\n * @name clear\n * @memberOf ListCache\n */\n function listCacheClear() {\n this.__data__ = [];\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the list cache.\n *\n * @private\n * @name delete\n * @memberOf ListCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function listCacheDelete(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n return false;\n }\n var lastIndex = data.length - 1;\n if (index == lastIndex) {\n data.pop();\n } else {\n splice.call(data, index, 1);\n }\n --this.size;\n return true;\n }\n\n /**\n * Gets the list cache value for `key`.\n *\n * @private\n * @name get\n * @memberOf ListCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function listCacheGet(key) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n return index < 0 ? undefined : data[index][1];\n }\n\n /**\n * Checks if a list cache value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf ListCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function listCacheHas(key) {\n return assocIndexOf(this.__data__, key) > -1;\n }\n\n /**\n * Sets the list cache `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf ListCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the list cache instance.\n */\n function listCacheSet(key, value) {\n var data = this.__data__,\n index = assocIndexOf(data, key);\n\n if (index < 0) {\n ++this.size;\n data.push([key, value]);\n } else {\n data[index][1] = value;\n }\n return this;\n }\n\n // Add methods to `ListCache`.\n ListCache.prototype.clear = listCacheClear;\n ListCache.prototype['delete'] = listCacheDelete;\n ListCache.prototype.get = listCacheGet;\n ListCache.prototype.has = listCacheHas;\n ListCache.prototype.set = listCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a map cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function MapCache(entries) {\n var index = -1,\n length = entries == null ? 0 : entries.length;\n\n this.clear();\n while (++index < length) {\n var entry = entries[index];\n this.set(entry[0], entry[1]);\n }\n }\n\n /**\n * Removes all key-value entries from the map.\n *\n * @private\n * @name clear\n * @memberOf MapCache\n */\n function mapCacheClear() {\n this.size = 0;\n this.__data__ = {\n 'hash': new Hash,\n 'map': new (Map || ListCache),\n 'string': new Hash\n };\n }\n\n /**\n * Removes `key` and its value from the map.\n *\n * @private\n * @name delete\n * @memberOf MapCache\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function mapCacheDelete(key) {\n var result = getMapData(this, key)['delete'](key);\n this.size -= result ? 1 : 0;\n return result;\n }\n\n /**\n * Gets the map value for `key`.\n *\n * @private\n * @name get\n * @memberOf MapCache\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function mapCacheGet(key) {\n return getMapData(this, key).get(key);\n }\n\n /**\n * Checks if a map value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf MapCache\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function mapCacheHas(key) {\n return getMapData(this, key).has(key);\n }\n\n /**\n * Sets the map `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf MapCache\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the map cache instance.\n */\n function mapCacheSet(key, value) {\n var data = getMapData(this, key),\n size = data.size;\n\n data.set(key, value);\n this.size += data.size == size ? 0 : 1;\n return this;\n }\n\n // Add methods to `MapCache`.\n MapCache.prototype.clear = mapCacheClear;\n MapCache.prototype['delete'] = mapCacheDelete;\n MapCache.prototype.get = mapCacheGet;\n MapCache.prototype.has = mapCacheHas;\n MapCache.prototype.set = mapCacheSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n *\n * Creates an array cache object to store unique values.\n *\n * @private\n * @constructor\n * @param {Array} [values] The values to cache.\n */\n function SetCache(values) {\n var index = -1,\n length = values == null ? 0 : values.length;\n\n this.__data__ = new MapCache;\n while (++index < length) {\n this.add(values[index]);\n }\n }\n\n /**\n * Adds `value` to the array cache.\n *\n * @private\n * @name add\n * @memberOf SetCache\n * @alias push\n * @param {*} value The value to cache.\n * @returns {Object} Returns the cache instance.\n */\n function setCacheAdd(value) {\n this.__data__.set(value, HASH_UNDEFINED);\n return this;\n }\n\n /**\n * Checks if `value` is in the array cache.\n *\n * @private\n * @name has\n * @memberOf SetCache\n * @param {*} value The value to search for.\n * @returns {number} Returns `true` if `value` is found, else `false`.\n */\n function setCacheHas(value) {\n return this.__data__.has(value);\n }\n\n // Add methods to `SetCache`.\n SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;\n SetCache.prototype.has = setCacheHas;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a stack cache object to store key-value pairs.\n *\n * @private\n * @constructor\n * @param {Array} [entries] The key-value pairs to cache.\n */\n function Stack(entries) {\n var data = this.__data__ = new ListCache(entries);\n this.size = data.size;\n }\n\n /**\n * Removes all key-value entries from the stack.\n *\n * @private\n * @name clear\n * @memberOf Stack\n */\n function stackClear() {\n this.__data__ = new ListCache;\n this.size = 0;\n }\n\n /**\n * Removes `key` and its value from the stack.\n *\n * @private\n * @name delete\n * @memberOf Stack\n * @param {string} key The key of the value to remove.\n * @returns {boolean} Returns `true` if the entry was removed, else `false`.\n */\n function stackDelete(key) {\n var data = this.__data__,\n result = data['delete'](key);\n\n this.size = data.size;\n return result;\n }\n\n /**\n * Gets the stack value for `key`.\n *\n * @private\n * @name get\n * @memberOf Stack\n * @param {string} key The key of the value to get.\n * @returns {*} Returns the entry value.\n */\n function stackGet(key) {\n return this.__data__.get(key);\n }\n\n /**\n * Checks if a stack value for `key` exists.\n *\n * @private\n * @name has\n * @memberOf Stack\n * @param {string} key The key of the entry to check.\n * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.\n */\n function stackHas(key) {\n return this.__data__.has(key);\n }\n\n /**\n * Sets the stack `key` to `value`.\n *\n * @private\n * @name set\n * @memberOf Stack\n * @param {string} key The key of the value to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns the stack cache instance.\n */\n function stackSet(key, value) {\n var data = this.__data__;\n if (data instanceof ListCache) {\n var pairs = data.__data__;\n if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) {\n pairs.push([key, value]);\n this.size = ++data.size;\n return this;\n }\n data = this.__data__ = new MapCache(pairs);\n }\n data.set(key, value);\n this.size = data.size;\n return this;\n }\n\n // Add methods to `Stack`.\n Stack.prototype.clear = stackClear;\n Stack.prototype['delete'] = stackDelete;\n Stack.prototype.get = stackGet;\n Stack.prototype.has = stackHas;\n Stack.prototype.set = stackSet;\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of the enumerable property names of the array-like `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @param {boolean} inherited Specify returning inherited property names.\n * @returns {Array} Returns the array of property names.\n */\n function arrayLikeKeys(value, inherited) {\n var isArr = isArray(value),\n isArg = !isArr && isArguments(value),\n isBuff = !isArr && !isArg && isBuffer(value),\n isType = !isArr && !isArg && !isBuff && isTypedArray(value),\n skipIndexes = isArr || isArg || isBuff || isType,\n result = skipIndexes ? baseTimes(value.length, String) : [],\n length = result.length;\n\n for (var key in value) {\n if ((inherited || hasOwnProperty.call(value, key)) &&\n !(skipIndexes && (\n // Safari 9 has enumerable `arguments.length` in strict mode.\n key == 'length' ||\n // Node.js 0.10 has enumerable non-index properties on buffers.\n (isBuff && (key == 'offset' || key == 'parent')) ||\n // PhantomJS 2 has enumerable non-index properties on typed arrays.\n (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) ||\n // Skip index properties.\n isIndex(key, length)\n ))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `_.sample` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @returns {*} Returns the random element.\n */\n function arraySample(array) {\n var length = array.length;\n return length ? array[baseRandom(0, length - 1)] : undefined;\n }\n\n /**\n * A specialized version of `_.sampleSize` for arrays.\n *\n * @private\n * @param {Array} array The array to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function arraySampleSize(array, n) {\n return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length));\n }\n\n /**\n * A specialized version of `_.shuffle` for arrays.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function arrayShuffle(array) {\n return shuffleSelf(copyArray(array));\n }\n\n /**\n * This function is like `assignValue` except that it doesn't assign\n * `undefined` values.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignMergeValue(object, key, value) {\n if ((value !== undefined && !eq(object[key], value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Assigns `value` to `key` of `object` if the existing value is not equivalent\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function assignValue(object, key, value) {\n var objValue = object[key];\n if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) ||\n (value === undefined && !(key in object))) {\n baseAssignValue(object, key, value);\n }\n }\n\n /**\n * Gets the index at which the `key` is found in `array` of key-value pairs.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {*} key The key to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n */\n function assocIndexOf(array, key) {\n var length = array.length;\n while (length--) {\n if (eq(array[length][0], key)) {\n return length;\n }\n }\n return -1;\n }\n\n /**\n * Aggregates elements of `collection` on `accumulator` with keys transformed\n * by `iteratee` and values set by `setter`.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform keys.\n * @param {Object} accumulator The initial aggregated object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseAggregator(collection, setter, iteratee, accumulator) {\n baseEach(collection, function(value, key, collection) {\n setter(accumulator, value, iteratee(value), collection);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.assign` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssign(object, source) {\n return object && copyObject(source, keys(source), object);\n }\n\n /**\n * The base implementation of `_.assignIn` without support for multiple sources\n * or `customizer` functions.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @returns {Object} Returns `object`.\n */\n function baseAssignIn(object, source) {\n return object && copyObject(source, keysIn(source), object);\n }\n\n /**\n * The base implementation of `assignValue` and `assignMergeValue` without\n * value checks.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {string} key The key of the property to assign.\n * @param {*} value The value to assign.\n */\n function baseAssignValue(object, key, value) {\n if (key == '__proto__' && defineProperty) {\n defineProperty(object, key, {\n 'configurable': true,\n 'enumerable': true,\n 'value': value,\n 'writable': true\n });\n } else {\n object[key] = value;\n }\n }\n\n /**\n * The base implementation of `_.at` without support for individual paths.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {string[]} paths The property paths to pick.\n * @returns {Array} Returns the picked elements.\n */\n function baseAt(object, paths) {\n var index = -1,\n length = paths.length,\n result = Array(length),\n skip = object == null;\n\n while (++index < length) {\n result[index] = skip ? undefined : get(object, paths[index]);\n }\n return result;\n }\n\n /**\n * The base implementation of `_.clamp` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n */\n function baseClamp(number, lower, upper) {\n if (number === number) {\n if (upper !== undefined) {\n number = number <= upper ? number : upper;\n }\n if (lower !== undefined) {\n number = number >= lower ? number : lower;\n }\n }\n return number;\n }\n\n /**\n * The base implementation of `_.clone` and `_.cloneDeep` which tracks\n * traversed objects.\n *\n * @private\n * @param {*} value The value to clone.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Deep clone\n * 2 - Flatten inherited properties\n * 4 - Clone symbols\n * @param {Function} [customizer] The function to customize cloning.\n * @param {string} [key] The key of `value`.\n * @param {Object} [object] The parent object of `value`.\n * @param {Object} [stack] Tracks traversed objects and their clone counterparts.\n * @returns {*} Returns the cloned value.\n */\n function baseClone(value, bitmask, customizer, key, object, stack) {\n var result,\n isDeep = bitmask & CLONE_DEEP_FLAG,\n isFlat = bitmask & CLONE_FLAT_FLAG,\n isFull = bitmask & CLONE_SYMBOLS_FLAG;\n\n if (customizer) {\n result = object ? customizer(value, key, object, stack) : customizer(value);\n }\n if (result !== undefined) {\n return result;\n }\n if (!isObject(value)) {\n return value;\n }\n var isArr = isArray(value);\n if (isArr) {\n result = initCloneArray(value);\n if (!isDeep) {\n return copyArray(value, result);\n }\n } else {\n var tag = getTag(value),\n isFunc = tag == funcTag || tag == genTag;\n\n if (isBuffer(value)) {\n return cloneBuffer(value, isDeep);\n }\n if (tag == objectTag || tag == argsTag || (isFunc && !object)) {\n result = (isFlat || isFunc) ? {} : initCloneObject(value);\n if (!isDeep) {\n return isFlat\n ? copySymbolsIn(value, baseAssignIn(result, value))\n : copySymbols(value, baseAssign(result, value));\n }\n } else {\n if (!cloneableTags[tag]) {\n return object ? value : {};\n }\n result = initCloneByTag(value, tag, isDeep);\n }\n }\n // Check for circular references and return its corresponding clone.\n stack || (stack = new Stack);\n var stacked = stack.get(value);\n if (stacked) {\n return stacked;\n }\n stack.set(value, result);\n\n if (isSet(value)) {\n value.forEach(function(subValue) {\n result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));\n });\n } else if (isMap(value)) {\n value.forEach(function(subValue, key) {\n result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n }\n\n var keysFunc = isFull\n ? (isFlat ? getAllKeysIn : getAllKeys)\n : (isFlat ? keysIn : keys);\n\n var props = isArr ? undefined : keysFunc(value);\n arrayEach(props || value, function(subValue, key) {\n if (props) {\n key = subValue;\n subValue = value[key];\n }\n // Recursively populate clone (susceptible to call stack limits).\n assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));\n });\n return result;\n }\n\n /**\n * The base implementation of `_.conforms` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property predicates to conform to.\n * @returns {Function} Returns the new spec function.\n */\n function baseConforms(source) {\n var props = keys(source);\n return function(object) {\n return baseConformsTo(object, source, props);\n };\n }\n\n /**\n * The base implementation of `_.conformsTo` which accepts `props` to check.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n */\n function baseConformsTo(object, source, props) {\n var length = props.length;\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (length--) {\n var key = props[length],\n predicate = source[key],\n value = object[key];\n\n if ((value === undefined && !(key in object)) || !predicate(value)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.delay` and `_.defer` which accepts `args`\n * to provide to `func`.\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {Array} args The arguments to provide to `func`.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n function baseDelay(func, wait, args) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return setTimeout(function() { func.apply(undefined, args); }, wait);\n }\n\n /**\n * The base implementation of methods like `_.difference` without support\n * for excluding multiple arrays or iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Array} values The values to exclude.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n */\n function baseDifference(array, values, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n isCommon = true,\n length = array.length,\n result = [],\n valuesLength = values.length;\n\n if (!length) {\n return result;\n }\n if (iteratee) {\n values = arrayMap(values, baseUnary(iteratee));\n }\n if (comparator) {\n includes = arrayIncludesWith;\n isCommon = false;\n }\n else if (values.length >= LARGE_ARRAY_SIZE) {\n includes = cacheHas;\n isCommon = false;\n values = new SetCache(values);\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee == null ? value : iteratee(value);\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var valuesIndex = valuesLength;\n while (valuesIndex--) {\n if (values[valuesIndex] === computed) {\n continue outer;\n }\n }\n result.push(value);\n }\n else if (!includes(values, computed, comparator)) {\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.forEach` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEach = createBaseEach(baseForOwn);\n\n /**\n * The base implementation of `_.forEachRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n */\n var baseEachRight = createBaseEach(baseForOwnRight, true);\n\n /**\n * The base implementation of `_.every` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`\n */\n function baseEvery(collection, predicate) {\n var result = true;\n baseEach(collection, function(value, index, collection) {\n result = !!predicate(value, index, collection);\n return result;\n });\n return result;\n }\n\n /**\n * The base implementation of methods like `_.max` and `_.min` which accepts a\n * `comparator` to determine the extremum value.\n *\n * @private\n * @param {Array} array The array to iterate over.\n * @param {Function} iteratee The iteratee invoked per iteration.\n * @param {Function} comparator The comparator used to compare values.\n * @returns {*} Returns the extremum value.\n */\n function baseExtremum(array, iteratee, comparator) {\n var index = -1,\n length = array.length;\n\n while (++index < length) {\n var value = array[index],\n current = iteratee(value);\n\n if (current != null && (computed === undefined\n ? (current === current && !isSymbol(current))\n : comparator(current, computed)\n )) {\n var computed = current,\n result = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.fill` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n */\n function baseFill(array, value, start, end) {\n var length = array.length;\n\n start = toInteger(start);\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = (end === undefined || end > length) ? length : toInteger(end);\n if (end < 0) {\n end += length;\n }\n end = start > end ? 0 : toLength(end);\n while (start < end) {\n array[start++] = value;\n }\n return array;\n }\n\n /**\n * The base implementation of `_.filter` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n */\n function baseFilter(collection, predicate) {\n var result = [];\n baseEach(collection, function(value, index, collection) {\n if (predicate(value, index, collection)) {\n result.push(value);\n }\n });\n return result;\n }\n\n /**\n * The base implementation of `_.flatten` with support for restricting flattening.\n *\n * @private\n * @param {Array} array The array to flatten.\n * @param {number} depth The maximum recursion depth.\n * @param {boolean} [predicate=isFlattenable] The function invoked per iteration.\n * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks.\n * @param {Array} [result=[]] The initial result value.\n * @returns {Array} Returns the new flattened array.\n */\n function baseFlatten(array, depth, predicate, isStrict, result) {\n var index = -1,\n length = array.length;\n\n predicate || (predicate = isFlattenable);\n result || (result = []);\n\n while (++index < length) {\n var value = array[index];\n if (depth > 0 && predicate(value)) {\n if (depth > 1) {\n // Recursively flatten arrays (susceptible to call stack limits).\n baseFlatten(value, depth - 1, predicate, isStrict, result);\n } else {\n arrayPush(result, value);\n }\n } else if (!isStrict) {\n result[result.length] = value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `baseForOwn` which iterates over `object`\n * properties returned by `keysFunc` and invokes `iteratee` for each property.\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseFor = createBaseFor();\n\n /**\n * This function is like `baseFor` except that it iterates over properties\n * in the opposite order.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @returns {Object} Returns `object`.\n */\n var baseForRight = createBaseFor(true);\n\n /**\n * The base implementation of `_.forOwn` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwn(object, iteratee) {\n return object && baseFor(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.forOwnRight` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Object} Returns `object`.\n */\n function baseForOwnRight(object, iteratee) {\n return object && baseForRight(object, iteratee, keys);\n }\n\n /**\n * The base implementation of `_.functions` which creates an array of\n * `object` function property names filtered from `props`.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Array} props The property names to filter.\n * @returns {Array} Returns the function names.\n */\n function baseFunctions(object, props) {\n return arrayFilter(props, function(key) {\n return isFunction(object[key]);\n });\n }\n\n /**\n * The base implementation of `_.get` without support for default values.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @returns {*} Returns the resolved value.\n */\n function baseGet(object, path) {\n path = castPath(path, object);\n\n var index = 0,\n length = path.length;\n\n while (object != null && index < length) {\n object = object[toKey(path[index++])];\n }\n return (index && index == length) ? object : undefined;\n }\n\n /**\n * The base implementation of `getAllKeys` and `getAllKeysIn` which uses\n * `keysFunc` and `symbolsFunc` to get the enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Function} keysFunc The function to get the keys of `object`.\n * @param {Function} symbolsFunc The function to get the symbols of `object`.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function baseGetAllKeys(object, keysFunc, symbolsFunc) {\n var result = keysFunc(object);\n return isArray(object) ? result : arrayPush(result, symbolsFunc(object));\n }\n\n /**\n * The base implementation of `getTag` without fallbacks for buggy environments.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n function baseGetTag(value) {\n if (value == null) {\n return value === undefined ? undefinedTag : nullTag;\n }\n return (symToStringTag && symToStringTag in Object(value))\n ? getRawTag(value)\n : objectToString(value);\n }\n\n /**\n * The base implementation of `_.gt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n */\n function baseGt(value, other) {\n return value > other;\n }\n\n /**\n * The base implementation of `_.has` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHas(object, key) {\n return object != null && hasOwnProperty.call(object, key);\n }\n\n /**\n * The base implementation of `_.hasIn` without support for deep paths.\n *\n * @private\n * @param {Object} [object] The object to query.\n * @param {Array|string} key The key to check.\n * @returns {boolean} Returns `true` if `key` exists, else `false`.\n */\n function baseHasIn(object, key) {\n return object != null && key in Object(object);\n }\n\n /**\n * The base implementation of `_.inRange` which doesn't coerce arguments.\n *\n * @private\n * @param {number} number The number to check.\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n */\n function baseInRange(number, start, end) {\n return number >= nativeMin(start, end) && number < nativeMax(start, end);\n }\n\n /**\n * The base implementation of methods like `_.intersection`, without support\n * for iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of shared values.\n */\n function baseIntersection(arrays, iteratee, comparator) {\n var includes = comparator ? arrayIncludesWith : arrayIncludes,\n length = arrays[0].length,\n othLength = arrays.length,\n othIndex = othLength,\n caches = Array(othLength),\n maxLength = Infinity,\n result = [];\n\n while (othIndex--) {\n var array = arrays[othIndex];\n if (othIndex && iteratee) {\n array = arrayMap(array, baseUnary(iteratee));\n }\n maxLength = nativeMin(array.length, maxLength);\n caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120))\n ? new SetCache(othIndex && array)\n : undefined;\n }\n array = arrays[0];\n\n var index = -1,\n seen = caches[0];\n\n outer:\n while (++index < length && result.length < maxLength) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (!(seen\n ? cacheHas(seen, computed)\n : includes(result, computed, comparator)\n )) {\n othIndex = othLength;\n while (--othIndex) {\n var cache = caches[othIndex];\n if (!(cache\n ? cacheHas(cache, computed)\n : includes(arrays[othIndex], computed, comparator))\n ) {\n continue outer;\n }\n }\n if (seen) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.invert` and `_.invertBy` which inverts\n * `object` with values transformed by `iteratee` and set by `setter`.\n *\n * @private\n * @param {Object} object The object to iterate over.\n * @param {Function} setter The function to set `accumulator` values.\n * @param {Function} iteratee The iteratee to transform values.\n * @param {Object} accumulator The initial inverted object.\n * @returns {Function} Returns `accumulator`.\n */\n function baseInverter(object, setter, iteratee, accumulator) {\n baseForOwn(object, function(value, key, object) {\n setter(accumulator, iteratee(value), key, object);\n });\n return accumulator;\n }\n\n /**\n * The base implementation of `_.invoke` without support for individual\n * method arguments.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {Array} args The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n */\n function baseInvoke(object, path, args) {\n path = castPath(path, object);\n object = parent(object, path);\n var func = object == null ? object : object[toKey(last(path))];\n return func == null ? undefined : apply(func, object, args);\n }\n\n /**\n * The base implementation of `_.isArguments`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n */\n function baseIsArguments(value) {\n return isObjectLike(value) && baseGetTag(value) == argsTag;\n }\n\n /**\n * The base implementation of `_.isArrayBuffer` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n */\n function baseIsArrayBuffer(value) {\n return isObjectLike(value) && baseGetTag(value) == arrayBufferTag;\n }\n\n /**\n * The base implementation of `_.isDate` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n */\n function baseIsDate(value) {\n return isObjectLike(value) && baseGetTag(value) == dateTag;\n }\n\n /**\n * The base implementation of `_.isEqual` which supports partial comparisons\n * and tracks traversed objects.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {boolean} bitmask The bitmask flags.\n * 1 - Unordered comparison\n * 2 - Partial comparison\n * @param {Function} [customizer] The function to customize comparisons.\n * @param {Object} [stack] Tracks traversed `value` and `other` objects.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n */\n function baseIsEqual(value, other, bitmask, customizer, stack) {\n if (value === other) {\n return true;\n }\n if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) {\n return value !== value && other !== other;\n }\n return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);\n }\n\n /**\n * A specialized version of `baseIsEqual` for arrays and objects which performs\n * deep comparisons and tracks traversed objects enabling objects with circular\n * references to be compared.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} [stack] Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {\n var objIsArr = isArray(object),\n othIsArr = isArray(other),\n objTag = objIsArr ? arrayTag : getTag(object),\n othTag = othIsArr ? arrayTag : getTag(other);\n\n objTag = objTag == argsTag ? objectTag : objTag;\n othTag = othTag == argsTag ? objectTag : othTag;\n\n var objIsObj = objTag == objectTag,\n othIsObj = othTag == objectTag,\n isSameTag = objTag == othTag;\n\n if (isSameTag && isBuffer(object)) {\n if (!isBuffer(other)) {\n return false;\n }\n objIsArr = true;\n objIsObj = false;\n }\n if (isSameTag && !objIsObj) {\n stack || (stack = new Stack);\n return (objIsArr || isTypedArray(object))\n ? equalArrays(object, other, bitmask, customizer, equalFunc, stack)\n : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);\n }\n if (!(bitmask & COMPARE_PARTIAL_FLAG)) {\n var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),\n othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');\n\n if (objIsWrapped || othIsWrapped) {\n var objUnwrapped = objIsWrapped ? object.value() : object,\n othUnwrapped = othIsWrapped ? other.value() : other;\n\n stack || (stack = new Stack);\n return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);\n }\n }\n if (!isSameTag) {\n return false;\n }\n stack || (stack = new Stack);\n return equalObjects(object, other, bitmask, customizer, equalFunc, stack);\n }\n\n /**\n * The base implementation of `_.isMap` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n */\n function baseIsMap(value) {\n return isObjectLike(value) && getTag(value) == mapTag;\n }\n\n /**\n * The base implementation of `_.isMatch` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Array} matchData The property names, values, and compare flags to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n */\n function baseIsMatch(object, source, matchData, customizer) {\n var index = matchData.length,\n length = index,\n noCustomizer = !customizer;\n\n if (object == null) {\n return !length;\n }\n object = Object(object);\n while (index--) {\n var data = matchData[index];\n if ((noCustomizer && data[2])\n ? data[1] !== object[data[0]]\n : !(data[0] in object)\n ) {\n return false;\n }\n }\n while (++index < length) {\n data = matchData[index];\n var key = data[0],\n objValue = object[key],\n srcValue = data[1];\n\n if (noCustomizer && data[2]) {\n if (objValue === undefined && !(key in object)) {\n return false;\n }\n } else {\n var stack = new Stack;\n if (customizer) {\n var result = customizer(objValue, srcValue, key, object, source, stack);\n }\n if (!(result === undefined\n ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack)\n : result\n )) {\n return false;\n }\n }\n }\n return true;\n }\n\n /**\n * The base implementation of `_.isNative` without bad shim checks.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n */\n function baseIsNative(value) {\n if (!isObject(value) || isMasked(value)) {\n return false;\n }\n var pattern = isFunction(value) ? reIsNative : reIsHostCtor;\n return pattern.test(toSource(value));\n }\n\n /**\n * The base implementation of `_.isRegExp` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n */\n function baseIsRegExp(value) {\n return isObjectLike(value) && baseGetTag(value) == regexpTag;\n }\n\n /**\n * The base implementation of `_.isSet` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n */\n function baseIsSet(value) {\n return isObjectLike(value) && getTag(value) == setTag;\n }\n\n /**\n * The base implementation of `_.isTypedArray` without Node.js optimizations.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n */\n function baseIsTypedArray(value) {\n return isObjectLike(value) &&\n isLength(value.length) && !!typedArrayTags[baseGetTag(value)];\n }\n\n /**\n * The base implementation of `_.iteratee`.\n *\n * @private\n * @param {*} [value=_.identity] The value to convert to an iteratee.\n * @returns {Function} Returns the iteratee.\n */\n function baseIteratee(value) {\n // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9.\n // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details.\n if (typeof value == 'function') {\n return value;\n }\n if (value == null) {\n return identity;\n }\n if (typeof value == 'object') {\n return isArray(value)\n ? baseMatchesProperty(value[0], value[1])\n : baseMatches(value);\n }\n return property(value);\n }\n\n /**\n * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeys(object) {\n if (!isPrototype(object)) {\n return nativeKeys(object);\n }\n var result = [];\n for (var key in Object(object)) {\n if (hasOwnProperty.call(object, key) && key != 'constructor') {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function baseKeysIn(object) {\n if (!isObject(object)) {\n return nativeKeysIn(object);\n }\n var isProto = isPrototype(object),\n result = [];\n\n for (var key in object) {\n if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.lt` which doesn't coerce arguments.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n */\n function baseLt(value, other) {\n return value < other;\n }\n\n /**\n * The base implementation of `_.map` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} iteratee The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n */\n function baseMap(collection, iteratee) {\n var index = -1,\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value, key, collection) {\n result[++index] = iteratee(value, key, collection);\n });\n return result;\n }\n\n /**\n * The base implementation of `_.matches` which doesn't clone `source`.\n *\n * @private\n * @param {Object} source The object of property values to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatches(source) {\n var matchData = getMatchData(source);\n if (matchData.length == 1 && matchData[0][2]) {\n return matchesStrictComparable(matchData[0][0], matchData[0][1]);\n }\n return function(object) {\n return object === source || baseIsMatch(object, source, matchData);\n };\n }\n\n /**\n * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`.\n *\n * @private\n * @param {string} path The path of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function baseMatchesProperty(path, srcValue) {\n if (isKey(path) && isStrictComparable(srcValue)) {\n return matchesStrictComparable(toKey(path), srcValue);\n }\n return function(object) {\n var objValue = get(object, path);\n return (objValue === undefined && objValue === srcValue)\n ? hasIn(object, path)\n : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG);\n };\n }\n\n /**\n * The base implementation of `_.merge` without support for multiple sources.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} [customizer] The function to customize merged values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMerge(object, source, srcIndex, customizer, stack) {\n if (object === source) {\n return;\n }\n baseFor(source, function(srcValue, key) {\n stack || (stack = new Stack);\n if (isObject(srcValue)) {\n baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack);\n }\n else {\n var newValue = customizer\n ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack)\n : undefined;\n\n if (newValue === undefined) {\n newValue = srcValue;\n }\n assignMergeValue(object, key, newValue);\n }\n }, keysIn);\n }\n\n /**\n * A specialized version of `baseMerge` for arrays and objects which performs\n * deep merges and tracks traversed objects enabling objects with circular\n * references to be merged.\n *\n * @private\n * @param {Object} object The destination object.\n * @param {Object} source The source object.\n * @param {string} key The key of the value to merge.\n * @param {number} srcIndex The index of `source`.\n * @param {Function} mergeFunc The function to merge values.\n * @param {Function} [customizer] The function to customize assigned values.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n */\n function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) {\n var objValue = safeGet(object, key),\n srcValue = safeGet(source, key),\n stacked = stack.get(srcValue);\n\n if (stacked) {\n assignMergeValue(object, key, stacked);\n return;\n }\n var newValue = customizer\n ? customizer(objValue, srcValue, (key + ''), object, source, stack)\n : undefined;\n\n var isCommon = newValue === undefined;\n\n if (isCommon) {\n var isArr = isArray(srcValue),\n isBuff = !isArr && isBuffer(srcValue),\n isTyped = !isArr && !isBuff && isTypedArray(srcValue);\n\n newValue = srcValue;\n if (isArr || isBuff || isTyped) {\n if (isArray(objValue)) {\n newValue = objValue;\n }\n else if (isArrayLikeObject(objValue)) {\n newValue = copyArray(objValue);\n }\n else if (isBuff) {\n isCommon = false;\n newValue = cloneBuffer(srcValue, true);\n }\n else if (isTyped) {\n isCommon = false;\n newValue = cloneTypedArray(srcValue, true);\n }\n else {\n newValue = [];\n }\n }\n else if (isPlainObject(srcValue) || isArguments(srcValue)) {\n newValue = objValue;\n if (isArguments(objValue)) {\n newValue = toPlainObject(objValue);\n }\n else if (!isObject(objValue) || isFunction(objValue)) {\n newValue = initCloneObject(srcValue);\n }\n }\n else {\n isCommon = false;\n }\n }\n if (isCommon) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, newValue);\n mergeFunc(newValue, srcValue, srcIndex, customizer, stack);\n stack['delete'](srcValue);\n }\n assignMergeValue(object, key, newValue);\n }\n\n /**\n * The base implementation of `_.nth` which doesn't coerce arguments.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {number} n The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n */\n function baseNth(array, n) {\n var length = array.length;\n if (!length) {\n return;\n }\n n += n < 0 ? length : 0;\n return isIndex(n, length) ? array[n] : undefined;\n }\n\n /**\n * The base implementation of `_.orderBy` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by.\n * @param {string[]} orders The sort orders of `iteratees`.\n * @returns {Array} Returns the new sorted array.\n */\n function baseOrderBy(collection, iteratees, orders) {\n var index = -1;\n iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee()));\n\n var result = baseMap(collection, function(value, key, collection) {\n var criteria = arrayMap(iteratees, function(iteratee) {\n return iteratee(value);\n });\n return { 'criteria': criteria, 'index': ++index, 'value': value };\n });\n\n return baseSortBy(result, function(object, other) {\n return compareMultiple(object, other, orders);\n });\n }\n\n /**\n * The base implementation of `_.pick` without support for individual\n * property identifiers.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @returns {Object} Returns the new object.\n */\n function basePick(object, paths) {\n return basePickBy(object, paths, function(value, path) {\n return hasIn(object, path);\n });\n }\n\n /**\n * The base implementation of `_.pickBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Object} object The source object.\n * @param {string[]} paths The property paths to pick.\n * @param {Function} predicate The function invoked per property.\n * @returns {Object} Returns the new object.\n */\n function basePickBy(object, paths, predicate) {\n var index = -1,\n length = paths.length,\n result = {};\n\n while (++index < length) {\n var path = paths[index],\n value = baseGet(object, path);\n\n if (predicate(value, path)) {\n baseSet(result, castPath(path, object), value);\n }\n }\n return result;\n }\n\n /**\n * A specialized version of `baseProperty` which supports deep paths.\n *\n * @private\n * @param {Array|string} path The path of the property to get.\n * @returns {Function} Returns the new accessor function.\n */\n function basePropertyDeep(path) {\n return function(object) {\n return baseGet(object, path);\n };\n }\n\n /**\n * The base implementation of `_.pullAllBy` without support for iteratee\n * shorthands.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n */\n function basePullAll(array, values, iteratee, comparator) {\n var indexOf = comparator ? baseIndexOfWith : baseIndexOf,\n index = -1,\n length = values.length,\n seen = array;\n\n if (array === values) {\n values = copyArray(values);\n }\n if (iteratee) {\n seen = arrayMap(array, baseUnary(iteratee));\n }\n while (++index < length) {\n var fromIndex = 0,\n value = values[index],\n computed = iteratee ? iteratee(value) : value;\n\n while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) {\n if (seen !== array) {\n splice.call(seen, fromIndex, 1);\n }\n splice.call(array, fromIndex, 1);\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.pullAt` without support for individual\n * indexes or capturing the removed elements.\n *\n * @private\n * @param {Array} array The array to modify.\n * @param {number[]} indexes The indexes of elements to remove.\n * @returns {Array} Returns `array`.\n */\n function basePullAt(array, indexes) {\n var length = array ? indexes.length : 0,\n lastIndex = length - 1;\n\n while (length--) {\n var index = indexes[length];\n if (length == lastIndex || index !== previous) {\n var previous = index;\n if (isIndex(index)) {\n splice.call(array, index, 1);\n } else {\n baseUnset(array, index);\n }\n }\n }\n return array;\n }\n\n /**\n * The base implementation of `_.random` without support for returning\n * floating-point numbers.\n *\n * @private\n * @param {number} lower The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the random number.\n */\n function baseRandom(lower, upper) {\n return lower + nativeFloor(nativeRandom() * (upper - lower + 1));\n }\n\n /**\n * The base implementation of `_.range` and `_.rangeRight` which doesn't\n * coerce arguments.\n *\n * @private\n * @param {number} start The start of the range.\n * @param {number} end The end of the range.\n * @param {number} step The value to increment or decrement by.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the range of numbers.\n */\n function baseRange(start, end, step, fromRight) {\n var index = -1,\n length = nativeMax(nativeCeil((end - start) / (step || 1)), 0),\n result = Array(length);\n\n while (length--) {\n result[fromRight ? length : ++index] = start;\n start += step;\n }\n return result;\n }\n\n /**\n * The base implementation of `_.repeat` which doesn't coerce arguments.\n *\n * @private\n * @param {string} string The string to repeat.\n * @param {number} n The number of times to repeat the string.\n * @returns {string} Returns the repeated string.\n */\n function baseRepeat(string, n) {\n var result = '';\n if (!string || n < 1 || n > MAX_SAFE_INTEGER) {\n return result;\n }\n // Leverage the exponentiation by squaring algorithm for a faster repeat.\n // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details.\n do {\n if (n % 2) {\n result += string;\n }\n n = nativeFloor(n / 2);\n if (n) {\n string += string;\n }\n } while (n);\n\n return result;\n }\n\n /**\n * The base implementation of `_.rest` which doesn't validate or coerce arguments.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n */\n function baseRest(func, start) {\n return setToString(overRest(func, start, identity), func + '');\n }\n\n /**\n * The base implementation of `_.sample`.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n */\n function baseSample(collection) {\n return arraySample(values(collection));\n }\n\n /**\n * The base implementation of `_.sampleSize` without param guards.\n *\n * @private\n * @param {Array|Object} collection The collection to sample.\n * @param {number} n The number of elements to sample.\n * @returns {Array} Returns the random elements.\n */\n function baseSampleSize(collection, n) {\n var array = values(collection);\n return shuffleSelf(array, baseClamp(n, 0, array.length));\n }\n\n /**\n * The base implementation of `_.set`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseSet(object, path, value, customizer) {\n if (!isObject(object)) {\n return object;\n }\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n lastIndex = length - 1,\n nested = object;\n\n while (nested != null && ++index < length) {\n var key = toKey(path[index]),\n newValue = value;\n\n if (index != lastIndex) {\n var objValue = nested[key];\n newValue = customizer ? customizer(objValue, key, nested) : undefined;\n if (newValue === undefined) {\n newValue = isObject(objValue)\n ? objValue\n : (isIndex(path[index + 1]) ? [] : {});\n }\n }\n assignValue(nested, key, newValue);\n nested = nested[key];\n }\n return object;\n }\n\n /**\n * The base implementation of `setData` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var baseSetData = !metaMap ? identity : function(func, data) {\n metaMap.set(func, data);\n return func;\n };\n\n /**\n * The base implementation of `setToString` without support for hot loop shorting.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var baseSetToString = !defineProperty ? identity : function(func, string) {\n return defineProperty(func, 'toString', {\n 'configurable': true,\n 'enumerable': false,\n 'value': constant(string),\n 'writable': true\n });\n };\n\n /**\n * The base implementation of `_.shuffle`.\n *\n * @private\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n */\n function baseShuffle(collection) {\n return shuffleSelf(values(collection));\n }\n\n /**\n * The base implementation of `_.slice` without an iteratee call guard.\n *\n * @private\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseSlice(array, start, end) {\n var index = -1,\n length = array.length;\n\n if (start < 0) {\n start = -start > length ? 0 : (length + start);\n }\n end = end > length ? length : end;\n if (end < 0) {\n end += length;\n }\n length = start > end ? 0 : ((end - start) >>> 0);\n start >>>= 0;\n\n var result = Array(length);\n while (++index < length) {\n result[index] = array[index + start];\n }\n return result;\n }\n\n /**\n * The base implementation of `_.some` without support for iteratee shorthands.\n *\n * @private\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} predicate The function invoked per iteration.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n */\n function baseSome(collection, predicate) {\n var result;\n\n baseEach(collection, function(value, index, collection) {\n result = predicate(value, index, collection);\n return !result;\n });\n return !!result;\n }\n\n /**\n * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which\n * performs a binary search of `array` to determine the index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndex(array, value, retHighest) {\n var low = 0,\n high = array == null ? low : array.length;\n\n if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) {\n while (low < high) {\n var mid = (low + high) >>> 1,\n computed = array[mid];\n\n if (computed !== null && !isSymbol(computed) &&\n (retHighest ? (computed <= value) : (computed < value))) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return high;\n }\n return baseSortedIndexBy(array, value, identity, retHighest);\n }\n\n /**\n * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy`\n * which invokes `iteratee` for `value` and each element of `array` to compute\n * their sort ranking. The iteratee is invoked with one argument; (value).\n *\n * @private\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} iteratee The iteratee invoked per element.\n * @param {boolean} [retHighest] Specify returning the highest qualified index.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n */\n function baseSortedIndexBy(array, value, iteratee, retHighest) {\n value = iteratee(value);\n\n var low = 0,\n high = array == null ? 0 : array.length,\n valIsNaN = value !== value,\n valIsNull = value === null,\n valIsSymbol = isSymbol(value),\n valIsUndefined = value === undefined;\n\n while (low < high) {\n var mid = nativeFloor((low + high) / 2),\n computed = iteratee(array[mid]),\n othIsDefined = computed !== undefined,\n othIsNull = computed === null,\n othIsReflexive = computed === computed,\n othIsSymbol = isSymbol(computed);\n\n if (valIsNaN) {\n var setLow = retHighest || othIsReflexive;\n } else if (valIsUndefined) {\n setLow = othIsReflexive && (retHighest || othIsDefined);\n } else if (valIsNull) {\n setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull);\n } else if (valIsSymbol) {\n setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol);\n } else if (othIsNull || othIsSymbol) {\n setLow = false;\n } else {\n setLow = retHighest ? (computed <= value) : (computed < value);\n }\n if (setLow) {\n low = mid + 1;\n } else {\n high = mid;\n }\n }\n return nativeMin(high, MAX_ARRAY_INDEX);\n }\n\n /**\n * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without\n * support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseSortedUniq(array, iteratee) {\n var index = -1,\n length = array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n if (!index || !eq(computed, seen)) {\n var seen = computed;\n result[resIndex++] = value === 0 ? 0 : value;\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.toNumber` which doesn't ensure correct\n * conversions of binary, hexadecimal, or octal string values.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n */\n function baseToNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n return +value;\n }\n\n /**\n * The base implementation of `_.toString` which doesn't convert nullish\n * values to empty strings.\n *\n * @private\n * @param {*} value The value to process.\n * @returns {string} Returns the string.\n */\n function baseToString(value) {\n // Exit early for strings to avoid a performance hit in some environments.\n if (typeof value == 'string') {\n return value;\n }\n if (isArray(value)) {\n // Recursively convert values (susceptible to call stack limits).\n return arrayMap(value, baseToString) + '';\n }\n if (isSymbol(value)) {\n return symbolToString ? symbolToString.call(value) : '';\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * The base implementation of `_.uniqBy` without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n */\n function baseUniq(array, iteratee, comparator) {\n var index = -1,\n includes = arrayIncludes,\n length = array.length,\n isCommon = true,\n result = [],\n seen = result;\n\n if (comparator) {\n isCommon = false;\n includes = arrayIncludesWith;\n }\n else if (length >= LARGE_ARRAY_SIZE) {\n var set = iteratee ? null : createSet(array);\n if (set) {\n return setToArray(set);\n }\n isCommon = false;\n includes = cacheHas;\n seen = new SetCache;\n }\n else {\n seen = iteratee ? [] : result;\n }\n outer:\n while (++index < length) {\n var value = array[index],\n computed = iteratee ? iteratee(value) : value;\n\n value = (comparator || value !== 0) ? value : 0;\n if (isCommon && computed === computed) {\n var seenIndex = seen.length;\n while (seenIndex--) {\n if (seen[seenIndex] === computed) {\n continue outer;\n }\n }\n if (iteratee) {\n seen.push(computed);\n }\n result.push(value);\n }\n else if (!includes(seen, computed, comparator)) {\n if (seen !== result) {\n seen.push(computed);\n }\n result.push(value);\n }\n }\n return result;\n }\n\n /**\n * The base implementation of `_.unset`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The property path to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n */\n function baseUnset(object, path) {\n path = castPath(path, object);\n object = parent(object, path);\n return object == null || delete object[toKey(last(path))];\n }\n\n /**\n * The base implementation of `_.update`.\n *\n * @private\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to update.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize path creation.\n * @returns {Object} Returns `object`.\n */\n function baseUpdate(object, path, updater, customizer) {\n return baseSet(object, path, updater(baseGet(object, path)), customizer);\n }\n\n /**\n * The base implementation of methods like `_.dropWhile` and `_.takeWhile`\n * without support for iteratee shorthands.\n *\n * @private\n * @param {Array} array The array to query.\n * @param {Function} predicate The function invoked per iteration.\n * @param {boolean} [isDrop] Specify dropping elements instead of taking them.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Array} Returns the slice of `array`.\n */\n function baseWhile(array, predicate, isDrop, fromRight) {\n var length = array.length,\n index = fromRight ? length : -1;\n\n while ((fromRight ? index-- : ++index < length) &&\n predicate(array[index], index, array)) {}\n\n return isDrop\n ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length))\n : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index));\n }\n\n /**\n * The base implementation of `wrapperValue` which returns the result of\n * performing a sequence of actions on the unwrapped `value`, where each\n * successive action is supplied the return value of the previous.\n *\n * @private\n * @param {*} value The unwrapped value.\n * @param {Array} actions Actions to perform to resolve the unwrapped value.\n * @returns {*} Returns the resolved value.\n */\n function baseWrapperValue(value, actions) {\n var result = value;\n if (result instanceof LazyWrapper) {\n result = result.value();\n }\n return arrayReduce(actions, function(result, action) {\n return action.func.apply(action.thisArg, arrayPush([result], action.args));\n }, result);\n }\n\n /**\n * The base implementation of methods like `_.xor`, without support for\n * iteratee shorthands, that accepts an array of arrays to inspect.\n *\n * @private\n * @param {Array} arrays The arrays to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of values.\n */\n function baseXor(arrays, iteratee, comparator) {\n var length = arrays.length;\n if (length < 2) {\n return length ? baseUniq(arrays[0]) : [];\n }\n var index = -1,\n result = Array(length);\n\n while (++index < length) {\n var array = arrays[index],\n othIndex = -1;\n\n while (++othIndex < length) {\n if (othIndex != index) {\n result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator);\n }\n }\n }\n return baseUniq(baseFlatten(result, 1), iteratee, comparator);\n }\n\n /**\n * This base implementation of `_.zipObject` which assigns values using `assignFunc`.\n *\n * @private\n * @param {Array} props The property identifiers.\n * @param {Array} values The property values.\n * @param {Function} assignFunc The function to assign values.\n * @returns {Object} Returns the new object.\n */\n function baseZipObject(props, values, assignFunc) {\n var index = -1,\n length = props.length,\n valsLength = values.length,\n result = {};\n\n while (++index < length) {\n var value = index < valsLength ? values[index] : undefined;\n assignFunc(result, props[index], value);\n }\n return result;\n }\n\n /**\n * Casts `value` to an empty array if it's not an array like object.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Array|Object} Returns the cast array-like object.\n */\n function castArrayLikeObject(value) {\n return isArrayLikeObject(value) ? value : [];\n }\n\n /**\n * Casts `value` to `identity` if it's not a function.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {Function} Returns cast function.\n */\n function castFunction(value) {\n return typeof value == 'function' ? value : identity;\n }\n\n /**\n * Casts `value` to a path array if it's not one.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {Object} [object] The object to query keys on.\n * @returns {Array} Returns the cast property path array.\n */\n function castPath(value, object) {\n if (isArray(value)) {\n return value;\n }\n return isKey(value, object) ? [value] : stringToPath(toString(value));\n }\n\n /**\n * A `baseRest` alias which can be replaced with `identity` by module\n * replacement plugins.\n *\n * @private\n * @type {Function}\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n var castRest = baseRest;\n\n /**\n * Casts `array` to a slice if it's needed.\n *\n * @private\n * @param {Array} array The array to inspect.\n * @param {number} start The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the cast slice.\n */\n function castSlice(array, start, end) {\n var length = array.length;\n end = end === undefined ? length : end;\n return (!start && end >= length) ? array : baseSlice(array, start, end);\n }\n\n /**\n * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout).\n *\n * @private\n * @param {number|Object} id The timer id or timeout object of the timer to clear.\n */\n var clearTimeout = ctxClearTimeout || function(id) {\n return root.clearTimeout(id);\n };\n\n /**\n * Creates a clone of `buffer`.\n *\n * @private\n * @param {Buffer} buffer The buffer to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Buffer} Returns the cloned buffer.\n */\n function cloneBuffer(buffer, isDeep) {\n if (isDeep) {\n return buffer.slice();\n }\n var length = buffer.length,\n result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);\n\n buffer.copy(result);\n return result;\n }\n\n /**\n * Creates a clone of `arrayBuffer`.\n *\n * @private\n * @param {ArrayBuffer} arrayBuffer The array buffer to clone.\n * @returns {ArrayBuffer} Returns the cloned array buffer.\n */\n function cloneArrayBuffer(arrayBuffer) {\n var result = new arrayBuffer.constructor(arrayBuffer.byteLength);\n new Uint8Array(result).set(new Uint8Array(arrayBuffer));\n return result;\n }\n\n /**\n * Creates a clone of `dataView`.\n *\n * @private\n * @param {Object} dataView The data view to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned data view.\n */\n function cloneDataView(dataView, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;\n return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);\n }\n\n /**\n * Creates a clone of `regexp`.\n *\n * @private\n * @param {Object} regexp The regexp to clone.\n * @returns {Object} Returns the cloned regexp.\n */\n function cloneRegExp(regexp) {\n var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));\n result.lastIndex = regexp.lastIndex;\n return result;\n }\n\n /**\n * Creates a clone of the `symbol` object.\n *\n * @private\n * @param {Object} symbol The symbol object to clone.\n * @returns {Object} Returns the cloned symbol object.\n */\n function cloneSymbol(symbol) {\n return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};\n }\n\n /**\n * Creates a clone of `typedArray`.\n *\n * @private\n * @param {Object} typedArray The typed array to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the cloned typed array.\n */\n function cloneTypedArray(typedArray, isDeep) {\n var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;\n return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);\n }\n\n /**\n * Compares values to sort them in ascending order.\n *\n * @private\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {number} Returns the sort order indicator for `value`.\n */\n function compareAscending(value, other) {\n if (value !== other) {\n var valIsDefined = value !== undefined,\n valIsNull = value === null,\n valIsReflexive = value === value,\n valIsSymbol = isSymbol(value);\n\n var othIsDefined = other !== undefined,\n othIsNull = other === null,\n othIsReflexive = other === other,\n othIsSymbol = isSymbol(other);\n\n if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) ||\n (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) ||\n (valIsNull && othIsDefined && othIsReflexive) ||\n (!valIsDefined && othIsReflexive) ||\n !valIsReflexive) {\n return 1;\n }\n if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) ||\n (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) ||\n (othIsNull && valIsDefined && valIsReflexive) ||\n (!othIsDefined && valIsReflexive) ||\n !othIsReflexive) {\n return -1;\n }\n }\n return 0;\n }\n\n /**\n * Used by `_.orderBy` to compare multiple properties of a value to another\n * and stable sort them.\n *\n * If `orders` is unspecified, all values are sorted in ascending order. Otherwise,\n * specify an order of \"desc\" for descending or \"asc\" for ascending sort order\n * of corresponding values.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {boolean[]|string[]} orders The order to sort by for each property.\n * @returns {number} Returns the sort order indicator for `object`.\n */\n function compareMultiple(object, other, orders) {\n var index = -1,\n objCriteria = object.criteria,\n othCriteria = other.criteria,\n length = objCriteria.length,\n ordersLength = orders.length;\n\n while (++index < length) {\n var result = compareAscending(objCriteria[index], othCriteria[index]);\n if (result) {\n if (index >= ordersLength) {\n return result;\n }\n var order = orders[index];\n return result * (order == 'desc' ? -1 : 1);\n }\n }\n // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications\n // that causes it, under certain circumstances, to provide the same value for\n // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247\n // for more details.\n //\n // This also ensures a stable sort in V8 and other engines.\n // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details.\n return object.index - other.index;\n }\n\n /**\n * Creates an array that is the composition of partially applied arguments,\n * placeholders, and provided arguments into a single array of arguments.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to prepend to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgs(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersLength = holders.length,\n leftIndex = -1,\n leftLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(leftLength + rangeLength),\n isUncurried = !isCurried;\n\n while (++leftIndex < leftLength) {\n result[leftIndex] = partials[leftIndex];\n }\n while (++argsIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[holders[argsIndex]] = args[argsIndex];\n }\n }\n while (rangeLength--) {\n result[leftIndex++] = args[argsIndex++];\n }\n return result;\n }\n\n /**\n * This function is like `composeArgs` except that the arguments composition\n * is tailored for `_.partialRight`.\n *\n * @private\n * @param {Array} args The provided arguments.\n * @param {Array} partials The arguments to append to those provided.\n * @param {Array} holders The `partials` placeholder indexes.\n * @params {boolean} [isCurried] Specify composing for a curried function.\n * @returns {Array} Returns the new array of composed arguments.\n */\n function composeArgsRight(args, partials, holders, isCurried) {\n var argsIndex = -1,\n argsLength = args.length,\n holdersIndex = -1,\n holdersLength = holders.length,\n rightIndex = -1,\n rightLength = partials.length,\n rangeLength = nativeMax(argsLength - holdersLength, 0),\n result = Array(rangeLength + rightLength),\n isUncurried = !isCurried;\n\n while (++argsIndex < rangeLength) {\n result[argsIndex] = args[argsIndex];\n }\n var offset = argsIndex;\n while (++rightIndex < rightLength) {\n result[offset + rightIndex] = partials[rightIndex];\n }\n while (++holdersIndex < holdersLength) {\n if (isUncurried || argsIndex < argsLength) {\n result[offset + holders[holdersIndex]] = args[argsIndex++];\n }\n }\n return result;\n }\n\n /**\n * Copies the values of `source` to `array`.\n *\n * @private\n * @param {Array} source The array to copy values from.\n * @param {Array} [array=[]] The array to copy values to.\n * @returns {Array} Returns `array`.\n */\n function copyArray(source, array) {\n var index = -1,\n length = source.length;\n\n array || (array = Array(length));\n while (++index < length) {\n array[index] = source[index];\n }\n return array;\n }\n\n /**\n * Copies properties of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy properties from.\n * @param {Array} props The property identifiers to copy.\n * @param {Object} [object={}] The object to copy properties to.\n * @param {Function} [customizer] The function to customize copied values.\n * @returns {Object} Returns `object`.\n */\n function copyObject(source, props, object, customizer) {\n var isNew = !object;\n object || (object = {});\n\n var index = -1,\n length = props.length;\n\n while (++index < length) {\n var key = props[index];\n\n var newValue = customizer\n ? customizer(object[key], source[key], key, object, source)\n : undefined;\n\n if (newValue === undefined) {\n newValue = source[key];\n }\n if (isNew) {\n baseAssignValue(object, key, newValue);\n } else {\n assignValue(object, key, newValue);\n }\n }\n return object;\n }\n\n /**\n * Copies own symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbols(source, object) {\n return copyObject(source, getSymbols(source), object);\n }\n\n /**\n * Copies own and inherited symbols of `source` to `object`.\n *\n * @private\n * @param {Object} source The object to copy symbols from.\n * @param {Object} [object={}] The object to copy symbols to.\n * @returns {Object} Returns `object`.\n */\n function copySymbolsIn(source, object) {\n return copyObject(source, getSymbolsIn(source), object);\n }\n\n /**\n * Creates a function like `_.groupBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} [initializer] The accumulator object initializer.\n * @returns {Function} Returns the new aggregator function.\n */\n function createAggregator(setter, initializer) {\n return function(collection, iteratee) {\n var func = isArray(collection) ? arrayAggregator : baseAggregator,\n accumulator = initializer ? initializer() : {};\n\n return func(collection, setter, getIteratee(iteratee, 2), accumulator);\n };\n }\n\n /**\n * Creates a function like `_.assign`.\n *\n * @private\n * @param {Function} assigner The function to assign values.\n * @returns {Function} Returns the new assigner function.\n */\n function createAssigner(assigner) {\n return baseRest(function(object, sources) {\n var index = -1,\n length = sources.length,\n customizer = length > 1 ? sources[length - 1] : undefined,\n guard = length > 2 ? sources[2] : undefined;\n\n customizer = (assigner.length > 3 && typeof customizer == 'function')\n ? (length--, customizer)\n : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n customizer = length < 3 ? undefined : customizer;\n length = 1;\n }\n object = Object(object);\n while (++index < length) {\n var source = sources[index];\n if (source) {\n assigner(object, source, index, customizer);\n }\n }\n return object;\n });\n }\n\n /**\n * Creates a `baseEach` or `baseEachRight` function.\n *\n * @private\n * @param {Function} eachFunc The function to iterate over a collection.\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseEach(eachFunc, fromRight) {\n return function(collection, iteratee) {\n if (collection == null) {\n return collection;\n }\n if (!isArrayLike(collection)) {\n return eachFunc(collection, iteratee);\n }\n var length = collection.length,\n index = fromRight ? length : -1,\n iterable = Object(collection);\n\n while ((fromRight ? index-- : ++index < length)) {\n if (iteratee(iterable[index], index, iterable) === false) {\n break;\n }\n }\n return collection;\n };\n }\n\n /**\n * Creates a base function for methods like `_.forIn` and `_.forOwn`.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new base function.\n */\n function createBaseFor(fromRight) {\n return function(object, iteratee, keysFunc) {\n var index = -1,\n iterable = Object(object),\n props = keysFunc(object),\n length = props.length;\n\n while (length--) {\n var key = props[fromRight ? length : ++index];\n if (iteratee(iterable[key], key, iterable) === false) {\n break;\n }\n }\n return object;\n };\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the optional `this`\n * binding of `thisArg`.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createBind(func, bitmask, thisArg) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return fn.apply(isBind ? thisArg : this, arguments);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.lowerFirst`.\n *\n * @private\n * @param {string} methodName The name of the `String` case method to use.\n * @returns {Function} Returns the new case function.\n */\n function createCaseFirst(methodName) {\n return function(string) {\n string = toString(string);\n\n var strSymbols = hasUnicode(string)\n ? stringToArray(string)\n : undefined;\n\n var chr = strSymbols\n ? strSymbols[0]\n : string.charAt(0);\n\n var trailing = strSymbols\n ? castSlice(strSymbols, 1).join('')\n : string.slice(1);\n\n return chr[methodName]() + trailing;\n };\n }\n\n /**\n * Creates a function like `_.camelCase`.\n *\n * @private\n * @param {Function} callback The function to combine each word.\n * @returns {Function} Returns the new compounder function.\n */\n function createCompounder(callback) {\n return function(string) {\n return arrayReduce(words(deburr(string).replace(reApos, '')), callback, '');\n };\n }\n\n /**\n * Creates a function that produces an instance of `Ctor` regardless of\n * whether it was invoked as part of a `new` expression or by `call` or `apply`.\n *\n * @private\n * @param {Function} Ctor The constructor to wrap.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCtor(Ctor) {\n return function() {\n // Use a `switch` statement to work with class constructors. See\n // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist\n // for more details.\n var args = arguments;\n switch (args.length) {\n case 0: return new Ctor;\n case 1: return new Ctor(args[0]);\n case 2: return new Ctor(args[0], args[1]);\n case 3: return new Ctor(args[0], args[1], args[2]);\n case 4: return new Ctor(args[0], args[1], args[2], args[3]);\n case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]);\n case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]);\n case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]);\n }\n var thisBinding = baseCreate(Ctor.prototype),\n result = Ctor.apply(thisBinding, args);\n\n // Mimic the constructor's `return` behavior.\n // See https://es5.github.io/#x13.2.2 for more details.\n return isObject(result) ? result : thisBinding;\n };\n }\n\n /**\n * Creates a function that wraps `func` to enable currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {number} arity The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createCurry(func, bitmask, arity) {\n var Ctor = createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length,\n placeholder = getHolder(wrapper);\n\n while (index--) {\n args[index] = arguments[index];\n }\n var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder)\n ? []\n : replaceHolders(args, placeholder);\n\n length -= holders.length;\n if (length < arity) {\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, undefined,\n args, holders, undefined, undefined, arity - length);\n }\n var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n return apply(fn, this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.find` or `_.findLast` function.\n *\n * @private\n * @param {Function} findIndexFunc The function to find the collection index.\n * @returns {Function} Returns the new find function.\n */\n function createFind(findIndexFunc) {\n return function(collection, predicate, fromIndex) {\n var iterable = Object(collection);\n if (!isArrayLike(collection)) {\n var iteratee = getIteratee(predicate, 3);\n collection = keys(collection);\n predicate = function(key) { return iteratee(iterable[key], key, iterable); };\n }\n var index = findIndexFunc(collection, predicate, fromIndex);\n return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined;\n };\n }\n\n /**\n * Creates a `_.flow` or `_.flowRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new flow function.\n */\n function createFlow(fromRight) {\n return flatRest(function(funcs) {\n var length = funcs.length,\n index = length,\n prereq = LodashWrapper.prototype.thru;\n\n if (fromRight) {\n funcs.reverse();\n }\n while (index--) {\n var func = funcs[index];\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (prereq && !wrapper && getFuncName(func) == 'wrapper') {\n var wrapper = new LodashWrapper([], true);\n }\n }\n index = wrapper ? index : length;\n while (++index < length) {\n func = funcs[index];\n\n var funcName = getFuncName(func),\n data = funcName == 'wrapper' ? getData(func) : undefined;\n\n if (data && isLaziable(data[0]) &&\n data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) &&\n !data[4].length && data[9] == 1\n ) {\n wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]);\n } else {\n wrapper = (func.length == 1 && isLaziable(func))\n ? wrapper[funcName]()\n : wrapper.thru(func);\n }\n }\n return function() {\n var args = arguments,\n value = args[0];\n\n if (wrapper && args.length == 1 && isArray(value)) {\n return wrapper.plant(value).value();\n }\n var index = 0,\n result = length ? funcs[index].apply(this, args) : value;\n\n while (++index < length) {\n result = funcs[index].call(this, result);\n }\n return result;\n };\n });\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with optional `this`\n * binding of `thisArg`, partial application, and currying.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [partialsRight] The arguments to append to those provided\n * to the new function.\n * @param {Array} [holdersRight] The `partialsRight` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) {\n var isAry = bitmask & WRAP_ARY_FLAG,\n isBind = bitmask & WRAP_BIND_FLAG,\n isBindKey = bitmask & WRAP_BIND_KEY_FLAG,\n isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG),\n isFlip = bitmask & WRAP_FLIP_FLAG,\n Ctor = isBindKey ? undefined : createCtor(func);\n\n function wrapper() {\n var length = arguments.length,\n args = Array(length),\n index = length;\n\n while (index--) {\n args[index] = arguments[index];\n }\n if (isCurried) {\n var placeholder = getHolder(wrapper),\n holdersCount = countHolders(args, placeholder);\n }\n if (partials) {\n args = composeArgs(args, partials, holders, isCurried);\n }\n if (partialsRight) {\n args = composeArgsRight(args, partialsRight, holdersRight, isCurried);\n }\n length -= holdersCount;\n if (isCurried && length < arity) {\n var newHolders = replaceHolders(args, placeholder);\n return createRecurry(\n func, bitmask, createHybrid, wrapper.placeholder, thisArg,\n args, newHolders, argPos, ary, arity - length\n );\n }\n var thisBinding = isBind ? thisArg : this,\n fn = isBindKey ? thisBinding[func] : func;\n\n length = args.length;\n if (argPos) {\n args = reorder(args, argPos);\n } else if (isFlip && length > 1) {\n args.reverse();\n }\n if (isAry && ary < length) {\n args.length = ary;\n }\n if (this && this !== root && this instanceof wrapper) {\n fn = Ctor || createCtor(fn);\n }\n return fn.apply(thisBinding, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a function like `_.invertBy`.\n *\n * @private\n * @param {Function} setter The function to set accumulator values.\n * @param {Function} toIteratee The function to resolve iteratees.\n * @returns {Function} Returns the new inverter function.\n */\n function createInverter(setter, toIteratee) {\n return function(object, iteratee) {\n return baseInverter(object, setter, toIteratee(iteratee), {});\n };\n }\n\n /**\n * Creates a function that performs a mathematical operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @param {number} [defaultValue] The value used for `undefined` arguments.\n * @returns {Function} Returns the new mathematical operation function.\n */\n function createMathOperation(operator, defaultValue) {\n return function(value, other) {\n var result;\n if (value === undefined && other === undefined) {\n return defaultValue;\n }\n if (value !== undefined) {\n result = value;\n }\n if (other !== undefined) {\n if (result === undefined) {\n return other;\n }\n if (typeof value == 'string' || typeof other == 'string') {\n value = baseToString(value);\n other = baseToString(other);\n } else {\n value = baseToNumber(value);\n other = baseToNumber(other);\n }\n result = operator(value, other);\n }\n return result;\n };\n }\n\n /**\n * Creates a function like `_.over`.\n *\n * @private\n * @param {Function} arrayFunc The function to iterate over iteratees.\n * @returns {Function} Returns the new over function.\n */\n function createOver(arrayFunc) {\n return flatRest(function(iteratees) {\n iteratees = arrayMap(iteratees, baseUnary(getIteratee()));\n return baseRest(function(args) {\n var thisArg = this;\n return arrayFunc(iteratees, function(iteratee) {\n return apply(iteratee, thisArg, args);\n });\n });\n });\n }\n\n /**\n * Creates the padding for `string` based on `length`. The `chars` string\n * is truncated if the number of characters exceeds `length`.\n *\n * @private\n * @param {number} length The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padding for `string`.\n */\n function createPadding(length, chars) {\n chars = chars === undefined ? ' ' : baseToString(chars);\n\n var charsLength = chars.length;\n if (charsLength < 2) {\n return charsLength ? baseRepeat(chars, length) : chars;\n }\n var result = baseRepeat(chars, nativeCeil(length / stringSize(chars)));\n return hasUnicode(chars)\n ? castSlice(stringToArray(result), 0, length).join('')\n : result.slice(0, length);\n }\n\n /**\n * Creates a function that wraps `func` to invoke it with the `this` binding\n * of `thisArg` and `partials` prepended to the arguments it receives.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {Array} partials The arguments to prepend to those provided to\n * the new function.\n * @returns {Function} Returns the new wrapped function.\n */\n function createPartial(func, bitmask, thisArg, partials) {\n var isBind = bitmask & WRAP_BIND_FLAG,\n Ctor = createCtor(func);\n\n function wrapper() {\n var argsIndex = -1,\n argsLength = arguments.length,\n leftIndex = -1,\n leftLength = partials.length,\n args = Array(leftLength + argsLength),\n fn = (this && this !== root && this instanceof wrapper) ? Ctor : func;\n\n while (++leftIndex < leftLength) {\n args[leftIndex] = partials[leftIndex];\n }\n while (argsLength--) {\n args[leftIndex++] = arguments[++argsIndex];\n }\n return apply(fn, isBind ? thisArg : this, args);\n }\n return wrapper;\n }\n\n /**\n * Creates a `_.range` or `_.rangeRight` function.\n *\n * @private\n * @param {boolean} [fromRight] Specify iterating from right to left.\n * @returns {Function} Returns the new range function.\n */\n function createRange(fromRight) {\n return function(start, end, step) {\n if (step && typeof step != 'number' && isIterateeCall(start, end, step)) {\n end = step = undefined;\n }\n // Ensure the sign of `-0` is preserved.\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n step = step === undefined ? (start < end ? 1 : -1) : toFinite(step);\n return baseRange(start, end, step, fromRight);\n };\n }\n\n /**\n * Creates a function that performs a relational operation on two values.\n *\n * @private\n * @param {Function} operator The function to perform the operation.\n * @returns {Function} Returns the new relational operation function.\n */\n function createRelationalOperation(operator) {\n return function(value, other) {\n if (!(typeof value == 'string' && typeof other == 'string')) {\n value = toNumber(value);\n other = toNumber(other);\n }\n return operator(value, other);\n };\n }\n\n /**\n * Creates a function that wraps `func` to continue currying.\n *\n * @private\n * @param {Function} func The function to wrap.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @param {Function} wrapFunc The function to create the `func` wrapper.\n * @param {*} placeholder The placeholder value.\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to prepend to those provided to\n * the new function.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) {\n var isCurry = bitmask & WRAP_CURRY_FLAG,\n newHolders = isCurry ? holders : undefined,\n newHoldersRight = isCurry ? undefined : holders,\n newPartials = isCurry ? partials : undefined,\n newPartialsRight = isCurry ? undefined : partials;\n\n bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG);\n bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG);\n\n if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) {\n bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG);\n }\n var newData = [\n func, bitmask, thisArg, newPartials, newHolders, newPartialsRight,\n newHoldersRight, argPos, ary, arity\n ];\n\n var result = wrapFunc.apply(undefined, newData);\n if (isLaziable(func)) {\n setData(result, newData);\n }\n result.placeholder = placeholder;\n return setWrapToString(result, func, bitmask);\n }\n\n /**\n * Creates a function like `_.round`.\n *\n * @private\n * @param {string} methodName The name of the `Math` method to use when rounding.\n * @returns {Function} Returns the new round function.\n */\n function createRound(methodName) {\n var func = Math[methodName];\n return function(number, precision) {\n number = toNumber(number);\n precision = precision == null ? 0 : nativeMin(toInteger(precision), 292);\n if (precision && nativeIsFinite(number)) {\n // Shift with exponential notation to avoid floating-point issues.\n // See [MDN](https://mdn.io/round#Examples) for more details.\n var pair = (toString(number) + 'e').split('e'),\n value = func(pair[0] + 'e' + (+pair[1] + precision));\n\n pair = (toString(value) + 'e').split('e');\n return +(pair[0] + 'e' + (+pair[1] - precision));\n }\n return func(number);\n };\n }\n\n /**\n * Creates a set object of `values`.\n *\n * @private\n * @param {Array} values The values to add to the set.\n * @returns {Object} Returns the new set.\n */\n var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) {\n return new Set(values);\n };\n\n /**\n * Creates a `_.toPairs` or `_.toPairsIn` function.\n *\n * @private\n * @param {Function} keysFunc The function to get the keys of a given object.\n * @returns {Function} Returns the new pairs function.\n */\n function createToPairs(keysFunc) {\n return function(object) {\n var tag = getTag(object);\n if (tag == mapTag) {\n return mapToArray(object);\n }\n if (tag == setTag) {\n return setToPairs(object);\n }\n return baseToPairs(object, keysFunc(object));\n };\n }\n\n /**\n * Creates a function that either curries or invokes `func` with optional\n * `this` binding and partially applied arguments.\n *\n * @private\n * @param {Function|string} func The function or method name to wrap.\n * @param {number} bitmask The bitmask flags.\n * 1 - `_.bind`\n * 2 - `_.bindKey`\n * 4 - `_.curry` or `_.curryRight` of a bound function\n * 8 - `_.curry`\n * 16 - `_.curryRight`\n * 32 - `_.partial`\n * 64 - `_.partialRight`\n * 128 - `_.rearg`\n * 256 - `_.ary`\n * 512 - `_.flip`\n * @param {*} [thisArg] The `this` binding of `func`.\n * @param {Array} [partials] The arguments to be partially applied.\n * @param {Array} [holders] The `partials` placeholder indexes.\n * @param {Array} [argPos] The argument positions of the new function.\n * @param {number} [ary] The arity cap of `func`.\n * @param {number} [arity] The arity of `func`.\n * @returns {Function} Returns the new wrapped function.\n */\n function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) {\n var isBindKey = bitmask & WRAP_BIND_KEY_FLAG;\n if (!isBindKey && typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var length = partials ? partials.length : 0;\n if (!length) {\n bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG);\n partials = holders = undefined;\n }\n ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0);\n arity = arity === undefined ? arity : toInteger(arity);\n length -= holders ? holders.length : 0;\n\n if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) {\n var partialsRight = partials,\n holdersRight = holders;\n\n partials = holders = undefined;\n }\n var data = isBindKey ? undefined : getData(func);\n\n var newData = [\n func, bitmask, thisArg, partials, holders, partialsRight, holdersRight,\n argPos, ary, arity\n ];\n\n if (data) {\n mergeData(newData, data);\n }\n func = newData[0];\n bitmask = newData[1];\n thisArg = newData[2];\n partials = newData[3];\n holders = newData[4];\n arity = newData[9] = newData[9] === undefined\n ? (isBindKey ? 0 : func.length)\n : nativeMax(newData[9] - length, 0);\n\n if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) {\n bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG);\n }\n if (!bitmask || bitmask == WRAP_BIND_FLAG) {\n var result = createBind(func, bitmask, thisArg);\n } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) {\n result = createCurry(func, bitmask, arity);\n } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) {\n result = createPartial(func, bitmask, thisArg, partials);\n } else {\n result = createHybrid.apply(undefined, newData);\n }\n var setter = data ? baseSetData : setData;\n return setWrapToString(setter(result, newData), func, bitmask);\n }\n\n /**\n * Used by `_.defaults` to customize its `_.assignIn` use to assign properties\n * of source objects to the destination object for all destination properties\n * that resolve to `undefined`.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to assign.\n * @param {Object} object The parent object of `objValue`.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsAssignIn(objValue, srcValue, key, object) {\n if (objValue === undefined ||\n (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n return srcValue;\n }\n return objValue;\n }\n\n /**\n * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source\n * objects into destination objects that are passed thru.\n *\n * @private\n * @param {*} objValue The destination value.\n * @param {*} srcValue The source value.\n * @param {string} key The key of the property to merge.\n * @param {Object} object The parent object of `objValue`.\n * @param {Object} source The parent object of `srcValue`.\n * @param {Object} [stack] Tracks traversed source values and their merged\n * counterparts.\n * @returns {*} Returns the value to assign.\n */\n function customDefaultsMerge(objValue, srcValue, key, object, source, stack) {\n if (isObject(objValue) && isObject(srcValue)) {\n // Recursively merge objects and arrays (susceptible to call stack limits).\n stack.set(srcValue, objValue);\n baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack);\n stack['delete'](srcValue);\n }\n return objValue;\n }\n\n /**\n * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain\n * objects.\n *\n * @private\n * @param {*} value The value to inspect.\n * @param {string} key The key of the property to inspect.\n * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`.\n */\n function customOmitClone(value) {\n return isPlainObject(value) ? undefined : value;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for arrays with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Array} array The array to compare.\n * @param {Array} other The other array to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `array` and `other` objects.\n * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.\n */\n function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n arrLength = array.length,\n othLength = other.length;\n\n if (arrLength != othLength && !(isPartial && othLength > arrLength)) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(array);\n if (stacked && stack.get(other)) {\n return stacked == other;\n }\n var index = -1,\n result = true,\n seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined;\n\n stack.set(array, other);\n stack.set(other, array);\n\n // Ignore non-index properties.\n while (++index < arrLength) {\n var arrValue = array[index],\n othValue = other[index];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, arrValue, index, other, array, stack)\n : customizer(arrValue, othValue, index, array, other, stack);\n }\n if (compared !== undefined) {\n if (compared) {\n continue;\n }\n result = false;\n break;\n }\n // Recursively compare arrays (susceptible to call stack limits).\n if (seen) {\n if (!arraySome(other, function(othValue, othIndex) {\n if (!cacheHas(seen, othIndex) &&\n (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {\n return seen.push(othIndex);\n }\n })) {\n result = false;\n break;\n }\n } else if (!(\n arrValue === othValue ||\n equalFunc(arrValue, othValue, bitmask, customizer, stack)\n )) {\n result = false;\n break;\n }\n }\n stack['delete'](array);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for comparing objects of\n * the same `toStringTag`.\n *\n * **Note:** This function only supports comparing values with tags of\n * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {string} tag The `toStringTag` of the objects to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {\n switch (tag) {\n case dataViewTag:\n if ((object.byteLength != other.byteLength) ||\n (object.byteOffset != other.byteOffset)) {\n return false;\n }\n object = object.buffer;\n other = other.buffer;\n\n case arrayBufferTag:\n if ((object.byteLength != other.byteLength) ||\n !equalFunc(new Uint8Array(object), new Uint8Array(other))) {\n return false;\n }\n return true;\n\n case boolTag:\n case dateTag:\n case numberTag:\n // Coerce booleans to `1` or `0` and dates to milliseconds.\n // Invalid dates are coerced to `NaN`.\n return eq(+object, +other);\n\n case errorTag:\n return object.name == other.name && object.message == other.message;\n\n case regexpTag:\n case stringTag:\n // Coerce regexes to strings and treat strings, primitives and objects,\n // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring\n // for more details.\n return object == (other + '');\n\n case mapTag:\n var convert = mapToArray;\n\n case setTag:\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG;\n convert || (convert = setToArray);\n\n if (object.size != other.size && !isPartial) {\n return false;\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked) {\n return stacked == other;\n }\n bitmask |= COMPARE_UNORDERED_FLAG;\n\n // Recursively compare objects (susceptible to call stack limits).\n stack.set(object, other);\n var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);\n stack['delete'](object);\n return result;\n\n case symbolTag:\n if (symbolValueOf) {\n return symbolValueOf.call(object) == symbolValueOf.call(other);\n }\n }\n return false;\n }\n\n /**\n * A specialized version of `baseIsEqualDeep` for objects with support for\n * partial deep comparisons.\n *\n * @private\n * @param {Object} object The object to compare.\n * @param {Object} other The other object to compare.\n * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.\n * @param {Function} customizer The function to customize comparisons.\n * @param {Function} equalFunc The function to determine equivalents of values.\n * @param {Object} stack Tracks traversed `object` and `other` objects.\n * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.\n */\n function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {\n var isPartial = bitmask & COMPARE_PARTIAL_FLAG,\n objProps = getAllKeys(object),\n objLength = objProps.length,\n othProps = getAllKeys(other),\n othLength = othProps.length;\n\n if (objLength != othLength && !isPartial) {\n return false;\n }\n var index = objLength;\n while (index--) {\n var key = objProps[index];\n if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {\n return false;\n }\n }\n // Assume cyclic values are equal.\n var stacked = stack.get(object);\n if (stacked && stack.get(other)) {\n return stacked == other;\n }\n var result = true;\n stack.set(object, other);\n stack.set(other, object);\n\n var skipCtor = isPartial;\n while (++index < objLength) {\n key = objProps[index];\n var objValue = object[key],\n othValue = other[key];\n\n if (customizer) {\n var compared = isPartial\n ? customizer(othValue, objValue, key, other, object, stack)\n : customizer(objValue, othValue, key, object, other, stack);\n }\n // Recursively compare objects (susceptible to call stack limits).\n if (!(compared === undefined\n ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack))\n : compared\n )) {\n result = false;\n break;\n }\n skipCtor || (skipCtor = key == 'constructor');\n }\n if (result && !skipCtor) {\n var objCtor = object.constructor,\n othCtor = other.constructor;\n\n // Non `Object` object instances with different constructors are not equal.\n if (objCtor != othCtor &&\n ('constructor' in object && 'constructor' in other) &&\n !(typeof objCtor == 'function' && objCtor instanceof objCtor &&\n typeof othCtor == 'function' && othCtor instanceof othCtor)) {\n result = false;\n }\n }\n stack['delete'](object);\n stack['delete'](other);\n return result;\n }\n\n /**\n * A specialized version of `baseRest` which flattens the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @returns {Function} Returns the new function.\n */\n function flatRest(func) {\n return setToString(overRest(func, undefined, flatten), func + '');\n }\n\n /**\n * Creates an array of own enumerable property names and symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeys(object) {\n return baseGetAllKeys(object, keys, getSymbols);\n }\n\n /**\n * Creates an array of own and inherited enumerable property names and\n * symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names and symbols.\n */\n function getAllKeysIn(object) {\n return baseGetAllKeys(object, keysIn, getSymbolsIn);\n }\n\n /**\n * Gets metadata for `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {*} Returns the metadata for `func`.\n */\n var getData = !metaMap ? noop : function(func) {\n return metaMap.get(func);\n };\n\n /**\n * Gets the name of `func`.\n *\n * @private\n * @param {Function} func The function to query.\n * @returns {string} Returns the function name.\n */\n function getFuncName(func) {\n var result = (func.name + ''),\n array = realNames[result],\n length = hasOwnProperty.call(realNames, result) ? array.length : 0;\n\n while (length--) {\n var data = array[length],\n otherFunc = data.func;\n if (otherFunc == null || otherFunc == func) {\n return data.name;\n }\n }\n return result;\n }\n\n /**\n * Gets the argument placeholder value for `func`.\n *\n * @private\n * @param {Function} func The function to inspect.\n * @returns {*} Returns the placeholder value.\n */\n function getHolder(func) {\n var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func;\n return object.placeholder;\n }\n\n /**\n * Gets the appropriate \"iteratee\" function. If `_.iteratee` is customized,\n * this function returns the custom method, otherwise it returns `baseIteratee`.\n * If arguments are provided, the chosen function is invoked with them and\n * its result is returned.\n *\n * @private\n * @param {*} [value] The value to convert to an iteratee.\n * @param {number} [arity] The arity of the created iteratee.\n * @returns {Function} Returns the chosen function or its result.\n */\n function getIteratee() {\n var result = lodash.iteratee || iteratee;\n result = result === iteratee ? baseIteratee : result;\n return arguments.length ? result(arguments[0], arguments[1]) : result;\n }\n\n /**\n * Gets the data for `map`.\n *\n * @private\n * @param {Object} map The map to query.\n * @param {string} key The reference key.\n * @returns {*} Returns the map data.\n */\n function getMapData(map, key) {\n var data = map.__data__;\n return isKeyable(key)\n ? data[typeof key == 'string' ? 'string' : 'hash']\n : data.map;\n }\n\n /**\n * Gets the property names, values, and compare flags of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the match data of `object`.\n */\n function getMatchData(object) {\n var result = keys(object),\n length = result.length;\n\n while (length--) {\n var key = result[length],\n value = object[key];\n\n result[length] = [key, value, isStrictComparable(value)];\n }\n return result;\n }\n\n /**\n * Gets the native function at `key` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the method to get.\n * @returns {*} Returns the function if it's native, else `undefined`.\n */\n function getNative(object, key) {\n var value = getValue(object, key);\n return baseIsNative(value) ? value : undefined;\n }\n\n /**\n * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the raw `toStringTag`.\n */\n function getRawTag(value) {\n var isOwn = hasOwnProperty.call(value, symToStringTag),\n tag = value[symToStringTag];\n\n try {\n value[symToStringTag] = undefined;\n var unmasked = true;\n } catch (e) {}\n\n var result = nativeObjectToString.call(value);\n if (unmasked) {\n if (isOwn) {\n value[symToStringTag] = tag;\n } else {\n delete value[symToStringTag];\n }\n }\n return result;\n }\n\n /**\n * Creates an array of the own enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbols = !nativeGetSymbols ? stubArray : function(object) {\n if (object == null) {\n return [];\n }\n object = Object(object);\n return arrayFilter(nativeGetSymbols(object), function(symbol) {\n return propertyIsEnumerable.call(object, symbol);\n });\n };\n\n /**\n * Creates an array of the own and inherited enumerable symbols of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of symbols.\n */\n var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) {\n var result = [];\n while (object) {\n arrayPush(result, getSymbols(object));\n object = getPrototype(object);\n }\n return result;\n };\n\n /**\n * Gets the `toStringTag` of `value`.\n *\n * @private\n * @param {*} value The value to query.\n * @returns {string} Returns the `toStringTag`.\n */\n var getTag = baseGetTag;\n\n // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.\n if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) ||\n (Map && getTag(new Map) != mapTag) ||\n (Promise && getTag(Promise.resolve()) != promiseTag) ||\n (Set && getTag(new Set) != setTag) ||\n (WeakMap && getTag(new WeakMap) != weakMapTag)) {\n getTag = function(value) {\n var result = baseGetTag(value),\n Ctor = result == objectTag ? value.constructor : undefined,\n ctorString = Ctor ? toSource(Ctor) : '';\n\n if (ctorString) {\n switch (ctorString) {\n case dataViewCtorString: return dataViewTag;\n case mapCtorString: return mapTag;\n case promiseCtorString: return promiseTag;\n case setCtorString: return setTag;\n case weakMapCtorString: return weakMapTag;\n }\n }\n return result;\n };\n }\n\n /**\n * Gets the view, applying any `transforms` to the `start` and `end` positions.\n *\n * @private\n * @param {number} start The start of the view.\n * @param {number} end The end of the view.\n * @param {Array} transforms The transformations to apply to the view.\n * @returns {Object} Returns an object containing the `start` and `end`\n * positions of the view.\n */\n function getView(start, end, transforms) {\n var index = -1,\n length = transforms.length;\n\n while (++index < length) {\n var data = transforms[index],\n size = data.size;\n\n switch (data.type) {\n case 'drop': start += size; break;\n case 'dropRight': end -= size; break;\n case 'take': end = nativeMin(end, start + size); break;\n case 'takeRight': start = nativeMax(start, end - size); break;\n }\n }\n return { 'start': start, 'end': end };\n }\n\n /**\n * Extracts wrapper details from the `source` body comment.\n *\n * @private\n * @param {string} source The source to inspect.\n * @returns {Array} Returns the wrapper details.\n */\n function getWrapDetails(source) {\n var match = source.match(reWrapDetails);\n return match ? match[1].split(reSplitDetails) : [];\n }\n\n /**\n * Checks if `path` exists on `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @param {Function} hasFunc The function to check properties.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n */\n function hasPath(object, path, hasFunc) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length,\n result = false;\n\n while (++index < length) {\n var key = toKey(path[index]);\n if (!(result = object != null && hasFunc(object, key))) {\n break;\n }\n object = object[key];\n }\n if (result || ++index != length) {\n return result;\n }\n length = object == null ? 0 : object.length;\n return !!length && isLength(length) && isIndex(key, length) &&\n (isArray(object) || isArguments(object));\n }\n\n /**\n * Initializes an array clone.\n *\n * @private\n * @param {Array} array The array to clone.\n * @returns {Array} Returns the initialized clone.\n */\n function initCloneArray(array) {\n var length = array.length,\n result = new array.constructor(length);\n\n // Add properties assigned by `RegExp#exec`.\n if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {\n result.index = array.index;\n result.input = array.input;\n }\n return result;\n }\n\n /**\n * Initializes an object clone.\n *\n * @private\n * @param {Object} object The object to clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneObject(object) {\n return (typeof object.constructor == 'function' && !isPrototype(object))\n ? baseCreate(getPrototype(object))\n : {};\n }\n\n /**\n * Initializes an object clone based on its `toStringTag`.\n *\n * **Note:** This function only supports cloning values with tags of\n * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.\n *\n * @private\n * @param {Object} object The object to clone.\n * @param {string} tag The `toStringTag` of the object to clone.\n * @param {boolean} [isDeep] Specify a deep clone.\n * @returns {Object} Returns the initialized clone.\n */\n function initCloneByTag(object, tag, isDeep) {\n var Ctor = object.constructor;\n switch (tag) {\n case arrayBufferTag:\n return cloneArrayBuffer(object);\n\n case boolTag:\n case dateTag:\n return new Ctor(+object);\n\n case dataViewTag:\n return cloneDataView(object, isDeep);\n\n case float32Tag: case float64Tag:\n case int8Tag: case int16Tag: case int32Tag:\n case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag:\n return cloneTypedArray(object, isDeep);\n\n case mapTag:\n return new Ctor;\n\n case numberTag:\n case stringTag:\n return new Ctor(object);\n\n case regexpTag:\n return cloneRegExp(object);\n\n case setTag:\n return new Ctor;\n\n case symbolTag:\n return cloneSymbol(object);\n }\n }\n\n /**\n * Inserts wrapper `details` in a comment at the top of the `source` body.\n *\n * @private\n * @param {string} source The source to modify.\n * @returns {Array} details The details to insert.\n * @returns {string} Returns the modified source.\n */\n function insertWrapDetails(source, details) {\n var length = details.length;\n if (!length) {\n return source;\n }\n var lastIndex = length - 1;\n details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex];\n details = details.join(length > 2 ? ', ' : ' ');\n return source.replace(reWrapComment, '{\\n/* [wrapped with ' + details + '] */\\n');\n }\n\n /**\n * Checks if `value` is a flattenable `arguments` object or array.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is flattenable, else `false`.\n */\n function isFlattenable(value) {\n return isArray(value) || isArguments(value) ||\n !!(spreadableSymbol && value && value[spreadableSymbol]);\n }\n\n /**\n * Checks if `value` is a valid array-like index.\n *\n * @private\n * @param {*} value The value to check.\n * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.\n * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.\n */\n function isIndex(value, length) {\n var type = typeof value;\n length = length == null ? MAX_SAFE_INTEGER : length;\n\n return !!length &&\n (type == 'number' ||\n (type != 'symbol' && reIsUint.test(value))) &&\n (value > -1 && value % 1 == 0 && value < length);\n }\n\n /**\n * Checks if the given arguments are from an iteratee call.\n *\n * @private\n * @param {*} value The potential iteratee value argument.\n * @param {*} index The potential iteratee index or key argument.\n * @param {*} object The potential iteratee object argument.\n * @returns {boolean} Returns `true` if the arguments are from an iteratee call,\n * else `false`.\n */\n function isIterateeCall(value, index, object) {\n if (!isObject(object)) {\n return false;\n }\n var type = typeof index;\n if (type == 'number'\n ? (isArrayLike(object) && isIndex(index, object.length))\n : (type == 'string' && index in object)\n ) {\n return eq(object[index], value);\n }\n return false;\n }\n\n /**\n * Checks if `value` is a property name and not a property path.\n *\n * @private\n * @param {*} value The value to check.\n * @param {Object} [object] The object to query keys on.\n * @returns {boolean} Returns `true` if `value` is a property name, else `false`.\n */\n function isKey(value, object) {\n if (isArray(value)) {\n return false;\n }\n var type = typeof value;\n if (type == 'number' || type == 'symbol' || type == 'boolean' ||\n value == null || isSymbol(value)) {\n return true;\n }\n return reIsPlainProp.test(value) || !reIsDeepProp.test(value) ||\n (object != null && value in Object(object));\n }\n\n /**\n * Checks if `value` is suitable for use as unique object key.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is suitable, else `false`.\n */\n function isKeyable(value) {\n var type = typeof value;\n return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean')\n ? (value !== '__proto__')\n : (value === null);\n }\n\n /**\n * Checks if `func` has a lazy counterpart.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` has a lazy counterpart,\n * else `false`.\n */\n function isLaziable(func) {\n var funcName = getFuncName(func),\n other = lodash[funcName];\n\n if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) {\n return false;\n }\n if (func === other) {\n return true;\n }\n var data = getData(other);\n return !!data && func === data[0];\n }\n\n /**\n * Checks if `func` has its source masked.\n *\n * @private\n * @param {Function} func The function to check.\n * @returns {boolean} Returns `true` if `func` is masked, else `false`.\n */\n function isMasked(func) {\n return !!maskSrcKey && (maskSrcKey in func);\n }\n\n /**\n * Checks if `func` is capable of being masked.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `func` is maskable, else `false`.\n */\n var isMaskable = coreJsData ? isFunction : stubFalse;\n\n /**\n * Checks if `value` is likely a prototype object.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.\n */\n function isPrototype(value) {\n var Ctor = value && value.constructor,\n proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto;\n\n return value === proto;\n }\n\n /**\n * Checks if `value` is suitable for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` if suitable for strict\n * equality comparisons, else `false`.\n */\n function isStrictComparable(value) {\n return value === value && !isObject(value);\n }\n\n /**\n * A specialized version of `matchesProperty` for source values suitable\n * for strict equality comparisons, i.e. `===`.\n *\n * @private\n * @param {string} key The key of the property to get.\n * @param {*} srcValue The value to match.\n * @returns {Function} Returns the new spec function.\n */\n function matchesStrictComparable(key, srcValue) {\n return function(object) {\n if (object == null) {\n return false;\n }\n return object[key] === srcValue &&\n (srcValue !== undefined || (key in Object(object)));\n };\n }\n\n /**\n * A specialized version of `_.memoize` which clears the memoized function's\n * cache when it exceeds `MAX_MEMOIZE_SIZE`.\n *\n * @private\n * @param {Function} func The function to have its output memoized.\n * @returns {Function} Returns the new memoized function.\n */\n function memoizeCapped(func) {\n var result = memoize(func, function(key) {\n if (cache.size === MAX_MEMOIZE_SIZE) {\n cache.clear();\n }\n return key;\n });\n\n var cache = result.cache;\n return result;\n }\n\n /**\n * Merges the function metadata of `source` into `data`.\n *\n * Merging metadata reduces the number of wrappers used to invoke a function.\n * This is possible because methods like `_.bind`, `_.curry`, and `_.partial`\n * may be applied regardless of execution order. Methods like `_.ary` and\n * `_.rearg` modify function arguments, making the order in which they are\n * executed important, preventing the merging of metadata. However, we make\n * an exception for a safe combined case where curried functions have `_.ary`\n * and or `_.rearg` applied.\n *\n * @private\n * @param {Array} data The destination metadata.\n * @param {Array} source The source metadata.\n * @returns {Array} Returns `data`.\n */\n function mergeData(data, source) {\n var bitmask = data[1],\n srcBitmask = source[1],\n newBitmask = bitmask | srcBitmask,\n isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG);\n\n var isCombo =\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) ||\n ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) ||\n ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG));\n\n // Exit early if metadata can't be merged.\n if (!(isCommon || isCombo)) {\n return data;\n }\n // Use source `thisArg` if available.\n if (srcBitmask & WRAP_BIND_FLAG) {\n data[2] = source[2];\n // Set when currying a bound function.\n newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG;\n }\n // Compose partial arguments.\n var value = source[3];\n if (value) {\n var partials = data[3];\n data[3] = partials ? composeArgs(partials, value, source[4]) : value;\n data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4];\n }\n // Compose partial right arguments.\n value = source[5];\n if (value) {\n partials = data[5];\n data[5] = partials ? composeArgsRight(partials, value, source[6]) : value;\n data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6];\n }\n // Use source `argPos` if available.\n value = source[7];\n if (value) {\n data[7] = value;\n }\n // Use source `ary` if it's smaller.\n if (srcBitmask & WRAP_ARY_FLAG) {\n data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]);\n }\n // Use source `arity` if one is not provided.\n if (data[9] == null) {\n data[9] = source[9];\n }\n // Use source `func` and merge bitmasks.\n data[0] = source[0];\n data[1] = newBitmask;\n\n return data;\n }\n\n /**\n * This function is like\n * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * except that it includes inherited enumerable properties.\n *\n * @private\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n */\n function nativeKeysIn(object) {\n var result = [];\n if (object != null) {\n for (var key in Object(object)) {\n result.push(key);\n }\n }\n return result;\n }\n\n /**\n * Converts `value` to a string using `Object.prototype.toString`.\n *\n * @private\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n */\n function objectToString(value) {\n return nativeObjectToString.call(value);\n }\n\n /**\n * A specialized version of `baseRest` which transforms the rest array.\n *\n * @private\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @param {Function} transform The rest array transform.\n * @returns {Function} Returns the new function.\n */\n function overRest(func, start, transform) {\n start = nativeMax(start === undefined ? (func.length - 1) : start, 0);\n return function() {\n var args = arguments,\n index = -1,\n length = nativeMax(args.length - start, 0),\n array = Array(length);\n\n while (++index < length) {\n array[index] = args[start + index];\n }\n index = -1;\n var otherArgs = Array(start + 1);\n while (++index < start) {\n otherArgs[index] = args[index];\n }\n otherArgs[start] = transform(array);\n return apply(func, this, otherArgs);\n };\n }\n\n /**\n * Gets the parent value at `path` of `object`.\n *\n * @private\n * @param {Object} object The object to query.\n * @param {Array} path The path to get the parent value of.\n * @returns {*} Returns the parent value.\n */\n function parent(object, path) {\n return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1));\n }\n\n /**\n * Reorder `array` according to the specified indexes where the element at\n * the first index is assigned as the first element, the element at\n * the second index is assigned as the second element, and so on.\n *\n * @private\n * @param {Array} array The array to reorder.\n * @param {Array} indexes The arranged array indexes.\n * @returns {Array} Returns `array`.\n */\n function reorder(array, indexes) {\n var arrLength = array.length,\n length = nativeMin(indexes.length, arrLength),\n oldArray = copyArray(array);\n\n while (length--) {\n var index = indexes[length];\n array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined;\n }\n return array;\n }\n\n /**\n * Gets the value at `key`, unless `key` is \"__proto__\" or \"constructor\".\n *\n * @private\n * @param {Object} object The object to query.\n * @param {string} key The key of the property to get.\n * @returns {*} Returns the property value.\n */\n function safeGet(object, key) {\n if (key === 'constructor' && typeof object[key] === 'function') {\n return;\n }\n\n if (key == '__proto__') {\n return;\n }\n\n return object[key];\n }\n\n /**\n * Sets metadata for `func`.\n *\n * **Note:** If this function becomes hot, i.e. is invoked a lot in a short\n * period of time, it will trip its breaker and transition to an identity\n * function to avoid garbage collection pauses in V8. See\n * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070)\n * for more details.\n *\n * @private\n * @param {Function} func The function to associate metadata with.\n * @param {*} data The metadata.\n * @returns {Function} Returns `func`.\n */\n var setData = shortOut(baseSetData);\n\n /**\n * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout).\n *\n * @private\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @returns {number|Object} Returns the timer id or timeout object.\n */\n var setTimeout = ctxSetTimeout || function(func, wait) {\n return root.setTimeout(func, wait);\n };\n\n /**\n * Sets the `toString` method of `func` to return `string`.\n *\n * @private\n * @param {Function} func The function to modify.\n * @param {Function} string The `toString` result.\n * @returns {Function} Returns `func`.\n */\n var setToString = shortOut(baseSetToString);\n\n /**\n * Sets the `toString` method of `wrapper` to mimic the source of `reference`\n * with wrapper details in a comment at the top of the source body.\n *\n * @private\n * @param {Function} wrapper The function to modify.\n * @param {Function} reference The reference function.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Function} Returns `wrapper`.\n */\n function setWrapToString(wrapper, reference, bitmask) {\n var source = (reference + '');\n return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask)));\n }\n\n /**\n * Creates a function that'll short out and invoke `identity` instead\n * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN`\n * milliseconds.\n *\n * @private\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new shortable function.\n */\n function shortOut(func) {\n var count = 0,\n lastCalled = 0;\n\n return function() {\n var stamp = nativeNow(),\n remaining = HOT_SPAN - (stamp - lastCalled);\n\n lastCalled = stamp;\n if (remaining > 0) {\n if (++count >= HOT_COUNT) {\n return arguments[0];\n }\n } else {\n count = 0;\n }\n return func.apply(undefined, arguments);\n };\n }\n\n /**\n * A specialized version of `_.shuffle` which mutates and sets the size of `array`.\n *\n * @private\n * @param {Array} array The array to shuffle.\n * @param {number} [size=array.length] The size of `array`.\n * @returns {Array} Returns `array`.\n */\n function shuffleSelf(array, size) {\n var index = -1,\n length = array.length,\n lastIndex = length - 1;\n\n size = size === undefined ? length : size;\n while (++index < size) {\n var rand = baseRandom(index, lastIndex),\n value = array[rand];\n\n array[rand] = array[index];\n array[index] = value;\n }\n array.length = size;\n return array;\n }\n\n /**\n * Converts `string` to a property path array.\n *\n * @private\n * @param {string} string The string to convert.\n * @returns {Array} Returns the property path array.\n */\n var stringToPath = memoizeCapped(function(string) {\n var result = [];\n if (string.charCodeAt(0) === 46 /* . */) {\n result.push('');\n }\n string.replace(rePropName, function(match, number, quote, subString) {\n result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match));\n });\n return result;\n });\n\n /**\n * Converts `value` to a string key if it's not a string or symbol.\n *\n * @private\n * @param {*} value The value to inspect.\n * @returns {string|symbol} Returns the key.\n */\n function toKey(value) {\n if (typeof value == 'string' || isSymbol(value)) {\n return value;\n }\n var result = (value + '');\n return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result;\n }\n\n /**\n * Converts `func` to its source code.\n *\n * @private\n * @param {Function} func The function to convert.\n * @returns {string} Returns the source code.\n */\n function toSource(func) {\n if (func != null) {\n try {\n return funcToString.call(func);\n } catch (e) {}\n try {\n return (func + '');\n } catch (e) {}\n }\n return '';\n }\n\n /**\n * Updates wrapper `details` based on `bitmask` flags.\n *\n * @private\n * @returns {Array} details The details to modify.\n * @param {number} bitmask The bitmask flags. See `createWrap` for more details.\n * @returns {Array} Returns `details`.\n */\n function updateWrapDetails(details, bitmask) {\n arrayEach(wrapFlags, function(pair) {\n var value = '_.' + pair[0];\n if ((bitmask & pair[1]) && !arrayIncludes(details, value)) {\n details.push(value);\n }\n });\n return details.sort();\n }\n\n /**\n * Creates a clone of `wrapper`.\n *\n * @private\n * @param {Object} wrapper The wrapper to clone.\n * @returns {Object} Returns the cloned wrapper.\n */\n function wrapperClone(wrapper) {\n if (wrapper instanceof LazyWrapper) {\n return wrapper.clone();\n }\n var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__);\n result.__actions__ = copyArray(wrapper.__actions__);\n result.__index__ = wrapper.__index__;\n result.__values__ = wrapper.__values__;\n return result;\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an array of elements split into groups the length of `size`.\n * If `array` can't be split evenly, the final chunk will be the remaining\n * elements.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to process.\n * @param {number} [size=1] The length of each chunk\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the new array of chunks.\n * @example\n *\n * _.chunk(['a', 'b', 'c', 'd'], 2);\n * // => [['a', 'b'], ['c', 'd']]\n *\n * _.chunk(['a', 'b', 'c', 'd'], 3);\n * // => [['a', 'b', 'c'], ['d']]\n */\n function chunk(array, size, guard) {\n if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) {\n size = 1;\n } else {\n size = nativeMax(toInteger(size), 0);\n }\n var length = array == null ? 0 : array.length;\n if (!length || size < 1) {\n return [];\n }\n var index = 0,\n resIndex = 0,\n result = Array(nativeCeil(length / size));\n\n while (index < length) {\n result[resIndex++] = baseSlice(array, index, (index += size));\n }\n return result;\n }\n\n /**\n * Creates an array with all falsey values removed. The values `false`, `null`,\n * `0`, `\"\"`, `undefined`, and `NaN` are falsey.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to compact.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.compact([0, 1, false, 2, '', 3]);\n * // => [1, 2, 3]\n */\n function compact(array) {\n var index = -1,\n length = array == null ? 0 : array.length,\n resIndex = 0,\n result = [];\n\n while (++index < length) {\n var value = array[index];\n if (value) {\n result[resIndex++] = value;\n }\n }\n return result;\n }\n\n /**\n * Creates a new array concatenating `array` with any additional arrays\n * and/or values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to concatenate.\n * @param {...*} [values] The values to concatenate.\n * @returns {Array} Returns the new concatenated array.\n * @example\n *\n * var array = [1];\n * var other = _.concat(array, 2, [3], [[4]]);\n *\n * console.log(other);\n * // => [1, 2, 3, [4]]\n *\n * console.log(array);\n * // => [1]\n */\n function concat() {\n var length = arguments.length;\n if (!length) {\n return [];\n }\n var args = Array(length - 1),\n array = arguments[0],\n index = length;\n\n while (index--) {\n args[index - 1] = arguments[index];\n }\n return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1));\n }\n\n /**\n * Creates an array of `array` values not included in the other given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * **Note:** Unlike `_.pullAll`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.without, _.xor\n * @example\n *\n * _.difference([2, 1], [2, 3]);\n * // => [1]\n */\n var difference = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `iteratee` which\n * is invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * **Note:** Unlike `_.pullAllBy`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var differenceBy = baseRest(function(array, values) {\n var iteratee = last(values);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.difference` except that it accepts `comparator`\n * which is invoked to compare elements of `array` to `values`. The order and\n * references of result values are determined by the first array. The comparator\n * is invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.pullAllWith`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...Array} [values] The values to exclude.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n *\n * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }]\n */\n var differenceWith = baseRest(function(array, values) {\n var comparator = last(values);\n if (isArrayLikeObject(comparator)) {\n comparator = undefined;\n }\n return isArrayLikeObject(array)\n ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator)\n : [];\n });\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.drop([1, 2, 3]);\n * // => [2, 3]\n *\n * _.drop([1, 2, 3], 2);\n * // => [3]\n *\n * _.drop([1, 2, 3], 5);\n * // => []\n *\n * _.drop([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function drop(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with `n` elements dropped from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to drop.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.dropRight([1, 2, 3]);\n * // => [1, 2]\n *\n * _.dropRight([1, 2, 3], 2);\n * // => [1]\n *\n * _.dropRight([1, 2, 3], 5);\n * // => []\n *\n * _.dropRight([1, 2, 3], 0);\n * // => [1, 2, 3]\n */\n function dropRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the end.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.dropRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropRightWhile(users, ['active', false]);\n * // => objects for ['barney']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropRightWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` excluding elements dropped from the beginning.\n * Elements are dropped until `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.dropWhile(users, function(o) { return !o.active; });\n * // => objects for ['pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.dropWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.dropWhile(users, ['active', false]);\n * // => objects for ['pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.dropWhile(users, 'active');\n * // => objects for ['barney', 'fred', 'pebbles']\n */\n function dropWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), true)\n : [];\n }\n\n /**\n * Fills elements of `array` with `value` from `start` up to, but not\n * including, `end`.\n *\n * **Note:** This method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Array\n * @param {Array} array The array to fill.\n * @param {*} value The value to fill `array` with.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.fill(array, 'a');\n * console.log(array);\n * // => ['a', 'a', 'a']\n *\n * _.fill(Array(3), 2);\n * // => [2, 2, 2]\n *\n * _.fill([4, 6, 8, 10], '*', 1, 3);\n * // => [4, '*', '*', 10]\n */\n function fill(array, value, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (start && typeof start != 'number' && isIterateeCall(array, value, start)) {\n start = 0;\n end = length;\n }\n return baseFill(array, value, start, end);\n }\n\n /**\n * This method is like `_.find` except that it returns the index of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.findIndex(users, function(o) { return o.user == 'barney'; });\n * // => 0\n *\n * // The `_.matches` iteratee shorthand.\n * _.findIndex(users, { 'user': 'fred', 'active': false });\n * // => 1\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findIndex(users, ['active', false]);\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.findIndex(users, 'active');\n * // => 2\n */\n function findIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index);\n }\n\n /**\n * This method is like `_.findIndex` except that it iterates over elements\n * of `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the found element, else `-1`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; });\n * // => 2\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastIndex(users, { 'user': 'barney', 'active': true });\n * // => 0\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastIndex(users, ['active', false]);\n * // => 2\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastIndex(users, 'active');\n * // => 0\n */\n function findLastIndex(array, predicate, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length - 1;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = fromIndex < 0\n ? nativeMax(length + index, 0)\n : nativeMin(index, length - 1);\n }\n return baseFindIndex(array, getIteratee(predicate, 3), index, true);\n }\n\n /**\n * Flattens `array` a single level deep.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flatten([1, [2, [3, [4]], 5]]);\n * // => [1, 2, [3, [4]], 5]\n */\n function flatten(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, 1) : [];\n }\n\n /**\n * Recursively flattens `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * _.flattenDeep([1, [2, [3, [4]], 5]]);\n * // => [1, 2, 3, 4, 5]\n */\n function flattenDeep(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseFlatten(array, INFINITY) : [];\n }\n\n /**\n * Recursively flatten `array` up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Array\n * @param {Array} array The array to flatten.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * var array = [1, [2, [3, [4]], 5]];\n *\n * _.flattenDepth(array, 1);\n * // => [1, 2, [3, [4]], 5]\n *\n * _.flattenDepth(array, 2);\n * // => [1, 2, 3, [4], 5]\n */\n function flattenDepth(array, depth) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(array, depth);\n }\n\n /**\n * The inverse of `_.toPairs`; this method returns an object composed\n * from key-value `pairs`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} pairs The key-value pairs.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.fromPairs([['a', 1], ['b', 2]]);\n * // => { 'a': 1, 'b': 2 }\n */\n function fromPairs(pairs) {\n var index = -1,\n length = pairs == null ? 0 : pairs.length,\n result = {};\n\n while (++index < length) {\n var pair = pairs[index];\n result[pair[0]] = pair[1];\n }\n return result;\n }\n\n /**\n * Gets the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias first\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the first element of `array`.\n * @example\n *\n * _.head([1, 2, 3]);\n * // => 1\n *\n * _.head([]);\n * // => undefined\n */\n function head(array) {\n return (array && array.length) ? array[0] : undefined;\n }\n\n /**\n * Gets the index at which the first occurrence of `value` is found in `array`\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. If `fromIndex` is negative, it's used as the\n * offset from the end of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.indexOf([1, 2, 1, 2], 2);\n * // => 1\n *\n * // Search from the `fromIndex`.\n * _.indexOf([1, 2, 1, 2], 2, 2);\n * // => 3\n */\n function indexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = fromIndex == null ? 0 : toInteger(fromIndex);\n if (index < 0) {\n index = nativeMax(length + index, 0);\n }\n return baseIndexOf(array, value, index);\n }\n\n /**\n * Gets all but the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.initial([1, 2, 3]);\n * // => [1, 2]\n */\n function initial(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 0, -1) : [];\n }\n\n /**\n * Creates an array of unique values that are included in all given arrays\n * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons. The order and references of result values are\n * determined by the first array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersection([2, 1], [2, 3]);\n * // => [2]\n */\n var intersection = baseRest(function(arrays) {\n var mapped = arrayMap(arrays, castArrayLikeObject);\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped)\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `iteratee`\n * which is invoked for each element of each `arrays` to generate the criterion\n * by which they're compared. The order and references of result values are\n * determined by the first array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [2.1]\n *\n * // The `_.property` iteratee shorthand.\n * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }]\n */\n var intersectionBy = baseRest(function(arrays) {\n var iteratee = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n if (iteratee === last(mapped)) {\n iteratee = undefined;\n } else {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, getIteratee(iteratee, 2))\n : [];\n });\n\n /**\n * This method is like `_.intersection` except that it accepts `comparator`\n * which is invoked to compare elements of `arrays`. The order and references\n * of result values are determined by the first array. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of intersecting values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.intersectionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }]\n */\n var intersectionWith = baseRest(function(arrays) {\n var comparator = last(arrays),\n mapped = arrayMap(arrays, castArrayLikeObject);\n\n comparator = typeof comparator == 'function' ? comparator : undefined;\n if (comparator) {\n mapped.pop();\n }\n return (mapped.length && mapped[0] === arrays[0])\n ? baseIntersection(mapped, undefined, comparator)\n : [];\n });\n\n /**\n * Converts all elements in `array` into a string separated by `separator`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to convert.\n * @param {string} [separator=','] The element separator.\n * @returns {string} Returns the joined string.\n * @example\n *\n * _.join(['a', 'b', 'c'], '~');\n * // => 'a~b~c'\n */\n function join(array, separator) {\n return array == null ? '' : nativeJoin.call(array, separator);\n }\n\n /**\n * Gets the last element of `array`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {*} Returns the last element of `array`.\n * @example\n *\n * _.last([1, 2, 3]);\n * // => 3\n */\n function last(array) {\n var length = array == null ? 0 : array.length;\n return length ? array[length - 1] : undefined;\n }\n\n /**\n * This method is like `_.indexOf` except that it iterates over elements of\n * `array` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=array.length-1] The index to search from.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.lastIndexOf([1, 2, 1, 2], 2);\n * // => 3\n *\n * // Search from the `fromIndex`.\n * _.lastIndexOf([1, 2, 1, 2], 2, 2);\n * // => 1\n */\n function lastIndexOf(array, value, fromIndex) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return -1;\n }\n var index = length;\n if (fromIndex !== undefined) {\n index = toInteger(fromIndex);\n index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1);\n }\n return value === value\n ? strictLastIndexOf(array, value, index)\n : baseFindIndex(array, baseIsNaN, index, true);\n }\n\n /**\n * Gets the element at index `n` of `array`. If `n` is negative, the nth\n * element from the end is returned.\n *\n * @static\n * @memberOf _\n * @since 4.11.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=0] The index of the element to return.\n * @returns {*} Returns the nth element of `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n *\n * _.nth(array, 1);\n * // => 'b'\n *\n * _.nth(array, -2);\n * // => 'c';\n */\n function nth(array, n) {\n return (array && array.length) ? baseNth(array, toInteger(n)) : undefined;\n }\n\n /**\n * Removes all given values from `array` using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove`\n * to remove elements from an array by predicate.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...*} [values] The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pull(array, 'a', 'c');\n * console.log(array);\n * // => ['b', 'b']\n */\n var pull = baseRest(pullAll);\n\n /**\n * This method is like `_.pull` except that it accepts an array of values to remove.\n *\n * **Note:** Unlike `_.difference`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = ['a', 'b', 'c', 'a', 'b', 'c'];\n *\n * _.pullAll(array, ['a', 'c']);\n * console.log(array);\n * // => ['b', 'b']\n */\n function pullAll(array, values) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values)\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `iteratee` which is\n * invoked for each element of `array` and `values` to generate the criterion\n * by which they're compared. The iteratee is invoked with one argument: (value).\n *\n * **Note:** Unlike `_.differenceBy`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }];\n *\n * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x');\n * console.log(array);\n * // => [{ 'x': 2 }]\n */\n function pullAllBy(array, values, iteratee) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, getIteratee(iteratee, 2))\n : array;\n }\n\n /**\n * This method is like `_.pullAll` except that it accepts `comparator` which\n * is invoked to compare elements of `array` to `values`. The comparator is\n * invoked with two arguments: (arrVal, othVal).\n *\n * **Note:** Unlike `_.differenceWith`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Array} values The values to remove.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }];\n *\n * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual);\n * console.log(array);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }]\n */\n function pullAllWith(array, values, comparator) {\n return (array && array.length && values && values.length)\n ? basePullAll(array, values, undefined, comparator)\n : array;\n }\n\n /**\n * Removes elements from `array` corresponding to `indexes` and returns an\n * array of removed elements.\n *\n * **Note:** Unlike `_.at`, this method mutates `array`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {...(number|number[])} [indexes] The indexes of elements to remove.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = ['a', 'b', 'c', 'd'];\n * var pulled = _.pullAt(array, [1, 3]);\n *\n * console.log(array);\n * // => ['a', 'c']\n *\n * console.log(pulled);\n * // => ['b', 'd']\n */\n var pullAt = flatRest(function(array, indexes) {\n var length = array == null ? 0 : array.length,\n result = baseAt(array, indexes);\n\n basePullAt(array, arrayMap(indexes, function(index) {\n return isIndex(index, length) ? +index : index;\n }).sort(compareAscending));\n\n return result;\n });\n\n /**\n * Removes all elements from `array` that `predicate` returns truthy for\n * and returns an array of the removed elements. The predicate is invoked\n * with three arguments: (value, index, array).\n *\n * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull`\n * to pull elements from an array by value.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new array of removed elements.\n * @example\n *\n * var array = [1, 2, 3, 4];\n * var evens = _.remove(array, function(n) {\n * return n % 2 == 0;\n * });\n *\n * console.log(array);\n * // => [1, 3]\n *\n * console.log(evens);\n * // => [2, 4]\n */\n function remove(array, predicate) {\n var result = [];\n if (!(array && array.length)) {\n return result;\n }\n var index = -1,\n indexes = [],\n length = array.length;\n\n predicate = getIteratee(predicate, 3);\n while (++index < length) {\n var value = array[index];\n if (predicate(value, index, array)) {\n result.push(value);\n indexes.push(index);\n }\n }\n basePullAt(array, indexes);\n return result;\n }\n\n /**\n * Reverses `array` so that the first element becomes the last, the second\n * element becomes the second to last, and so on.\n *\n * **Note:** This method mutates `array` and is based on\n * [`Array#reverse`](https://mdn.io/Array/reverse).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to modify.\n * @returns {Array} Returns `array`.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _.reverse(array);\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function reverse(array) {\n return array == null ? array : nativeReverse.call(array);\n }\n\n /**\n * Creates a slice of `array` from `start` up to, but not including, `end`.\n *\n * **Note:** This method is used instead of\n * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are\n * returned.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to slice.\n * @param {number} [start=0] The start position.\n * @param {number} [end=array.length] The end position.\n * @returns {Array} Returns the slice of `array`.\n */\n function slice(array, start, end) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n if (end && typeof end != 'number' && isIterateeCall(array, start, end)) {\n start = 0;\n end = length;\n }\n else {\n start = start == null ? 0 : toInteger(start);\n end = end === undefined ? length : toInteger(end);\n }\n return baseSlice(array, start, end);\n }\n\n /**\n * Uses a binary search to determine the lowest index at which `value`\n * should be inserted into `array` in order to maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedIndex([30, 50], 40);\n * // => 1\n */\n function sortedIndex(array, value) {\n return baseSortedIndex(array, value);\n }\n\n /**\n * This method is like `_.sortedIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 0\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedIndexBy(objects, { 'x': 4 }, 'x');\n * // => 0\n */\n function sortedIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2));\n }\n\n /**\n * This method is like `_.indexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedIndexOf([4, 5, 5, 5, 6], 5);\n * // => 1\n */\n function sortedIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value);\n if (index < length && eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.sortedIndex` except that it returns the highest\n * index at which `value` should be inserted into `array` in order to\n * maintain its sort order.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * _.sortedLastIndex([4, 5, 5, 5, 6], 5);\n * // => 4\n */\n function sortedLastIndex(array, value) {\n return baseSortedIndex(array, value, true);\n }\n\n /**\n * This method is like `_.sortedLastIndex` except that it accepts `iteratee`\n * which is invoked for `value` and each element of `array` to compute their\n * sort ranking. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The sorted array to inspect.\n * @param {*} value The value to evaluate.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {number} Returns the index at which `value` should be inserted\n * into `array`.\n * @example\n *\n * var objects = [{ 'x': 4 }, { 'x': 5 }];\n *\n * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; });\n * // => 1\n *\n * // The `_.property` iteratee shorthand.\n * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x');\n * // => 1\n */\n function sortedLastIndexBy(array, value, iteratee) {\n return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true);\n }\n\n /**\n * This method is like `_.lastIndexOf` except that it performs a binary\n * search on a sorted `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {*} value The value to search for.\n * @returns {number} Returns the index of the matched value, else `-1`.\n * @example\n *\n * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5);\n * // => 3\n */\n function sortedLastIndexOf(array, value) {\n var length = array == null ? 0 : array.length;\n if (length) {\n var index = baseSortedIndex(array, value, true) - 1;\n if (eq(array[index], value)) {\n return index;\n }\n }\n return -1;\n }\n\n /**\n * This method is like `_.uniq` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniq([1, 1, 2]);\n * // => [1, 2]\n */\n function sortedUniq(array) {\n return (array && array.length)\n ? baseSortedUniq(array)\n : [];\n }\n\n /**\n * This method is like `_.uniqBy` except that it's designed and optimized\n * for sorted arrays.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor);\n * // => [1.1, 2.3]\n */\n function sortedUniqBy(array, iteratee) {\n return (array && array.length)\n ? baseSortedUniq(array, getIteratee(iteratee, 2))\n : [];\n }\n\n /**\n * Gets all but the first element of `array`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.tail([1, 2, 3]);\n * // => [2, 3]\n */\n function tail(array) {\n var length = array == null ? 0 : array.length;\n return length ? baseSlice(array, 1, length) : [];\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the beginning.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.take([1, 2, 3]);\n * // => [1]\n *\n * _.take([1, 2, 3], 2);\n * // => [1, 2]\n *\n * _.take([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.take([1, 2, 3], 0);\n * // => []\n */\n function take(array, n, guard) {\n if (!(array && array.length)) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n return baseSlice(array, 0, n < 0 ? 0 : n);\n }\n\n /**\n * Creates a slice of `array` with `n` elements taken from the end.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {number} [n=1] The number of elements to take.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * _.takeRight([1, 2, 3]);\n * // => [3]\n *\n * _.takeRight([1, 2, 3], 2);\n * // => [2, 3]\n *\n * _.takeRight([1, 2, 3], 5);\n * // => [1, 2, 3]\n *\n * _.takeRight([1, 2, 3], 0);\n * // => []\n */\n function takeRight(array, n, guard) {\n var length = array == null ? 0 : array.length;\n if (!length) {\n return [];\n }\n n = (guard || n === undefined) ? 1 : toInteger(n);\n n = length - n;\n return baseSlice(array, n < 0 ? 0 : n, length);\n }\n\n /**\n * Creates a slice of `array` with elements taken from the end. Elements are\n * taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': false }\n * ];\n *\n * _.takeRightWhile(users, function(o) { return !o.active; });\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false });\n * // => objects for ['pebbles']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeRightWhile(users, ['active', false]);\n * // => objects for ['fred', 'pebbles']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeRightWhile(users, 'active');\n * // => []\n */\n function takeRightWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3), false, true)\n : [];\n }\n\n /**\n * Creates a slice of `array` with elements taken from the beginning. Elements\n * are taken until `predicate` returns falsey. The predicate is invoked with\n * three arguments: (value, index, array).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Array\n * @param {Array} array The array to query.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the slice of `array`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'active': false },\n * { 'user': 'fred', 'active': false },\n * { 'user': 'pebbles', 'active': true }\n * ];\n *\n * _.takeWhile(users, function(o) { return !o.active; });\n * // => objects for ['barney', 'fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.takeWhile(users, { 'user': 'barney', 'active': false });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.takeWhile(users, ['active', false]);\n * // => objects for ['barney', 'fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.takeWhile(users, 'active');\n * // => []\n */\n function takeWhile(array, predicate) {\n return (array && array.length)\n ? baseWhile(array, getIteratee(predicate, 3))\n : [];\n }\n\n /**\n * Creates an array of unique values, in order, from all given arrays using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.union([2], [1, 2]);\n * // => [2, 1]\n */\n var union = baseRest(function(arrays) {\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true));\n });\n\n /**\n * This method is like `_.union` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which uniqueness is computed. Result values are chosen from the first\n * array in which the value occurs. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * _.unionBy([2.1], [1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n var unionBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.union` except that it accepts `comparator` which\n * is invoked to compare elements of `arrays`. Result values are chosen from\n * the first array in which the value occurs. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of combined values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.unionWith(objects, others, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var unionWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator);\n });\n\n /**\n * Creates a duplicate-free version of an array, using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons, in which only the first occurrence of each element\n * is kept. The order of result values is determined by the order they occur\n * in the array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniq([2, 1, 2]);\n * // => [2, 1]\n */\n function uniq(array) {\n return (array && array.length) ? baseUniq(array) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `iteratee` which is\n * invoked for each element in `array` to generate the criterion by which\n * uniqueness is computed. The order of result values is determined by the\n * order they occur in the array. The iteratee is invoked with one argument:\n * (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * _.uniqBy([2.1, 1.2, 2.3], Math.floor);\n * // => [2.1, 1.2]\n *\n * // The `_.property` iteratee shorthand.\n * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 1 }, { 'x': 2 }]\n */\n function uniqBy(array, iteratee) {\n return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : [];\n }\n\n /**\n * This method is like `_.uniq` except that it accepts `comparator` which\n * is invoked to compare elements of `array`. The order of result values is\n * determined by the order they occur in the array.The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new duplicate free array.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.uniqWith(objects, _.isEqual);\n * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]\n */\n function uniqWith(array, comparator) {\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return (array && array.length) ? baseUniq(array, undefined, comparator) : [];\n }\n\n /**\n * This method is like `_.zip` except that it accepts an array of grouped\n * elements and creates an array regrouping the elements to their pre-zip\n * configuration.\n *\n * @static\n * @memberOf _\n * @since 1.2.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n *\n * _.unzip(zipped);\n * // => [['a', 'b'], [1, 2], [true, false]]\n */\n function unzip(array) {\n if (!(array && array.length)) {\n return [];\n }\n var length = 0;\n array = arrayFilter(array, function(group) {\n if (isArrayLikeObject(group)) {\n length = nativeMax(group.length, length);\n return true;\n }\n });\n return baseTimes(length, function(index) {\n return arrayMap(array, baseProperty(index));\n });\n }\n\n /**\n * This method is like `_.unzip` except that it accepts `iteratee` to specify\n * how regrouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {Array} array The array of grouped elements to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * regrouped values.\n * @returns {Array} Returns the new array of regrouped elements.\n * @example\n *\n * var zipped = _.zip([1, 2], [10, 20], [100, 200]);\n * // => [[1, 10, 100], [2, 20, 200]]\n *\n * _.unzipWith(zipped, _.add);\n * // => [3, 30, 300]\n */\n function unzipWith(array, iteratee) {\n if (!(array && array.length)) {\n return [];\n }\n var result = unzip(array);\n if (iteratee == null) {\n return result;\n }\n return arrayMap(result, function(group) {\n return apply(iteratee, undefined, group);\n });\n }\n\n /**\n * Creates an array excluding all given values using\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * for equality comparisons.\n *\n * **Note:** Unlike `_.pull`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {Array} array The array to inspect.\n * @param {...*} [values] The values to exclude.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.xor\n * @example\n *\n * _.without([2, 1, 2, 3], 1, 2);\n * // => [3]\n */\n var without = baseRest(function(array, values) {\n return isArrayLikeObject(array)\n ? baseDifference(array, values)\n : [];\n });\n\n /**\n * Creates an array of unique values that is the\n * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference)\n * of the given arrays. The order of result values is determined by the order\n * they occur in the arrays.\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @returns {Array} Returns the new array of filtered values.\n * @see _.difference, _.without\n * @example\n *\n * _.xor([2, 1], [2, 3]);\n * // => [1, 3]\n */\n var xor = baseRest(function(arrays) {\n return baseXor(arrayFilter(arrays, isArrayLikeObject));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `iteratee` which is\n * invoked for each element of each `arrays` to generate the criterion by\n * which by which they're compared. The order of result values is determined\n * by the order they occur in the arrays. The iteratee is invoked with one\n * argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor);\n * // => [1.2, 3.4]\n *\n * // The `_.property` iteratee shorthand.\n * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x');\n * // => [{ 'x': 2 }]\n */\n var xorBy = baseRest(function(arrays) {\n var iteratee = last(arrays);\n if (isArrayLikeObject(iteratee)) {\n iteratee = undefined;\n }\n return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2));\n });\n\n /**\n * This method is like `_.xor` except that it accepts `comparator` which is\n * invoked to compare elements of `arrays`. The order of result values is\n * determined by the order they occur in the arrays. The comparator is invoked\n * with two arguments: (arrVal, othVal).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Array\n * @param {...Array} [arrays] The arrays to inspect.\n * @param {Function} [comparator] The comparator invoked per element.\n * @returns {Array} Returns the new array of filtered values.\n * @example\n *\n * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }];\n * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }];\n *\n * _.xorWith(objects, others, _.isEqual);\n * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }]\n */\n var xorWith = baseRest(function(arrays) {\n var comparator = last(arrays);\n comparator = typeof comparator == 'function' ? comparator : undefined;\n return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator);\n });\n\n /**\n * Creates an array of grouped elements, the first of which contains the\n * first elements of the given arrays, the second of which contains the\n * second elements of the given arrays, and so on.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zip(['a', 'b'], [1, 2], [true, false]);\n * // => [['a', 1, true], ['b', 2, false]]\n */\n var zip = baseRest(unzip);\n\n /**\n * This method is like `_.fromPairs` except that it accepts two arrays,\n * one of property identifiers and one of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 0.4.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObject(['a', 'b'], [1, 2]);\n * // => { 'a': 1, 'b': 2 }\n */\n function zipObject(props, values) {\n return baseZipObject(props || [], values || [], assignValue);\n }\n\n /**\n * This method is like `_.zipObject` except that it supports property paths.\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Array\n * @param {Array} [props=[]] The property identifiers.\n * @param {Array} [values=[]] The property values.\n * @returns {Object} Returns the new object.\n * @example\n *\n * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]);\n * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } }\n */\n function zipObjectDeep(props, values) {\n return baseZipObject(props || [], values || [], baseSet);\n }\n\n /**\n * This method is like `_.zip` except that it accepts `iteratee` to specify\n * how grouped values should be combined. The iteratee is invoked with the\n * elements of each group: (...group).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Array\n * @param {...Array} [arrays] The arrays to process.\n * @param {Function} [iteratee=_.identity] The function to combine\n * grouped values.\n * @returns {Array} Returns the new array of grouped elements.\n * @example\n *\n * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) {\n * return a + b + c;\n * });\n * // => [111, 222]\n */\n var zipWith = baseRest(function(arrays) {\n var length = arrays.length,\n iteratee = length > 1 ? arrays[length - 1] : undefined;\n\n iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined;\n return unzipWith(arrays, iteratee);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates a `lodash` wrapper instance that wraps `value` with explicit method\n * chain sequences enabled. The result of such sequences must be unwrapped\n * with `_#value`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Seq\n * @param {*} value The value to wrap.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'pebbles', 'age': 1 }\n * ];\n *\n * var youngest = _\n * .chain(users)\n * .sortBy('age')\n * .map(function(o) {\n * return o.user + ' is ' + o.age;\n * })\n * .head()\n * .value();\n * // => 'pebbles is 1'\n */\n function chain(value) {\n var result = lodash(value);\n result.__chain__ = true;\n return result;\n }\n\n /**\n * This method invokes `interceptor` and returns `value`. The interceptor\n * is invoked with one argument; (value). The purpose of this method is to\n * \"tap into\" a method chain sequence in order to modify intermediate results.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns `value`.\n * @example\n *\n * _([1, 2, 3])\n * .tap(function(array) {\n * // Mutate input array.\n * array.pop();\n * })\n * .reverse()\n * .value();\n * // => [2, 1]\n */\n function tap(value, interceptor) {\n interceptor(value);\n return value;\n }\n\n /**\n * This method is like `_.tap` except that it returns the result of `interceptor`.\n * The purpose of this method is to \"pass thru\" values replacing intermediate\n * results in a method chain sequence.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Seq\n * @param {*} value The value to provide to `interceptor`.\n * @param {Function} interceptor The function to invoke.\n * @returns {*} Returns the result of `interceptor`.\n * @example\n *\n * _(' abc ')\n * .chain()\n * .trim()\n * .thru(function(value) {\n * return [value];\n * })\n * .value();\n * // => ['abc']\n */\n function thru(value, interceptor) {\n return interceptor(value);\n }\n\n /**\n * This method is the wrapper version of `_.at`.\n *\n * @name at\n * @memberOf _\n * @since 1.0.0\n * @category Seq\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _(object).at(['a[0].b.c', 'a[1]']).value();\n * // => [3, 4]\n */\n var wrapperAt = flatRest(function(paths) {\n var length = paths.length,\n start = length ? paths[0] : 0,\n value = this.__wrapped__,\n interceptor = function(object) { return baseAt(object, paths); };\n\n if (length > 1 || this.__actions__.length ||\n !(value instanceof LazyWrapper) || !isIndex(start)) {\n return this.thru(interceptor);\n }\n value = value.slice(start, +start + (length ? 1 : 0));\n value.__actions__.push({\n 'func': thru,\n 'args': [interceptor],\n 'thisArg': undefined\n });\n return new LodashWrapper(value, this.__chain__).thru(function(array) {\n if (length && !array.length) {\n array.push(undefined);\n }\n return array;\n });\n });\n\n /**\n * Creates a `lodash` wrapper instance with explicit method chain sequences enabled.\n *\n * @name chain\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 }\n * ];\n *\n * // A sequence without explicit chaining.\n * _(users).head();\n * // => { 'user': 'barney', 'age': 36 }\n *\n * // A sequence with explicit chaining.\n * _(users)\n * .chain()\n * .head()\n * .pick('user')\n * .value();\n * // => { 'user': 'barney' }\n */\n function wrapperChain() {\n return chain(this);\n }\n\n /**\n * Executes the chain sequence and returns the wrapped result.\n *\n * @name commit\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2];\n * var wrapped = _(array).push(3);\n *\n * console.log(array);\n * // => [1, 2]\n *\n * wrapped = wrapped.commit();\n * console.log(array);\n * // => [1, 2, 3]\n *\n * wrapped.last();\n * // => 3\n *\n * console.log(array);\n * // => [1, 2, 3]\n */\n function wrapperCommit() {\n return new LodashWrapper(this.value(), this.__chain__);\n }\n\n /**\n * Gets the next value on a wrapped object following the\n * [iterator protocol](https://mdn.io/iteration_protocols#iterator).\n *\n * @name next\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the next iterator value.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 1 }\n *\n * wrapped.next();\n * // => { 'done': false, 'value': 2 }\n *\n * wrapped.next();\n * // => { 'done': true, 'value': undefined }\n */\n function wrapperNext() {\n if (this.__values__ === undefined) {\n this.__values__ = toArray(this.value());\n }\n var done = this.__index__ >= this.__values__.length,\n value = done ? undefined : this.__values__[this.__index__++];\n\n return { 'done': done, 'value': value };\n }\n\n /**\n * Enables the wrapper to be iterable.\n *\n * @name Symbol.iterator\n * @memberOf _\n * @since 4.0.0\n * @category Seq\n * @returns {Object} Returns the wrapper object.\n * @example\n *\n * var wrapped = _([1, 2]);\n *\n * wrapped[Symbol.iterator]() === wrapped;\n * // => true\n *\n * Array.from(wrapped);\n * // => [1, 2]\n */\n function wrapperToIterator() {\n return this;\n }\n\n /**\n * Creates a clone of the chain sequence planting `value` as the wrapped value.\n *\n * @name plant\n * @memberOf _\n * @since 3.2.0\n * @category Seq\n * @param {*} value The value to plant.\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var wrapped = _([1, 2]).map(square);\n * var other = wrapped.plant([3, 4]);\n *\n * other.value();\n * // => [9, 16]\n *\n * wrapped.value();\n * // => [1, 4]\n */\n function wrapperPlant(value) {\n var result,\n parent = this;\n\n while (parent instanceof baseLodash) {\n var clone = wrapperClone(parent);\n clone.__index__ = 0;\n clone.__values__ = undefined;\n if (result) {\n previous.__wrapped__ = clone;\n } else {\n result = clone;\n }\n var previous = clone;\n parent = parent.__wrapped__;\n }\n previous.__wrapped__ = value;\n return result;\n }\n\n /**\n * This method is the wrapper version of `_.reverse`.\n *\n * **Note:** This method mutates the wrapped array.\n *\n * @name reverse\n * @memberOf _\n * @since 0.1.0\n * @category Seq\n * @returns {Object} Returns the new `lodash` wrapper instance.\n * @example\n *\n * var array = [1, 2, 3];\n *\n * _(array).reverse().value()\n * // => [3, 2, 1]\n *\n * console.log(array);\n * // => [3, 2, 1]\n */\n function wrapperReverse() {\n var value = this.__wrapped__;\n if (value instanceof LazyWrapper) {\n var wrapped = value;\n if (this.__actions__.length) {\n wrapped = new LazyWrapper(this);\n }\n wrapped = wrapped.reverse();\n wrapped.__actions__.push({\n 'func': thru,\n 'args': [reverse],\n 'thisArg': undefined\n });\n return new LodashWrapper(wrapped, this.__chain__);\n }\n return this.thru(reverse);\n }\n\n /**\n * Executes the chain sequence to resolve the unwrapped value.\n *\n * @name value\n * @memberOf _\n * @since 0.1.0\n * @alias toJSON, valueOf\n * @category Seq\n * @returns {*} Returns the resolved unwrapped value.\n * @example\n *\n * _([1, 2, 3]).value();\n * // => [1, 2, 3]\n */\n function wrapperValue() {\n return baseWrapperValue(this.__wrapped__, this.__actions__);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the number of times the key was returned by `iteratee`. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.countBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': 1, '6': 2 }\n *\n * // The `_.property` iteratee shorthand.\n * _.countBy(['one', 'two', 'three'], 'length');\n * // => { '3': 2, '5': 1 }\n */\n var countBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n ++result[key];\n } else {\n baseAssignValue(result, key, 1);\n }\n });\n\n /**\n * Checks if `predicate` returns truthy for **all** elements of `collection`.\n * Iteration is stopped once `predicate` returns falsey. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * **Note:** This method returns `true` for\n * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because\n * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of\n * elements of empty collections.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if all elements pass the predicate check,\n * else `false`.\n * @example\n *\n * _.every([true, 1, null, 'yes'], Boolean);\n * // => false\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.every(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.every(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.every(users, 'active');\n * // => false\n */\n function every(collection, predicate, guard) {\n var func = isArray(collection) ? arrayEvery : baseEvery;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning an array of all elements\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * **Note:** Unlike `_.remove`, this method returns a new array.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.reject\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false }\n * ];\n *\n * _.filter(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.filter(users, { 'age': 36, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.filter(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.filter(users, 'active');\n * // => objects for ['barney']\n */\n function filter(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Iterates over elements of `collection`, returning the first element\n * `predicate` returns truthy for. The predicate is invoked with three\n * arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=0] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': true },\n * { 'user': 'fred', 'age': 40, 'active': false },\n * { 'user': 'pebbles', 'age': 1, 'active': true }\n * ];\n *\n * _.find(users, function(o) { return o.age < 40; });\n * // => object for 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.find(users, { 'age': 1, 'active': true });\n * // => object for 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.find(users, ['active', false]);\n * // => object for 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.find(users, 'active');\n * // => object for 'barney'\n */\n var find = createFind(findIndex);\n\n /**\n * This method is like `_.find` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param {number} [fromIndex=collection.length-1] The index to search from.\n * @returns {*} Returns the matched element, else `undefined`.\n * @example\n *\n * _.findLast([1, 2, 3, 4], function(n) {\n * return n % 2 == 1;\n * });\n * // => 3\n */\n var findLast = createFind(findLastIndex);\n\n /**\n * Creates a flattened array of values by running each element in `collection`\n * thru `iteratee` and flattening the mapped results. The iteratee is invoked\n * with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [n, n];\n * }\n *\n * _.flatMap([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMap(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), 1);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDeep([1, 2], duplicate);\n * // => [1, 1, 2, 2]\n */\n function flatMapDeep(collection, iteratee) {\n return baseFlatten(map(collection, iteratee), INFINITY);\n }\n\n /**\n * This method is like `_.flatMap` except that it recursively flattens the\n * mapped results up to `depth` times.\n *\n * @static\n * @memberOf _\n * @since 4.7.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {number} [depth=1] The maximum recursion depth.\n * @returns {Array} Returns the new flattened array.\n * @example\n *\n * function duplicate(n) {\n * return [[[n, n]]];\n * }\n *\n * _.flatMapDepth([1, 2], duplicate, 2);\n * // => [[1, 1], [2, 2]]\n */\n function flatMapDepth(collection, iteratee, depth) {\n depth = depth === undefined ? 1 : toInteger(depth);\n return baseFlatten(map(collection, iteratee), depth);\n }\n\n /**\n * Iterates over elements of `collection` and invokes `iteratee` for each element.\n * The iteratee is invoked with three arguments: (value, index|key, collection).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * **Note:** As with other \"Collections\" methods, objects with a \"length\"\n * property are iterated like arrays. To avoid this behavior use `_.forIn`\n * or `_.forOwn` for object iteration.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @alias each\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEachRight\n * @example\n *\n * _.forEach([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `1` then `2`.\n *\n * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forEach(collection, iteratee) {\n var func = isArray(collection) ? arrayEach : baseEach;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forEach` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @alias eachRight\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array|Object} Returns `collection`.\n * @see _.forEach\n * @example\n *\n * _.forEachRight([1, 2], function(value) {\n * console.log(value);\n * });\n * // => Logs `2` then `1`.\n */\n function forEachRight(collection, iteratee) {\n var func = isArray(collection) ? arrayEachRight : baseEachRight;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The order of grouped values\n * is determined by the order they occur in `collection`. The corresponding\n * value of each key is an array of elements responsible for generating the\n * key. The iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * _.groupBy([6.1, 4.2, 6.3], Math.floor);\n * // => { '4': [4.2], '6': [6.1, 6.3] }\n *\n * // The `_.property` iteratee shorthand.\n * _.groupBy(['one', 'two', 'three'], 'length');\n * // => { '3': ['one', 'two'], '5': ['three'] }\n */\n var groupBy = createAggregator(function(result, value, key) {\n if (hasOwnProperty.call(result, key)) {\n result[key].push(value);\n } else {\n baseAssignValue(result, key, [value]);\n }\n });\n\n /**\n * Checks if `value` is in `collection`. If `collection` is a string, it's\n * checked for a substring of `value`, otherwise\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * is used for equality comparisons. If `fromIndex` is negative, it's used as\n * the offset from the end of `collection`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @param {*} value The value to search for.\n * @param {number} [fromIndex=0] The index to search from.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {boolean} Returns `true` if `value` is found, else `false`.\n * @example\n *\n * _.includes([1, 2, 3], 1);\n * // => true\n *\n * _.includes([1, 2, 3], 1, 2);\n * // => false\n *\n * _.includes({ 'a': 1, 'b': 2 }, 1);\n * // => true\n *\n * _.includes('abcd', 'bc');\n * // => true\n */\n function includes(collection, value, fromIndex, guard) {\n collection = isArrayLike(collection) ? collection : values(collection);\n fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0;\n\n var length = collection.length;\n if (fromIndex < 0) {\n fromIndex = nativeMax(length + fromIndex, 0);\n }\n return isString(collection)\n ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1)\n : (!!length && baseIndexOf(collection, value, fromIndex) > -1);\n }\n\n /**\n * Invokes the method at `path` of each element in `collection`, returning\n * an array of the results of each invoked method. Any additional arguments\n * are provided to each invoked method. If `path` is a function, it's invoked\n * for, and `this` bound to, each element in `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array|Function|string} path The path of the method to invoke or\n * the function invoked per iteration.\n * @param {...*} [args] The arguments to invoke each method with.\n * @returns {Array} Returns the array of results.\n * @example\n *\n * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort');\n * // => [[1, 5, 7], [1, 2, 3]]\n *\n * _.invokeMap([123, 456], String.prototype.split, '');\n * // => [['1', '2', '3'], ['4', '5', '6']]\n */\n var invokeMap = baseRest(function(collection, path, args) {\n var index = -1,\n isFunc = typeof path == 'function',\n result = isArrayLike(collection) ? Array(collection.length) : [];\n\n baseEach(collection, function(value) {\n result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args);\n });\n return result;\n });\n\n /**\n * Creates an object composed of keys generated from the results of running\n * each element of `collection` thru `iteratee`. The corresponding value of\n * each key is the last element responsible for generating the key. The\n * iteratee is invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The iteratee to transform keys.\n * @returns {Object} Returns the composed aggregate object.\n * @example\n *\n * var array = [\n * { 'dir': 'left', 'code': 97 },\n * { 'dir': 'right', 'code': 100 }\n * ];\n *\n * _.keyBy(array, function(o) {\n * return String.fromCharCode(o.code);\n * });\n * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } }\n *\n * _.keyBy(array, 'dir');\n * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } }\n */\n var keyBy = createAggregator(function(result, value, key) {\n baseAssignValue(result, key, value);\n });\n\n /**\n * Creates an array of values by running each element in `collection` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`.\n *\n * The guarded methods are:\n * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`,\n * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`,\n * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`,\n * `template`, `trim`, `trimEnd`, `trimStart`, and `words`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new mapped array.\n * @example\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * _.map([4, 8], square);\n * // => [16, 64]\n *\n * _.map({ 'a': 4, 'b': 8 }, square);\n * // => [16, 64] (iteration order is not guaranteed)\n *\n * var users = [\n * { 'user': 'barney' },\n * { 'user': 'fred' }\n * ];\n *\n * // The `_.property` iteratee shorthand.\n * _.map(users, 'user');\n * // => ['barney', 'fred']\n */\n function map(collection, iteratee) {\n var func = isArray(collection) ? arrayMap : baseMap;\n return func(collection, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.sortBy` except that it allows specifying the sort\n * orders of the iteratees to sort by. If `orders` is unspecified, all values\n * are sorted in ascending order. Otherwise, specify an order of \"desc\" for\n * descending or \"asc\" for ascending sort order of corresponding values.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @param {string[]} [orders] The sort orders of `iteratees`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 34 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 36 }\n * ];\n *\n * // Sort by `user` in ascending order and by `age` in descending order.\n * _.orderBy(users, ['user', 'age'], ['asc', 'desc']);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n */\n function orderBy(collection, iteratees, orders, guard) {\n if (collection == null) {\n return [];\n }\n if (!isArray(iteratees)) {\n iteratees = iteratees == null ? [] : [iteratees];\n }\n orders = guard ? undefined : orders;\n if (!isArray(orders)) {\n orders = orders == null ? [] : [orders];\n }\n return baseOrderBy(collection, iteratees, orders);\n }\n\n /**\n * Creates an array of elements split into two groups, the first of which\n * contains elements `predicate` returns truthy for, the second of which\n * contains elements `predicate` returns falsey for. The predicate is\n * invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the array of grouped elements.\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true },\n * { 'user': 'pebbles', 'age': 1, 'active': false }\n * ];\n *\n * _.partition(users, function(o) { return o.active; });\n * // => objects for [['fred'], ['barney', 'pebbles']]\n *\n * // The `_.matches` iteratee shorthand.\n * _.partition(users, { 'age': 1, 'active': false });\n * // => objects for [['pebbles'], ['barney', 'fred']]\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.partition(users, ['active', false]);\n * // => objects for [['barney', 'pebbles'], ['fred']]\n *\n * // The `_.property` iteratee shorthand.\n * _.partition(users, 'active');\n * // => objects for [['fred'], ['barney', 'pebbles']]\n */\n var partition = createAggregator(function(result, value, key) {\n result[key ? 0 : 1].push(value);\n }, function() { return [[], []]; });\n\n /**\n * Reduces `collection` to a value which is the accumulated result of running\n * each element in `collection` thru `iteratee`, where each successive\n * invocation is supplied the return value of the previous. If `accumulator`\n * is not given, the first element of `collection` is used as the initial\n * value. The iteratee is invoked with four arguments:\n * (accumulator, value, index|key, collection).\n *\n * Many lodash methods are guarded to work as iteratees for methods like\n * `_.reduce`, `_.reduceRight`, and `_.transform`.\n *\n * The guarded methods are:\n * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`,\n * and `sortBy`\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduceRight\n * @example\n *\n * _.reduce([1, 2], function(sum, n) {\n * return sum + n;\n * }, 0);\n * // => 3\n *\n * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * return result;\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed)\n */\n function reduce(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduce : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach);\n }\n\n /**\n * This method is like `_.reduce` except that it iterates over elements of\n * `collection` from right to left.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The initial value.\n * @returns {*} Returns the accumulated value.\n * @see _.reduce\n * @example\n *\n * var array = [[0, 1], [2, 3], [4, 5]];\n *\n * _.reduceRight(array, function(flattened, other) {\n * return flattened.concat(other);\n * }, []);\n * // => [4, 5, 2, 3, 0, 1]\n */\n function reduceRight(collection, iteratee, accumulator) {\n var func = isArray(collection) ? arrayReduceRight : baseReduce,\n initAccum = arguments.length < 3;\n\n return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight);\n }\n\n /**\n * The opposite of `_.filter`; this method returns the elements of `collection`\n * that `predicate` does **not** return truthy for.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {Array} Returns the new filtered array.\n * @see _.filter\n * @example\n *\n * var users = [\n * { 'user': 'barney', 'age': 36, 'active': false },\n * { 'user': 'fred', 'age': 40, 'active': true }\n * ];\n *\n * _.reject(users, function(o) { return !o.active; });\n * // => objects for ['fred']\n *\n * // The `_.matches` iteratee shorthand.\n * _.reject(users, { 'age': 40, 'active': true });\n * // => objects for ['barney']\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.reject(users, ['active', false]);\n * // => objects for ['fred']\n *\n * // The `_.property` iteratee shorthand.\n * _.reject(users, 'active');\n * // => objects for ['barney']\n */\n function reject(collection, predicate) {\n var func = isArray(collection) ? arrayFilter : baseFilter;\n return func(collection, negate(getIteratee(predicate, 3)));\n }\n\n /**\n * Gets a random element from `collection`.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @returns {*} Returns the random element.\n * @example\n *\n * _.sample([1, 2, 3, 4]);\n * // => 2\n */\n function sample(collection) {\n var func = isArray(collection) ? arraySample : baseSample;\n return func(collection);\n }\n\n /**\n * Gets `n` random elements at unique keys from `collection` up to the\n * size of `collection`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Collection\n * @param {Array|Object} collection The collection to sample.\n * @param {number} [n=1] The number of elements to sample.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Array} Returns the random elements.\n * @example\n *\n * _.sampleSize([1, 2, 3], 2);\n * // => [3, 1]\n *\n * _.sampleSize([1, 2, 3], 4);\n * // => [2, 3, 1]\n */\n function sampleSize(collection, n, guard) {\n if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n var func = isArray(collection) ? arraySampleSize : baseSampleSize;\n return func(collection, n);\n }\n\n /**\n * Creates an array of shuffled values, using a version of the\n * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to shuffle.\n * @returns {Array} Returns the new shuffled array.\n * @example\n *\n * _.shuffle([1, 2, 3, 4]);\n * // => [4, 1, 3, 2]\n */\n function shuffle(collection) {\n var func = isArray(collection) ? arrayShuffle : baseShuffle;\n return func(collection);\n }\n\n /**\n * Gets the size of `collection` by returning its length for array-like\n * values or the number of own enumerable string keyed properties for objects.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object|string} collection The collection to inspect.\n * @returns {number} Returns the collection size.\n * @example\n *\n * _.size([1, 2, 3]);\n * // => 3\n *\n * _.size({ 'a': 1, 'b': 2 });\n * // => 2\n *\n * _.size('pebbles');\n * // => 7\n */\n function size(collection) {\n if (collection == null) {\n return 0;\n }\n if (isArrayLike(collection)) {\n return isString(collection) ? stringSize(collection) : collection.length;\n }\n var tag = getTag(collection);\n if (tag == mapTag || tag == setTag) {\n return collection.size;\n }\n return baseKeys(collection).length;\n }\n\n /**\n * Checks if `predicate` returns truthy for **any** element of `collection`.\n * Iteration is stopped once `predicate` returns truthy. The predicate is\n * invoked with three arguments: (value, index|key, collection).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {boolean} Returns `true` if any element passes the predicate check,\n * else `false`.\n * @example\n *\n * _.some([null, 0, 'yes', false], Boolean);\n * // => true\n *\n * var users = [\n * { 'user': 'barney', 'active': true },\n * { 'user': 'fred', 'active': false }\n * ];\n *\n * // The `_.matches` iteratee shorthand.\n * _.some(users, { 'user': 'barney', 'active': false });\n * // => false\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.some(users, ['active', false]);\n * // => true\n *\n * // The `_.property` iteratee shorthand.\n * _.some(users, 'active');\n * // => true\n */\n function some(collection, predicate, guard) {\n var func = isArray(collection) ? arraySome : baseSome;\n if (guard && isIterateeCall(collection, predicate, guard)) {\n predicate = undefined;\n }\n return func(collection, getIteratee(predicate, 3));\n }\n\n /**\n * Creates an array of elements, sorted in ascending order by the results of\n * running each element in a collection thru each iteratee. This method\n * performs a stable sort, that is, it preserves the original sort order of\n * equal elements. The iteratees are invoked with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Collection\n * @param {Array|Object} collection The collection to iterate over.\n * @param {...(Function|Function[])} [iteratees=[_.identity]]\n * The iteratees to sort by.\n * @returns {Array} Returns the new sorted array.\n * @example\n *\n * var users = [\n * { 'user': 'fred', 'age': 48 },\n * { 'user': 'barney', 'age': 36 },\n * { 'user': 'fred', 'age': 40 },\n * { 'user': 'barney', 'age': 34 }\n * ];\n *\n * _.sortBy(users, [function(o) { return o.user; }]);\n * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]]\n *\n * _.sortBy(users, ['user', 'age']);\n * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]]\n */\n var sortBy = baseRest(function(collection, iteratees) {\n if (collection == null) {\n return [];\n }\n var length = iteratees.length;\n if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) {\n iteratees = [];\n } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) {\n iteratees = [iteratees[0]];\n }\n return baseOrderBy(collection, baseFlatten(iteratees, 1), []);\n });\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Gets the timestamp of the number of milliseconds that have elapsed since\n * the Unix epoch (1 January 1970 00:00:00 UTC).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Date\n * @returns {number} Returns the timestamp.\n * @example\n *\n * _.defer(function(stamp) {\n * console.log(_.now() - stamp);\n * }, _.now());\n * // => Logs the number of milliseconds it took for the deferred invocation.\n */\n var now = ctxNow || function() {\n return root.Date.now();\n };\n\n /*------------------------------------------------------------------------*/\n\n /**\n * The opposite of `_.before`; this method creates a function that invokes\n * `func` once it's called `n` or more times.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {number} n The number of calls before `func` is invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var saves = ['profile', 'settings'];\n *\n * var done = _.after(saves.length, function() {\n * console.log('done saving!');\n * });\n *\n * _.forEach(saves, function(type) {\n * asyncSave({ 'type': type, 'complete': done });\n * });\n * // => Logs 'done saving!' after the two async saves have completed.\n */\n function after(n, func) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n < 1) {\n return func.apply(this, arguments);\n }\n };\n }\n\n /**\n * Creates a function that invokes `func`, with up to `n` arguments,\n * ignoring any additional arguments.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @param {number} [n=func.length] The arity cap.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.ary(parseInt, 1));\n * // => [6, 8, 10]\n */\n function ary(func, n, guard) {\n n = guard ? undefined : n;\n n = (func && n == null) ? func.length : n;\n return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n);\n }\n\n /**\n * Creates a function that invokes `func`, with the `this` binding and arguments\n * of the created function, while it's called less than `n` times. Subsequent\n * calls to the created function return the result of the last `func` invocation.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {number} n The number of calls at which `func` is no longer invoked.\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * jQuery(element).on('click', _.before(5, addContactToList));\n * // => Allows adding up to 4 contacts to the list.\n */\n function before(n, func) {\n var result;\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n n = toInteger(n);\n return function() {\n if (--n > 0) {\n result = func.apply(this, arguments);\n }\n if (n <= 1) {\n func = undefined;\n }\n return result;\n };\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of `thisArg`\n * and `partials` prepended to the arguments it receives.\n *\n * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for partially applied arguments.\n *\n * **Note:** Unlike native `Function#bind`, this method doesn't set the \"length\"\n * property of bound functions.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to bind.\n * @param {*} thisArg The `this` binding of `func`.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * function greet(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n *\n * var object = { 'user': 'fred' };\n *\n * var bound = _.bind(greet, object, 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bind(greet, object, _, '!');\n * bound('hi');\n * // => 'hi fred!'\n */\n var bind = baseRest(function(func, thisArg, partials) {\n var bitmask = WRAP_BIND_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bind));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(func, bitmask, thisArg, partials, holders);\n });\n\n /**\n * Creates a function that invokes the method at `object[key]` with `partials`\n * prepended to the arguments it receives.\n *\n * This method differs from `_.bind` by allowing bound functions to reference\n * methods that may be redefined or don't yet exist. See\n * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern)\n * for more details.\n *\n * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Function\n * @param {Object} object The object to invoke the method on.\n * @param {string} key The key of the method.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new bound function.\n * @example\n *\n * var object = {\n * 'user': 'fred',\n * 'greet': function(greeting, punctuation) {\n * return greeting + ' ' + this.user + punctuation;\n * }\n * };\n *\n * var bound = _.bindKey(object, 'greet', 'hi');\n * bound('!');\n * // => 'hi fred!'\n *\n * object.greet = function(greeting, punctuation) {\n * return greeting + 'ya ' + this.user + punctuation;\n * };\n *\n * bound('!');\n * // => 'hiya fred!'\n *\n * // Bound with placeholders.\n * var bound = _.bindKey(object, 'greet', _, '!');\n * bound('hi');\n * // => 'hiya fred!'\n */\n var bindKey = baseRest(function(object, key, partials) {\n var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG;\n if (partials.length) {\n var holders = replaceHolders(partials, getHolder(bindKey));\n bitmask |= WRAP_PARTIAL_FLAG;\n }\n return createWrap(key, bitmask, object, partials, holders);\n });\n\n /**\n * Creates a function that accepts arguments of `func` and either invokes\n * `func` returning its result, if at least `arity` number of arguments have\n * been provided, or returns a function that accepts the remaining `func`\n * arguments, and so on. The arity of `func` may be specified if `func.length`\n * is not sufficient.\n *\n * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds,\n * may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curry(abc);\n *\n * curried(1)(2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2)(3);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(1)(_, 3)(2);\n * // => [1, 2, 3]\n */\n function curry(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curry.placeholder;\n return result;\n }\n\n /**\n * This method is like `_.curry` except that arguments are applied to `func`\n * in the manner of `_.partialRight` instead of `_.partial`.\n *\n * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for provided arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of curried functions.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to curry.\n * @param {number} [arity=func.length] The arity of `func`.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the new curried function.\n * @example\n *\n * var abc = function(a, b, c) {\n * return [a, b, c];\n * };\n *\n * var curried = _.curryRight(abc);\n *\n * curried(3)(2)(1);\n * // => [1, 2, 3]\n *\n * curried(2, 3)(1);\n * // => [1, 2, 3]\n *\n * curried(1, 2, 3);\n * // => [1, 2, 3]\n *\n * // Curried with placeholders.\n * curried(3)(1, _)(2);\n * // => [1, 2, 3]\n */\n function curryRight(func, arity, guard) {\n arity = guard ? undefined : arity;\n var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity);\n result.placeholder = curryRight.placeholder;\n return result;\n }\n\n /**\n * Creates a debounced function that delays invoking `func` until after `wait`\n * milliseconds have elapsed since the last time the debounced function was\n * invoked. The debounced function comes with a `cancel` method to cancel\n * delayed `func` invocations and a `flush` method to immediately invoke them.\n * Provide `options` to indicate whether `func` should be invoked on the\n * leading and/or trailing edge of the `wait` timeout. The `func` is invoked\n * with the last arguments provided to the debounced function. Subsequent\n * calls to the debounced function return the result of the last `func`\n * invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the debounced function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.debounce` and `_.throttle`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to debounce.\n * @param {number} [wait=0] The number of milliseconds to delay.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=false]\n * Specify invoking on the leading edge of the timeout.\n * @param {number} [options.maxWait]\n * The maximum time `func` is allowed to be delayed before it's invoked.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new debounced function.\n * @example\n *\n * // Avoid costly calculations while the window size is in flux.\n * jQuery(window).on('resize', _.debounce(calculateLayout, 150));\n *\n * // Invoke `sendMail` when clicked, debouncing subsequent calls.\n * jQuery(element).on('click', _.debounce(sendMail, 300, {\n * 'leading': true,\n * 'trailing': false\n * }));\n *\n * // Ensure `batchLog` is invoked once after 1 second of debounced calls.\n * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });\n * var source = new EventSource('/stream');\n * jQuery(source).on('message', debounced);\n *\n * // Cancel the trailing debounced invocation.\n * jQuery(window).on('popstate', debounced.cancel);\n */\n function debounce(func, wait, options) {\n var lastArgs,\n lastThis,\n maxWait,\n result,\n timerId,\n lastCallTime,\n lastInvokeTime = 0,\n leading = false,\n maxing = false,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n wait = toNumber(wait) || 0;\n if (isObject(options)) {\n leading = !!options.leading;\n maxing = 'maxWait' in options;\n maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n\n function invokeFunc(time) {\n var args = lastArgs,\n thisArg = lastThis;\n\n lastArgs = lastThis = undefined;\n lastInvokeTime = time;\n result = func.apply(thisArg, args);\n return result;\n }\n\n function leadingEdge(time) {\n // Reset any `maxWait` timer.\n lastInvokeTime = time;\n // Start the timer for the trailing edge.\n timerId = setTimeout(timerExpired, wait);\n // Invoke the leading edge.\n return leading ? invokeFunc(time) : result;\n }\n\n function remainingWait(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime,\n timeWaiting = wait - timeSinceLastCall;\n\n return maxing\n ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke)\n : timeWaiting;\n }\n\n function shouldInvoke(time) {\n var timeSinceLastCall = time - lastCallTime,\n timeSinceLastInvoke = time - lastInvokeTime;\n\n // Either this is the first call, activity has stopped and we're at the\n // trailing edge, the system time has gone backwards and we're treating\n // it as the trailing edge, or we've hit the `maxWait` limit.\n return (lastCallTime === undefined || (timeSinceLastCall >= wait) ||\n (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait));\n }\n\n function timerExpired() {\n var time = now();\n if (shouldInvoke(time)) {\n return trailingEdge(time);\n }\n // Restart the timer.\n timerId = setTimeout(timerExpired, remainingWait(time));\n }\n\n function trailingEdge(time) {\n timerId = undefined;\n\n // Only invoke if we have `lastArgs` which means `func` has been\n // debounced at least once.\n if (trailing && lastArgs) {\n return invokeFunc(time);\n }\n lastArgs = lastThis = undefined;\n return result;\n }\n\n function cancel() {\n if (timerId !== undefined) {\n clearTimeout(timerId);\n }\n lastInvokeTime = 0;\n lastArgs = lastCallTime = lastThis = timerId = undefined;\n }\n\n function flush() {\n return timerId === undefined ? result : trailingEdge(now());\n }\n\n function debounced() {\n var time = now(),\n isInvoking = shouldInvoke(time);\n\n lastArgs = arguments;\n lastThis = this;\n lastCallTime = time;\n\n if (isInvoking) {\n if (timerId === undefined) {\n return leadingEdge(lastCallTime);\n }\n if (maxing) {\n // Handle invocations in a tight loop.\n clearTimeout(timerId);\n timerId = setTimeout(timerExpired, wait);\n return invokeFunc(lastCallTime);\n }\n }\n if (timerId === undefined) {\n timerId = setTimeout(timerExpired, wait);\n }\n return result;\n }\n debounced.cancel = cancel;\n debounced.flush = flush;\n return debounced;\n }\n\n /**\n * Defers invoking the `func` until the current call stack has cleared. Any\n * additional arguments are provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to defer.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.defer(function(text) {\n * console.log(text);\n * }, 'deferred');\n * // => Logs 'deferred' after one millisecond.\n */\n var defer = baseRest(function(func, args) {\n return baseDelay(func, 1, args);\n });\n\n /**\n * Invokes `func` after `wait` milliseconds. Any additional arguments are\n * provided to `func` when it's invoked.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to delay.\n * @param {number} wait The number of milliseconds to delay invocation.\n * @param {...*} [args] The arguments to invoke `func` with.\n * @returns {number} Returns the timer id.\n * @example\n *\n * _.delay(function(text) {\n * console.log(text);\n * }, 1000, 'later');\n * // => Logs 'later' after one second.\n */\n var delay = baseRest(function(func, wait, args) {\n return baseDelay(func, toNumber(wait) || 0, args);\n });\n\n /**\n * Creates a function that invokes `func` with arguments reversed.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to flip arguments for.\n * @returns {Function} Returns the new flipped function.\n * @example\n *\n * var flipped = _.flip(function() {\n * return _.toArray(arguments);\n * });\n *\n * flipped('a', 'b', 'c', 'd');\n * // => ['d', 'c', 'b', 'a']\n */\n function flip(func) {\n return createWrap(func, WRAP_FLIP_FLAG);\n }\n\n /**\n * Creates a function that memoizes the result of `func`. If `resolver` is\n * provided, it determines the cache key for storing the result based on the\n * arguments provided to the memoized function. By default, the first argument\n * provided to the memoized function is used as the map cache key. The `func`\n * is invoked with the `this` binding of the memoized function.\n *\n * **Note:** The cache is exposed as the `cache` property on the memoized\n * function. Its creation may be customized by replacing the `_.memoize.Cache`\n * constructor with one whose instances implement the\n * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)\n * method interface of `clear`, `delete`, `get`, `has`, and `set`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to have its output memoized.\n * @param {Function} [resolver] The function to resolve the cache key.\n * @returns {Function} Returns the new memoized function.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n * var other = { 'c': 3, 'd': 4 };\n *\n * var values = _.memoize(_.values);\n * values(object);\n * // => [1, 2]\n *\n * values(other);\n * // => [3, 4]\n *\n * object.a = 2;\n * values(object);\n * // => [1, 2]\n *\n * // Modify the result cache.\n * values.cache.set(object, ['a', 'b']);\n * values(object);\n * // => ['a', 'b']\n *\n * // Replace `_.memoize.Cache`.\n * _.memoize.Cache = WeakMap;\n */\n function memoize(func, resolver) {\n if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n var memoized = function() {\n var args = arguments,\n key = resolver ? resolver.apply(this, args) : args[0],\n cache = memoized.cache;\n\n if (cache.has(key)) {\n return cache.get(key);\n }\n var result = func.apply(this, args);\n memoized.cache = cache.set(key, result) || cache;\n return result;\n };\n memoized.cache = new (memoize.Cache || MapCache);\n return memoized;\n }\n\n // Expose `MapCache`.\n memoize.Cache = MapCache;\n\n /**\n * Creates a function that negates the result of the predicate `func`. The\n * `func` predicate is invoked with the `this` binding and arguments of the\n * created function.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} predicate The predicate to negate.\n * @returns {Function} Returns the new negated function.\n * @example\n *\n * function isEven(n) {\n * return n % 2 == 0;\n * }\n *\n * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven));\n * // => [1, 3, 5]\n */\n function negate(predicate) {\n if (typeof predicate != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n return function() {\n var args = arguments;\n switch (args.length) {\n case 0: return !predicate.call(this);\n case 1: return !predicate.call(this, args[0]);\n case 2: return !predicate.call(this, args[0], args[1]);\n case 3: return !predicate.call(this, args[0], args[1], args[2]);\n }\n return !predicate.apply(this, args);\n };\n }\n\n /**\n * Creates a function that is restricted to invoking `func` once. Repeat calls\n * to the function return the value of the first invocation. The `func` is\n * invoked with the `this` binding and arguments of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to restrict.\n * @returns {Function} Returns the new restricted function.\n * @example\n *\n * var initialize = _.once(createApplication);\n * initialize();\n * initialize();\n * // => `createApplication` is invoked once\n */\n function once(func) {\n return before(2, func);\n }\n\n /**\n * Creates a function that invokes `func` with its arguments transformed.\n *\n * @static\n * @since 4.0.0\n * @memberOf _\n * @category Function\n * @param {Function} func The function to wrap.\n * @param {...(Function|Function[])} [transforms=[_.identity]]\n * The argument transforms.\n * @returns {Function} Returns the new function.\n * @example\n *\n * function doubled(n) {\n * return n * 2;\n * }\n *\n * function square(n) {\n * return n * n;\n * }\n *\n * var func = _.overArgs(function(x, y) {\n * return [x, y];\n * }, [square, doubled]);\n *\n * func(9, 3);\n * // => [81, 6]\n *\n * func(10, 5);\n * // => [100, 10]\n */\n var overArgs = castRest(function(func, transforms) {\n transforms = (transforms.length == 1 && isArray(transforms[0]))\n ? arrayMap(transforms[0], baseUnary(getIteratee()))\n : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee()));\n\n var funcsLength = transforms.length;\n return baseRest(function(args) {\n var index = -1,\n length = nativeMin(args.length, funcsLength);\n\n while (++index < length) {\n args[index] = transforms[index].call(this, args[index]);\n }\n return apply(func, this, args);\n });\n });\n\n /**\n * Creates a function that invokes `func` with `partials` prepended to the\n * arguments it receives. This method is like `_.bind` except it does **not**\n * alter the `this` binding.\n *\n * The `_.partial.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 0.2.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var sayHelloTo = _.partial(greet, 'hello');\n * sayHelloTo('fred');\n * // => 'hello fred'\n *\n * // Partially applied with placeholders.\n * var greetFred = _.partial(greet, _, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n */\n var partial = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partial));\n return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders);\n });\n\n /**\n * This method is like `_.partial` except that partially applied arguments\n * are appended to the arguments it receives.\n *\n * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic\n * builds, may be used as a placeholder for partially applied arguments.\n *\n * **Note:** This method doesn't set the \"length\" property of partially\n * applied functions.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Function\n * @param {Function} func The function to partially apply arguments to.\n * @param {...*} [partials] The arguments to be partially applied.\n * @returns {Function} Returns the new partially applied function.\n * @example\n *\n * function greet(greeting, name) {\n * return greeting + ' ' + name;\n * }\n *\n * var greetFred = _.partialRight(greet, 'fred');\n * greetFred('hi');\n * // => 'hi fred'\n *\n * // Partially applied with placeholders.\n * var sayHelloTo = _.partialRight(greet, 'hello', _);\n * sayHelloTo('fred');\n * // => 'hello fred'\n */\n var partialRight = baseRest(function(func, partials) {\n var holders = replaceHolders(partials, getHolder(partialRight));\n return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders);\n });\n\n /**\n * Creates a function that invokes `func` with arguments arranged according\n * to the specified `indexes` where the argument value at the first index is\n * provided as the first argument, the argument value at the second index is\n * provided as the second argument, and so on.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Function\n * @param {Function} func The function to rearrange arguments for.\n * @param {...(number|number[])} indexes The arranged argument indexes.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var rearged = _.rearg(function(a, b, c) {\n * return [a, b, c];\n * }, [2, 0, 1]);\n *\n * rearged('b', 'c', 'a')\n * // => ['a', 'b', 'c']\n */\n var rearg = flatRest(function(func, indexes) {\n return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes);\n });\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * created function and arguments from `start` and beyond provided as\n * an array.\n *\n * **Note:** This method is based on the\n * [rest parameter](https://mdn.io/rest_parameters).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to apply a rest parameter to.\n * @param {number} [start=func.length-1] The start position of the rest parameter.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.rest(function(what, names) {\n * return what + ' ' + _.initial(names).join(', ') +\n * (_.size(names) > 1 ? ', & ' : '') + _.last(names);\n * });\n *\n * say('hello', 'fred', 'barney', 'pebbles');\n * // => 'hello fred, barney, & pebbles'\n */\n function rest(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start === undefined ? start : toInteger(start);\n return baseRest(func, start);\n }\n\n /**\n * Creates a function that invokes `func` with the `this` binding of the\n * create function and an array of arguments much like\n * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply).\n *\n * **Note:** This method is based on the\n * [spread operator](https://mdn.io/spread_operator).\n *\n * @static\n * @memberOf _\n * @since 3.2.0\n * @category Function\n * @param {Function} func The function to spread arguments over.\n * @param {number} [start=0] The start position of the spread.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var say = _.spread(function(who, what) {\n * return who + ' says ' + what;\n * });\n *\n * say(['fred', 'hello']);\n * // => 'fred says hello'\n *\n * var numbers = Promise.all([\n * Promise.resolve(40),\n * Promise.resolve(36)\n * ]);\n *\n * numbers.then(_.spread(function(x, y) {\n * return x + y;\n * }));\n * // => a Promise of 76\n */\n function spread(func, start) {\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n start = start == null ? 0 : nativeMax(toInteger(start), 0);\n return baseRest(function(args) {\n var array = args[start],\n otherArgs = castSlice(args, 0, start);\n\n if (array) {\n arrayPush(otherArgs, array);\n }\n return apply(func, this, otherArgs);\n });\n }\n\n /**\n * Creates a throttled function that only invokes `func` at most once per\n * every `wait` milliseconds. The throttled function comes with a `cancel`\n * method to cancel delayed `func` invocations and a `flush` method to\n * immediately invoke them. Provide `options` to indicate whether `func`\n * should be invoked on the leading and/or trailing edge of the `wait`\n * timeout. The `func` is invoked with the last arguments provided to the\n * throttled function. Subsequent calls to the throttled function return the\n * result of the last `func` invocation.\n *\n * **Note:** If `leading` and `trailing` options are `true`, `func` is\n * invoked on the trailing edge of the timeout only if the throttled function\n * is invoked more than once during the `wait` timeout.\n *\n * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred\n * until to the next tick, similar to `setTimeout` with a timeout of `0`.\n *\n * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)\n * for details over the differences between `_.throttle` and `_.debounce`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {Function} func The function to throttle.\n * @param {number} [wait=0] The number of milliseconds to throttle invocations to.\n * @param {Object} [options={}] The options object.\n * @param {boolean} [options.leading=true]\n * Specify invoking on the leading edge of the timeout.\n * @param {boolean} [options.trailing=true]\n * Specify invoking on the trailing edge of the timeout.\n * @returns {Function} Returns the new throttled function.\n * @example\n *\n * // Avoid excessively updating the position while scrolling.\n * jQuery(window).on('scroll', _.throttle(updatePosition, 100));\n *\n * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes.\n * var throttled = _.throttle(renewToken, 300000, { 'trailing': false });\n * jQuery(element).on('click', throttled);\n *\n * // Cancel the trailing throttled invocation.\n * jQuery(window).on('popstate', throttled.cancel);\n */\n function throttle(func, wait, options) {\n var leading = true,\n trailing = true;\n\n if (typeof func != 'function') {\n throw new TypeError(FUNC_ERROR_TEXT);\n }\n if (isObject(options)) {\n leading = 'leading' in options ? !!options.leading : leading;\n trailing = 'trailing' in options ? !!options.trailing : trailing;\n }\n return debounce(func, wait, {\n 'leading': leading,\n 'maxWait': wait,\n 'trailing': trailing\n });\n }\n\n /**\n * Creates a function that accepts up to one argument, ignoring any\n * additional arguments.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Function\n * @param {Function} func The function to cap arguments for.\n * @returns {Function} Returns the new capped function.\n * @example\n *\n * _.map(['6', '8', '10'], _.unary(parseInt));\n * // => [6, 8, 10]\n */\n function unary(func) {\n return ary(func, 1);\n }\n\n /**\n * Creates a function that provides `value` to `wrapper` as its first\n * argument. Any additional arguments provided to the function are appended\n * to those provided to the `wrapper`. The wrapper is invoked with the `this`\n * binding of the created function.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Function\n * @param {*} value The value to wrap.\n * @param {Function} [wrapper=identity] The wrapper function.\n * @returns {Function} Returns the new function.\n * @example\n *\n * var p = _.wrap(_.escape, function(func, text) {\n * return '

    ' + func(text) + '

    ';\n * });\n *\n * p('fred, barney, & pebbles');\n * // => '

    fred, barney, & pebbles

    '\n */\n function wrap(value, wrapper) {\n return partial(castFunction(wrapper), value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Casts `value` as an array if it's not one.\n *\n * @static\n * @memberOf _\n * @since 4.4.0\n * @category Lang\n * @param {*} value The value to inspect.\n * @returns {Array} Returns the cast array.\n * @example\n *\n * _.castArray(1);\n * // => [1]\n *\n * _.castArray({ 'a': 1 });\n * // => [{ 'a': 1 }]\n *\n * _.castArray('abc');\n * // => ['abc']\n *\n * _.castArray(null);\n * // => [null]\n *\n * _.castArray(undefined);\n * // => [undefined]\n *\n * _.castArray();\n * // => []\n *\n * var array = [1, 2, 3];\n * console.log(_.castArray(array) === array);\n * // => true\n */\n function castArray() {\n if (!arguments.length) {\n return [];\n }\n var value = arguments[0];\n return isArray(value) ? value : [value];\n }\n\n /**\n * Creates a shallow clone of `value`.\n *\n * **Note:** This method is loosely based on the\n * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm)\n * and supports cloning arrays, array buffers, booleans, date objects, maps,\n * numbers, `Object` objects, regexes, sets, strings, symbols, and typed\n * arrays. The own enumerable properties of `arguments` objects are cloned\n * as plain objects. An empty object is returned for uncloneable values such\n * as error objects, functions, DOM nodes, and WeakMaps.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to clone.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeep\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var shallow = _.clone(objects);\n * console.log(shallow[0] === objects[0]);\n * // => true\n */\n function clone(value) {\n return baseClone(value, CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.clone` except that it accepts `customizer` which\n * is invoked to produce the cloned value. If `customizer` returns `undefined`,\n * cloning is handled by the method instead. The `customizer` is invoked with\n * up to four arguments; (value [, index|key, object, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the cloned value.\n * @see _.cloneDeepWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(false);\n * }\n * }\n *\n * var el = _.cloneWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 0\n */\n function cloneWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * This method is like `_.clone` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @returns {*} Returns the deep cloned value.\n * @see _.clone\n * @example\n *\n * var objects = [{ 'a': 1 }, { 'b': 2 }];\n *\n * var deep = _.cloneDeep(objects);\n * console.log(deep[0] === objects[0]);\n * // => false\n */\n function cloneDeep(value) {\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);\n }\n\n /**\n * This method is like `_.cloneWith` except that it recursively clones `value`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to recursively clone.\n * @param {Function} [customizer] The function to customize cloning.\n * @returns {*} Returns the deep cloned value.\n * @see _.cloneWith\n * @example\n *\n * function customizer(value) {\n * if (_.isElement(value)) {\n * return value.cloneNode(true);\n * }\n * }\n *\n * var el = _.cloneDeepWith(document.body, customizer);\n *\n * console.log(el === document.body);\n * // => false\n * console.log(el.nodeName);\n * // => 'BODY'\n * console.log(el.childNodes.length);\n * // => 20\n */\n function cloneDeepWith(value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer);\n }\n\n /**\n * Checks if `object` conforms to `source` by invoking the predicate\n * properties of `source` with the corresponding property values of `object`.\n *\n * **Note:** This method is equivalent to `_.conforms` when `source` is\n * partially applied.\n *\n * @static\n * @memberOf _\n * @since 4.14.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property predicates to conform to.\n * @returns {boolean} Returns `true` if `object` conforms, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 1; } });\n * // => true\n *\n * _.conformsTo(object, { 'b': function(n) { return n > 2; } });\n * // => false\n */\n function conformsTo(object, source) {\n return source == null || baseConformsTo(object, source, keys(source));\n }\n\n /**\n * Performs a\n * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)\n * comparison between two values to determine if they are equivalent.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.eq(object, object);\n * // => true\n *\n * _.eq(object, other);\n * // => false\n *\n * _.eq('a', 'a');\n * // => true\n *\n * _.eq('a', Object('a'));\n * // => false\n *\n * _.eq(NaN, NaN);\n * // => true\n */\n function eq(value, other) {\n return value === other || (value !== value && other !== other);\n }\n\n /**\n * Checks if `value` is greater than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than `other`,\n * else `false`.\n * @see _.lt\n * @example\n *\n * _.gt(3, 1);\n * // => true\n *\n * _.gt(3, 3);\n * // => false\n *\n * _.gt(1, 3);\n * // => false\n */\n var gt = createRelationalOperation(baseGt);\n\n /**\n * Checks if `value` is greater than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is greater than or equal to\n * `other`, else `false`.\n * @see _.lte\n * @example\n *\n * _.gte(3, 1);\n * // => true\n *\n * _.gte(3, 3);\n * // => true\n *\n * _.gte(1, 3);\n * // => false\n */\n var gte = createRelationalOperation(function(value, other) {\n return value >= other;\n });\n\n /**\n * Checks if `value` is likely an `arguments` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an `arguments` object,\n * else `false`.\n * @example\n *\n * _.isArguments(function() { return arguments; }());\n * // => true\n *\n * _.isArguments([1, 2, 3]);\n * // => false\n */\n var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) {\n return isObjectLike(value) && hasOwnProperty.call(value, 'callee') &&\n !propertyIsEnumerable.call(value, 'callee');\n };\n\n /**\n * Checks if `value` is classified as an `Array` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array, else `false`.\n * @example\n *\n * _.isArray([1, 2, 3]);\n * // => true\n *\n * _.isArray(document.body.children);\n * // => false\n *\n * _.isArray('abc');\n * // => false\n *\n * _.isArray(_.noop);\n * // => false\n */\n var isArray = Array.isArray;\n\n /**\n * Checks if `value` is classified as an `ArrayBuffer` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`.\n * @example\n *\n * _.isArrayBuffer(new ArrayBuffer(2));\n * // => true\n *\n * _.isArrayBuffer(new Array(2));\n * // => false\n */\n var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer;\n\n /**\n * Checks if `value` is array-like. A value is considered array-like if it's\n * not a function and has a `value.length` that's an integer greater than or\n * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is array-like, else `false`.\n * @example\n *\n * _.isArrayLike([1, 2, 3]);\n * // => true\n *\n * _.isArrayLike(document.body.children);\n * // => true\n *\n * _.isArrayLike('abc');\n * // => true\n *\n * _.isArrayLike(_.noop);\n * // => false\n */\n function isArrayLike(value) {\n return value != null && isLength(value.length) && !isFunction(value);\n }\n\n /**\n * This method is like `_.isArrayLike` except that it also checks if `value`\n * is an object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an array-like object,\n * else `false`.\n * @example\n *\n * _.isArrayLikeObject([1, 2, 3]);\n * // => true\n *\n * _.isArrayLikeObject(document.body.children);\n * // => true\n *\n * _.isArrayLikeObject('abc');\n * // => false\n *\n * _.isArrayLikeObject(_.noop);\n * // => false\n */\n function isArrayLikeObject(value) {\n return isObjectLike(value) && isArrayLike(value);\n }\n\n /**\n * Checks if `value` is classified as a boolean primitive or object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a boolean, else `false`.\n * @example\n *\n * _.isBoolean(false);\n * // => true\n *\n * _.isBoolean(null);\n * // => false\n */\n function isBoolean(value) {\n return value === true || value === false ||\n (isObjectLike(value) && baseGetTag(value) == boolTag);\n }\n\n /**\n * Checks if `value` is a buffer.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.\n * @example\n *\n * _.isBuffer(new Buffer(2));\n * // => true\n *\n * _.isBuffer(new Uint8Array(2));\n * // => false\n */\n var isBuffer = nativeIsBuffer || stubFalse;\n\n /**\n * Checks if `value` is classified as a `Date` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a date object, else `false`.\n * @example\n *\n * _.isDate(new Date);\n * // => true\n *\n * _.isDate('Mon April 23 2012');\n * // => false\n */\n var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate;\n\n /**\n * Checks if `value` is likely a DOM element.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`.\n * @example\n *\n * _.isElement(document.body);\n * // => true\n *\n * _.isElement('');\n * // => false\n */\n function isElement(value) {\n return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value);\n }\n\n /**\n * Checks if `value` is an empty object, collection, map, or set.\n *\n * Objects are considered empty if they have no own enumerable string keyed\n * properties.\n *\n * Array-like values such as `arguments` objects, arrays, buffers, strings, or\n * jQuery-like collections are considered empty if they have a `length` of `0`.\n * Similarly, maps and sets are considered empty if they have a `size` of `0`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is empty, else `false`.\n * @example\n *\n * _.isEmpty(null);\n * // => true\n *\n * _.isEmpty(true);\n * // => true\n *\n * _.isEmpty(1);\n * // => true\n *\n * _.isEmpty([1, 2, 3]);\n * // => false\n *\n * _.isEmpty({ 'a': 1 });\n * // => false\n */\n function isEmpty(value) {\n if (value == null) {\n return true;\n }\n if (isArrayLike(value) &&\n (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' ||\n isBuffer(value) || isTypedArray(value) || isArguments(value))) {\n return !value.length;\n }\n var tag = getTag(value);\n if (tag == mapTag || tag == setTag) {\n return !value.size;\n }\n if (isPrototype(value)) {\n return !baseKeys(value).length;\n }\n for (var key in value) {\n if (hasOwnProperty.call(value, key)) {\n return false;\n }\n }\n return true;\n }\n\n /**\n * Performs a deep comparison between two values to determine if they are\n * equivalent.\n *\n * **Note:** This method supports comparing arrays, array buffers, booleans,\n * date objects, error objects, maps, numbers, `Object` objects, regexes,\n * sets, strings, symbols, and typed arrays. `Object` objects are compared\n * by their own, not inherited, enumerable properties. Functions and DOM\n * nodes are compared by strict equality, i.e. `===`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * var object = { 'a': 1 };\n * var other = { 'a': 1 };\n *\n * _.isEqual(object, other);\n * // => true\n *\n * object === other;\n * // => false\n */\n function isEqual(value, other) {\n return baseIsEqual(value, other);\n }\n\n /**\n * This method is like `_.isEqual` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with up to\n * six arguments: (objValue, othValue [, index|key, object, other, stack]).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if the values are equivalent, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, othValue) {\n * if (isGreeting(objValue) && isGreeting(othValue)) {\n * return true;\n * }\n * }\n *\n * var array = ['hello', 'goodbye'];\n * var other = ['hi', 'goodbye'];\n *\n * _.isEqualWith(array, other, customizer);\n * // => true\n */\n function isEqualWith(value, other, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n var result = customizer ? customizer(value, other) : undefined;\n return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;\n }\n\n /**\n * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`,\n * `SyntaxError`, `TypeError`, or `URIError` object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an error object, else `false`.\n * @example\n *\n * _.isError(new Error);\n * // => true\n *\n * _.isError(Error);\n * // => false\n */\n function isError(value) {\n if (!isObjectLike(value)) {\n return false;\n }\n var tag = baseGetTag(value);\n return tag == errorTag || tag == domExcTag ||\n (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value));\n }\n\n /**\n * Checks if `value` is a finite primitive number.\n *\n * **Note:** This method is based on\n * [`Number.isFinite`](https://mdn.io/Number/isFinite).\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a finite number, else `false`.\n * @example\n *\n * _.isFinite(3);\n * // => true\n *\n * _.isFinite(Number.MIN_VALUE);\n * // => true\n *\n * _.isFinite(Infinity);\n * // => false\n *\n * _.isFinite('3');\n * // => false\n */\n function isFinite(value) {\n return typeof value == 'number' && nativeIsFinite(value);\n }\n\n /**\n * Checks if `value` is classified as a `Function` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a function, else `false`.\n * @example\n *\n * _.isFunction(_);\n * // => true\n *\n * _.isFunction(/abc/);\n * // => false\n */\n function isFunction(value) {\n if (!isObject(value)) {\n return false;\n }\n // The use of `Object#toString` avoids issues with the `typeof` operator\n // in Safari 9 which returns 'object' for typed arrays and other constructors.\n var tag = baseGetTag(value);\n return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;\n }\n\n /**\n * Checks if `value` is an integer.\n *\n * **Note:** This method is based on\n * [`Number.isInteger`](https://mdn.io/Number/isInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an integer, else `false`.\n * @example\n *\n * _.isInteger(3);\n * // => true\n *\n * _.isInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isInteger(Infinity);\n * // => false\n *\n * _.isInteger('3');\n * // => false\n */\n function isInteger(value) {\n return typeof value == 'number' && value == toInteger(value);\n }\n\n /**\n * Checks if `value` is a valid array-like length.\n *\n * **Note:** This method is loosely based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.\n * @example\n *\n * _.isLength(3);\n * // => true\n *\n * _.isLength(Number.MIN_VALUE);\n * // => false\n *\n * _.isLength(Infinity);\n * // => false\n *\n * _.isLength('3');\n * // => false\n */\n function isLength(value) {\n return typeof value == 'number' &&\n value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is the\n * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)\n * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is an object, else `false`.\n * @example\n *\n * _.isObject({});\n * // => true\n *\n * _.isObject([1, 2, 3]);\n * // => true\n *\n * _.isObject(_.noop);\n * // => true\n *\n * _.isObject(null);\n * // => false\n */\n function isObject(value) {\n var type = typeof value;\n return value != null && (type == 'object' || type == 'function');\n }\n\n /**\n * Checks if `value` is object-like. A value is object-like if it's not `null`\n * and has a `typeof` result of \"object\".\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is object-like, else `false`.\n * @example\n *\n * _.isObjectLike({});\n * // => true\n *\n * _.isObjectLike([1, 2, 3]);\n * // => true\n *\n * _.isObjectLike(_.noop);\n * // => false\n *\n * _.isObjectLike(null);\n * // => false\n */\n function isObjectLike(value) {\n return value != null && typeof value == 'object';\n }\n\n /**\n * Checks if `value` is classified as a `Map` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a map, else `false`.\n * @example\n *\n * _.isMap(new Map);\n * // => true\n *\n * _.isMap(new WeakMap);\n * // => false\n */\n var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;\n\n /**\n * Performs a partial deep comparison between `object` and `source` to\n * determine if `object` contains equivalent property values.\n *\n * **Note:** This method is equivalent to `_.matches` when `source` is\n * partially applied.\n *\n * Partial comparisons will match empty array and empty object `source`\n * values against any array or object value, respectively. See `_.isEqual`\n * for a list of supported value comparisons.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * var object = { 'a': 1, 'b': 2 };\n *\n * _.isMatch(object, { 'b': 2 });\n * // => true\n *\n * _.isMatch(object, { 'b': 1 });\n * // => false\n */\n function isMatch(object, source) {\n return object === source || baseIsMatch(object, source, getMatchData(source));\n }\n\n /**\n * This method is like `_.isMatch` except that it accepts `customizer` which\n * is invoked to compare values. If `customizer` returns `undefined`, comparisons\n * are handled by the method instead. The `customizer` is invoked with five\n * arguments: (objValue, srcValue, index|key, object, source).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {Object} object The object to inspect.\n * @param {Object} source The object of property values to match.\n * @param {Function} [customizer] The function to customize comparisons.\n * @returns {boolean} Returns `true` if `object` is a match, else `false`.\n * @example\n *\n * function isGreeting(value) {\n * return /^h(?:i|ello)$/.test(value);\n * }\n *\n * function customizer(objValue, srcValue) {\n * if (isGreeting(objValue) && isGreeting(srcValue)) {\n * return true;\n * }\n * }\n *\n * var object = { 'greeting': 'hello' };\n * var source = { 'greeting': 'hi' };\n *\n * _.isMatchWith(object, source, customizer);\n * // => true\n */\n function isMatchWith(object, source, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return baseIsMatch(object, source, getMatchData(source), customizer);\n }\n\n /**\n * Checks if `value` is `NaN`.\n *\n * **Note:** This method is based on\n * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as\n * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for\n * `undefined` and other non-number values.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`.\n * @example\n *\n * _.isNaN(NaN);\n * // => true\n *\n * _.isNaN(new Number(NaN));\n * // => true\n *\n * isNaN(undefined);\n * // => true\n *\n * _.isNaN(undefined);\n * // => false\n */\n function isNaN(value) {\n // An `NaN` primitive is the only value that is not equal to itself.\n // Perform the `toStringTag` check first to avoid errors with some\n // ActiveX objects in IE.\n return isNumber(value) && value != +value;\n }\n\n /**\n * Checks if `value` is a pristine native function.\n *\n * **Note:** This method can't reliably detect native functions in the presence\n * of the core-js package because core-js circumvents this kind of detection.\n * Despite multiple requests, the core-js maintainer has made it clear: any\n * attempt to fix the detection will be obstructed. As a result, we're left\n * with little choice but to throw an error. Unfortunately, this also affects\n * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill),\n * which rely on core-js.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a native function,\n * else `false`.\n * @example\n *\n * _.isNative(Array.prototype.push);\n * // => true\n *\n * _.isNative(_);\n * // => false\n */\n function isNative(value) {\n if (isMaskable(value)) {\n throw new Error(CORE_ERROR_TEXT);\n }\n return baseIsNative(value);\n }\n\n /**\n * Checks if `value` is `null`.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `null`, else `false`.\n * @example\n *\n * _.isNull(null);\n * // => true\n *\n * _.isNull(void 0);\n * // => false\n */\n function isNull(value) {\n return value === null;\n }\n\n /**\n * Checks if `value` is `null` or `undefined`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is nullish, else `false`.\n * @example\n *\n * _.isNil(null);\n * // => true\n *\n * _.isNil(void 0);\n * // => true\n *\n * _.isNil(NaN);\n * // => false\n */\n function isNil(value) {\n return value == null;\n }\n\n /**\n * Checks if `value` is classified as a `Number` primitive or object.\n *\n * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are\n * classified as numbers, use the `_.isFinite` method.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a number, else `false`.\n * @example\n *\n * _.isNumber(3);\n * // => true\n *\n * _.isNumber(Number.MIN_VALUE);\n * // => true\n *\n * _.isNumber(Infinity);\n * // => true\n *\n * _.isNumber('3');\n * // => false\n */\n function isNumber(value) {\n return typeof value == 'number' ||\n (isObjectLike(value) && baseGetTag(value) == numberTag);\n }\n\n /**\n * Checks if `value` is a plain object, that is, an object created by the\n * `Object` constructor or one with a `[[Prototype]]` of `null`.\n *\n * @static\n * @memberOf _\n * @since 0.8.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a plain object, else `false`.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * _.isPlainObject(new Foo);\n * // => false\n *\n * _.isPlainObject([1, 2, 3]);\n * // => false\n *\n * _.isPlainObject({ 'x': 0, 'y': 0 });\n * // => true\n *\n * _.isPlainObject(Object.create(null));\n * // => true\n */\n function isPlainObject(value) {\n if (!isObjectLike(value) || baseGetTag(value) != objectTag) {\n return false;\n }\n var proto = getPrototype(value);\n if (proto === null) {\n return true;\n }\n var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor;\n return typeof Ctor == 'function' && Ctor instanceof Ctor &&\n funcToString.call(Ctor) == objectCtorString;\n }\n\n /**\n * Checks if `value` is classified as a `RegExp` object.\n *\n * @static\n * @memberOf _\n * @since 0.1.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a regexp, else `false`.\n * @example\n *\n * _.isRegExp(/abc/);\n * // => true\n *\n * _.isRegExp('/abc/');\n * // => false\n */\n var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp;\n\n /**\n * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754\n * double precision number which isn't the result of a rounded unsafe integer.\n *\n * **Note:** This method is based on\n * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`.\n * @example\n *\n * _.isSafeInteger(3);\n * // => true\n *\n * _.isSafeInteger(Number.MIN_VALUE);\n * // => false\n *\n * _.isSafeInteger(Infinity);\n * // => false\n *\n * _.isSafeInteger('3');\n * // => false\n */\n function isSafeInteger(value) {\n return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER;\n }\n\n /**\n * Checks if `value` is classified as a `Set` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a set, else `false`.\n * @example\n *\n * _.isSet(new Set);\n * // => true\n *\n * _.isSet(new WeakSet);\n * // => false\n */\n var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;\n\n /**\n * Checks if `value` is classified as a `String` primitive or object.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a string, else `false`.\n * @example\n *\n * _.isString('abc');\n * // => true\n *\n * _.isString(1);\n * // => false\n */\n function isString(value) {\n return typeof value == 'string' ||\n (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag);\n }\n\n /**\n * Checks if `value` is classified as a `Symbol` primitive or object.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.\n * @example\n *\n * _.isSymbol(Symbol.iterator);\n * // => true\n *\n * _.isSymbol('abc');\n * // => false\n */\n function isSymbol(value) {\n return typeof value == 'symbol' ||\n (isObjectLike(value) && baseGetTag(value) == symbolTag);\n }\n\n /**\n * Checks if `value` is classified as a typed array.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.\n * @example\n *\n * _.isTypedArray(new Uint8Array);\n * // => true\n *\n * _.isTypedArray([]);\n * // => false\n */\n var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;\n\n /**\n * Checks if `value` is `undefined`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`.\n * @example\n *\n * _.isUndefined(void 0);\n * // => true\n *\n * _.isUndefined(null);\n * // => false\n */\n function isUndefined(value) {\n return value === undefined;\n }\n\n /**\n * Checks if `value` is classified as a `WeakMap` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak map, else `false`.\n * @example\n *\n * _.isWeakMap(new WeakMap);\n * // => true\n *\n * _.isWeakMap(new Map);\n * // => false\n */\n function isWeakMap(value) {\n return isObjectLike(value) && getTag(value) == weakMapTag;\n }\n\n /**\n * Checks if `value` is classified as a `WeakSet` object.\n *\n * @static\n * @memberOf _\n * @since 4.3.0\n * @category Lang\n * @param {*} value The value to check.\n * @returns {boolean} Returns `true` if `value` is a weak set, else `false`.\n * @example\n *\n * _.isWeakSet(new WeakSet);\n * // => true\n *\n * _.isWeakSet(new Set);\n * // => false\n */\n function isWeakSet(value) {\n return isObjectLike(value) && baseGetTag(value) == weakSetTag;\n }\n\n /**\n * Checks if `value` is less than `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than `other`,\n * else `false`.\n * @see _.gt\n * @example\n *\n * _.lt(1, 3);\n * // => true\n *\n * _.lt(3, 3);\n * // => false\n *\n * _.lt(3, 1);\n * // => false\n */\n var lt = createRelationalOperation(baseLt);\n\n /**\n * Checks if `value` is less than or equal to `other`.\n *\n * @static\n * @memberOf _\n * @since 3.9.0\n * @category Lang\n * @param {*} value The value to compare.\n * @param {*} other The other value to compare.\n * @returns {boolean} Returns `true` if `value` is less than or equal to\n * `other`, else `false`.\n * @see _.gte\n * @example\n *\n * _.lte(1, 3);\n * // => true\n *\n * _.lte(3, 3);\n * // => true\n *\n * _.lte(3, 1);\n * // => false\n */\n var lte = createRelationalOperation(function(value, other) {\n return value <= other;\n });\n\n /**\n * Converts `value` to an array.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Array} Returns the converted array.\n * @example\n *\n * _.toArray({ 'a': 1, 'b': 2 });\n * // => [1, 2]\n *\n * _.toArray('abc');\n * // => ['a', 'b', 'c']\n *\n * _.toArray(1);\n * // => []\n *\n * _.toArray(null);\n * // => []\n */\n function toArray(value) {\n if (!value) {\n return [];\n }\n if (isArrayLike(value)) {\n return isString(value) ? stringToArray(value) : copyArray(value);\n }\n if (symIterator && value[symIterator]) {\n return iteratorToArray(value[symIterator]());\n }\n var tag = getTag(value),\n func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values);\n\n return func(value);\n }\n\n /**\n * Converts `value` to a finite number.\n *\n * @static\n * @memberOf _\n * @since 4.12.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted number.\n * @example\n *\n * _.toFinite(3.2);\n * // => 3.2\n *\n * _.toFinite(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toFinite(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toFinite('3.2');\n * // => 3.2\n */\n function toFinite(value) {\n if (!value) {\n return value === 0 ? value : 0;\n }\n value = toNumber(value);\n if (value === INFINITY || value === -INFINITY) {\n var sign = (value < 0 ? -1 : 1);\n return sign * MAX_INTEGER;\n }\n return value === value ? value : 0;\n }\n\n /**\n * Converts `value` to an integer.\n *\n * **Note:** This method is loosely based on\n * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toInteger(3.2);\n * // => 3\n *\n * _.toInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toInteger(Infinity);\n * // => 1.7976931348623157e+308\n *\n * _.toInteger('3.2');\n * // => 3\n */\n function toInteger(value) {\n var result = toFinite(value),\n remainder = result % 1;\n\n return result === result ? (remainder ? result - remainder : result) : 0;\n }\n\n /**\n * Converts `value` to an integer suitable for use as the length of an\n * array-like object.\n *\n * **Note:** This method is based on\n * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toLength(3.2);\n * // => 3\n *\n * _.toLength(Number.MIN_VALUE);\n * // => 0\n *\n * _.toLength(Infinity);\n * // => 4294967295\n *\n * _.toLength('3.2');\n * // => 3\n */\n function toLength(value) {\n return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0;\n }\n\n /**\n * Converts `value` to a number.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to process.\n * @returns {number} Returns the number.\n * @example\n *\n * _.toNumber(3.2);\n * // => 3.2\n *\n * _.toNumber(Number.MIN_VALUE);\n * // => 5e-324\n *\n * _.toNumber(Infinity);\n * // => Infinity\n *\n * _.toNumber('3.2');\n * // => 3.2\n */\n function toNumber(value) {\n if (typeof value == 'number') {\n return value;\n }\n if (isSymbol(value)) {\n return NAN;\n }\n if (isObject(value)) {\n var other = typeof value.valueOf == 'function' ? value.valueOf() : value;\n value = isObject(other) ? (other + '') : other;\n }\n if (typeof value != 'string') {\n return value === 0 ? value : +value;\n }\n value = value.replace(reTrim, '');\n var isBinary = reIsBinary.test(value);\n return (isBinary || reIsOctal.test(value))\n ? freeParseInt(value.slice(2), isBinary ? 2 : 8)\n : (reIsBadHex.test(value) ? NAN : +value);\n }\n\n /**\n * Converts `value` to a plain object flattening inherited enumerable string\n * keyed properties of `value` to own properties of the plain object.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {Object} Returns the converted plain object.\n * @example\n *\n * function Foo() {\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.assign({ 'a': 1 }, new Foo);\n * // => { 'a': 1, 'b': 2 }\n *\n * _.assign({ 'a': 1 }, _.toPlainObject(new Foo));\n * // => { 'a': 1, 'b': 2, 'c': 3 }\n */\n function toPlainObject(value) {\n return copyObject(value, keysIn(value));\n }\n\n /**\n * Converts `value` to a safe integer. A safe integer can be compared and\n * represented correctly.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.toSafeInteger(3.2);\n * // => 3\n *\n * _.toSafeInteger(Number.MIN_VALUE);\n * // => 0\n *\n * _.toSafeInteger(Infinity);\n * // => 9007199254740991\n *\n * _.toSafeInteger('3.2');\n * // => 3\n */\n function toSafeInteger(value) {\n return value\n ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER)\n : (value === 0 ? value : 0);\n }\n\n /**\n * Converts `value` to a string. An empty string is returned for `null`\n * and `undefined` values. The sign of `-0` is preserved.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Lang\n * @param {*} value The value to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.toString(null);\n * // => ''\n *\n * _.toString(-0);\n * // => '-0'\n *\n * _.toString([1, 2, 3]);\n * // => '1,2,3'\n */\n function toString(value) {\n return value == null ? '' : baseToString(value);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Assigns own enumerable string keyed properties of source objects to the\n * destination object. Source objects are applied from left to right.\n * Subsequent sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object` and is loosely based on\n * [`Object.assign`](https://mdn.io/Object/assign).\n *\n * @static\n * @memberOf _\n * @since 0.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assignIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assign({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'c': 3 }\n */\n var assign = createAssigner(function(object, source) {\n if (isPrototype(source) || isArrayLike(source)) {\n copyObject(source, keys(source), object);\n return;\n }\n for (var key in source) {\n if (hasOwnProperty.call(source, key)) {\n assignValue(object, key, source[key]);\n }\n }\n });\n\n /**\n * This method is like `_.assign` except that it iterates over own and\n * inherited source properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extend\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.assign\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * }\n *\n * function Bar() {\n * this.c = 3;\n * }\n *\n * Foo.prototype.b = 2;\n * Bar.prototype.d = 4;\n *\n * _.assignIn({ 'a': 0 }, new Foo, new Bar);\n * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 }\n */\n var assignIn = createAssigner(function(object, source) {\n copyObject(source, keysIn(source), object);\n });\n\n /**\n * This method is like `_.assignIn` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias extendWith\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignInWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignInWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keysIn(source), object, customizer);\n });\n\n /**\n * This method is like `_.assign` except that it accepts `customizer`\n * which is invoked to produce the assigned values. If `customizer` returns\n * `undefined`, assignment is handled by the method instead. The `customizer`\n * is invoked with five arguments: (objValue, srcValue, key, object, source).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @see _.assignInWith\n * @example\n *\n * function customizer(objValue, srcValue) {\n * return _.isUndefined(objValue) ? srcValue : objValue;\n * }\n *\n * var defaults = _.partialRight(_.assignWith, customizer);\n *\n * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var assignWith = createAssigner(function(object, source, srcIndex, customizer) {\n copyObject(source, keys(source), object, customizer);\n });\n\n /**\n * Creates an array of values corresponding to `paths` of `object`.\n *\n * @static\n * @memberOf _\n * @since 1.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Array} Returns the picked values.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] };\n *\n * _.at(object, ['a[0].b.c', 'a[1]']);\n * // => [3, 4]\n */\n var at = flatRest(baseAt);\n\n /**\n * Creates an object that inherits from the `prototype` object. If a\n * `properties` object is given, its own enumerable string keyed properties\n * are assigned to the created object.\n *\n * @static\n * @memberOf _\n * @since 2.3.0\n * @category Object\n * @param {Object} prototype The object to inherit from.\n * @param {Object} [properties] The properties to assign to the object.\n * @returns {Object} Returns the new object.\n * @example\n *\n * function Shape() {\n * this.x = 0;\n * this.y = 0;\n * }\n *\n * function Circle() {\n * Shape.call(this);\n * }\n *\n * Circle.prototype = _.create(Shape.prototype, {\n * 'constructor': Circle\n * });\n *\n * var circle = new Circle;\n * circle instanceof Circle;\n * // => true\n *\n * circle instanceof Shape;\n * // => true\n */\n function create(prototype, properties) {\n var result = baseCreate(prototype);\n return properties == null ? result : baseAssign(result, properties);\n }\n\n /**\n * Assigns own and inherited enumerable string keyed properties of source\n * objects to the destination object for all destination properties that\n * resolve to `undefined`. Source objects are applied from left to right.\n * Once a property is set, additional values of the same property are ignored.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaultsDeep\n * @example\n *\n * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 });\n * // => { 'a': 1, 'b': 2 }\n */\n var defaults = baseRest(function(object, sources) {\n object = Object(object);\n\n var index = -1;\n var length = sources.length;\n var guard = length > 2 ? sources[2] : undefined;\n\n if (guard && isIterateeCall(sources[0], sources[1], guard)) {\n length = 1;\n }\n\n while (++index < length) {\n var source = sources[index];\n var props = keysIn(source);\n var propsIndex = -1;\n var propsLength = props.length;\n\n while (++propsIndex < propsLength) {\n var key = props[propsIndex];\n var value = object[key];\n\n if (value === undefined ||\n (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) {\n object[key] = source[key];\n }\n }\n }\n\n return object;\n });\n\n /**\n * This method is like `_.defaults` except that it recursively assigns\n * default properties.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.10.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @see _.defaults\n * @example\n *\n * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } });\n * // => { 'a': { 'b': 2, 'c': 3 } }\n */\n var defaultsDeep = baseRest(function(args) {\n args.push(undefined, customDefaultsMerge);\n return apply(mergeWith, undefined, args);\n });\n\n /**\n * This method is like `_.find` except that it returns the key of the first\n * element `predicate` returns truthy for instead of the element itself.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findKey(users, function(o) { return o.age < 40; });\n * // => 'barney' (iteration order is not guaranteed)\n *\n * // The `_.matches` iteratee shorthand.\n * _.findKey(users, { 'age': 1, 'active': true });\n * // => 'pebbles'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findKey(users, 'active');\n * // => 'barney'\n */\n function findKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwn);\n }\n\n /**\n * This method is like `_.findKey` except that it iterates over elements of\n * a collection in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @param {Function} [predicate=_.identity] The function invoked per iteration.\n * @returns {string|undefined} Returns the key of the matched element,\n * else `undefined`.\n * @example\n *\n * var users = {\n * 'barney': { 'age': 36, 'active': true },\n * 'fred': { 'age': 40, 'active': false },\n * 'pebbles': { 'age': 1, 'active': true }\n * };\n *\n * _.findLastKey(users, function(o) { return o.age < 40; });\n * // => returns 'pebbles' assuming `_.findKey` returns 'barney'\n *\n * // The `_.matches` iteratee shorthand.\n * _.findLastKey(users, { 'age': 36, 'active': true });\n * // => 'barney'\n *\n * // The `_.matchesProperty` iteratee shorthand.\n * _.findLastKey(users, ['active', false]);\n * // => 'fred'\n *\n * // The `_.property` iteratee shorthand.\n * _.findLastKey(users, 'active');\n * // => 'pebbles'\n */\n function findLastKey(object, predicate) {\n return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight);\n }\n\n /**\n * Iterates over own and inherited enumerable string keyed properties of an\n * object and invokes `iteratee` for each property. The iteratee is invoked\n * with three arguments: (value, key, object). Iteratee functions may exit\n * iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forInRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forIn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed).\n */\n function forIn(object, iteratee) {\n return object == null\n ? object\n : baseFor(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * This method is like `_.forIn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forIn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forInRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'.\n */\n function forInRight(object, iteratee) {\n return object == null\n ? object\n : baseForRight(object, getIteratee(iteratee, 3), keysIn);\n }\n\n /**\n * Iterates over own enumerable string keyed properties of an object and\n * invokes `iteratee` for each property. The iteratee is invoked with three\n * arguments: (value, key, object). Iteratee functions may exit iteration\n * early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 0.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwnRight\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwn(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'a' then 'b' (iteration order is not guaranteed).\n */\n function forOwn(object, iteratee) {\n return object && baseForOwn(object, getIteratee(iteratee, 3));\n }\n\n /**\n * This method is like `_.forOwn` except that it iterates over properties of\n * `object` in the opposite order.\n *\n * @static\n * @memberOf _\n * @since 2.0.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns `object`.\n * @see _.forOwn\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.forOwnRight(new Foo, function(value, key) {\n * console.log(key);\n * });\n * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'.\n */\n function forOwnRight(object, iteratee) {\n return object && baseForOwnRight(object, getIteratee(iteratee, 3));\n }\n\n /**\n * Creates an array of function property names from own enumerable properties\n * of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functionsIn\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functions(new Foo);\n * // => ['a', 'b']\n */\n function functions(object) {\n return object == null ? [] : baseFunctions(object, keys(object));\n }\n\n /**\n * Creates an array of function property names from own and inherited\n * enumerable properties of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to inspect.\n * @returns {Array} Returns the function names.\n * @see _.functions\n * @example\n *\n * function Foo() {\n * this.a = _.constant('a');\n * this.b = _.constant('b');\n * }\n *\n * Foo.prototype.c = _.constant('c');\n *\n * _.functionsIn(new Foo);\n * // => ['a', 'b', 'c']\n */\n function functionsIn(object) {\n return object == null ? [] : baseFunctions(object, keysIn(object));\n }\n\n /**\n * Gets the value at `path` of `object`. If the resolved value is\n * `undefined`, the `defaultValue` is returned in its place.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to get.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.get(object, 'a[0].b.c');\n * // => 3\n *\n * _.get(object, ['a', '0', 'b', 'c']);\n * // => 3\n *\n * _.get(object, 'a.b.c', 'default');\n * // => 'default'\n */\n function get(object, path, defaultValue) {\n var result = object == null ? undefined : baseGet(object, path);\n return result === undefined ? defaultValue : result;\n }\n\n /**\n * Checks if `path` is a direct property of `object`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = { 'a': { 'b': 2 } };\n * var other = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.has(object, 'a');\n * // => true\n *\n * _.has(object, 'a.b');\n * // => true\n *\n * _.has(object, ['a', 'b']);\n * // => true\n *\n * _.has(other, 'a');\n * // => false\n */\n function has(object, path) {\n return object != null && hasPath(object, path, baseHas);\n }\n\n /**\n * Checks if `path` is a direct or inherited property of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path to check.\n * @returns {boolean} Returns `true` if `path` exists, else `false`.\n * @example\n *\n * var object = _.create({ 'a': _.create({ 'b': 2 }) });\n *\n * _.hasIn(object, 'a');\n * // => true\n *\n * _.hasIn(object, 'a.b');\n * // => true\n *\n * _.hasIn(object, ['a', 'b']);\n * // => true\n *\n * _.hasIn(object, 'b');\n * // => false\n */\n function hasIn(object, path) {\n return object != null && hasPath(object, path, baseHasIn);\n }\n\n /**\n * Creates an object composed of the inverted keys and values of `object`.\n * If `object` contains duplicate values, subsequent values overwrite\n * property assignments of previous values.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Object\n * @param {Object} object The object to invert.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invert(object);\n * // => { '1': 'c', '2': 'b' }\n */\n var invert = createInverter(function(result, value, key) {\n if (value != null &&\n typeof value.toString != 'function') {\n value = nativeObjectToString.call(value);\n }\n\n result[value] = key;\n }, constant(identity));\n\n /**\n * This method is like `_.invert` except that the inverted object is generated\n * from the results of running each element of `object` thru `iteratee`. The\n * corresponding inverted value of each inverted key is an array of keys\n * responsible for generating the inverted value. The iteratee is invoked\n * with one argument: (value).\n *\n * @static\n * @memberOf _\n * @since 4.1.0\n * @category Object\n * @param {Object} object The object to invert.\n * @param {Function} [iteratee=_.identity] The iteratee invoked per element.\n * @returns {Object} Returns the new inverted object.\n * @example\n *\n * var object = { 'a': 1, 'b': 2, 'c': 1 };\n *\n * _.invertBy(object);\n * // => { '1': ['a', 'c'], '2': ['b'] }\n *\n * _.invertBy(object, function(value) {\n * return 'group' + value;\n * });\n * // => { 'group1': ['a', 'c'], 'group2': ['b'] }\n */\n var invertBy = createInverter(function(result, value, key) {\n if (value != null &&\n typeof value.toString != 'function') {\n value = nativeObjectToString.call(value);\n }\n\n if (hasOwnProperty.call(result, value)) {\n result[value].push(key);\n } else {\n result[value] = [key];\n }\n }, getIteratee);\n\n /**\n * Invokes the method at `path` of `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the method to invoke.\n * @param {...*} [args] The arguments to invoke the method with.\n * @returns {*} Returns the result of the invoked method.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] };\n *\n * _.invoke(object, 'a[0].b.c.slice', 1, 3);\n * // => [2, 3]\n */\n var invoke = baseRest(baseInvoke);\n\n /**\n * Creates an array of the own enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects. See the\n * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)\n * for more details.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keys(new Foo);\n * // => ['a', 'b'] (iteration order is not guaranteed)\n *\n * _.keys('hi');\n * // => ['0', '1']\n */\n function keys(object) {\n return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);\n }\n\n /**\n * Creates an array of the own and inherited enumerable property names of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property names.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.keysIn(new Foo);\n * // => ['a', 'b', 'c'] (iteration order is not guaranteed)\n */\n function keysIn(object) {\n return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);\n }\n\n /**\n * The opposite of `_.mapValues`; this method creates an object with the\n * same values as `object` and keys generated by running each own enumerable\n * string keyed property of `object` thru `iteratee`. The iteratee is invoked\n * with three arguments: (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 3.8.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapValues\n * @example\n *\n * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) {\n * return key + value;\n * });\n * // => { 'a1': 1, 'b2': 2 }\n */\n function mapKeys(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, iteratee(value, key, object), value);\n });\n return result;\n }\n\n /**\n * Creates an object with the same keys as `object` and values generated\n * by running each own enumerable string keyed property of `object` thru\n * `iteratee`. The iteratee is invoked with three arguments:\n * (value, key, object).\n *\n * @static\n * @memberOf _\n * @since 2.4.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @returns {Object} Returns the new mapped object.\n * @see _.mapKeys\n * @example\n *\n * var users = {\n * 'fred': { 'user': 'fred', 'age': 40 },\n * 'pebbles': { 'user': 'pebbles', 'age': 1 }\n * };\n *\n * _.mapValues(users, function(o) { return o.age; });\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n *\n * // The `_.property` iteratee shorthand.\n * _.mapValues(users, 'age');\n * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed)\n */\n function mapValues(object, iteratee) {\n var result = {};\n iteratee = getIteratee(iteratee, 3);\n\n baseForOwn(object, function(value, key, object) {\n baseAssignValue(result, key, iteratee(value, key, object));\n });\n return result;\n }\n\n /**\n * This method is like `_.assign` except that it recursively merges own and\n * inherited enumerable string keyed properties of source objects into the\n * destination object. Source properties that resolve to `undefined` are\n * skipped if a destination value exists. Array and plain object properties\n * are merged recursively. Other objects and value types are overridden by\n * assignment. Source objects are applied from left to right. Subsequent\n * sources overwrite property assignments of previous sources.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 0.5.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} [sources] The source objects.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {\n * 'a': [{ 'b': 2 }, { 'd': 4 }]\n * };\n *\n * var other = {\n * 'a': [{ 'c': 3 }, { 'e': 5 }]\n * };\n *\n * _.merge(object, other);\n * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] }\n */\n var merge = createAssigner(function(object, source, srcIndex) {\n baseMerge(object, source, srcIndex);\n });\n\n /**\n * This method is like `_.merge` except that it accepts `customizer` which\n * is invoked to produce the merged values of the destination and source\n * properties. If `customizer` returns `undefined`, merging is handled by the\n * method instead. The `customizer` is invoked with six arguments:\n * (objValue, srcValue, key, object, source, stack).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The destination object.\n * @param {...Object} sources The source objects.\n * @param {Function} customizer The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * function customizer(objValue, srcValue) {\n * if (_.isArray(objValue)) {\n * return objValue.concat(srcValue);\n * }\n * }\n *\n * var object = { 'a': [1], 'b': [2] };\n * var other = { 'a': [3], 'b': [4] };\n *\n * _.mergeWith(object, other, customizer);\n * // => { 'a': [1, 3], 'b': [2, 4] }\n */\n var mergeWith = createAssigner(function(object, source, srcIndex, customizer) {\n baseMerge(object, source, srcIndex, customizer);\n });\n\n /**\n * The opposite of `_.pick`; this method creates an object composed of the\n * own and inherited enumerable property paths of `object` that are not omitted.\n *\n * **Note:** This method is considerably slower than `_.pick`.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to omit.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omit(object, ['a', 'c']);\n * // => { 'b': '2' }\n */\n var omit = flatRest(function(object, paths) {\n var result = {};\n if (object == null) {\n return result;\n }\n var isDeep = false;\n paths = arrayMap(paths, function(path) {\n path = castPath(path, object);\n isDeep || (isDeep = path.length > 1);\n return path;\n });\n copyObject(object, getAllKeysIn(object), result);\n if (isDeep) {\n result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone);\n }\n var length = paths.length;\n while (length--) {\n baseUnset(result, paths[length]);\n }\n return result;\n });\n\n /**\n * The opposite of `_.pickBy`; this method creates an object composed of\n * the own and inherited enumerable string keyed properties of `object` that\n * `predicate` doesn't return truthy for. The predicate is invoked with two\n * arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.omitBy(object, _.isNumber);\n * // => { 'b': '2' }\n */\n function omitBy(object, predicate) {\n return pickBy(object, negate(getIteratee(predicate)));\n }\n\n /**\n * Creates an object composed of the picked `object` properties.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The source object.\n * @param {...(string|string[])} [paths] The property paths to pick.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pick(object, ['a', 'c']);\n * // => { 'a': 1, 'c': 3 }\n */\n var pick = flatRest(function(object, paths) {\n return object == null ? {} : basePick(object, paths);\n });\n\n /**\n * Creates an object composed of the `object` properties `predicate` returns\n * truthy for. The predicate is invoked with two arguments: (value, key).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The source object.\n * @param {Function} [predicate=_.identity] The function invoked per property.\n * @returns {Object} Returns the new object.\n * @example\n *\n * var object = { 'a': 1, 'b': '2', 'c': 3 };\n *\n * _.pickBy(object, _.isNumber);\n * // => { 'a': 1, 'c': 3 }\n */\n function pickBy(object, predicate) {\n if (object == null) {\n return {};\n }\n var props = arrayMap(getAllKeysIn(object), function(prop) {\n return [prop];\n });\n predicate = getIteratee(predicate);\n return basePickBy(object, props, function(value, path) {\n return predicate(value, path[0]);\n });\n }\n\n /**\n * This method is like `_.get` except that if the resolved value is a\n * function it's invoked with the `this` binding of its parent object and\n * its result is returned.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @param {Array|string} path The path of the property to resolve.\n * @param {*} [defaultValue] The value returned for `undefined` resolved values.\n * @returns {*} Returns the resolved value.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] };\n *\n * _.result(object, 'a[0].b.c1');\n * // => 3\n *\n * _.result(object, 'a[0].b.c2');\n * // => 4\n *\n * _.result(object, 'a[0].b.c3', 'default');\n * // => 'default'\n *\n * _.result(object, 'a[0].b.c3', _.constant('default'));\n * // => 'default'\n */\n function result(object, path, defaultValue) {\n path = castPath(path, object);\n\n var index = -1,\n length = path.length;\n\n // Ensure the loop is entered when path is empty.\n if (!length) {\n length = 1;\n object = undefined;\n }\n while (++index < length) {\n var value = object == null ? undefined : object[toKey(path[index])];\n if (value === undefined) {\n index = length;\n value = defaultValue;\n }\n object = isFunction(value) ? value.call(object) : value;\n }\n return object;\n }\n\n /**\n * Sets the value at `path` of `object`. If a portion of `path` doesn't exist,\n * it's created. Arrays are created for missing index properties while objects\n * are created for all other missing properties. Use `_.setWith` to customize\n * `path` creation.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 3.7.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.set(object, 'a[0].b.c', 4);\n * console.log(object.a[0].b.c);\n * // => 4\n *\n * _.set(object, ['x', '0', 'y', 'z'], 5);\n * console.log(object.x[0].y.z);\n * // => 5\n */\n function set(object, path, value) {\n return object == null ? object : baseSet(object, path, value);\n }\n\n /**\n * This method is like `_.set` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {*} value The value to set.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.setWith(object, '[0][1]', 'a', Object);\n * // => { '0': { '1': 'a' } }\n */\n function setWith(object, path, value, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseSet(object, path, value, customizer);\n }\n\n /**\n * Creates an array of own enumerable string keyed-value pairs for `object`\n * which can be consumed by `_.fromPairs`. If `object` is a map or set, its\n * entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entries\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairs(new Foo);\n * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed)\n */\n var toPairs = createToPairs(keys);\n\n /**\n * Creates an array of own and inherited enumerable string keyed-value pairs\n * for `object` which can be consumed by `_.fromPairs`. If `object` is a map\n * or set, its entries are returned.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @alias entriesIn\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the key-value pairs.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.toPairsIn(new Foo);\n * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed)\n */\n var toPairsIn = createToPairs(keysIn);\n\n /**\n * An alternative to `_.reduce`; this method transforms `object` to a new\n * `accumulator` object which is the result of running each of its own\n * enumerable string keyed properties thru `iteratee`, with each invocation\n * potentially mutating the `accumulator` object. If `accumulator` is not\n * provided, a new object with the same `[[Prototype]]` will be used. The\n * iteratee is invoked with four arguments: (accumulator, value, key, object).\n * Iteratee functions may exit iteration early by explicitly returning `false`.\n *\n * @static\n * @memberOf _\n * @since 1.3.0\n * @category Object\n * @param {Object} object The object to iterate over.\n * @param {Function} [iteratee=_.identity] The function invoked per iteration.\n * @param {*} [accumulator] The custom accumulator value.\n * @returns {*} Returns the accumulated value.\n * @example\n *\n * _.transform([2, 3, 4], function(result, n) {\n * result.push(n *= n);\n * return n % 2 == 0;\n * }, []);\n * // => [4, 9]\n *\n * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) {\n * (result[value] || (result[value] = [])).push(key);\n * }, {});\n * // => { '1': ['a', 'c'], '2': ['b'] }\n */\n function transform(object, iteratee, accumulator) {\n var isArr = isArray(object),\n isArrLike = isArr || isBuffer(object) || isTypedArray(object);\n\n iteratee = getIteratee(iteratee, 4);\n if (accumulator == null) {\n var Ctor = object && object.constructor;\n if (isArrLike) {\n accumulator = isArr ? new Ctor : [];\n }\n else if (isObject(object)) {\n accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {};\n }\n else {\n accumulator = {};\n }\n }\n (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) {\n return iteratee(accumulator, value, index, object);\n });\n return accumulator;\n }\n\n /**\n * Removes the property at `path` of `object`.\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to unset.\n * @returns {boolean} Returns `true` if the property is deleted, else `false`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 7 } }] };\n * _.unset(object, 'a[0].b.c');\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n *\n * _.unset(object, ['a', '0', 'b', 'c']);\n * // => true\n *\n * console.log(object);\n * // => { 'a': [{ 'b': {} }] };\n */\n function unset(object, path) {\n return object == null ? true : baseUnset(object, path);\n }\n\n /**\n * This method is like `_.set` except that accepts `updater` to produce the\n * value to set. Use `_.updateWith` to customize `path` creation. The `updater`\n * is invoked with one argument: (value).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = { 'a': [{ 'b': { 'c': 3 } }] };\n *\n * _.update(object, 'a[0].b.c', function(n) { return n * n; });\n * console.log(object.a[0].b.c);\n * // => 9\n *\n * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; });\n * console.log(object.x[0].y.z);\n * // => 0\n */\n function update(object, path, updater) {\n return object == null ? object : baseUpdate(object, path, castFunction(updater));\n }\n\n /**\n * This method is like `_.update` except that it accepts `customizer` which is\n * invoked to produce the objects of `path`. If `customizer` returns `undefined`\n * path creation is handled by the method instead. The `customizer` is invoked\n * with three arguments: (nsValue, key, nsObject).\n *\n * **Note:** This method mutates `object`.\n *\n * @static\n * @memberOf _\n * @since 4.6.0\n * @category Object\n * @param {Object} object The object to modify.\n * @param {Array|string} path The path of the property to set.\n * @param {Function} updater The function to produce the updated value.\n * @param {Function} [customizer] The function to customize assigned values.\n * @returns {Object} Returns `object`.\n * @example\n *\n * var object = {};\n *\n * _.updateWith(object, '[0][1]', _.constant('a'), Object);\n * // => { '0': { '1': 'a' } }\n */\n function updateWith(object, path, updater, customizer) {\n customizer = typeof customizer == 'function' ? customizer : undefined;\n return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer);\n }\n\n /**\n * Creates an array of the own enumerable string keyed property values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.values(new Foo);\n * // => [1, 2] (iteration order is not guaranteed)\n *\n * _.values('hi');\n * // => ['h', 'i']\n */\n function values(object) {\n return object == null ? [] : baseValues(object, keys(object));\n }\n\n /**\n * Creates an array of the own and inherited enumerable string keyed property\n * values of `object`.\n *\n * **Note:** Non-object values are coerced to objects.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category Object\n * @param {Object} object The object to query.\n * @returns {Array} Returns the array of property values.\n * @example\n *\n * function Foo() {\n * this.a = 1;\n * this.b = 2;\n * }\n *\n * Foo.prototype.c = 3;\n *\n * _.valuesIn(new Foo);\n * // => [1, 2, 3] (iteration order is not guaranteed)\n */\n function valuesIn(object) {\n return object == null ? [] : baseValues(object, keysIn(object));\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Clamps `number` within the inclusive `lower` and `upper` bounds.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category Number\n * @param {number} number The number to clamp.\n * @param {number} [lower] The lower bound.\n * @param {number} upper The upper bound.\n * @returns {number} Returns the clamped number.\n * @example\n *\n * _.clamp(-10, -5, 5);\n * // => -5\n *\n * _.clamp(10, -5, 5);\n * // => 5\n */\n function clamp(number, lower, upper) {\n if (upper === undefined) {\n upper = lower;\n lower = undefined;\n }\n if (upper !== undefined) {\n upper = toNumber(upper);\n upper = upper === upper ? upper : 0;\n }\n if (lower !== undefined) {\n lower = toNumber(lower);\n lower = lower === lower ? lower : 0;\n }\n return baseClamp(toNumber(number), lower, upper);\n }\n\n /**\n * Checks if `n` is between `start` and up to, but not including, `end`. If\n * `end` is not specified, it's set to `start` with `start` then set to `0`.\n * If `start` is greater than `end` the params are swapped to support\n * negative ranges.\n *\n * @static\n * @memberOf _\n * @since 3.3.0\n * @category Number\n * @param {number} number The number to check.\n * @param {number} [start=0] The start of the range.\n * @param {number} end The end of the range.\n * @returns {boolean} Returns `true` if `number` is in the range, else `false`.\n * @see _.range, _.rangeRight\n * @example\n *\n * _.inRange(3, 2, 4);\n * // => true\n *\n * _.inRange(4, 8);\n * // => true\n *\n * _.inRange(4, 2);\n * // => false\n *\n * _.inRange(2, 2);\n * // => false\n *\n * _.inRange(1.2, 2);\n * // => true\n *\n * _.inRange(5.2, 4);\n * // => false\n *\n * _.inRange(-3, -2, -6);\n * // => true\n */\n function inRange(number, start, end) {\n start = toFinite(start);\n if (end === undefined) {\n end = start;\n start = 0;\n } else {\n end = toFinite(end);\n }\n number = toNumber(number);\n return baseInRange(number, start, end);\n }\n\n /**\n * Produces a random number between the inclusive `lower` and `upper` bounds.\n * If only one argument is provided a number between `0` and the given number\n * is returned. If `floating` is `true`, or either `lower` or `upper` are\n * floats, a floating-point number is returned instead of an integer.\n *\n * **Note:** JavaScript follows the IEEE-754 standard for resolving\n * floating-point values which can produce unexpected results.\n *\n * @static\n * @memberOf _\n * @since 0.7.0\n * @category Number\n * @param {number} [lower=0] The lower bound.\n * @param {number} [upper=1] The upper bound.\n * @param {boolean} [floating] Specify returning a floating-point number.\n * @returns {number} Returns the random number.\n * @example\n *\n * _.random(0, 5);\n * // => an integer between 0 and 5\n *\n * _.random(5);\n * // => also an integer between 0 and 5\n *\n * _.random(5, true);\n * // => a floating-point number between 0 and 5\n *\n * _.random(1.2, 5.2);\n * // => a floating-point number between 1.2 and 5.2\n */\n function random(lower, upper, floating) {\n if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) {\n upper = floating = undefined;\n }\n if (floating === undefined) {\n if (typeof upper == 'boolean') {\n floating = upper;\n upper = undefined;\n }\n else if (typeof lower == 'boolean') {\n floating = lower;\n lower = undefined;\n }\n }\n if (lower === undefined && upper === undefined) {\n lower = 0;\n upper = 1;\n }\n else {\n lower = toFinite(lower);\n if (upper === undefined) {\n upper = lower;\n lower = 0;\n } else {\n upper = toFinite(upper);\n }\n }\n if (lower > upper) {\n var temp = lower;\n lower = upper;\n upper = temp;\n }\n if (floating || lower % 1 || upper % 1) {\n var rand = nativeRandom();\n return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper);\n }\n return baseRandom(lower, upper);\n }\n\n /*------------------------------------------------------------------------*/\n\n /**\n * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the camel cased string.\n * @example\n *\n * _.camelCase('Foo Bar');\n * // => 'fooBar'\n *\n * _.camelCase('--foo-bar--');\n * // => 'fooBar'\n *\n * _.camelCase('__FOO_BAR__');\n * // => 'fooBar'\n */\n var camelCase = createCompounder(function(result, word, index) {\n word = word.toLowerCase();\n return result + (index ? capitalize(word) : word);\n });\n\n /**\n * Converts the first character of `string` to upper case and the remaining\n * to lower case.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to capitalize.\n * @returns {string} Returns the capitalized string.\n * @example\n *\n * _.capitalize('FRED');\n * // => 'Fred'\n */\n function capitalize(string) {\n return upperFirst(toString(string).toLowerCase());\n }\n\n /**\n * Deburrs `string` by converting\n * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table)\n * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A)\n * letters to basic Latin letters and removing\n * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to deburr.\n * @returns {string} Returns the deburred string.\n * @example\n *\n * _.deburr('déjà vu');\n * // => 'deja vu'\n */\n function deburr(string) {\n string = toString(string);\n return string && string.replace(reLatin, deburrLetter).replace(reComboMark, '');\n }\n\n /**\n * Checks if `string` ends with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=string.length] The position to search up to.\n * @returns {boolean} Returns `true` if `string` ends with `target`,\n * else `false`.\n * @example\n *\n * _.endsWith('abc', 'c');\n * // => true\n *\n * _.endsWith('abc', 'b');\n * // => false\n *\n * _.endsWith('abc', 'b', 2);\n * // => true\n */\n function endsWith(string, target, position) {\n string = toString(string);\n target = baseToString(target);\n\n var length = string.length;\n position = position === undefined\n ? length\n : baseClamp(toInteger(position), 0, length);\n\n var end = position;\n position -= target.length;\n return position >= 0 && string.slice(position, end) == target;\n }\n\n /**\n * Converts the characters \"&\", \"<\", \">\", '\"', and \"'\" in `string` to their\n * corresponding HTML entities.\n *\n * **Note:** No other characters are escaped. To escape additional\n * characters use a third-party library like [_he_](https://mths.be/he).\n *\n * Though the \">\" character is escaped for symmetry, characters like\n * \">\" and \"/\" don't need escaping in HTML and have no special meaning\n * unless they're part of a tag or unquoted attribute value. See\n * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands)\n * (under \"semi-related fun fact\") for more details.\n *\n * When working with HTML you should always\n * [quote attribute values](http://wonko.com/post/html-escaping) to reduce\n * XSS vectors.\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escape('fred, barney, & pebbles');\n * // => 'fred, barney, & pebbles'\n */\n function escape(string) {\n string = toString(string);\n return (string && reHasUnescapedHtml.test(string))\n ? string.replace(reUnescapedHtml, escapeHtmlChar)\n : string;\n }\n\n /**\n * Escapes the `RegExp` special characters \"^\", \"$\", \"\\\", \".\", \"*\", \"+\",\n * \"?\", \"(\", \")\", \"[\", \"]\", \"{\", \"}\", and \"|\" in `string`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to escape.\n * @returns {string} Returns the escaped string.\n * @example\n *\n * _.escapeRegExp('[lodash](https://lodash.com/)');\n * // => '\\[lodash\\]\\(https://lodash\\.com/\\)'\n */\n function escapeRegExp(string) {\n string = toString(string);\n return (string && reHasRegExpChar.test(string))\n ? string.replace(reRegExpChar, '\\\\$&')\n : string;\n }\n\n /**\n * Converts `string` to\n * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the kebab cased string.\n * @example\n *\n * _.kebabCase('Foo Bar');\n * // => 'foo-bar'\n *\n * _.kebabCase('fooBar');\n * // => 'foo-bar'\n *\n * _.kebabCase('__FOO_BAR__');\n * // => 'foo-bar'\n */\n var kebabCase = createCompounder(function(result, word, index) {\n return result + (index ? '-' : '') + word.toLowerCase();\n });\n\n /**\n * Converts `string`, as space separated words, to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the lower cased string.\n * @example\n *\n * _.lowerCase('--Foo-Bar--');\n * // => 'foo bar'\n *\n * _.lowerCase('fooBar');\n * // => 'foo bar'\n *\n * _.lowerCase('__FOO_BAR__');\n * // => 'foo bar'\n */\n var lowerCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + word.toLowerCase();\n });\n\n /**\n * Converts the first character of `string` to lower case.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the converted string.\n * @example\n *\n * _.lowerFirst('Fred');\n * // => 'fred'\n *\n * _.lowerFirst('FRED');\n * // => 'fRED'\n */\n var lowerFirst = createCaseFirst('toLowerCase');\n\n /**\n * Pads `string` on the left and right sides if it's shorter than `length`.\n * Padding characters are truncated if they can't be evenly divided by `length`.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.pad('abc', 8);\n * // => ' abc '\n *\n * _.pad('abc', 8, '_-');\n * // => '_-abc_-_'\n *\n * _.pad('abc', 3);\n * // => 'abc'\n */\n function pad(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n if (!length || strLength >= length) {\n return string;\n }\n var mid = (length - strLength) / 2;\n return (\n createPadding(nativeFloor(mid), chars) +\n string +\n createPadding(nativeCeil(mid), chars)\n );\n }\n\n /**\n * Pads `string` on the right side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padEnd('abc', 6);\n * // => 'abc '\n *\n * _.padEnd('abc', 6, '_-');\n * // => 'abc_-_'\n *\n * _.padEnd('abc', 3);\n * // => 'abc'\n */\n function padEnd(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (string + createPadding(length - strLength, chars))\n : string;\n }\n\n /**\n * Pads `string` on the left side if it's shorter than `length`. Padding\n * characters are truncated if they exceed `length`.\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to pad.\n * @param {number} [length=0] The padding length.\n * @param {string} [chars=' '] The string used as padding.\n * @returns {string} Returns the padded string.\n * @example\n *\n * _.padStart('abc', 6);\n * // => ' abc'\n *\n * _.padStart('abc', 6, '_-');\n * // => '_-_abc'\n *\n * _.padStart('abc', 3);\n * // => 'abc'\n */\n function padStart(string, length, chars) {\n string = toString(string);\n length = toInteger(length);\n\n var strLength = length ? stringSize(string) : 0;\n return (length && strLength < length)\n ? (createPadding(length - strLength, chars) + string)\n : string;\n }\n\n /**\n * Converts `string` to an integer of the specified radix. If `radix` is\n * `undefined` or `0`, a `radix` of `10` is used unless `value` is a\n * hexadecimal, in which case a `radix` of `16` is used.\n *\n * **Note:** This method aligns with the\n * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`.\n *\n * @static\n * @memberOf _\n * @since 1.1.0\n * @category String\n * @param {string} string The string to convert.\n * @param {number} [radix=10] The radix to interpret `value` by.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {number} Returns the converted integer.\n * @example\n *\n * _.parseInt('08');\n * // => 8\n *\n * _.map(['6', '08', '10'], _.parseInt);\n * // => [6, 8, 10]\n */\n function parseInt(string, radix, guard) {\n if (guard || radix == null) {\n radix = 0;\n } else if (radix) {\n radix = +radix;\n }\n return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0);\n }\n\n /**\n * Repeats the given string `n` times.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to repeat.\n * @param {number} [n=1] The number of times to repeat the string.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {string} Returns the repeated string.\n * @example\n *\n * _.repeat('*', 3);\n * // => '***'\n *\n * _.repeat('abc', 2);\n * // => 'abcabc'\n *\n * _.repeat('abc', 0);\n * // => ''\n */\n function repeat(string, n, guard) {\n if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) {\n n = 1;\n } else {\n n = toInteger(n);\n }\n return baseRepeat(toString(string), n);\n }\n\n /**\n * Replaces matches for `pattern` in `string` with `replacement`.\n *\n * **Note:** This method is based on\n * [`String#replace`](https://mdn.io/String/replace).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to modify.\n * @param {RegExp|string} pattern The pattern to replace.\n * @param {Function|string} replacement The match replacement.\n * @returns {string} Returns the modified string.\n * @example\n *\n * _.replace('Hi Fred', 'Fred', 'Barney');\n * // => 'Hi Barney'\n */\n function replace() {\n var args = arguments,\n string = toString(args[0]);\n\n return args.length < 3 ? string : string.replace(args[1], args[2]);\n }\n\n /**\n * Converts `string` to\n * [snake case](https://en.wikipedia.org/wiki/Snake_case).\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the snake cased string.\n * @example\n *\n * _.snakeCase('Foo Bar');\n * // => 'foo_bar'\n *\n * _.snakeCase('fooBar');\n * // => 'foo_bar'\n *\n * _.snakeCase('--FOO-BAR--');\n * // => 'foo_bar'\n */\n var snakeCase = createCompounder(function(result, word, index) {\n return result + (index ? '_' : '') + word.toLowerCase();\n });\n\n /**\n * Splits `string` by `separator`.\n *\n * **Note:** This method is based on\n * [`String#split`](https://mdn.io/String/split).\n *\n * @static\n * @memberOf _\n * @since 4.0.0\n * @category String\n * @param {string} [string=''] The string to split.\n * @param {RegExp|string} separator The separator pattern to split by.\n * @param {number} [limit] The length to truncate results to.\n * @returns {Array} Returns the string segments.\n * @example\n *\n * _.split('a-b-c', '-', 2);\n * // => ['a', 'b']\n */\n function split(string, separator, limit) {\n if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) {\n separator = limit = undefined;\n }\n limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0;\n if (!limit) {\n return [];\n }\n string = toString(string);\n if (string && (\n typeof separator == 'string' ||\n (separator != null && !isRegExp(separator))\n )) {\n separator = baseToString(separator);\n if (!separator && hasUnicode(string)) {\n return castSlice(stringToArray(string), 0, limit);\n }\n }\n return string.split(separator, limit);\n }\n\n /**\n * Converts `string` to\n * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage).\n *\n * @static\n * @memberOf _\n * @since 3.1.0\n * @category String\n * @param {string} [string=''] The string to convert.\n * @returns {string} Returns the start cased string.\n * @example\n *\n * _.startCase('--foo-bar--');\n * // => 'Foo Bar'\n *\n * _.startCase('fooBar');\n * // => 'Foo Bar'\n *\n * _.startCase('__FOO_BAR__');\n * // => 'FOO BAR'\n */\n var startCase = createCompounder(function(result, word, index) {\n return result + (index ? ' ' : '') + upperFirst(word);\n });\n\n /**\n * Checks if `string` starts with the given target string.\n *\n * @static\n * @memberOf _\n * @since 3.0.0\n * @category String\n * @param {string} [string=''] The string to inspect.\n * @param {string} [target] The string to search for.\n * @param {number} [position=0] The position to search from.\n * @returns {boolean} Returns `true` if `string` starts with `target`,\n * else `false`.\n * @example\n *\n * _.startsWith('abc', 'a');\n * // => true\n *\n * _.startsWith('abc', 'b');\n * // => false\n *\n * _.startsWith('abc', 'b', 1);\n * // => true\n */\n function startsWith(string, target, position) {\n string = toString(string);\n position = position == null\n ? 0\n : baseClamp(toInteger(position), 0, string.length);\n\n target = baseToString(target);\n return string.slice(position, position + target.length) == target;\n }\n\n /**\n * Creates a compiled template function that can interpolate data properties\n * in \"interpolate\" delimiters, HTML-escape interpolated data properties in\n * \"escape\" delimiters, and execute JavaScript in \"evaluate\" delimiters. Data\n * properties may be accessed as free variables in the template. If a setting\n * object is given, it takes precedence over `_.templateSettings` values.\n *\n * **Note:** In the development build `_.template` utilizes\n * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl)\n * for easier debugging.\n *\n * For more information on precompiling templates see\n * [lodash's custom builds documentation](https://lodash.com/custom-builds).\n *\n * For more information on Chrome extension sandboxes see\n * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval).\n *\n * @static\n * @since 0.1.0\n * @memberOf _\n * @category String\n * @param {string} [string=''] The template string.\n * @param {Object} [options={}] The options object.\n * @param {RegExp} [options.escape=_.templateSettings.escape]\n * The HTML \"escape\" delimiter.\n * @param {RegExp} [options.evaluate=_.templateSettings.evaluate]\n * The \"evaluate\" delimiter.\n * @param {Object} [options.imports=_.templateSettings.imports]\n * An object to import into the template as free variables.\n * @param {RegExp} [options.interpolate=_.templateSettings.interpolate]\n * The \"interpolate\" delimiter.\n * @param {string} [options.sourceURL='lodash.templateSources[n]']\n * The sourceURL of the compiled template.\n * @param {string} [options.variable='obj']\n * The data object variable name.\n * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`.\n * @returns {Function} Returns the compiled template function.\n * @example\n *\n * // Use the \"interpolate\" delimiter to create a compiled template.\n * var compiled = _.template('hello <%= user %>!');\n * compiled({ 'user': 'fred' });\n * // => 'hello fred!'\n *\n * // Use the HTML \"escape\" delimiter to escape data property values.\n * var compiled = _.template('<%- value %>');\n * compiled({ 'value': ' diff --git a/packages/server/appPackages/_master/yarn.lock b/packages/server/appPackages/_master/yarn.lock index ac5e8b1836..26d653bde8 100644 --- a/packages/server/appPackages/_master/yarn.lock +++ b/packages/server/appPackages/_master/yarn.lock @@ -2,46 +2,12 @@ # yarn lockfile v1 -"@budibase/client@file:../../../client": - version "0.0.3" - dependencies: - "@nx-js/compiler-util" "^2.0.0" - lodash "^4.17.15" - lunr "^2.3.5" - shortid "^2.2.8" - svelte "^3.9.2" +"@budibase/materialdesign-components@^0.0.19": + version "0.0.19" + resolved "https://registry.yarnpkg.com/@budibase/materialdesign-components/-/materialdesign-components-0.0.19.tgz#640330fb2deb37ca655ef77cc71a0bec34d96bcd" + integrity sha512-JasPnberm/In/OBYlRstwtKoh7khj/y8pDEK6naK26s8a9Ty7pV5ANgdvlpaXOutg75D9HAdvzGBzqf0qATp/w== -"@budibase/standard-components@file:../../../standard-components": - version "0.0.5" - -"@nx-js/compiler-util@^2.0.0": - version "2.0.0" - resolved "https://registry.yarnpkg.com/@nx-js/compiler-util/-/compiler-util-2.0.0.tgz#c74c12165fa2f017a292bb79af007e8fce0af297" - integrity sha512-AxSQbwj9zqt8DYPZ6LwZdytqnwfiOEdcFdq4l8sdjkZmU2clTht7RDLCI8xvkp7KqgcNaOGlTeCM55TULWruyQ== - -lodash@^4.17.15: - version "4.17.15" - resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.15.tgz#b447f6670a0455bbfeedd11392eff330ea097548" - integrity sha512-8xOcRHvCjnocdS5cpwXQXVzmmh5e5+saE2QGoeQmbKmRS6J3VQppPOIt0MnmE+4xlZoumy0GPG0D0MVIQbNA1A== - -lunr@^2.3.5: - version "2.3.6" - resolved "https://registry.yarnpkg.com/lunr/-/lunr-2.3.6.tgz#f278beee7ffd56ad86e6e478ce02ab2b98c78dd5" - integrity sha512-swStvEyDqQ85MGpABCMBclZcLI/pBIlu8FFDtmX197+oEgKloJ67QnB+Tidh0340HmLMs39c4GrkPY3cmkXp6Q== - -nanoid@^2.1.0: - version "2.1.1" - resolved "https://registry.yarnpkg.com/nanoid/-/nanoid-2.1.1.tgz#524fd4acd45c126e0c87cd43ab5ee8346e695df9" - integrity sha512-0YbJdaL4JFoejIOoawgLcYValFGJ2iyUuVDIWL3g8Es87SSOWFbWdRUMV3VMSiyPs3SQ3QxCIxFX00q5DLkMCw== - -shortid@^2.2.8: - version "2.2.15" - resolved "https://registry.yarnpkg.com/shortid/-/shortid-2.2.15.tgz#2b902eaa93a69b11120373cd42a1f1fe4437c122" - integrity sha512-5EaCy2mx2Jgc/Fdn9uuDuNIIfWBpzY4XIlhoqtXF6qsf+/+SGZ+FxDdX/ZsMZiWupIWNqAEmiNY4RC+LSmCeOw== - dependencies: - nanoid "^2.1.0" - -svelte@^3.9.2: - version "3.12.1" - resolved "https://registry.yarnpkg.com/svelte/-/svelte-3.12.1.tgz#ddfacd43272ac3255907c682b74ee7d3d8b06b0c" - integrity sha512-t29WJNjHIqfrdMcVXqIyRfgLEaNz7MihKXTpb8qHlbzvf0WyOOIhIlwIGvl6ahJ9+9CLJwz0sjhFNAmPgo8BHg== +"@budibase/standard-components@^0.0.19": + version "0.0.19" + resolved "https://registry.yarnpkg.com/@budibase/standard-components/-/standard-components-0.0.19.tgz#9a4c7fd74b8ef1011ecd8b8cec56b84d81a7fb57" + integrity sha512-lMsCsmYw5EBCxt3YzgBN0Ab4fwFs/Wd4kp5hE/+c9ghhbFOUBK1QW9cBEAMVkAhDF0wCiiXhVLLTEByeqtkfVA== diff --git a/packages/server/middleware/routers.js b/packages/server/middleware/routers.js index b7cd5c53a2..3d07ac29d9 100644 --- a/packages/server/middleware/routers.js +++ b/packages/server/middleware/routers.js @@ -302,30 +302,27 @@ module.exports = (config, app) => { ctx.body = await ctx.instance.authApi.getAccessLevels() ctx.response.status = StatusCodes.OK }) - .get("/:appname/api/listRecords/:indexkey", async ctx => { - ctx.body = await ctx.instance.indexApi.listItems(ctx.params.indexkey) + .get("/:appname/api/listRecords/*", async ctx => { + const indexkey = getRecordKey(ctx.params.appname, ctx.request.path) + ctx.body = await ctx.instance.indexApi.listItems(indexkey) ctx.response.status = StatusCodes.OK }) - .post("/:appname/api/listRecords/:indexkey", async ctx => { - ctx.body = await ctx.instance.indexApi.listItems( - ctx.request.body.indexKey, - { - rangeStartParams: ctx.request.body.rangeStartParams, - rangeEndParams: ctx.request.body.rangeEndParams, - searchPhrase: ctx.request.body.searchPhrase, - } - ) + .post("/:appname/api/listRecords/*", async ctx => { + const indexkey = getRecordKey(ctx.params.appname, ctx.request.path) + ctx.body = await ctx.instance.indexApi.listItems(indexkey, { + rangeStartParams: ctx.request.body.rangeStartParams, + rangeEndParams: ctx.request.body.rangeEndParams, + searchPhrase: ctx.request.body.searchPhrase, + }) ctx.response.status = StatusCodes.OK }) - .post("/:appname/api/aggregates/:indexkey", async ctx => { - ctx.body = await ctx.instance.indexApi.aggregates( - ctx.request.body.indexKey, - { - rangeStartParams: ctx.request.body.rangeStartParams, - rangeEndParams: ctx.request.body.rangeEndParams, - searchPhrase: ctx.request.body.searchPhrase, - } - ) + .post("/:appname/api/aggregates/*", async ctx => { + const indexkey = getRecordKey(ctx.params.appname, ctx.request.path) + ctx.body = await ctx.instance.indexApi.aggregates(indexkey, { + rangeStartParams: ctx.request.body.rangeStartParams, + rangeEndParams: ctx.request.body.rangeEndParams, + searchPhrase: ctx.request.body.searchPhrase, + }) ctx.response.status = StatusCodes.OK }) .post("/:appname/api/files/*", async ctx => { @@ -394,6 +391,8 @@ module.exports = (config, app) => { .replace(`/${appname}/api/files/`, "") .replace(`/${appname}/api/lookup_field/`, "") .replace(`/${appname}/api/record/`, "") + .replace(`/${appname}/api/listRecords/`, "") + .replace(`/${appname}/api/aggregates/`, "") return router } diff --git a/packages/server/package.json b/packages/server/package.json index ea37dcfa02..854f25e917 100644 --- a/packages/server/package.json +++ b/packages/server/package.json @@ -1,6 +1,6 @@ { "name": "@budibase/server", - "version": "0.0.16", + "version": "0.0.24", "description": "Budibase Web Server", "main": "index.js", "scripts": { @@ -16,8 +16,8 @@ "author": "Michael Shanks", "license": "AGPL-3.0-or-later", "dependencies": { - "@budibase/client": "^0.0.16", - "@budibase/core": "^0.0.16", + "@budibase/client": "^0.0.24", + "@budibase/core": "^0.0.24", "@koa/router": "^8.0.0", "fs-extra": "^8.1.0", "koa": "^2.7.0", diff --git a/packages/server/utilities/createAppPackage.js b/packages/server/utilities/createAppPackage.js index 05ad359346..3aaa6ce09f 100644 --- a/packages/server/utilities/createAppPackage.js +++ b/packages/server/utilities/createAppPackage.js @@ -30,7 +30,10 @@ module.exports.appsFolder = config => appPackageFolder(config, "") module.exports.masterAppPackage = context => { const { config } = context - const standardPackage = createAppPackage(context, "../appPackages/_master") + const standardPackage = createAppPackage( + context, + `${__dirname}/../appPackages/_master` + ) const customizeMaster = config && config.customizeMaster ? config.customizeMaster : a => a diff --git a/packages/standard-components/.npmignore b/packages/standard-components/.npmignore new file mode 100644 index 0000000000..81c5644598 --- /dev/null +++ b/packages/standard-components/.npmignore @@ -0,0 +1,3 @@ +* +!dist/* +!components.json \ No newline at end of file diff --git a/packages/standard-components/package.json b/packages/standard-components/package.json index ba695dc325..4d51a5ec0c 100644 --- a/packages/standard-components/package.json +++ b/packages/standard-components/package.json @@ -12,7 +12,7 @@ "publishdev": "yarn build && node ./scripts/publishDev.js" }, "devDependencies": { - "@budibase/client": "^0.0.16", + "@budibase/client": "^0.0.24", "@nx-js/compiler-util": "^2.0.0", "bcryptjs": "2.4.3", "fs-extra": "^8.1.0", @@ -32,7 +32,7 @@ "keywords": [ "svelte" ], - "version": "0.0.16", + "version": "0.0.24", "license": "MIT", "gitHead": "115189f72a850bfb52b65ec61d932531bf327072" }